commit d4484275e81c3cb7951da954e3a97f9ef7c1c1dc Author: Nicolas Bally Date: Sat Jun 25 12:08:06 2011 +0200 initial diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..fa53a9a --- /dev/null +++ b/.gitignore @@ -0,0 +1,10 @@ +.bundle +db/*.sqlite3 +db/schema.rb +log/*.log +tmp/**/* + +public/assets/stylesheets/* + +.sass-cache/** + diff --git a/Capfile b/Capfile new file mode 100644 index 0000000..d04de11 --- /dev/null +++ b/Capfile @@ -0,0 +1,4 @@ +load 'deploy' if respond_to?(:namespace) # cap2 differentiator +Dir['vendor/gems/*/recipes/*.rb','vendor/plugins/*/recipes/*.rb'].each { |plugin| load(plugin) } + +load 'config/deploy' # remove this line to skip loading any of the default tasks \ No newline at end of file diff --git a/Gemfile b/Gemfile new file mode 100644 index 0000000..a7ea35e --- /dev/null +++ b/Gemfile @@ -0,0 +1,47 @@ +source 'http://rubygems.org' + +gem 'rails', '3.0.6' + +# Bundle edge Rails instead: +# gem 'rails', :git => 'git://github.com/rails/rails.git' + +gem 'sqlite3' + +# Asset template engines + +gem 'sass' + +gem 'jquery-rails' + +# Use unicorn as the web server +# gem 'unicorn' + +# Deploy with Capistrano +gem 'capistrano' + +# To use debugger +# gem 'ruby-debug' + + + +gem "simple-navigation" + +gem "kaminari" +gem 'formtastic' + +gem "acts_as_tree" +gem "acts_as_list" + +gem 'rmagick' + +gem 'carrierwave' + +gem 'mimetype-fu' + +gem "cancan" + +gem "meta_where" +gem 'meta_search' + +gem "devise" +gem "haml", ">= 3.0.0" diff --git a/Gemfile.lock b/Gemfile.lock new file mode 100644 index 0000000..7f1a034 --- /dev/null +++ b/Gemfile.lock @@ -0,0 +1,140 @@ +GEM + remote: http://rubygems.org/ + specs: + abstract (1.0.0) + actionmailer (3.0.6) + actionpack (= 3.0.6) + mail (~> 2.2.15) + actionpack (3.0.6) + activemodel (= 3.0.6) + activesupport (= 3.0.6) + builder (~> 2.1.2) + erubis (~> 2.6.6) + i18n (~> 0.5.0) + rack (~> 1.2.1) + rack-mount (~> 0.6.14) + rack-test (~> 0.5.7) + tzinfo (~> 0.3.23) + activemodel (3.0.6) + activesupport (= 3.0.6) + builder (~> 2.1.2) + i18n (~> 0.5.0) + activerecord (3.0.6) + activemodel (= 3.0.6) + activesupport (= 3.0.6) + arel (~> 2.0.2) + tzinfo (~> 0.3.23) + activeresource (3.0.6) + activemodel (= 3.0.6) + activesupport (= 3.0.6) + activesupport (3.0.6) + acts_as_list (0.1.2) + acts_as_tree (0.1.1) + arel (2.0.9) + bcrypt-ruby (2.1.4) + builder (2.1.2) + cancan (1.6.4) + capistrano (2.6.0) + highline + net-scp (>= 1.0.0) + net-sftp (>= 2.0.0) + net-ssh (>= 2.0.14) + net-ssh-gateway (>= 1.1.0) + carrierwave (0.5.3) + activesupport (~> 3.0) + devise (1.3.4) + bcrypt-ruby (~> 2.1.2) + orm_adapter (~> 0.0.3) + warden (~> 1.0.3) + erubis (2.6.6) + abstract (>= 1.0.0) + formtastic (1.2.3) + actionpack (>= 2.3.7) + activesupport (>= 2.3.7) + i18n (~> 0.4) + haml (3.1.1) + highline (1.6.1) + i18n (0.5.0) + jquery-rails (1.0.2) + railties (~> 3.0) + thor (~> 0.14) + kaminari (0.12.4) + rails (>= 3.0.0) + mail (2.2.19) + activesupport (>= 2.3.6) + i18n (>= 0.4.0) + mime-types (~> 1.16) + treetop (~> 1.4.8) + meta_search (1.0.5) + actionpack (~> 3.0.2) + activerecord (~> 3.0.2) + activesupport (~> 3.0.2) + arel (~> 2.0.2) + meta_where (1.0.4) + activerecord (~> 3.0.0) + activesupport (~> 3.0.0) + arel (~> 2.0.7) + mime-types (1.16) + mimetype-fu (0.1.2) + net-scp (1.0.4) + net-ssh (>= 1.99.1) + net-sftp (2.0.5) + net-ssh (>= 2.0.9) + net-ssh (2.1.4) + net-ssh-gateway (1.1.0) + net-ssh (>= 1.99.1) + orm_adapter (0.0.5) + polyglot (0.3.1) + rack (1.2.2) + rack-mount (0.6.14) + rack (>= 1.0.0) + rack-test (0.5.7) + rack (>= 1.0) + rails (3.0.6) + actionmailer (= 3.0.6) + actionpack (= 3.0.6) + activerecord (= 3.0.6) + activeresource (= 3.0.6) + activesupport (= 3.0.6) + bundler (~> 1.0) + railties (= 3.0.6) + railties (3.0.6) + actionpack (= 3.0.6) + activesupport (= 3.0.6) + rake (>= 0.8.7) + thor (~> 0.14.4) + rake (0.8.7) + rmagick (2.13.1) + sass (3.1.1) + simple-navigation (3.2.0) + activesupport (>= 2.3.2) + sqlite3 (1.3.3) + thor (0.14.6) + treetop (1.4.9) + polyglot (>= 0.3.1) + tzinfo (0.3.27) + warden (1.0.4) + rack (>= 1.0) + +PLATFORMS + ruby + +DEPENDENCIES + acts_as_list + acts_as_tree + cancan + capistrano + carrierwave + devise + formtastic + haml (>= 3.0.0) + jquery-rails + kaminari + meta_search + meta_where + mimetype-fu + rails (= 3.0.6) + rmagick + sass + simple-navigation + sqlite3 diff --git a/README b/README new file mode 100644 index 0000000..9f0f1d0 --- /dev/null +++ b/README @@ -0,0 +1,256 @@ +== Welcome to Rails + +Rails is a web-application framework that includes everything needed to create +database-backed web applications according to the Model-View-Control pattern. + +This pattern splits the view (also called the presentation) into "dumb" +templates that are primarily responsible for inserting pre-built data in between +HTML tags. The model contains the "smart" domain objects (such as Account, +Product, Person, Post) that holds all the business logic and knows how to +persist themselves to a database. The controller handles the incoming requests +(such as Save New Account, Update Product, Show Post) by manipulating the model +and directing data to the view. + +In Rails, the model is handled by what's called an object-relational mapping +layer entitled Active Record. This layer allows you to present the data from +database rows as objects and embellish these data objects with business logic +methods. You can read more about Active Record in +link:files/vendor/rails/activerecord/README.html. + +The controller and view are handled by the Action Pack, which handles both +layers by its two parts: Action View and Action Controller. These two layers +are bundled in a single package due to their heavy interdependence. This is +unlike the relationship between the Active Record and Action Pack that is much +more separate. Each of these packages can be used independently outside of +Rails. You can read more about Action Pack in +link:files/vendor/rails/actionpack/README.html. + + +== Getting Started + +1. At the command prompt, create a new Rails application: + rails new myapp (where myapp is the application name) + +2. Change directory to myapp and start the web server: + cd myapp; rails server (run with --help for options) + +3. Go to http://localhost:3000/ and you'll see: + "Welcome aboard: You're riding Ruby on Rails!" + +4. Follow the guidelines to start developing your application. You can find +the following resources handy: + +* The Getting Started Guide: http://guides.rubyonrails.org/getting_started.html +* Ruby on Rails Tutorial Book: http://www.railstutorial.org/ + + +== Debugging Rails + +Sometimes your application goes wrong. Fortunately there are a lot of tools that +will help you debug it and get it back on the rails. + +First area to check is the application log files. Have "tail -f" commands +running on the server.log and development.log. Rails will automatically display +debugging and runtime information to these files. Debugging info will also be +shown in the browser on requests from 127.0.0.1. + +You can also log your own messages directly into the log file from your code +using the Ruby logger class from inside your controllers. Example: + + class WeblogController < ActionController::Base + def destroy + @weblog = Weblog.find(params[:id]) + @weblog.destroy + logger.info("#{Time.now} Destroyed Weblog ID ##{@weblog.id}!") + end + end + +The result will be a message in your log file along the lines of: + + Mon Oct 08 14:22:29 +1000 2007 Destroyed Weblog ID #1! + +More information on how to use the logger is at http://www.ruby-doc.org/core/ + +Also, Ruby documentation can be found at http://www.ruby-lang.org/. There are +several books available online as well: + +* Programming Ruby: http://www.ruby-doc.org/docs/ProgrammingRuby/ (Pickaxe) +* Learn to Program: http://pine.fm/LearnToProgram/ (a beginners guide) + +These two books will bring you up to speed on the Ruby language and also on +programming in general. + + +== Debugger + +Debugger support is available through the debugger command when you start your +Mongrel or WEBrick server with --debugger. This means that you can break out of +execution at any point in the code, investigate and change the model, and then, +resume execution! You need to install ruby-debug to run the server in debugging +mode. With gems, use sudo gem install ruby-debug. Example: + + class WeblogController < ActionController::Base + def index + @posts = Post.all + debugger + end + end + +So the controller will accept the action, run the first line, then present you +with a IRB prompt in the server window. Here you can do things like: + + >> @posts.inspect + => "[#nil, "body"=>nil, "id"=>"1"}>, + #"Rails", "body"=>"Only ten..", "id"=>"2"}>]" + >> @posts.first.title = "hello from a debugger" + => "hello from a debugger" + +...and even better, you can examine how your runtime objects actually work: + + >> f = @posts.first + => #nil, "body"=>nil, "id"=>"1"}> + >> f. + Display all 152 possibilities? (y or n) + +Finally, when you're ready to resume execution, you can enter "cont". + + +== Console + +The console is a Ruby shell, which allows you to interact with your +application's domain model. Here you'll have all parts of the application +configured, just like it is when the application is running. You can inspect +domain models, change values, and save to the database. Starting the script +without arguments will launch it in the development environment. + +To start the console, run rails console from the application +directory. + +Options: + +* Passing the -s, --sandbox argument will rollback any modifications + made to the database. +* Passing an environment name as an argument will load the corresponding + environment. Example: rails console production. + +To reload your controllers and models after launching the console run +reload! + +More information about irb can be found at: +link:http://www.rubycentral.org/pickaxe/irb.html + + +== dbconsole + +You can go to the command line of your database directly through rails +dbconsole. You would be connected to the database with the credentials +defined in database.yml. Starting the script without arguments will connect you +to the development database. Passing an argument will connect you to a different +database, like rails dbconsole production. Currently works for MySQL, +PostgreSQL and SQLite 3. + +== Description of Contents + +The default directory structure of a generated Ruby on Rails application: + + |-- app + | |-- controllers + | |-- helpers + | |-- mailers + | |-- models + | `-- views + | `-- layouts + |-- config + | |-- environments + | |-- initializers + | `-- locales + |-- db + |-- doc + |-- lib + | `-- tasks + |-- log + |-- public + | |-- images + | |-- javascripts + | `-- stylesheets + |-- script + |-- test + | |-- fixtures + | |-- functional + | |-- integration + | |-- performance + | `-- unit + |-- tmp + | |-- cache + | |-- pids + | |-- sessions + | `-- sockets + `-- vendor + `-- plugins + +app + Holds all the code that's specific to this particular application. + +app/controllers + Holds controllers that should be named like weblogs_controller.rb for + automated URL mapping. All controllers should descend from + ApplicationController which itself descends from ActionController::Base. + +app/models + Holds models that should be named like post.rb. Models descend from + ActiveRecord::Base by default. + +app/views + Holds the template files for the view that should be named like + weblogs/index.html.erb for the WeblogsController#index action. All views use + eRuby syntax by default. + +app/views/layouts + Holds the template files for layouts to be used with views. This models the + common header/footer method of wrapping views. In your views, define a layout + using the layout :default and create a file named default.html.erb. + Inside default.html.erb, call <% yield %> to render the view using this + layout. + +app/helpers + Holds view helpers that should be named like weblogs_helper.rb. These are + generated for you automatically when using generators for controllers. + Helpers can be used to wrap functionality for your views into methods. + +config + Configuration files for the Rails environment, the routing map, the database, + and other dependencies. + +db + Contains the database schema in schema.rb. db/migrate contains all the + sequence of Migrations for your schema. + +doc + This directory is where your application documentation will be stored when + generated using rake doc:app + +lib + Application specific libraries. Basically, any kind of custom code that + doesn't belong under controllers, models, or helpers. This directory is in + the load path. + +public + The directory available for the web server. Contains subdirectories for + images, stylesheets, and javascripts. Also contains the dispatchers and the + default HTML files. This should be set as the DOCUMENT_ROOT of your web + server. + +script + Helper scripts for automation and generation. + +test + Unit and functional tests along with fixtures. When using the rails generate + command, template test files will be generated for you and placed in this + directory. + +vendor + External libraries that the application depends on. Also includes the plugins + subdirectory. If the app has frozen rails, those gems also go here, under + vendor/rails/. This directory is in the load path. diff --git a/Rakefile b/Rakefile new file mode 100644 index 0000000..047df41 --- /dev/null +++ b/Rakefile @@ -0,0 +1,7 @@ +#!/usr/bin/env rake +# Add your own tasks in files placed in lib/tasks ending in .rake, +# for example lib/tasks/capistrano.rake, and they will automatically be available to Rake. + +require File.expand_path('../config/application', __FILE__) + +PharmacieboissierCom::Application.load_tasks diff --git a/app/assets/stylesheets/admin/admin.scss b/app/assets/stylesheets/admin/admin.scss new file mode 100644 index 0000000..a3ebe10 --- /dev/null +++ b/app/assets/stylesheets/admin/admin.scss @@ -0,0 +1,2595 @@ +/* + * FIXME: Introduce SCSS & Sprockets + *= require formtastic + + *= require_tree . +*= require_self +*/ + + +@import "../mixins/css3"; + + + +body { + -webkit-font-smoothing: antialiased; + width:100%; + font-size: 13px; + font-family: 'Lucida Grande', 'Lucida Sans Unicode', Helvetica, Arial, Verdana, sans-serif; + padding: 0px; + margin: 0px; + @include linear-gradient(rgb(250,250,250), RGB(247,251,253)); +} + + + +/* bar.css */ + +.bar{ + padding:10px; + +} + +.bar a{ + padding:5px; + +} + +.bar a.active{ + padding:5px; + + border-radius:10px; + -moz-border-radius:5px; + + +} + + +.bar.dark_blue{ + background:#6FB7E9; + + +} + +.bar.dark_blue a{ + color:white; + +} + +.bar.dark_blue a.active{ + color:#6FB7E9; + background:white; + +} + + +/* blocks.css */ +.portlet_place_holder{ + width:100%; + height:15px; + +} +.col{ + min-height:300px; +} + +.portlet{ + + + + position:relative; + border:1px dotted rgb(127,127,127); + background:white; + +} + + +.portlet .move{ + cursor:pointer; + +} + + + +.portlet .actions{ + + position:absolute; + top:-15px; + + + left:20px; + padding :0px 5px 0px 5px; + display:none; + border:1px solid rgb(70,70,70); + + background:rgba(250,250,250,1); + border-radius:10px; + + text-align:center; + + + + + + +} + +.portlet .actions img{ + + margin:5px; + + + + + +} + + + + + +.portlet_hover { + border:1px solid rgb(127,127,127); + +} + + + +.portlet_hover > .actions{ + display:block; +} + + + +.portlet .render_admin{ + padding:1px; + + padding:0px 10px 0px 10px; + +} + +.portlet .render_admin.render_admin_block_content{ + padding:0px ; +} + +.portlet .render_admin.render_admin_block_content .col_1{ + padding-right:5px; + margin-right:0px; + border-right:1px dotted rgb(127,127,127); + +} + + + + +.portlet .render_admin.render_admin_block_content{ + min-height:100px; + +} + + +.portlet .render_admin.render_admin_block_content .col_2{ + + + +} + +.portlet_hover .render_admin.render_admin_block_content .col_1{ + + border-right:1px solid rgb(127,127,127); +} + + +.portlet.portlet_table_content { + +border:1px solid white; +} + +.portlet .render_admin.render_admin_table_content .table_content_cel{ + + border:2px solid rgb(127,127,127); + vertical-align:top; + padding:5px; +} + +.portlet .render_admin.render_admin_table_content .add_cel{ + + width:12px; + text-align:center; +} + +.portlet .render_admin.render_admin_table_content .add_col{ + + + text-align:center; +} +.portlet .render_admin.render_admin_table_content { + padding: 0px 0px 0px 0px; +} + + +.portlet .render_admin.render_admin_table_content .innerWrapper:hover .row_menu{ +display:block; +} +.portlet .render_admin.render_admin_table_content .innerWrapper:hover .col_menu{ +display:block; +} + + +.portlet .render_admin.render_admin_table_content .row_menu{ + position:absolute; + top:6px; + right:6px; + z-index:800; + display:none; +} + + + +.portlet .render_admin.render_admin_table_content .row_menu a{ + display:block; + width:200px; + padding:5px; + background:rgba(0,0,0,0.8); + color:#eff2f2; + border:1px solid #444444; + border-bottom:none; + + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; +} + + +.portlet .render_admin.render_admin_table_content .row_menu a:last-child{ + + border-bottom:1px solid #444444; + + +} + +.portlet .render_admin.render_admin_table_content .row_menu a:hover{ + background-color:rgba(131,131,131,0.9); + color:black; +} + + + +.portlet .render_admin.render_admin_table_content .col_menu{ + position:absolute; + top:6px; + left:6px; + z-index:800; + display:none; +} + + + +.portlet .render_admin.render_admin_table_content .col_menu a{ + display:block; + width:200px; + padding:5px; + background:rgba(0,0,0,0.8); + color:#eff2f2; + border:1px solid #444444; + border-bottom:none; + + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; +} + + +.portlet .render_admin.render_admin_table_content .col_menu a:last-child{ + + border-bottom:1px solid #444444; + + +} + +.portlet .render_admin.render_admin_table_content .col_menu a:hover{ + background-color:rgba(131,131,131,0.9); + color:black; +} + + + +.portlet .render_admin.render_admin_table_content .innerWrapper{ + cursor:pointer; + position:relative; +} + +#content_types_draggables{ + text-align:center; + position:fixed; + bottom:-13px; + right:0px; + left:0px; + z-index:800; + background:rgba(0,0,0,0.8); + +} + +.content_types_draggable{ +display:inline-block; +cursor:pointer; +width:60px; +} + +.content_types_draggable img{ +width:70px; +position:relative; + +top:-5px; +left:-5px; + +} + +#new_portlet_form_inline{ + + padding:10px; + background:#E9F2F9; + +} + +#edit_portlet_content_form{ + + padding:10px; + background:#CDE892; + +} + +.portlet_receptable_hover{ + background:#B7DF63; + + +} + +.slide{ + margin:10px; + padding:5px; + border:1px solid RGB(34,34,34); +} + +.slide .image_file{ + +float:right; +} + +/* data_files.css */ + + +#data_files_big_container{ + width:100%; + + background:red; + position:absolute; + top:36px; + left:0px; +} + +#data_files_big_container #sidebar{ + width:209px; + border-right:1px solid #adb5ba; + background:#d7d9dc; + position:absolute; + bottom:34px; + top:0px; + left:0px; +} + +#data_files_big_container #sidebar #file_folders a.file_folder_highlight{ +cursor:pointer; +background:RGB(217,233,245); +} + +#data_files_big_container #sidebar #file_folders a.active.file_folder_highlight{ +cursor:pointer; +background:RGB(217,233,245); +} + + +#data_files_big_container #sidebar #file_folders a{ + display:block; + padding:6px; + border-bottom:1px solid #9ca6ab; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; +} + +#data_files_big_container #sidebar #file_folders a.active{ + background-color:RGBA(46,119,187,0.9); + color:white; + border-bottom:1px solid RGBA(46,119,187,0.9); +} + +#data_files_big_container #sidebar #file_folders a:hover{ + background-color:RGBA(46,119,187,0.5); + color:white; + border-bottom:1px solid RGBA(46,119,187,0.5); +} + +#data_files_big_container #main_workspace_view{ + background:#eff2f2; + position:absolute; + top:0px; + left:210px; + bottom:0px; + right:0px; + padding-bottom:34px; +} + + + + +/* Grille des images */ +#data_files_big_container #main_workspace_view #data_files_container { + background:#eff2f2; + position:absolute; + + top:0px; + left:0px; + bottom:0px; + right:0px; + overflow:auto; + padding-bottom:34px; +} + + + + + +#data_files_big_container #main_workspace_view .data_file { + + margin:2px; + padding:4px ; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.5s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.5s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.5s; + + + +} + +#data_files_big_container #main_workspace_view .data_file:hover{ + background:RGB(230,230,230); +} + +#data_files_big_container #main_workspace_view #data_files_container #data_files .data_file.active { + + background-color:RGBA(46,119,187,0.3); + +} + + + + + + + +/* Aperçu des images */ +#data_files_big_container #main_workspace_view #data_file_container { + background:RGB(239,242,242); + position:absolute; + top:0px; + left:0px; + bottom:0px; + right:0px; + display:none; + padding-bottom:34px; +} + +#data_files_big_container #main_workspace_view #data_file_container.data_file_container_active{ + display:block; +} + +#data_files_big_container #main_workspace_view #data_file_container .img{ + position:absolute; + top:20px; + bottom:254px; + left:20px; + right:20px; + + background-position:center center; + background-repeat:no-repeat; + + + background-size: contain; + -moz-background-size: contain; /* Gecko 1.9.2 (Firefox 3.6) */ + -webkit-background-size: contain;/* Safari 3.0 */ +} + +#data_files_big_container #main_workspace_view #data_file_container .form{ + position:absolute; + bottom:34px; + height:180px; + left:0px; + right:0px; + background-color:RGBA(215,217,220,0.3); + border-top:1px solid #d7d9dc; + padding:10px; + color:#232424; +} + +#data_files_big_container #main_workspace_view #data_file_container .form input[type=text]{ + border:0px; + background:transparent; +} + +#data_files_big_container #main_workspace_view #data_file_container .form input[type=text]:focus{ + border:0px; + background:white; +} + +#data_files_big_container #main_workspace_view #data_file_container .form textarea{ + border:0px; + background:transparent; +} + +#data_files_big_container #main_workspace_view #data_file_container .form textarea:focus{ + border:0px; + background:white; +} + +#data_files_big_container #main_workspace_view #data_file_container .form .submit_tr{ + display:none; +} + + + + + +#data_files_big_container #main_workspace_view #data_file_container .close_link{ + width:29px; + height:29px; + background-image : url("/images/quartz_admin/button_close.png"); + background-repeat:no-repeat; + background-position:top; + position:absolute; + top:5px; + left:5px; + cursor:pointer; +} + +#data_files_big_container #main_workspace_view #data_file_container .close_link:hover{ + background-image : url("/images/quartz_admin/button_close.png"); + background-position:bottom; + cursor:pointer; +} + + + +#data_files_big_container #right_bar #multiple_selection{ + color:#eff2f2; + position:absolute; + top:0px; + left:10px; + padding:9px; + width:200px; + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + + +} + + + +#data_files_big_container #right_bar #multiple_selection:hover{ + background-color:rgba(131,131,131,0.3); + + + +} + + + + +#data_files_big_container #left_buttons{ + width:210px; + + background:#d7d9dc; + position:absolute; + height:33px; + bottom:0px; + border-top:1px solid #adb5ba; + left:0px; +} + +#data_files_big_container #left_buttons #add_file_folder{ + + position:absolute; + top:7px; + left:10px; + +} + +#data_files_big_container #left_buttons #remove_current_file_folder{ + + position:absolute; + top:7px; + right:40px; + +} + +#data_files_big_container #left_buttons #edit_current_file_folder{ + + position:absolute; + top:7px; + right:10px; + +} + + + + +#data_files_big_container #right_bar_clone{ + + background:rgba(0,0,0,0.8); + position:absolute; + + height:34px; + bottom:0px; + + left:0px; + right:0px; +} + +#data_files_big_container #right_bar_clone #right_bar_clone_buttons_left{ + + + position:absolute; + + top:9px; + + left:10px; + +} + + + + + +#data_files_big_container #right_bar{ + + background:rgba(0,0,0,0.8); + position:absolute; + height:34px; + bottom:0px; + + left:210px; + right:0px; +} + + + + + +#data_files_big_container #right_bar #data_file_form{ + position:absolute; + top:0px; + left:240px; + +} + + +#data_files_big_container #right_bar #data_file_form .file_upload { + position: relative; + overflow: hidden; + + + padding:9px; + width:250px; + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + + + + direction: ltr; + cursor: pointer; + text-align: left; + color:#eff2f2; + + + + +} + +#data_files_big_container #right_bar #data_file_form .file_upload:hover { + background-color:rgba(131,131,131,0.3); + + + + +} + + + +.file_upload_highlight { + background-color: rgba(106,191,6,0.2); +} + + +#data_files_big_container #right_bar #data_file_queue{ + position:absolute; + left:240px; + bottom:33px; + color:#eff2f2; + width:50%; + + background:rgba(0,0,0,0.9); + border:1px solid #444444; + border-top:0px; + + -webkit-transition: 0.4s ease-in-out; + -moz-transition: 0.4s ease-in-out; + -o-transition: 0.4s ease-in-out; + transition: 0.4s ease-in-out; + +} + +#data_files_big_container #right_bar #data_file_queue #files td{ + + padding:5px; +} + + +#data_files_big_container #right_bar #grid_slider{ + position:absolute; + right:20px; + top:15px; + width:150px; + height:3px; + background:#191919; + border:1px solid #444444; + border-radius:2px; +} + +#data_files_big_container #right_bar #grid_slider .ui-slider-handle{ + + border-radius:6px; + height:10px; + width:10px; + cursor:pointer; + background:#838383; + +} + +#data_files_big_container #right_bar #multiple_selection #multiple_menu{ + position:absolute; + left:0px; + bottom:33px; + height:0px; + width:216px; + background:rgba(0,0,0,0.9); + border:1px solid #444444; + border-top:0px; + overflow:hidden; + -webkit-transition: 0.4s ease-in-out; + -moz-transition: 0.4s ease-in-out; + -o-transition: 0.4s ease-in-out; + transition: 0.4s ease-in-out; + +} + +#data_files_big_container #right_bar #multiple_selection #multiple_menu a{ + + display:block; + padding:9px; + border-top:1px solid #444444; + color:#eff2f2; + + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + +} + +#data_files_big_container #right_bar #multiple_selection #multiple_menu a:hover{ + + background-color:rgba(131,131,131,0.3); + +} + + + +#data_files_big_container #right_bar #multiple_selection:hover #multiple_menu{ +height:auto; + + +} + + +/* general.css */ + +#menu_items_breadcrumbs .add_menu_item_link{ + float:right; + margin-top:2px; +} +#breadcrumb{ + + padding:10px 10px 10px 10px; + position:relative; + color:#FFFFFF; + background: #2E2E2E; + + +} +#breadcrumb .logout_link{ + + position:absolute; + right:10px; + top:10px; + +} + + + +#breadcrumb *{ + color:#FFFFFF; + +} + +.main_slide{ + + + width: 100%; + min-height:600px; + + + margin: auto; + + + +} + +.header{ + background:#6FB7E9; + padding:10px; + +} + +.header h1{ + + color:#ffffff; + + font-family:georgia; + text-shadow: #357EB0 1px 1px 0px; +} +.right{ + float:right; + +} + +.header_2{ + background:#B7DF63; + color:#ffffff; + padding:10px; + font-family:georgia; +} + +.header_2 *{ + + color:#ffffff; + text-shadow: #8EBF27 1px 1px 0px; + +} + + +#menu_item_show { + background:#E9F2F9; + padding:10px; +} + +.form1{ + background:#E9F2F9; + padding:10px; +} +.form2{ + background:#F3F8FC; + padding:10px; +} + +.grip{ + + width:30px; + cursor:move; +} + + +.receptable{ + background:none; + width:50px; + text-align:center; + +} + +.row_1 .receptable{ + background:yellow; + width:50px; +} + +.draggable{ + background:white; + padding:5px; + + border:1px solid #F3F1EF; + border-radius:10px; +} + + + +.draggable:hover{ + -webkit-box-shadow: #666666 0px 0px 10px; + -moz-box-shadow: #666666 0px 0px 10px; + box-shadow: #666666 0px 0px 10px; + border-color:white; +} + +.receptable_position{ + height:10px; + width:100%; +} + +.hoverhighlight_position{ + + background:#ECF8FE; + +} +#menu_items_breadcrumbs{ + margin-top:10px; + + height:30px; + background : #F0F0F0; + + border-radius:10px; +} +#menu_items_breadcrumbs *{ + color:#505B66; +} +#menu_items_breadcrumbs .receptable{ + float:left; + padding:5px 10px 5px 10px; + + + width:auto; + + /*background : url("/images/quartz_admin/icons_receptable.png") no-repeat right center;*/ +} + +#menu_items_breadcrumbs .separate{ + float:left; + padding:5px; + + + width:auto; + + /*background : url("/images/quartz_admin/icons_receptable.png") no-repeat right center;*/ +} + +#menu_items_breadcrumbs .actual{ + float:left; + padding:5px; + padding-right:20px; + margin-right:5px; + width:auto; +} + + + +.hoverhighlight a{ + + color:#3F94EB; + cursor:se-resize; +} + +.no_menu_items{ + padding:10px; + text-align:center; + color : #505B66; +} + + +#big_slider { + overflow:hidden; +} + +#page_slides{ + width:10000px; +} + +#page_slides .page_slide{ + float:left; + + + +} +.past_slide{ + + +} +#page_slides .page_slide#main_slide{ + float:left; + display:block; + -webkit-transition-property: margin; + -webkit-transition-duration: 1s; + +} + +/* image_files.css */ + + +#image_files_big_container{ + width:100%; + + background:red; + position:absolute; + top:36px; + left:0px; +} + +#image_files_big_container #sidebar{ + width:209px; + border-right:1px solid #adb5ba; + background:#d7d9dc; + position:absolute; + bottom:34px; + top:0px; + left:0px; +} + +#image_files_big_container #sidebar #albums a.album_highlight{ +cursor:pointer; +background:RGB(217,233,245); +} + +#image_files_big_container #sidebar #albums a.active.album_highlight{ +cursor:pointer; +background:RGB(217,233,245); +} + + +#image_files_big_container #sidebar #albums a{ + display:block; + padding:6px; + border-bottom:1px solid #9ca6ab; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; +} + +#image_files_big_container #sidebar #albums a.active{ + background-color:RGBA(46,119,187,0.9); + color:white; + border-bottom:1px solid RGBA(46,119,187,0.9); +} + +#image_files_big_container #sidebar #albums a:hover{ + background-color:RGBA(46,119,187,0.5); + color:white; + border-bottom:1px solid RGBA(46,119,187,0.5); +} + +#image_files_big_container #main_workspace_view{ + background:#eff2f2; + position:absolute; + top:0px; + left:210px; + bottom:0px; + right:0px; + padding-bottom:34px; +} + + + + +/* Grille des images */ +#image_files_big_container #main_workspace_view #image_files_container { + background:#eff2f2; + position:absolute; + + top:0px; + left:0px; + bottom:0px; + right:0px; + overflow:auto; + padding-bottom:34px; +} + + + + + +#image_files_big_container #main_workspace_view .image_file .img { + text-align:center; + width:150px; + height:150px; + margin:0px; + + +} + + +#image_files_big_container #main_workspace_view .image_file .name { + + padding:4px 0px 2px 0px; + font-size:10px; + text-align:center; + +} + +#image_files_big_container #main_workspace_view .image_file { + float:left; + padding:8px; + margin:2px; + border:4px solid #eff2f2; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.5s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.5s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.5s; + + + +} + +#image_files_big_container #main_workspace_view #image_files_container #image_files .image_file.active { + + background-color:RGBA(46,119,187,0.3); + +} + + + + + + + +/* Aperçu des images */ +#image_files_big_container #main_workspace_view #image_file_container { + background:RGB(239,242,242); + position:absolute; + top:0px; + left:0px; + bottom:0px; + right:0px; + display:none; + padding-bottom:34px; +} + +#image_files_big_container #main_workspace_view #image_file_container.image_file_container_active{ + display:block; +} + +#image_files_big_container #main_workspace_view #image_file_container .img{ + position:absolute; + top:20px; + bottom:254px; + left:20px; + right:20px; + + background-position:center center; + background-repeat:no-repeat; + + + background-size: contain; + -moz-background-size: contain; /* Gecko 1.9.2 (Firefox 3.6) */ + -webkit-background-size: contain;/* Safari 3.0 */ +} + +#image_files_big_container #main_workspace_view #image_file_container .form{ + position:absolute; + bottom:34px; + height:180px; + left:0px; + right:0px; + background-color:RGBA(215,217,220,0.3); + border-top:1px solid #d7d9dc; + padding:10px; + color:#232424; +} + +#image_files_big_container #main_workspace_view #image_file_container .form input[type=text]{ + border:0px; + background:transparent; +} + +#image_files_big_container #main_workspace_view #image_file_container .form input[type=text]:focus{ + border:0px; + background:white; +} + +#image_files_big_container #main_workspace_view #image_file_container .form textarea{ + border:0px; + background:transparent; +} + +#image_files_big_container #main_workspace_view #image_file_container .form textarea:focus{ + border:0px; + background:white; +} + +#image_files_big_container #main_workspace_view #image_file_container .form .submit_tr{ + display:none; +} + + + + + +#image_files_big_container #main_workspace_view #image_file_container .close_link{ + width:24px; + height:24px; + background-image : url("/iconic/gray_light/x_alt_24x24.png"); + background-repeat:no-repeat; + background-position:top; + position:absolute; + top:5px; + left:5px; + cursor:pointer; +} + +#image_files_big_container #main_workspace_view #image_file_container .close_link:hover{ + background-image : url("/iconic/gray_dark/x_alt_24x24.png"); + background-position:bottom; + cursor:pointer; +} + + + +#image_files_big_container #right_bar #multiple_selection{ + color:#eff2f2; + position:absolute; + top:0px; + left:10px; + padding:9px; + width:200px; + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + + +} + + + +#image_files_big_container #right_bar #multiple_selection:hover{ + background-color:rgba(131,131,131,0.3); + + + +} + + + + +#image_files_big_container #left_buttons{ + width:210px; + + background:#d7d9dc; + position:absolute; + height:33px; + bottom:0px; + border-top:1px solid #adb5ba; + left:0px; +} + +#image_files_big_container #left_buttons #add_album{ + + position:absolute; + top:7px; + left:10px; + +} + +#image_files_big_container #left_buttons #remove_current_album{ + + position:absolute; + top:7px; + right:40px; + +} + +#image_files_big_container #left_buttons #edit_current_album{ + + position:absolute; + top:7px; + right:10px; + +} + + + + +#image_files_big_container #right_bar_clone{ + + background:rgba(0,0,0,0.8); + position:absolute; + + height:34px; + bottom:0px; + + left:0px; + right:0px; +} + +#image_files_big_container #right_bar_clone #right_bar_clone_buttons_left{ + + + position:absolute; + + top:9px; + + left:10px; + +} + + + + + +#image_files_big_container #right_bar{ + + background:rgba(0,0,0,0.8); + position:absolute; + height:34px; + bottom:0px; + + left:210px; + right:0px; +} + + + + + +#image_files_big_container #right_bar #image_file_form{ + position:absolute; + top:0px; + left:240px; + +} + + +#image_files_big_container #right_bar #image_file_form .file_upload { + position: relative; + overflow: hidden; + + + padding:9px; + width:250px; + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + + + + direction: ltr; + cursor: pointer; + text-align: left; + color:#eff2f2; + + + + +} + +#image_files_big_container #right_bar #image_file_form .file_upload:hover { + background-color:rgba(131,131,131,0.3); + + + + +} + + + +.file_upload_highlight { + background-color: rgba(106,191,6,0.2); +} + + +#image_files_big_container #right_bar #image_file_queue{ + position:absolute; + left:240px; + bottom:33px; + color:#eff2f2; + width:50%; + + background:rgba(0,0,0,0.9); + border:1px solid #444444; + border-top:0px; + + -webkit-transition: 0.4s ease-in-out; + -moz-transition: 0.4s ease-in-out; + -o-transition: 0.4s ease-in-out; + transition: 0.4s ease-in-out; + +} + +#image_files_big_container #right_bar #image_file_queue #files td{ + + padding:5px; +} + + +#image_files_big_container #right_bar #grid_slider{ + position:absolute; + right:20px; + top:15px; + width:150px; + height:3px; + background:#191919; + border:1px solid #444444; + border-radius:2px; +} + +#image_files_big_container #right_bar #grid_slider .ui-slider-handle{ + + border-radius:6px; + height:10px; + width:10px; + cursor:pointer; + background:#838383; + +} + +#image_files_big_container #right_bar #multiple_selection #multiple_menu{ + position:absolute; + left:0px; + bottom:33px; + height:0px; + width:216px; + background:rgba(0,0,0,0.9); + border:1px solid #444444; + border-top:0px; + overflow:hidden; + -webkit-transition: 0.4s ease-in-out; + -moz-transition: 0.4s ease-in-out; + -o-transition: 0.4s ease-in-out; + transition: 0.4s ease-in-out; + +} + +#image_files_big_container #right_bar #multiple_selection #multiple_menu a{ + + display:block; + padding:9px; + border-top:1px solid #444444; + color:#eff2f2; + + + + cursor:pointer; + + /* webkit */ + -webkit-transition-property: background-color; + -webkit-transition-duration: 0.4s; + + /* Firefox */ + -moz-transition-property: background-color; + -moz-transition-duration: 0.4s; + + /* standardisé */ + transition-property: background-color; + transition-duration: 0.4s; + +} + +#image_files_big_container #right_bar #multiple_selection #multiple_menu a:hover{ + + background-color:rgba(131,131,131,0.3); + +} + + + +#image_files_big_container #right_bar #multiple_selection:hover #multiple_menu{ +height:auto; + + +} + + +/* index_block.css */ +.row_1 td { + background: #ebf2fe; } + +.row td { + padding: 2px; } +.row .actions { + text-align: right; + padding-left: 5px; + width: 40px; } + +.search_bar { + background: #8ac2f6; + padding: 10px; + margin-bottom: 20px; } + +.rows_header a { + text-decoration: none; + color: black; + font-weight: bold; } +.rows_header th { + padding: 5px; } +.rows_header td { + padding-top: 5px; + padding-bottom: 5px; + border-top: 1px solid #484848; + border-bottom: 1px solid #484848; } + +.paginate_cel { + text-align: right; } + .paginate_cel .disabled { + visibility: hidden; } + .paginate_cel em { + text-decoration: none; + padding: 2px 5px 2px 5px; + border-radius: 10px; + text-decoration: none; + color: white; + font-style: normal; + margin-right: 2px; + font-weight: bold; + background-color: #484848; } + .paginate_cel a { + text-decoration: none; + padding: 1px 5px 2px 5px; + text-decoration: none; + color: #484848; + margin-right: 2px; + background-color: #f0f0f0; + border-radius: 10px; } + .paginate_cel a:hover { + padding: 2px 5px 2px 5px; + margin-right: 2px; + background-color: #484848; + color: white; } + +.per_page_cel { + color: #484848; + padding-bottom: 10px; + padding-top: 10px; } + .per_page_cel em { + text-decoration: none; + padding: 2px 5px 2px 5px; + border-radius: 10px; + text-decoration: none; + color: #484848; + font-style: normal; + margin-right: -3px; + font-weight: normal; + background-color: #ebf2fe; } + .per_page_cel a { + text-decoration: none; + padding: 1px 5px 2px 5px; + background: transparent; + text-decoration: none; + color: #484848; + margin-right: 2px; + font-weight: normal; + border-radius: 10px; } + .per_page_cel a:hover { + padding: 2px 5px 2px 5px; + margin-right: 2px; + background-color: #ebf2fe; + color: #484848; } + +.menu_item_position a { + text-decoration: none; } +.menu_item_position .move { + font-size: 10px; } +.menu_item_position td { + padding: 0px; } + +.exportation { + color: #484848; + padding: 5px; } + .exportation em { + text-decoration: none; + padding: 2px 5px 2px 5px; + border-radius: 10px; + text-decoration: none; + color: #484848; + font-style: normal; + margin-right: -3px; + font-weight: normal; + background-color: #ebf2fe; } + .exportation a { + text-decoration: none; + padding: 1px 5px 2px 5px; + text-decoration: none; + margin-right: 2px; + font-weight: normal; + border-radius: 10px; + background-color: #ebf2fe; + color: #484848; } + .exportation a:hover { + padding: 2px 5px 2px 5px; + margin-right: 2px; + font-weight: bold; + background-color: #484848; + color: white; } + +/* manager.css */ +#manager_box_place{ + position:fixed; + height:0; + width:100%; + z-index:1500; + + margin:0px; + padding:0px; + display:none; + +} +#manager_box{ + position:relative; + width:95%; + height:95%; + overflow:auto; + + margin:auto; + margin-top:0px; + + background:white; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(#eff2f2), to(#ffffff)); + background: -moz-linear-gradient(0% 100%, 0% 0%, from(#eff2f2), to(#ffffff)); + -webkit-box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + -moz-box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + + /* webkit */ + + +} + +#manager_box_place.manager_box_place_active{ + height:100%; + + +} + + +/* pane_hover */ +#qi_pane_hover{ + position:fixed; + top:0px; + left:0px; + bottom:0px; + right:0px; + + + + +} + +#qi_pane_hover #qi_pane_hover_content{ + margin:auto; + position:relative; + + background:white; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(rgb(239,242,242)), to(rgb(255,255,255))); + background: -moz-linear-gradient(0% 100%, 0% 0%, from(rgb(239,242,242)), to(rgb(255,255,255))); + -webkit-box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + -moz-box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + box-shadow: rgba(0,0,0,0.8) 1px 1px 50px; + +} + +#qi_pane_hover #qi_pane_hover_content .content{ + + position:absolute; + top:0px; + right:0px; + left:0px; + bottom:37px; + overflow:auto; + padding:10px; + + +} + + +#qi_pane_hover #qi_pane_hover_content .actions{ + position:absolute; + bottom:0px; + left:0px; + right:0px; + text-align:right; + padding-bottom:5px; + padding-top : 5px; + border-top :1px solid rgba(127,127,127,0.2); + height:26px; + +} + +/* prescription.css.scss */ +#dashboard_actions{ + + .panel{ + h3{ + font-weight:normal; + } + + a + { + display:block; + padding:10px; + @include box-shadow(0px, 1px, 3px, rgba(0, 0, 0, 0.4)); + margin-bottom:20px; + border:5px solid white; + + @include linear-gradient(#FAFAFA, #EEE); + text-align:center; + color:black; + + img{ + display:block; + margin:auto; + height:100px; + } + + + + + &:hover{ + + @include box-shadow(0px, 2px, 10px, rgba(0, 0, 0, 0.398438)); + } + + } + } + + + +} + + + + +#prescriptions_big_container{ + position:relative; + + #sidebar{ + + width:300px; + position:absolute; + top:0px; + left:0px; + bottom:0px; + overflow:auto; + border-right:1px solid RGB(34,34,34); + + + .prescription{ + padding:10px; + border-bottom:1px solid gray; + cursor:pointer; + -webkit-transition-duration:0.8s; + + + .date{ + color:gray; + } + + &:hover{ + + background-color:RGB(235,247,253); + + } + + + } + .prescription.unread{ + background-image:url('/images/point_unread.png'); + background-repeat: no-repeat; + background-position: 270px center; + } + .prescription.undone{ + + background-image:url('/images/point_undone.png'); + background-repeat: no-repeat; + background-position: 270px center; + } + .prescription.unread{ + background-image:url('/images/point_unread.png'); + background-repeat: no-repeat; + background-position: 270px center; + } + + .prescription.done{ + background-image:url('/images/point_done.png'); + background-repeat: no-repeat; + background-position: 270px center; + } + + + .prescription.active{ + background-color:RGB(235,247,253); + } + + + + } + + + #main_workspace_view{ + position:absolute; + left:300px; + right:0px; + top:0px; + bottom:0px; + overflow:auto; + padding:10px; + padding-bottom:40px; + padding-top:40px; + + .notes{ + padding:5px; + margin:5px; + font-size:15px; + border:1px solid #ffd148; + } + h2{ + .tel{ + float:right; + } + + } + #ship_info{ + position:absolute; + top:0px; + right:0px; + left:1px; + height:16px; + background:#49bd22; + color:white; + padding:10px; + + } + .file{ + text-align:center; + img{ + + + } + } + .done{ + padding:5px; + } + + } + + #right_bar{ + left:300px; + color:#eff2f2; + .delete{ + padding:7px; + } + .left{ + float:right; + padding:4px; + } + } + +} + +/* styled_blocks.css */ + +.image_square{ + float:left; + padding:5px; + margin:5px; + position:relative; + border : 1px solid rgb(230,230,230); + border-radius:10px; + background:white; +} +.image_square:hover{ + border : 1px solid rgba(0,0,0,0.8); +} +.image_square .img{ + text-align:center; + width:150px; + height:150px; + margin:0px; + background-position:center center; + background-repeat:no-repeat; + + background-size: contain; + -moz-background-size: contain; /* Gecko 1.9.2 (Firefox 3.6) */ + -webkit-background-size: contain;/* Safari 3.0 */ + + +} + +.image_square:hover .actions{ + display:block; + border:none; + padding:0px; + margin:0px; + left:0px; + top:0px; + + opacity:0.5; + background :rgb(10,10,10); + +} + +.image_square:hover .actions:hover{ + + opacity:1; + +} + +/* core/elements */ +a{ + color : #3C74A8; + text-decoration:none; +} + +a:hover{ + color:#3F94EB; +} + +/* core/fluid_grid */ +/* + Variable Grid System (Fluid Version). + Learn more ~ http://www.spry-soft.com/grids/ + Based on 960 Grid System - http://960.gs/ & 960 Fluid - http://www.designinfluences.com/ + + Licensed under GPL and MIT. +*/ + + +/* Containers +----------------------------------------------------------------------------------------------------*/ +.container_12 { + width: 100%; +/* + margin-left: 4%; + margin-right: 4%; +*/ +} + +/* Grid >> Global +----------------------------------------------------------------------------------------------------*/ + +.grid_1, +.grid_2, +.grid_3, +.grid_4, +.grid_5, +.grid_6, +.grid_7, +.grid_8, +.grid_9, +.grid_10, +.grid_11, +.grid_12 { + display:inline; + float: left; + position: relative; + margin-left: 1%; + margin-right: 1%; +} + +/* Grid >> Children (Alpha ~ First, Omega ~ Last) +----------------------------------------------------------------------------------------------------*/ + +.alpha { + margin-left: 0; +} + +.omega { + margin-right: 0; +} + +/* Grid >> 12 Columns +----------------------------------------------------------------------------------------------------*/ + + +.container_12 .grid_1 { + width:6.333%; +} + +.container_12 .grid_2 { + width:14.667%; +} + +.container_12 .grid_3 { + width:23.0%; +} + +.container_12 .grid_4 { + width:31.333%; +} + +.container_12 .grid_5 { + width:39.667%; +} + +.container_12 .grid_6 { + width:48.0%; +} + +.container_12 .grid_7 { + width:56.333%; +} + +.container_12 .grid_8 { + width:64.667%; +} + +.container_12 .grid_9 { + width:73.0%; +} + +.container_12 .grid_10 { + width:81.333%; +} + +.container_12 .grid_11 { + width:89.667%; +} + +.container_12 .grid_12 { + width:98.0%; +} + + + +/* Prefix Extra Space >> 12 Columns +----------------------------------------------------------------------------------------------------*/ + + +.container_12 .prefix_1 { + padding-left:8.333%; +} + +.container_12 .prefix_2 { + padding-left:16.667%; +} + +.container_12 .prefix_3 { + padding-left:25.0%; +} + +.container_12 .prefix_4 { + padding-left:33.333%; +} + +.container_12 .prefix_5 { + padding-left:41.667%; +} + +.container_12 .prefix_6 { + padding-left:50.0%; +} + +.container_12 .prefix_7 { + padding-left:58.333%; +} + +.container_12 .prefix_8 { + padding-left:66.667%; +} + +.container_12 .prefix_9 { + padding-left:75.0%; +} + +.container_12 .prefix_10 { + padding-left:83.333%; +} + +.container_12 .prefix_11 { + padding-left:91.667%; +} + + + +/* Suffix Extra Space >> 12 Columns +----------------------------------------------------------------------------------------------------*/ + + +.container_12 .suffix_1 { + padding-right:8.333%; +} + +.container_12 .suffix_2 { + padding-right:16.667%; +} + +.container_12 .suffix_3 { + padding-right:25.0%; +} + +.container_12 .suffix_4 { + padding-right:33.333%; +} + +.container_12 .suffix_5 { + padding-right:41.667%; +} + +.container_12 .suffix_6 { + padding-right:50.0%; +} + +.container_12 .suffix_7 { + padding-right:58.333%; +} + +.container_12 .suffix_8 { + padding-right:66.667%; +} + +.container_12 .suffix_9 { + padding-right:75.0%; +} + +.container_12 .suffix_10 { + padding-right:83.333%; +} + +.container_12 .suffix_11 { + padding-right:91.667%; +} + + + +/* Push Space >> 12 Columns +----------------------------------------------------------------------------------------------------*/ + + +.container_12 .push_1 { + left:8.333%; +} + +.container_12 .push_2 { + left:16.667%; +} + +.container_12 .push_3 { + left:25.0%; +} + +.container_12 .push_4 { + left:33.333%; +} + +.container_12 .push_5 { + left:41.667%; +} + +.container_12 .push_6 { + left:50.0%; +} + +.container_12 .push_7 { + left:58.333%; +} + +.container_12 .push_8 { + left:66.667%; +} + +.container_12 .push_9 { + left:75.0%; +} + +.container_12 .push_10 { + left:83.333%; +} + +.container_12 .push_11 { + left:91.667%; +} + + + +/* Pull Space >> 12 Columns +----------------------------------------------------------------------------------------------------*/ + + +.container_12 .pull_1 { + left:-8.333%; +} + +.container_12 .pull_2 { + left:-16.667%; +} + +.container_12 .pull_3 { + left:-25.0%; +} + +.container_12 .pull_4 { + left:-33.333%; +} + +.container_12 .pull_5 { + left:-41.667%; +} + +.container_12 .pull_6 { + left:-50.0%; +} + +.container_12 .pull_7 { + left:-58.333%; +} + +.container_12 .pull_8 { + left:-66.667%; +} + +.container_12 .pull_9 { + left:-75.0%; +} + +.container_12 .pull_10 { + left:-83.333%; +} + +.container_12 .pull_11 { + left:-91.667%; +} + + + + +/* Clear Floated Elements +----------------------------------------------------------------------------------------------------*/ + +/* http://sonspring.com/journal/clearing-floats */ + +.clear { + clear: both; + display: block; + overflow: hidden; + visibility: hidden; + width: 0; + height: 0; +} + +/* http://perishablepress.com/press/2008/02/05/lessons-learned-concerning-the-clearfix-css-hack */ + +.clearfix:after { + clear: both; + content: ' '; + display: block; + font-size: 0; + line-height: 0; + visibility: hidden; + width: 0; + height: 0; +} + +.clearfix { + display: inline-block; +} + +* html .clearfix { + height: 1%; +} + +.clearfix { + display: block; +} + +/* forms.css */ + +/* tutorial */ + +input[type=text],input[type=password], textarea { + padding: 5px; + border: solid 1px #C9C9C9; + outline: 0; + font: normal 13px/100% Verdana, Tahoma, sans-serif; + width: 200px; + + background: -webkit-gradient(linear, left top, left 25, from(#FFFFFF), color-stop(4%, #F7F7F7), to(#FFFFFF)); + background: -moz-linear-gradient(top, #FFFFFF, #F7F7F7 1px, #FFFFFF 25px); + + } + +textarea { + width: 400px; + max-width: 400px; + height: 150px; + line-height: 150%; + } + +input:hover, textarea:hover, +input:focus, textarea:focus { + box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + -moz-box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + -webkit-box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + + } + +label { + + + cursor:pointer; + } + + + + +.button{ + display: inline-block; + background: #3c74a8; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(rgb(239,242,242)), to(rgb(255,255,255))); + background: -moz-linear-gradient(bottom, rgb(239,242,242), rgb(255,255,255)); + box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -moz-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -webkit-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + border: none; + -moz-border-radius: 20px; + -webkit-border-radius: 20px; + border-radius: 20px; + color: RGB(46,46,46); + + + + + padding: 5px 15px; + margin:0px 5px 0px 5px; + font-weight:normal; + + } + + + + +.button:hover { + box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -moz-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -webkit-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + color: RGB(46,46,46); + cursor: pointer; + } + + +.actions{ + text-align:right; +} + +button,input[type=submit] { + display: inline-block; + background: #3c74a8; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(rgb(60,116,168)), to(rgb(103,146,187))); + background: -moz-linear-gradient(bottom, rgb(60,116,168), rgb(103,146,187)); + box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -moz-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -webkit-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + border: none; + -moz-border-radius: 20px; + -webkit-border-radius: 20px; + border-radius: 20px; + color: white; + + margin:0px 5px 0px 5px; + + padding: 5px 15px; + text-shadow: 0 1px 1px rgba(0,0,0,0.6); + font-weight:normal; + font-size:13px; + + } + +button:hover,input[type=submit]:hover { + box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -moz-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -webkit-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + cursor: pointer; + } + + + + +.field_with_errors{ + display:inline; + color:red; + +} + +.field_with_errors input{ + display:inline; + border-color:red; + + +} + +.errorExplanation{ + border-top: 1px solid black; + border-bottom: 1px solid black; + padding:5px; + border-color:#F2EDA1; + background:#FEFCDB; + +} +.errorExplanation h2{ + font-size:13px; + margin:0px; + padding:0px; +} + +/* core/general */ +.message{ + border: 4px solid black; + border-radius:10px; + padding:5px; + margin:20px; + -webkit-box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; + -moz-box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; + box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; +} +.alert{ + border-color: rgb(242,237,161); + background: rgba(254,252,219,0.8); +} + +.notice{ + border-color:rgb(205,230,245); + background:rgba(236,248,254,0.8); +} +#flash{ + position:fixed; + bottom:0px; + width:100%; +} + +a img{ + border:0px; +} + +table{ + border-collapse:collapse; + width:100%; +} + +h1, h2, h3, h4, h5, h6 { + margin:0px; + padding:0px; +} + + + +.search_studient { + + .grid_4{ + height:300px; + overflow:auto; + border:1px solid RGB(131,160,195); + } + fieldset > ol > li label{ + width:100% !important; + } + + li{ + list-style:none; + margin:0px !important; + padding:0px !important; + } + +} \ No newline at end of file diff --git a/app/assets/stylesheets/connexion.scss b/app/assets/stylesheets/connexion.scss new file mode 100644 index 0000000..29a4697 --- /dev/null +++ b/app/assets/stylesheets/connexion.scss @@ -0,0 +1,35 @@ +/* +*=require admin/core/reset +*= require_self +*= require admin/core/forms +*= require admin/core/elements +*= require admin/core/general + + + +*/ + +body { + background: #3f94eb; + font-family: verdana; +padding:0px; +margin:0px; + -webkit-font-smoothing: antialiased; + font-size: 13px; + font-family: "Lucida Grande", arial, helvetica, sans-serif; } + body #title { + width: 520px; + margin: auto; + margin-top: 10%; + color: #9fc9f5; + text-shadow: 0 1px 1px #3f94eb; + padding: 0px; + text-transform: uppercase; } + body #main { + background: white; + width: 500px; + padding: 10px; + margin: auto; + -webkit-box-shadow: #666666 0px 0px 20px; + -moz-box-shadow: #666666 0px 0px 20px; + box-shadow: #666666 0px 0px 20px; } diff --git a/app/assets/stylesheets/mixins/_css3.scss b/app/assets/stylesheets/mixins/_css3.scss new file mode 100644 index 0000000..0d6e575 --- /dev/null +++ b/app/assets/stylesheets/mixins/_css3.scss @@ -0,0 +1,75 @@ +// ==== CSS3 SASS MIXINS ==== +// https://github.com/madr/css3-sass-mixins + +// Should IE filters be used or not? +// PROS: gradients, drop shadows etc will be handled by css. +// CONS: will harm the site performance badly, +// especially on sites with heavy rendering and scripting. +$useIEFilters: 0; // might be 0 or 1. disabled by default. + +@mixin border-radius ($values) { + -moz-border-radius: $values; + -webkit-border-radius: $values; + border-radius: $values; +} + +@mixin box-shadow ($x, $y, $offset, $hex, $ie: $useIEFilters) { + -moz-box-shadow: $x $y $offset $hex; + -o-box-shadow: $x $y $offset $hex; + -webkit-box-shadow: $x $y $offset $hex; + box-shadow: $x $y $offset $hex; + + @if $ie == 1 { + $iecolor: '#' + red($hex) + green($hex) + blue($hex); + filter: progid:DXImageTransform.Microsoft.dropshadow(OffX=#{$x}, OffY=#{$y}, Color='#{$iecolor}'); + -ms-filter: quote(progid:DXImageTransform.Microsoft.dropshadow(OffX=#{$x}, OffY=#{$y}, Color='#{$iecolor}')); + } +} + +@mixin linear-gradient($from, $to, $ie: $useIEFilters) { + @if $ie != 1 { + background-color: $to; + } + + background-image: -moz-linear-gradient(top, $from, $to); + background-image: -webkit-gradient(linear,left top,left bottom,color-stop(0, $from),color-stop(1, $to)); + + @if $ie == 1 { + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#{$from}', endColorstr='#{$to}'); + -ms-filter: quote(progid:DXImageTransform.Microsoft.gradient(startColorstr='#{$from}', endColorstr='#{$to}')); + } +} + +@mixin rgba($hex, $alpha, $ie: $useIEFilters) { + @if $ie == 1 { + // this formula is not accurate enough, will be fixed with sass 3.1 + $hexopac: '#' + ceil((($alpha * 255)/16) *10) + $hex; + background-color: none; + filter: progid:DXImageTransform.Microsoft.gradient(startColorStr='#{$hexopac}',EndColorStr='#{$hexopac}}'); + -ms-filter: quote(progid:DXImageTransform.Microsoft.gradient(startColorStr='#{$hexopac}',EndColorStr='#{$hexopac}')); + } + @else { + background-color: $hex; + background-color: rgba(red($hex), green($hex), blue($hex), $alpha); + } +} + +@mixin rotate ($deg, $ie: $useIEFilters) { + -moz-transform: rotate(#{$deg}deg); + -o-transform: rotate(#{$deg}deg); + -webkit-transform: rotate(#{$deg}deg); + // not ready, impediment: cos required! + //@if $ie == 1 { + // filter: progid:DXImageTransform.Microsoft.Matrix(sizingMethod='auto expand', M11=0.99144486137381, M12=--0.130526192220052, M21=0.130526192220052, M22=0.99144486137381); + // -ms-filter: quote(progid:DXImageTransform.Microsoft.Matrix(SizingMethod='auto expand', M11=0.99144486137381, M12=--0.130526192220052, M21=0.130526192220052, M22=0.99144486137381)); + // zoom: 1; + //} +} + +@mixin transition ($value) { + -moz-transition: $value; + -o-transition: $value; + -webkit-transition: $value; + transition: $value; +} +// ==== /CSS3 SASS MIXINS ==== \ No newline at end of file diff --git a/app/assets/stylesheets/public/public.scss b/app/assets/stylesheets/public/public.scss new file mode 100644 index 0000000..fced4c1 --- /dev/null +++ b/app/assets/stylesheets/public/public.scss @@ -0,0 +1,246 @@ +/* + * FIXME: Introduce SCSS & Sprockets + *= require_self +*= require prettyPhoto +*= require formtastic + + + *= require_tree . + +*/ + + +@import "../mixins/css3"; + +body { + padding: 0px; + margin: 0px; + font-size: 14px; + font-family: "Verdana"; + color:#1d1d1d; + } + a { + + color: #001c6d; + text-decoration: none; + + img { + border: 0px; + } + + &:hover { + text-decoration: underline; + color:#68c545; + } + } + +#breadcrumb{ + color:#848484; + + *{ + color:#848484; + } +} + +#public_core{ + + margin:auto; + width:960px; + margin-top:20px; + @include box-shadow(0px, 0px, 10px, rgba(0, 0, 0, 0.4)); + border:1px solid #87c51c; + background:white; + + + + #header{ + padding:1px; + + table{ + width:100%; + } + + #logo { + width:160px; + text-align:center; + } + + + h1{ + margin-top:0px; + text-align:center; + + } + } + + #menu_top { + background:#87c51c; + text-align:center; + + a { + display:inline-block; + padding: 5px 10px 5px 10px; + text-transform:uppercase; + color:white; + text-decoration: none; + min-width:100px; + text-align:center; + border-bottom:2px solid transparent; + + &:hover{ + border-color : #001871; + color:white; + } + + } + + + } + + + + #page_main { + #sidebar { + float: left; + width: 240px; + position: relative; + min-height: 400px; + background:#eaeaea; + } + } + +} + + + +#menu_left ul { +list-style: none; +padding-left: 0px; + + li{ + + + a{ + display:block; + padding:5px; + color:#3f3f3f; + + border-bottom: 1px solid white; + + &:hover{ + background:#f8f8f8; + } + + } + } + + ul { + //padding-left: 20px; + padding-bottom:10px; + li{ + a{ + color:#5b5b5b; + padding-left: 20px; + border-bottom: 1px dotted white; + } + + } + } + +} + + + +#public #header { +width: 960px; +margin: auto; +} + + + + + + + + + + + + body .clear { + clear: both; } + + + + + body #page_main { + width: 960px; + margin: auto; } + + body #page_main #content { + float: left; + width: 700px; +padding:10px; + + + } + body #menu_bottom { + margin: auto; + width: 960px; + margin-top: 20px; + margin-bottom: 20px; } + body #menu_bottom #left_bottom { + float: left; } + body #menu_bottom #right_bottom { + float: right; } + body .article { + border: 1px solid RGB(129, 178, 11); + padding: 10px; + margin-bottom: 10px; } + body .article h3 { + color: RGB(129, 178, 11); } + body .article .image_file { + float: left; + margin-right: 10px; } + body .article .title, body .article .description { + margin-left: 130px; } + body .article .title a, body .article .description a { + color: #604435; + text-decoration: none; } + + + + + +#flash_notice{ + border:3px solid #6bb800; + padding:10px; + +} + + + +.portlet.table_content table { +width: 100%; +border-collapse: collapse; } +.portlet.table_content table td { +border: 1px solid black; } + +.portlet.block_content .two_column .column { +float: left; +width: 50%; } +.portlet.block_content .two_column .column .block { +padding: 10px; } + +.portlet.link_content{ + padding:5px; + + +} + +.portlet.download_content{ + padding:5px; + padding-left:20px; + + border:1px solid #6bb800; + +} diff --git a/app/assets/stylesheets/qi/forms.scss b/app/assets/stylesheets/qi/forms.scss new file mode 100755 index 0000000..800d55e --- /dev/null +++ b/app/assets/stylesheets/qi/forms.scss @@ -0,0 +1,138 @@ + +/* tutorial */ + +input[type=text],input[type=password], textarea { + padding: 5px; + border: solid 1px #C9C9C9; + outline: 0; + font: normal 13px/100% Verdana, Tahoma, sans-serif; + width: 200px; + + background: -webkit-gradient(linear, left top, left 25, from(#FFFFFF), color-stop(4%, #F7F7F7), to(#FFFFFF)); + background: -moz-linear-gradient(top, #FFFFFF, #F7F7F7 1px, #FFFFFF 25px); + + } + +textarea { + width: 400px; + max-width: 400px; + height: 150px; + line-height: 150%; + } + +input:hover, textarea:hover, +input:focus, textarea:focus { + box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + -moz-box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + -webkit-box-shadow: rgba(0,0,0, 0.1) 0px 0px 8px; + + } + +label { + + + cursor:pointer; + } + + + + +.button{ + display: inline-block; + background: #3c74a8; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(rgb(239,242,242)), to(rgb(255,255,255))); + background: -moz-linear-gradient(bottom, rgb(239,242,242), rgb(255,255,255)); + box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -moz-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -webkit-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + border: none; + -moz-border-radius: 20px; + -webkit-border-radius: 20px; + border-radius: 20px; + color: RGB(46,46,46); + + + + + padding: 5px 15px; + margin:0px 5px 0px 5px; + font-weight:normal; + + } + + + + +.button:hover { + box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -moz-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -webkit-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + color: RGB(46,46,46); + cursor: pointer; + } + + +.actions{ + text-align:right; +} + +button,input[type=submit] { + display: inline-block; + background: #3c74a8; + background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(rgb(60,116,168)), to(rgb(103,146,187))); + background: -moz-linear-gradient(bottom, rgb(60,116,168), rgb(103,146,187)); + box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -moz-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + -webkit-box-shadow: rgba(0,0,0, 0.4) 0px 0px 3px; + border: none; + -moz-border-radius: 20px; + -webkit-border-radius: 20px; + border-radius: 20px; + color: white; + + margin:0px 5px 0px 5px; + + padding: 5px 15px; + text-shadow: 0 1px 1px rgba(0,0,0,0.6); + font-weight:normal; + font-size:13px; + + } + +button:hover,input[type=submit]:hover { + box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -moz-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + -webkit-box-shadow: rgba(0,0,0, 0.6) 0px 0px 5px; + cursor: pointer; + } + + + + +.field_with_errors{ + display:inline; + color:red; + +} + +.field_with_errors input{ + display:inline; + border-color:red; + + +} + +.errorExplanation{ + border-top: 1px solid black; + border-bottom: 1px solid black; + padding:5px; + border-color:#F2EDA1; + background:#FEFCDB; + +} +.errorExplanation h2{ + font-size:13px; + margin:0px; + padding:0px; +} + diff --git a/app/assets/stylesheets/qi/general.scss b/app/assets/stylesheets/qi/general.scss new file mode 100644 index 0000000..2398950 --- /dev/null +++ b/app/assets/stylesheets/qi/general.scss @@ -0,0 +1,47 @@ +.message{ + border: 4px solid black; + border-radius:10px; + padding:5px; + margin:20px; + -webkit-box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; + -moz-box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; + box-shadow: rgba(0,0,0,0.5) 1px 1px 40px; +} +.alert{ + border-color: rgb(242,237,161); + background: rgba(254,252,219,0.8); +} + +.notice{ + border-color:rgb(205,230,245); + background:rgba(236,248,254,0.8); +} +#flash{ + position:fixed; + bottom:0px; + width:100%; +} + +a img{ + border:0px; +} + +table{ + border-collapse:collapse; + width:100%; +} + +h1, h2, h3, h4, h5, h6 { + margin:0px; + padding:0px; +} + +a{ + color : #3C74A8; + text-decoration:none; +} + +a:hover{ + color:#3F94EB; +} + diff --git a/app/assets/stylesheets/qi/qi.scss b/app/assets/stylesheets/qi/qi.scss new file mode 100644 index 0000000..8df9742 --- /dev/null +++ b/app/assets/stylesheets/qi/qi.scss @@ -0,0 +1,52 @@ +.QI_background_middle { + background-color: #e2eef7; } + +.QI_background_middle_alt1 { + background-color: #a9d64b; } + +.QI_padding_small { + padding: 5px; } + +.QI_padding { + padding: 10px; } + +.QI_table_alternate_alt1 tr:nth-child(odd) { + background-color: #ebf4fa; } + +.QI_background_resize { + background-position: center center; + background-repeat: no-repeat; + background-size: contain; + -moz-background-size: contain; + -webkit-background-size: contain; } + +.QI_box_shadow { + -webkit-box-shadow: #AFAFAF 0px 0px 5px; + -moz-box-shadow: #AFAFAF 0px 0px 5px; + box-shadow: #AFAFAF 0px 0px 5px; } + +.QI_font_alt1 { + font-family: Georgia; } + +.QI_font { + font-family: Lucida grande; } + +.QI_color_white { + color: white; } + + + +.bar_transparent_dark{ + background:rgba(0,0,0,0.8); + + height:34px; + +} + +.position_absolute_bottom{ + position:absolute; + bottom:0px; + right:0px; + left:0px; + +} diff --git a/app/controllers/admin/admins_controller.rb b/app/controllers/admin/admins_controller.rb new file mode 100644 index 0000000..ce1da70 --- /dev/null +++ b/app/controllers/admin/admins_controller.rb @@ -0,0 +1,110 @@ +# -*- encoding : utf-8 -*- +class Admin::AdminsController < ApplicationController + before_filter :authenticate_admin! + layout "admin" + + navigation :admins + + + def index + + + @breadcrumb = ["liste des administrateurs"] + + @order = magick_order("email", "DESC") + + @admins = Admin.order(@order).page(magick_page()).per(magick_per_page()) + + if @admins.num_pages.to_i < magick_page().to_i + params[:page] = @admins.num_pages + @admins = Admin.order(@order).page(magick_page()).per(magick_per_page()) + end + + end + +def show +@admin = Admin.find(params[:id]) + +respond_to do |format| +format.html +end +end + + + def new + @breadcrumb = [["liste des administrateurs", admin_admins_path],"Ajouter un administrateur"] + @admin = Admin.new + + respond_to do |format| + + format.js + end + end + + def edit + @breadcrumb = [["liste des administrateurs", admin_admins_path],"Modifier un administrateur"] + @admin = Admin.find(params[:id]) + end + + + def create + @admin = Admin.new(params[:admin]) + + respond_to do |format| + if @admin.save + flash[:notice] = "L'administrateur "+@admin.email.to_s+" à été ajouté avec succès." + format.html { redirect_to(admin_admins_path) } + format.js + else + format.html { render :action => "new" } + format.js { render :action => "new" } + end + end + end + + def update + @breadcrumb = [["liste des administrateurs", admin_admins_path],"Modifier un administrateur"] + + @admin = Admin.find(params[:id]) + + if params[:admin][:password] == "" + params[:admin].delete(:password) + params[:admin].delete(:password_confirmation) + end + + respond_to do |format| + if @admin.update_attributes(params[:admin]) + + flash[:notice] = "L'administrateur "+@admin.email.to_s+" à été modifié avec succès." + format.html { redirect_to(admin_admins_path) } + format.js + else + format.html { render :action => "edit" } + format.js { render :action => "edit" } + end + end + end + + + def destroy + @admin = Admin.find(params[:id]) + + if @admin == current_admin + respond_to do |format| + format.html { + redirect_to(admin_admins_url, :alert => "Vous ne pouvez pas supprimer l'administrateur actuellement connecté.") + } + end + else + @admin.destroy + + respond_to do |format| + format.html { + redirect_to(admin_admins_url, :notice => "L'utilisateur "+@admin.email.to_s+" à bien été supprimé.") + } + end + + end + + end +end diff --git a/app/controllers/admin/albums_controller.rb b/app/controllers/admin/albums_controller.rb new file mode 100644 index 0000000..2a92a79 --- /dev/null +++ b/app/controllers/admin/albums_controller.rb @@ -0,0 +1,49 @@ +# -*- encoding : utf-8 -*- +class Admin::AlbumsController < ApplicationController + load_and_authorize_resource + + def index + @albums = Album.all(:order => :name) + end + + def new + @album = Album.new() + end + + def create + @album = Album.new(params[:album]) + @album_create = true + + if @album.save + @albums = Album.all(:order => :name) + else + render :action => :new + + end + end + + def edit + @album = Album.find(params[:id]) + end + + def update + @album = Album.find(params[:id]) + @album_update = true + + if @album.update_attributes(params[:album]) + @albums = Album.all(:order => :name) + flash[:notice] = "L'album a bien été renomé." + else + render :action => :edit + + end + end + + def destroy + @album = Album.find(params[:id]) + if @album.id != 1 + @album.delete + end + end + +end diff --git a/app/controllers/admin/blocks_controller.rb b/app/controllers/admin/blocks_controller.rb new file mode 100644 index 0000000..0ef510e --- /dev/null +++ b/app/controllers/admin/blocks_controller.rb @@ -0,0 +1,56 @@ +# -*- encoding : utf-8 -*- +class Admin::BlocksController < ApplicationController + before_filter :authenticate_admin! + load_and_authorize_resource + + layout "admin" + + + def index + + + + end + + def new + + + + end + + + def edit + @block = Block.find(params[:id]) + if request.xhr? + render :layout => false + end + + end + +def show + @block = Block.find(params[:id]) + + if request.xhr? + render :layout => false + end + + end + + def create + + end + + def update + + + end + + def destroy + + + end + + + + +end diff --git a/app/controllers/admin/cibles_controller.rb b/app/controllers/admin/cibles_controller.rb new file mode 100644 index 0000000..5f572ba --- /dev/null +++ b/app/controllers/admin/cibles_controller.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class Admin::CiblesController < ApplicationController + before_filter :authenticate_admin! + + + def new + @resource = params[:resource_type].to_s.constantize.new() + + @resource.cible = params[:cible_type].to_s.constantize.new() + + if params[:resource_type] == "LinkContent" + @namespace = :portlet + else + @namespace = :admin + end + + end + +end diff --git a/app/controllers/admin/dashboard_controller.rb b/app/controllers/admin/dashboard_controller.rb new file mode 100644 index 0000000..0077a12 --- /dev/null +++ b/app/controllers/admin/dashboard_controller.rb @@ -0,0 +1,12 @@ +# -*- encoding : utf-8 -*- +class Admin::DashboardController < ApplicationController + navigation :dahsboard + before_filter :authenticate_admin! + + + layout "admin" + + def index + end + +end diff --git a/app/controllers/admin/data_files_controller.rb b/app/controllers/admin/data_files_controller.rb new file mode 100644 index 0000000..259944e --- /dev/null +++ b/app/controllers/admin/data_files_controller.rb @@ -0,0 +1,60 @@ +# -*- encoding : utf-8 -*- + class Admin::DataFilesController < ApplicationController + before_filter :authenticate_admin! + # load_and_authorize_resource + + layout "admin" + navigation :data_files + def index + params[:file_folder_id] = params[:file_folder_id] || 1 + + @file_folder = FileFolder.find(params[:file_folder_id]) + @file_folders = FileFolder.all(:order => :name) + @data_files = DataFile.all(:order => "created_at DESC", :conditions => {:file_folder_id => @file_folder.id}) + @data_file = DataFile.new(:file_folder_id => @file_folder.id) + if request.xhr? + render :layout => false + end + end + + def new + end + + def edit + end + + def create + @data_file_create = true + @data_file = DataFile.new(:name => params[:data_file][:name], :file_folder_id => params[:data_file][:file_folder_id], :file =>params[:data_file][:file][0]) + + if @data_file.save + + else + + end + + + end + + def update + @data_file = DataFile.find(params[:id]) + if @data_file.update_attributes(params[:data_file]) + + else + + end + end + + def destroy + @data_file = DataFile.find(params[:id]) + @data_file.destroy + + flash[:notice] = "Le fichier à bien été supprimée." + end + + def show + @data_file = DataFile.find(params[:id]) + + end + +end diff --git a/app/controllers/admin/file_folders_controller.rb b/app/controllers/admin/file_folders_controller.rb new file mode 100644 index 0000000..e2c0787 --- /dev/null +++ b/app/controllers/admin/file_folders_controller.rb @@ -0,0 +1,50 @@ +# -*- encoding : utf-8 -*- +class Admin::FileFoldersController < ApplicationController + before_filter :authenticate_admin! + load_and_authorize_resource + + + def index + @file_folders = FileFolder.all(:order => :name) + end + + def new + @file_folder = FileFolder.new() + end + + def create + @file_folder = FileFolder.new(params[:file_folder]) + @file_folder_create = true + + if @file_folder.save + @file_folders = FileFolder.all(:order => :name) + else + render :action => :new + + end + end + + def edit + @file_folder = FileFolder.find(params[:id]) + end + + def update + @file_folder = FileFolder.find(params[:id]) + @file_folder_update = true + + if @file_folder.update_attributes(params[:file_folder]) + @file_folders = FileFolder.all(:order => :name) + else + render :action => :edit + + end + end + + def destroy + @file_folder = FileFolder.find(params[:id]) + if @file_folder.id != 1 + @file_folder.delete + end + end + +end diff --git a/app/controllers/admin/folders_controller.rb b/app/controllers/admin/folders_controller.rb new file mode 100644 index 0000000..bac8359 --- /dev/null +++ b/app/controllers/admin/folders_controller.rb @@ -0,0 +1,80 @@ +# -*- encoding : utf-8 -*- +class Admin::FoldersController < ApplicationController + before_filter :authenticate_admin! + load_and_authorize_resource + + layout "admin" + + navigation :folders + + + def index + @folders = Folder.all + end + + def new + current_navigation :new_folders + @folder = Folder.new + end + + def create + current_navigation :new_folders + + @folder = Folder.new(params[:folder]) + + if @folder.save + @folders = Folder.all + flash[:notice] = "Le dossier à bien été créé." + + respond_to do |format| + format.html { redirect_to(admin_folders_path()) } + format.js + end + + else + + respond_to do |format| + format.html { render :action => :new} + format.js { render :action => :new} + end + + end + end + + + def edit + current_navigation :edit_folders + + @folder = Folder.find(params[:id]) + + end + + def update + current_navigation :edit_folders + + @folder = Folder.find(params[:id]) + + if @folder.update_attributes(params[:folder]) + flash[:notice] = "Le dossier à bien été modifié." + + respond_to do |format| + format.html { redirect_to(admin_folders_path()) } + format.js + end + + else + respond_to do |format| + format.html { render :action => :edit} + format.js { render :action => :edit} + end + end + end + + + def destroy + @folder = Folder.find(params[:id]) + @folder.destroy + + flash[:notice] = "Le dossier à bien été supprimé." + end +end diff --git a/app/controllers/admin/foyers_controller.rb b/app/controllers/admin/foyers_controller.rb new file mode 100644 index 0000000..03dfb75 --- /dev/null +++ b/app/controllers/admin/foyers_controller.rb @@ -0,0 +1,126 @@ +# -*- encoding : utf-8 -*- + +class Admin::FoyersController < ApplicationController + before_filter :authenticate_admin! + + + layout "admin" + navigation :foyers + + + def index + @foyers = Foyer.order('surname ASC') + if request.xhr? + render :layout => false + + end + end + + def new + + + @foyer = Foyer.new() + end + + def create + + @foyers = Foyer.order('surname ASC') + @foyer = Foyer.new(params[:foyer]) + + + if @foyer.save + flash[:notice] = "Le foyer à bien été créé." + + respond_to do |format| + format.js + end + + else + + respond_to do |format| + format.js { render :action => :new} + end + + end + end + + + def edit + + + @foyer = Foyer.find(params[:id]) + + + end + + def update + + + @foyer = Foyer.find(params[:id]) + + if @foyer.update_attributes(params[:foyer]) + flash[:notice] = "Le foyer à bien été modifié." + + respond_to do |format| + format.html { redirect_to(admin_foyers_path()) } + format.js + end + + else + respond_to do |format| + format.html { render :action => :edit} + format.js { render :action => :edit} + end + end + end + + + def destroy + @foyer = Foyer.find(params[:id]) + @foyer.destroy + + + flash[:notice] = "Le foyer à bien été supprimé." + end + def import + if params[:dump] and params[:dump][:file] + require 'csv' + require 'iconv' + + Foyer.destroy_all + + @parsed_file=CSV.parse(Iconv.conv('utf-8', 'ISO-8859-1', params[:dump][:file].read),:col_sep => ';') + #@parsed_file=CSV::Reader.parse(params[:dump][:file], ';') + @parsed_file.each do |row| + if row[19] == "LYCEE PIERRE BEGHIN" + + + + if Foyer.find_by_fcpe_id(row[0]) + @foyer = Foyer.find_by_fcpe_id(row[0]) + else + @foyer = Foyer.new( + :fcpe_id => row[0], + :surname => row[1], + :name => row[2], + :email => row[8], + :city => row[6].to_s+" "+row[7].to_s + + ) + @foyer.save + end + + @foyer.studients << Studient.create(:surname => row[17], :name => row[18], :classe => row[20].to_s+" "+row[21].to_s) + + end + end + redirect_to :back, :alert => "Le nouveau fichier à bien été importé." + else + redirect_to :back, :alert => "Aucun fichier n'a été séléctionner." + end + end + + def import_validation + end + +end diff --git a/app/controllers/admin/image_files_controller.rb b/app/controllers/admin/image_files_controller.rb new file mode 100644 index 0000000..8f0936d --- /dev/null +++ b/app/controllers/admin/image_files_controller.rb @@ -0,0 +1,59 @@ +# -*- encoding : utf-8 -*- + class Admin::ImageFilesController < ApplicationController + before_filter :authenticate_admin! + layout "admin" + navigation :image_files + + def index + params[:album_id] = params[:album_id] || 1 + + @album = Album.find(params[:album_id]) + @albums = Album.all(:order => :name) + @image_files = ImageFile.all(:order => "created_at DESC", :conditions => {:album_id => @album.id}) + @image_file = ImageFile.new(:album_id => @album.id) + if request.xhr? + render :layout => false + end + end + + def new + end + + def edit + end + + def create + @image_file_create = true + @image_file = ImageFile.new(:name => params[:image_file][:name], :album_id => params[:image_file][:album_id], :file =>params[:image_file][:file][0]) + + if @image_file.save + + else + + end + + + end + + def update + @image_file = ImageFile.find(params[:id]) + if @image_file.update_attributes(params[:image_file]) + + else + + end + end + + def destroy + @image_file = ImageFile.find(params[:id]) + @image_file.destroy + + flash[:notice] = "L'image à bien été supprimée." + end + + def show + @image_file = ImageFile.find(params[:id]) + + end + +end diff --git a/app/controllers/admin/menu_aliases_controller.rb b/app/controllers/admin/menu_aliases_controller.rb new file mode 100644 index 0000000..24b6ccd --- /dev/null +++ b/app/controllers/admin/menu_aliases_controller.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class Admin::MenuAliasesController < ApplicationController + + before_filter :authenticate_admin! + load_and_authorize_resource + + +def edit + + end + + def update + end + +end diff --git a/app/controllers/admin/menu_items_controller.rb b/app/controllers/admin/menu_items_controller.rb new file mode 100644 index 0000000..c016953 --- /dev/null +++ b/app/controllers/admin/menu_items_controller.rb @@ -0,0 +1,174 @@ +# -*- encoding : utf-8 -*- +class Admin::MenuItemsController < ApplicationController + before_filter :authenticate_admin! + #load_and_authorize_resource + + layout "admin" + navigation :menu_items + + + def index + + + + if params[:menu_id] and params[:menu_id] != "" and @menu = Menu.find(params[:menu_id]) + + + params[:parent_id] = nil if !params[:parent_id] + + @menu_parent = MenuItem.find(params[:parent_id]) if params[:parent_id] + + + + @order = "position ASC" + + @menu_items = @menu.menu_items.where(:parent_id => params[:parent_id]).order(@order).page(magick_page()).per(magick_per_page()) + + if @menu_items.num_pages.to_i < magick_page().to_i + params[:page] = @menu_items.num_pages + @menu_items = @menu.menu_items.where(:parent_id => params[:parent_id]).order(@order).page(magick_page()).per(magick_per_page()) + end + + + + + else + redirect_to admin_root_path, :alert => "Un menu doit être séléctionné." + end + end + + def new + current_navigation :new_menu_items + + + @menu_item = MenuItem.new(:menu_id => params[:menu_id],:parent_id => params[:parent_id]) + + params[:menu_item_content_type] = "Page" if !params[:menu_item_content_type] + + @content = params[:menu_item_content_type].constantize.new() + @menu_item.menu_content = @content + + + + + end + + def create + + current_navigation :new_menu_items + params_content = params[:menu_item].delete(:menu_content_attributes) + content_type = params[:menu_item][:menu_content_type] + + puts params[:menu_item][:menu_content_type] + + @menu_item= MenuItem.new(params[:menu_item]) + content = content_type.constantize.new(params_content) + + @menu_item.menu_content = content + + + + respond_to do |format| + if @menu_item.save + MenuItem.all.each do |mi| + mi.set_permalink + end + + flash[:notice] = "Le menu à été ajouté avec succès." + format.html { + redirect_to(admin_menu_items_path(:menu_id => @menu_item.menu_id, :parent_id => @menu_item.parent_id)) + } + + else + format.html { render :action => "new" } + end + end + + end + + def edit + current_navigation :edit_menu_items + @menu_item= MenuItem.find(params[:id]) + + end + + def update + current_navigation :edit_menu_items + @menu_item= MenuItem.find(params[:id]) + + @menu = @menu_item.menu + + if request.xhr? + @menu_parent = @menu_item.parent if @menu_item.parent + @menu_items = MenuItem.where(:parent_id => @menu_item.parent_id, :menu_id => @menu_item.menu_id).order(:position) + end + + if params[:menu_item][:parent_id] and params[:menu_item][:parent_id] == "no-menu-selected" + @menu_item.parent_id = nil + @menu_item.save + params[:menu_item].delete(:parent_id) + + end + + @reorder = true if params[:reorder] + + + + + + + + respond_to do |format| + if @menu_item.update_attributes(params[:menu_item]) + puts "TEST" + MenuItem.all.each do |mi| + mi.set_permalink + + end + + flash[:notice] = "Le menu à été modifié avec succès." + format.html { redirect_to(admin_menu_items_path(:parent_id => @menu_item.parent_id, :menu_id => @menu_item.menu_id)) } + if @reorder + format.js { + + render :action => "update" } + else + format.js { + + render :action => "show" } + end + else + + flash[:alert] = "Cet élément de menu n'a pas pu être déplacé. Vérifiez que sont lien permanent n'éxiste pas déjà dans l'élément cible." + if @reorder + format.js { render :action => "update_reorder_failled" } + else + format.html { render :action => "edit" } + format.js { render :action => "edit" } + end + + + end + end + + end + + def destroy + @menu_item = MenuItem.find(params[:id]) + @menu_item.destroy + flash[:notice] = "L'élément de menu a été supprimé avec succès." + respond_to do |format| + + + format.html { redirect_to(admin_menu_items_path(:menu_id => @menu_item.menu_id, :parent_id => @menu_item.parent_id)) } + format.js + + + end + end + + def show + @menu_item= MenuItem.find(params[:id]) + end + +end diff --git a/app/controllers/admin/menu_urls_controller.rb b/app/controllers/admin/menu_urls_controller.rb new file mode 100644 index 0000000..bd1ece5 --- /dev/null +++ b/app/controllers/admin/menu_urls_controller.rb @@ -0,0 +1,14 @@ +# -*- encoding : utf-8 -*- +class Admin::MenuUrlsController < ApplicationController + before_filter :authenticate_admin! + load_and_authorize_resource + +def edit + + + end + + def update + end + +end diff --git a/app/controllers/admin/menus_controller.rb b/app/controllers/admin/menus_controller.rb new file mode 100644 index 0000000..baee041 --- /dev/null +++ b/app/controllers/admin/menus_controller.rb @@ -0,0 +1,80 @@ +# -*- encoding : utf-8 -*- +class Admin::MenusController < ApplicationController + before_filter :authenticate_admin! + layout "admin" + + before_filter :authenticate_admin! + load_and_authorize_resource + + + def index + @breadcrumb = ["liste des menus"] + + @order = magick_order("name", "ASC") + + @menus = Menu.order(@order).page(magick_page()).per(magick_per_page()) + + if @menus.num_pages.to_i < magick_page().to_i + params[:page] = @menus.num_pages + @menus = Menu.order(@order).page(magick_page()).per(magick_per_page()) + end + + end + + def show + end + + def new + @breadcrumb = [["liste des menus", admin_menus_path],"Ajouter un menu"] + @menu = Menu.new + + end + + def create + @breadcrumb = [["liste des menus", admin_menus_path],"Ajouter un menu"] + @menu = Menu.new(params[:menu]) + + respond_to do |format| + if @menu.save + flash[:notice] = "Le menu à été ajouté avec succès." + format.html { redirect_to(admin_menus_path) } + else + format.html { render :action => "new" } + end + end + end + + def edit + @breadcrumb = [["liste des menus", admin_menus_path],"Modifier un menu"] + @menu = Menu.find(params[:id]) + + + end + + def update + @breadcrumb = [["liste des menus", admin_menus_path],"Modifier un menu"] + @menu = Menu.find(params[:id]) + respond_to do |format| + if @menu.update_attributes(params[:menu]) + + flash[:notice] = "Le menu à été modifié avec succès." + format.html { redirect_to(admin_menus_path) } + else + format.html { render :action => "edit" } + end + end + end + + def destroy + @menu = Menu.find(params[:id]) + @menu.destroy + + respond_to do |format| + format.html { + redirect_to(admin_menus_url, :notice => "Le menu a bien été supprimé.") + } + end + + end + +end diff --git a/app/controllers/admin/newsletters_controller.rb b/app/controllers/admin/newsletters_controller.rb new file mode 100644 index 0000000..671db55 --- /dev/null +++ b/app/controllers/admin/newsletters_controller.rb @@ -0,0 +1,140 @@ +# -*- encoding : utf-8 -*- + +class Admin::NewslettersController < ApplicationController + before_filter :authenticate_admin! + + + layout "admin" + navigation :newsletters + + + def index + @newsletters = Newsletter.order('subject ASC') + if request.xhr? + render :layout => false + + end + end + + def new + + + @newsletter = Newsletter.new() + end + + def create + + @newsletter = Newsletter.new(params[:newsletter]) + + puts params[:newsletter][:subject] + if @newsletter.save + flash[:notice] = "La newsletter à bien été créé." + + respond_to do |format| + format.js + format.html{ redirect_to admin_newsletters_path} + end + + else + + respond_to do |format| + format.js { render :action => :new} + end + + end + end + + + def edit + + + @newsletter = Newsletter.find(params[:id]) + + + end + + def update + + + @newsletter = Newsletter.find(params[:id]) + + if @newsletter.update_attributes(params[:newsletter]) + flash[:notice] = "La newsletter à bien été modifié." + + respond_to do |format| + format.html { redirect_to(admin_newsletters_path()) } + format.js + end + + else + respond_to do |format| + format.html { render :action => :edit} + format.js { render :action => :edit} + end + end + end + + + def destroy + @newsletter = Newsletter.find(params[:id]) + @newsletter.destroy + + + flash[:notice] = "La newsletter à bien été supprimé." + end + + + def send_test + + @newsletter = Newsletter.find(params[:id]) + @email = params[:email].to_s + + General.send_newsletter(@email,@newsletter.subject, @newsletter.content).deliver + + + + + + redirect_to(admin_newsletters_path, :notice => "La newsletter a bien été envoyée à l'email de test") + end + + def select_recipients + @newsletter = Newsletter.find(params[:id]) + if !params[:search] + params[:search] = {} + params[:search][:classe_in] = [''] + params[:search][:foyer_city_in] = [''] + end + params[:search].delete(:foyer_delegue_is_true) if params[:search][:foyer_delegue_is_true] and params[:search][:foyer_delegue_is_true] == 0 + @search = Studient.search(params[:search]) + @studients = @search.all + + respond_to do |format| + format.html + format.js + end + + + end + + def send_newsletter + @newsletter = Newsletter.find(params[:id]) + @i = 0 + if params[:confirmed_emails] + + params[:confirmed_emails].uniq.each do |email| + puts "mail envoyé à "+email.to_s + + General.send_newsletter(email,@newsletter.subject, @newsletter.content).deliver + @i +=1 + end + end + @newsletter.sended = true + @newsletter.send_at = Time.now + @newsletter.save + + redirect_to(admin_newsletters_path, :notice => "La newsletter a la séléction d'emails ("+@i.to_s+" envois.)") + end + + +end diff --git a/app/controllers/admin/pages_controller.rb b/app/controllers/admin/pages_controller.rb new file mode 100644 index 0000000..652484f --- /dev/null +++ b/app/controllers/admin/pages_controller.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class Admin::PagesController < ApplicationController + before_filter :authenticate_admin! + load_and_authorize_resource + + +def edit + @page = Page.find(params[:id]) + + end + + def update + end + +end diff --git a/app/controllers/admin/studients_controller.rb b/app/controllers/admin/studients_controller.rb new file mode 100644 index 0000000..5185d73 --- /dev/null +++ b/app/controllers/admin/studients_controller.rb @@ -0,0 +1,86 @@ +# -*- encoding : utf-8 -*- + +class Admin::StudientsController < ApplicationController + before_filter :authenticate_admin! + + + layout "admin" + navigation :studients + + + + + def new + + + @studient = Studient.new(:foyer_id => params[:foyer_id]) + end + + def create + + + @studient = Studient.new(params[:studient]) + + @studients = @studient.foyer.studients.order('name ASC') + + if @studient.save + flash[:notice] = "L'étudiant à bien été créé." + + respond_to do |format| + format.js + end + + else + + respond_to do |format| + format.js { render :action => :new} + end + + end + end + + + def edit + + + @studient = Studient.find(params[:id]) + + + end + + def update + + + @studient = Studient.find(params[:id]) + + if @studient.update_attributes(params[:studient]) + flash[:notice] = "L'étudiant à bien été modifié." + + respond_to do |format| + format.html { redirect_to(admin_studients_path()) } + format.js + end + + else + respond_to do |format| + format.html { render :action => :edit} + format.js { render :action => :edit} + end + end + end + + + def destroy + @studient = Studient.find(params[:id]) + @studient.destroy + + + flash[:notice] = "L'étudiant à bien été supprimé." + end + def import + end + + def import_validation + end + +end diff --git a/app/controllers/admins/passwords_controller.rb b/app/controllers/admins/passwords_controller.rb new file mode 100644 index 0000000..b0ec010 --- /dev/null +++ b/app/controllers/admins/passwords_controller.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class Admins::PasswordsController < ::Devise::PasswordsController + layout "connexion" + + def create + self.resource = resource_class.send_reset_password_instructions(params[resource_name]) + + if resource.errors.empty? + set_flash_message :notice, :send_instructions + redirect_to new_session_path(resource_name) + else + @flash_i= {} + @flash_i[:alert] = "Aucun compte associé à cette adresse mail n'a été trouvé." + render_with_scope :new + end + end +end diff --git a/app/controllers/admins/sessions_controller.rb b/app/controllers/admins/sessions_controller.rb new file mode 100644 index 0000000..6324e4d --- /dev/null +++ b/app/controllers/admins/sessions_controller.rb @@ -0,0 +1,5 @@ +# -*- encoding : utf-8 -*- +class Admins::SessionsController < ::Devise::SessionsController + layout "connexion" + +end diff --git a/app/controllers/application_controller.rb b/app/controllers/application_controller.rb new file mode 100644 index 0000000..6352042 --- /dev/null +++ b/app/controllers/application_controller.rb @@ -0,0 +1,67 @@ +# -*- encoding : utf-8 -*- +#encoding: utf-8 + +class ApplicationController < ActionController::Base + protect_from_forgery +helper_method :magick_order, :magick_search, :to_my_log + +def magick_order(default_row, default_a_d, name="default") + session_order_name = (params[:controller]+"/"+params[:action]).to_slug.gsub('-','_')+"_"+name+"_magick_order" + + if params[:order] + + session[session_order_name] = [] + + session[session_order_name][1] = params[:order] + session[session_order_name][2] = params[:a_d] + + + + elsif session[session_order_name] + + params[:a_d] = session[session_order_name][2] + params[:order] = session[session_order_name][1] + else + params[:order] = default_row + params[:a_d] = default_a_d + end + + return params[:order]+" "+params[:a_d] +end + +def magick_per_page(per_page=20, name="defaut") + session_search_name = (params[:controller]+"/"+params[:action]).to_slug.gsub('-','_')+"_"+name+"_magick_per_page" + + if params[:per_page] + session[session_search_name] = params[:per_page] + elsif session[session_search_name] + params[:per_page] = session[session_search_name] + else + params[:per_page] = per_page + + end + end + + def magick_page(name="defaut") + session_search_name = (params[:controller]+"/"+params[:action]).to_slug.gsub('-','_')+"_"+name+"_magick_page" + + if params[:page] + session[session_search_name] = params[:page] + elsif session[session_search_name] + params[:page] = session[session_search_name] + + + + end + end + +def to_my_log(message) + #current_user.user_logs.create(:message => message) + end + + +def current_ability + @current_ability ||= Ability.new(current_admin) +end + +end diff --git a/app/controllers/download_data_files_controller.rb b/app/controllers/download_data_files_controller.rb new file mode 100644 index 0000000..369728a --- /dev/null +++ b/app/controllers/download_data_files_controller.rb @@ -0,0 +1,14 @@ +# -*- encoding : utf-8 -*- +class DownloadDataFilesController < ApplicationController + def index + end + + + + def show + @data_file = DataFile.find(params[:id]) + send_file @data_file.file.path, :filename => @data_file.abstract_file_name_slug #, :disposition => "inline" + end + + +end diff --git a/app/controllers/portlet/block_contents_controller.rb b/app/controllers/portlet/block_contents_controller.rb new file mode 100644 index 0000000..cf0b7af --- /dev/null +++ b/app/controllers/portlet/block_contents_controller.rb @@ -0,0 +1,111 @@ +# -*- encoding : utf-8 -*- +class Portlet::BlockContentsController < ApplicationController + layout "admin" + + def new + @block_content = BlockContent.new(:nbr_columns => 2) + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @block_content = BlockContent.new(params[:block_content]) + + respond_to do |format| + if @block_content.save + @block_content.nbr_columns.times do + @block = Block.new(:block_name => "") + @block.blockable = @block_content + @block.save + end + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @block_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @block_content = BlockContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @block_content = BlockContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @block_content.update_attributes(params[:block_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @block_content = BlockContent.find(params[:id]) + @block_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/break_contents_controller.rb b/app/controllers/portlet/break_contents_controller.rb new file mode 100644 index 0000000..e266eb9 --- /dev/null +++ b/app/controllers/portlet/break_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::BreakContentsController < ApplicationController + layout "admin" + + def new + @break_content = BreakContent.new(:line => true) + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @break_content = BreakContent.new(params[:break_content]) + + respond_to do |format| + if @break_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @break_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @break_content = BreakContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @break_content = BreakContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @break_content.update_attributes(params[:break_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @break_content = BreakContent.find(params[:id]) + @break_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/download_contents_controller.rb b/app/controllers/portlet/download_contents_controller.rb new file mode 100644 index 0000000..c8cea69 --- /dev/null +++ b/app/controllers/portlet/download_contents_controller.rb @@ -0,0 +1,109 @@ +# -*- encoding : utf-8 -*- +class Portlet::DownloadContentsController < ApplicationController + layout "admin" + + def new + @download_content = DownloadContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @download_content = DownloadContent.new(params[:download_content]) + + respond_to do |format| + if @download_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @download_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @download_content = DownloadContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @download_content = DownloadContent.find(params[:id]) + @portlet = @download_content.portlet + + respond_to do |format| + if @download_content.update_attributes(params[:download_content]) + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @download_content = DownloadContent.find(params[:id]) + @download_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/dynamic_contents_controller.rb b/app/controllers/portlet/dynamic_contents_controller.rb new file mode 100644 index 0000000..41bb45e --- /dev/null +++ b/app/controllers/portlet/dynamic_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::DynamicContentsController < ApplicationController + layout "admin" + + def new + @dynamic_content = DynamicContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @dynamic_content = DynamicContent.new(params[:dynamic_content]) + + respond_to do |format| + if @dynamic_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @dynamic_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @dynamic_content = DynamicContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @dynamic_content = DynamicContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @dynamic_content.update_attributes(params[:dynamic_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @dynamic_content = DynamicContent.find(params[:id]) + @dynamic_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/gallery_contents_controller.rb b/app/controllers/portlet/gallery_contents_controller.rb new file mode 100644 index 0000000..086f693 --- /dev/null +++ b/app/controllers/portlet/gallery_contents_controller.rb @@ -0,0 +1,109 @@ +# -*- encoding : utf-8 -*- +class Portlet::GalleryContentsController < ApplicationController + layout "admin" + + def new + @gallery_content = GalleryContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + + def create + @gallery_content = GalleryContent.new(params[:gallery_content]) + + respond_to do |format| + if @gallery_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @gallery_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @gallery_content = GalleryContent.find(params[:id]) + @portlet = @gallery_content.portlet + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @gallery_content = GalleryContent.find(params[:id]) + @portlet = @gallery_content.portlet + + respond_to do |format| + if @gallery_content.update_attributes(params[:gallery_content]) + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @gallery_content = GalleryContent.find(params[:id]) + @gallery_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/gallery_images_controller.rb b/app/controllers/portlet/gallery_images_controller.rb new file mode 100644 index 0000000..a3bb6a6 --- /dev/null +++ b/app/controllers/portlet/gallery_images_controller.rb @@ -0,0 +1,82 @@ +# -*- encoding : utf-8 -*- +class Portlet::GalleryImagesController < ApplicationController + layout "admin" + + + def reorder + i = 0 + params[:gallery_image].each do |gallery_image_id| + i += 1 + gallery_image = GalleryImage.find(gallery_image_id) + gallery_image.position = i + gallery_image.save + end + + end + + def create + + @gallery_content = GalleryContent.find(params[:gallery_content_id]) + @gallery_images = [] + if params[:image_file_ids].kind_of?(Array) + params[:image_file_ids].each do |image_file_id| + image_file = ImageFile.find(image_file_id) + gallery_image = GalleryImage.create(:image_file_id => image_file.id, :title => image_file.name, :description => image_file.description, :gallery_content_id => @gallery_content.id ) + + @gallery_images << gallery_image + end + end + + + + respond_to do |format| + + format.js + + end + end + + + + def edit + @gallery_image = GalleryImage.find(params[:id]) + + if request.xhr? + render :layout => false + end + + end + + + + + + def show + + + end + + def update + @gallery_image = GalleryImage.find(params[:id]) + respond_to do |format| + if @gallery_image.update_attributes(params[:gallery_image]) + + format.js + else + format.html { render :action => "edit", :layout => false} + format.js { render :action => "edit" } + end + + end + end + + def destroy + + @gallery_image = GalleryImage.find(params[:id]) + @gallery_image.destroy + + + end + + +end diff --git a/app/controllers/portlet/html_contents_controller.rb b/app/controllers/portlet/html_contents_controller.rb new file mode 100644 index 0000000..319dbff --- /dev/null +++ b/app/controllers/portlet/html_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::HtmlContentsController < ApplicationController + layout "admin" + + def new + @html_content = HtmlContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @html_content = HtmlContent.new(params[:html_content]) + + respond_to do |format| + if @html_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @html_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @html_content = HtmlContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @html_content = HtmlContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @html_content.update_attributes(params[:html_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @html_content = HtmlContent.find(params[:id]) + @html_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/image_contents_controller.rb b/app/controllers/portlet/image_contents_controller.rb new file mode 100644 index 0000000..8776b92 --- /dev/null +++ b/app/controllers/portlet/image_contents_controller.rb @@ -0,0 +1,100 @@ +# -*- encoding : utf-8 -*- +class Portlet::ImageContentsController < ApplicationController + layout "admin" + + def new + @image_content = ImageContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @image_content = ImageContent.new(params[:image_content]) + + respond_to do |format| + if @image_content.save + + + @portlet = Portlet.create(:content => @image_content) + + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @image_content = ImageContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @image_content = ImageContent.find(params[:id]) + @portlet = @image_content.portlet + + respond_to do |format| + if @image_content.update_attributes(params[:image_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @image_content = ImageContent.find(params[:id]) + @image_content.destroy + + + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/link_contents_controller.rb b/app/controllers/portlet/link_contents_controller.rb new file mode 100644 index 0000000..df07756 --- /dev/null +++ b/app/controllers/portlet/link_contents_controller.rb @@ -0,0 +1,131 @@ +# -*- encoding : utf-8 -*- +class Portlet::LinkContentsController < ApplicationController + layout "admin" + + def new + @link_content = LinkContent.new + + + + params[:link_content_cible_type] = "CibleUrl" if !params[:link_content_cible_type] + + @cible = params[:link_content_cible_type].constantize.new() + @link_content.cible = @cible + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + + + params_cible = params[:link_content].delete(:cible_attributes) + cible_type = params[:link_content][:cible_type] + + @link_content = LinkContent.new(params[:link_content]) + + + cible = cible_type.constantize.new(params_cible) + + @link_content.cible = cible + + respond_to do |format| + if @link_content.save + + + @portlet = Portlet.create(:content => @link_content) + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @link_content = LinkContent.find(params[:id]) + @portlet = @link_content.portlet + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @link_content = LinkContent.find(params[:id]) + @portlet = @link_content.portlet + + + + params_cible = params[:link_content].delete(:cible_attributes) + cible_type = params[:link_content][:cible_type] + + + if !(params[:link_content][:cible_id] and params[:link_content][:cible_id] != "") + cible = cible_type.constantize.new(params_cible) + @link_content.cible = cible + end + + + + + + + respond_to do |format| + if @link_content.update_attributes(params[:link_content]) + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @link_content = LinkContent.find(params[:id]) + @link_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/map_contents_controller.rb b/app/controllers/portlet/map_contents_controller.rb new file mode 100644 index 0000000..5e96f23 --- /dev/null +++ b/app/controllers/portlet/map_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::MapContentsController < ApplicationController + layout "admin" + + def new + @map_content = MapContent.new(:zoom => 12, :view => 1) + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @map_content = MapContent.new(params[:map_content]) + + respond_to do |format| + if @map_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @map_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @map_content = MapContent.find(params[:id]) + @portlet = @map_content.portlet + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @map_content = MapContent.find(params[:id]) + @portlet = @map_content.portlet + + respond_to do |format| + if @map_content.update_attributes(params[:map_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @map_content = MapContent.find(params[:id]) + @map_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/portlets_controller.rb b/app/controllers/portlet/portlets_controller.rb new file mode 100644 index 0000000..9450a2f --- /dev/null +++ b/app/controllers/portlet/portlets_controller.rb @@ -0,0 +1,122 @@ +# -*- encoding : utf-8 -*- +class Portlet::PortletsController < ApplicationController + layout "admin" + + + + def new + @portlet = Portlet.new(:block_id => params[:block_id]) + + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js + end + + end + + + def show + @portlet = Portlet.find(params[:id]) + end + + + + def edit + @portlet = Portlet.find(params[:id]) + if request.xhr? + render :layout => false + end + end + + + + def update + @portlet = Portlet.find(params[:id]) + + flash[:notice] = "Le contenu à été mis à jour avec succès." + if @portlet.update_attributes(params[:portlet]) + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s) + end + end + render :action => "update" + + else + render :action => "edit" + end + + + + + end + + def destroy + @portlet = Portlet.find(params[:id]) + @portlet.destroy + flash[:notice] = "Le contenu à été supprimé avec succès." + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + end + end + + def ajax_create + @t = params[:type] + if @t == "Title" + @content = TitleContent.new() + elsif @t == "Text" + @content = TextContent.new() + elsif @t == "Image" + @content = ImageContent.new() + elsif @t == "Gallery" + @content = GalleryContent.new() + elsif @t == "Link" + @content = LinkContent.new() + elsif @t == "Break" + @content = BreakContent.new() + elsif @t == "Html" + @content = HtmlContent.new() + elsif @t == "Download" + @content = DownloadContent.new() + elsif @t == "DynamicContent" + @content = DynamicContent.new() + end + @portlet = Portlet.new(:block_id => params[:block_id]) + @content.portlets << @portlet + @content.save! + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + end + flash[:notice] = "Le contenu à été créé avec succès." + end + + def reorder + + params[:blocks].each do |index, block| + + block_id = block["block_id"].to_i + i = 0 + if block["block_portlet_ids"].kind_of?(Array) + block["block_portlet_ids"].each do |portlet_id| + i += 1 + Portlet.find(portlet_id.to_i).update_attributes(:position => i, :block_id => block_id) + end + end + + end + + render :inline => "ok" + + end +end diff --git a/app/controllers/portlet/table_cols_controller.rb b/app/controllers/portlet/table_cols_controller.rb new file mode 100644 index 0000000..f623bcf --- /dev/null +++ b/app/controllers/portlet/table_cols_controller.rb @@ -0,0 +1,35 @@ +# -*- encoding : utf-8 -*- +class Portlet::TableColsController < ApplicationController + def create + + @table_content = TableContent.find(params[:table_content_id]) + + @table_content.table_rows.each do |table_row| + CelTable.create( :position => params[:position], :table_row_id => table_row.id) + + + end + @table_content.nbr_cols = @table_content.nbr_cols + 1 + @table_content.save + end + + def update + end + + def destroy + @table_content = TableContent.find(params[:table_content_id]) + + + + + + CelTable.where(:table_row_id => @table_content.table_row_ids,:position => params[:id] ).each do |cel_table| + cel_table.destroy + + end + + @table_content.nbr_cols = @table_content.nbr_cols - 1 + @table_content.save + end + +end diff --git a/app/controllers/portlet/table_contents_controller.rb b/app/controllers/portlet/table_contents_controller.rb new file mode 100644 index 0000000..e90635e --- /dev/null +++ b/app/controllers/portlet/table_contents_controller.rb @@ -0,0 +1,108 @@ +# -*- encoding : utf-8 -*- +class Portlet::TableContentsController < ApplicationController + layout "admin" + + def new + @table_content = TableContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @table_content = TableContent.new(params[:table_content]) + + respond_to do |format| + if @table_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @table_content) + + + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @table_content = TableContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @table_content = TableContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @table_content.update_attributes(params[:table_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @table_content = TableContent.find(params[:id]) + @table_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/table_rows_controller.rb b/app/controllers/portlet/table_rows_controller.rb new file mode 100644 index 0000000..2e2f4cd --- /dev/null +++ b/app/controllers/portlet/table_rows_controller.rb @@ -0,0 +1,106 @@ +# -*- encoding : utf-8 -*- +class Portlet::TableRowsController < ApplicationController + layout "admin" + + def new + @title_content = TitleContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @table_row = TableRow.new(params[:table_row]) + + respond_to do |format| + if @table_row.save + + @table = @table_row.table_content + @table.nbr_cols.times do + cel_table = CelTable.new + @table_row.cel_tables << cel_table + end + nbr_past = @table.nbr_rows + @table.nbr_rows = nbr_past +1 + @table.save + + + @portlet = Portlet.find(@table.portlet.id) + + #format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js + else + #format.html { render :action => "new" } + #format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @title_content = TitleContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @title_content = TitleContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @title_content.update_attributes(params[:title_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + + @table_row = TableRow.find(params[:id]) + @table_content = @table_row.table_content + @table_row.destroy + + + respond_to do |format| + format.html {} + format.js + end + end + + +end diff --git a/app/controllers/portlet/text_contents_controller.rb b/app/controllers/portlet/text_contents_controller.rb new file mode 100644 index 0000000..66feebf --- /dev/null +++ b/app/controllers/portlet/text_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::TextContentsController < ApplicationController + layout "admin" + + def new + @text_content = TextContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @text_content = TextContent.new(params[:text_content]) + + respond_to do |format| + if @text_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @text_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @text_content = TextContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @text_content = TextContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @text_content.update_attributes(params[:text_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @text_content = TextContent.find(params[:id]) + @text_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/portlet/title_contents_controller.rb b/app/controllers/portlet/title_contents_controller.rb new file mode 100644 index 0000000..a8967d5 --- /dev/null +++ b/app/controllers/portlet/title_contents_controller.rb @@ -0,0 +1,116 @@ +# -*- encoding : utf-8 -*- +class Portlet::TitleContentsController < ApplicationController + layout "admin" + + def new + @title_content = TitleContent.new + + respond_to do |format| + format.html { + if request.xhr? + render :layout => false + end + } + format.js { render :template => "portlet/shared/new" } + end + end + + def create + @title_content = TitleContent.new(params[:title_content]) + + respond_to do |format| + if @title_content.save + + + @portlet = Portlet.create(:position => params[:position], :block_id => params[:block_id], :content => @title_content) + + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (ajout d'un portlet)") + end + end + + + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Elément ajouté avec succès.') } + format.js { render :template => "portlet/shared/create" } + else + format.html { render :action => "new" } + format.js { render :template => "portlet/shared/new" } + end + end + end + + def edit + @title_content = TitleContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + respond_to do |format| + format.html { + if request.xhr? + render :template => "portlet/shared/edit", :layout => false + end + } + format.js { render :template => "portlet/shared/edit" } + end + end + + + + + + def show + + + end + + def update + @title_content = TitleContent.find(params[:id]) + @portlet = Portlet.find(params[:portlet_id]) + + respond_to do |format| + if @title_content.update_attributes(params[:title_content]) + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (modification d'un portlet)") + end + end + + format.html { redirect_to([:admin, @portlet.block.blockable], :notice => 'Titre mis à jour.') } + format.js { render :template => "portlet/shared/update" } + else + format.html { render :action => "portlet/shared/edit" } + format.js { render :template => "portlet/shared/edit" } + end + + end + end + + def destroy + @portlet = Portlet.find(params[:portlet_id]) + @title_content = TitleContent.find(params[:id]) + @title_content.destroy + + if @portlet.block and @portlet.block.blockable + @portlet.block.blockable.updated_at = Time.now + @portlet.block.blockable.save + if @portlet.block.blockable_type == "Page" + + to_my_log("[Page_"+@portlet.block.blockable.id.to_s+"] "+"Modification de la page "+@portlet.block.blockable.title.to_s+" (suppression d'un portlet)") + end + end + + respond_to do |format| + format.html {} + format.js { render :template => "portlet/shared/destroy" } + end + end + + +end diff --git a/app/controllers/public/menu_items_controller.rb b/app/controllers/public/menu_items_controller.rb new file mode 100644 index 0000000..f05960c --- /dev/null +++ b/app/controllers/public/menu_items_controller.rb @@ -0,0 +1,46 @@ +# -*- encoding : utf-8 -*- +class Public::MenuItemsController < ApplicationController + + layout "public" + def show + @menu_item = MenuItem.find_by_permalink(params[:url]) + if @menu_item + + if !@menu_item.enabled + redirect_to "/404.html" + + elsif @menu_item.menu_content_type == "MenuAlias" + if @menu_item.menu_content.menu_item + redirect_to menu_item_path(:url => @menu_item.menu_content.menu_item_alias.permalink) + else + redirect_to "/404.html" + end + + + elsif @menu_item.menu_content_type == "Page" + + + @page = @menu_item.menu_content + + @title = @page.title + + + end + else + redirect_to "/", :notice => "La page que vous demandez n'a pas pu être trouvée.

Vous avez donc été redirigé sur notre page d'accueil" + + end + end + + def home + if MenuItem.find_by_slug("accueil") + + redirect_to "/pages/accueil.html" + + else + + render :file => "#{Rails.root}/public/404.html", :status => :not_found, :layout => false + end + end + +end diff --git a/app/helpers/admin/adherents_helper.rb b/app/helpers/admin/adherents_helper.rb new file mode 100644 index 0000000..0d7d0df --- /dev/null +++ b/app/helpers/admin/adherents_helper.rb @@ -0,0 +1,2 @@ +module Admin::AdherentsHelper +end diff --git a/app/helpers/admin/auto_load_div_helper.rb b/app/helpers/admin/auto_load_div_helper.rb new file mode 100644 index 0000000..aa38906 --- /dev/null +++ b/app/helpers/admin/auto_load_div_helper.rb @@ -0,0 +1,35 @@ +# -*- encoding : utf-8 -*- +module Admin::AutoLoadDivHelper + + def auto_load_div(url,div=nil) + + r = "" + + + rand = (rand(99999999999999)) + + + + + content = content_tag(:div, "", :id => rand.to_s) + + + content += content_tag(:div, image_tag('/quartz_admin/icons/load.gif'), :class => "loading") + content += content_tag(:div, "", :class => "ajax_load_content") + + javascript = "" + + content += raw(javascript) + + content_tag(:div, content, :"data-load" => true, :"data-url" => url, :id => div.to_s) + + + + end +end diff --git a/app/helpers/admin/icon_helper.rb b/app/helpers/admin/icon_helper.rb new file mode 100644 index 0000000..97698f0 --- /dev/null +++ b/app/helpers/admin/icon_helper.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +module Admin::IconHelper + + + def i(name,color=:gray_dark, size=16) + + image_tag(i_path(name,color,size)) + end + + def i_path(name,color=:gray_dark, size=16) + if size.kind_of?(Integer) + s = size.to_s+"x"+size.to_s + else + s = size.to_s + end + "/iconic/"+color.to_s+"/"+name.to_s+"_"+s+".png" + end + +end diff --git a/app/helpers/admin/javascripts_helper.rb b/app/helpers/admin/javascripts_helper.rb new file mode 100644 index 0000000..faae31b --- /dev/null +++ b/app/helpers/admin/javascripts_helper.rb @@ -0,0 +1,28 @@ +# -*- encoding : utf-8 -*- +module Admin::JavascriptsHelper + + def flash_notice() + if flash[:notice] + text = flash[:notice] + flash[:notice] = nil + return raw('flash_notice("'+escape_javascript(text)+'");') + end + end + + def flash_alert() + if flash[:alert] + text = flash[:alert] + flash[:alert] = nil + return raw('flash_alert("'+escape_javascript(text)+'");') + end + end + + def flashs() + r= flash_notice().to_s + r+= flash_alert().to_s + + return raw(r) + end + + +end diff --git a/app/helpers/admin/magick_order_helper.rb b/app/helpers/admin/magick_order_helper.rb new file mode 100644 index 0000000..edc27bb --- /dev/null +++ b/app/helpers/admin/magick_order_helper.rb @@ -0,0 +1,36 @@ +# -*- encoding : utf-8 -*- +module Admin::MagickOrderHelper + + + def a_d(test=params[:a_d]) + if test == "DESC" + "ASC" + else + "DESC" + end + + end + + + + def link_to_sort_results(text, row) + + new_params = {} + + + new_params[:order] = row + new_params[:a_d] = a_d + params.each do |p| + new_params[p[0].to_sym] = p[1] + end + new_params[:order] = row + new_params[:a_d] = a_d + #:page => (params[:page] if params[:page]) + + link_to( text, url_for(new_params ), :remote => true, :style => ("font-weight:bold" if row == params[:order])) + + end + + + +end diff --git a/app/helpers/admin/pagination_helper.rb b/app/helpers/admin/pagination_helper.rb new file mode 100644 index 0000000..6474b7e --- /dev/null +++ b/app/helpers/admin/pagination_helper.rb @@ -0,0 +1,40 @@ +# -*- encoding : utf-8 -*- +module Admin::PaginationHelper + + + def per_page_link(per_page) + new_params = {} + new_params.merge!(params) + new_params["per_page"] = per_page + link_to per_page, new_params, :remote => true + + end + + def per_page_links(per_page, items) + to_r = "" + + + nbrs = [5, 10, 20, 50 ] + + + max = ((items.to_i.to_f / 10).to_i*10)+10 + nbrs << max if !nbrs.include?(max) + nbrs_to_show = nbrs + nbrs_to_show.delete(per_page.to_i) + nbrs.sort.each do |nbr| + to_r += per_page_link(nbr) + end + to_r += "" + to_r += per_page.to_s + to_r += "" + to_r += " lignes/pages" + + raw(to_r) + end + + + + + + +end diff --git a/app/helpers/application_helper.rb b/app/helpers/application_helper.rb new file mode 100644 index 0000000..24a9642 --- /dev/null +++ b/app/helpers/application_helper.rb @@ -0,0 +1,3 @@ +# -*- encoding : utf-8 -*- +module ApplicationHelper +end diff --git a/app/helpers/public/menu_items_helper.rb b/app/helpers/public/menu_items_helper.rb new file mode 100644 index 0000000..1c84b1f --- /dev/null +++ b/app/helpers/public/menu_items_helper.rb @@ -0,0 +1,20 @@ +# -*- encoding : utf-8 -*- +module Public::MenuItemsHelper +def menu_item_link(menu_item) + link_to menu_item.name, menu_item_path(:url => menu_item.url), :class => ('active' if @menu_item and (@menu_item.id == menu_item.id or @menu_item.ancestors.include?(menu_item))) +end + +def lien_bouton(nbr,slug) + menu_item = MenuItem.find_by_slug( slug) + if menu_item + link_to "", menu_item_path(:url => menu_item.url) , :id => "button-"+nbr.to_s, :class => "digibutton", :"data-text" => menu_item.name + end + # page = Page.find_by_permanent_slug("bouton"+nbr.to_s) || nil +# if page +# link_to "", permalink(page) , :id => "button-"+nbr.to_s, :class => "digibutton", :"data-text" => page.title +# else +# link_to "", "" , :id => "button-"+nbr.to_s, :class => "digibutton", :"data-text" => "" +# end +end + +end diff --git a/app/mailers/.gitkeep b/app/mailers/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/app/mailers/general.rb b/app/mailers/general.rb new file mode 100644 index 0000000..4f78bde --- /dev/null +++ b/app/mailers/general.rb @@ -0,0 +1,15 @@ +class General < ActionMailer::Base + default :from => "secretaire@fcpe-lycee-moirans.fr" + self.default_url_options = {:host => HOSTNAME} + + + def send_newsletter(email,subject, newsletter) + @newsletter = newsletter + + mail(:to => email, :subject => subject) do |format| + format.html { render :action => "send_newsletter"} + end + end + + +end diff --git a/app/models/.gitkeep b/app/models/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/app/models/ability.rb b/app/models/ability.rb new file mode 100644 index 0000000..612fecc --- /dev/null +++ b/app/models/ability.rb @@ -0,0 +1,50 @@ +# -*- encoding : utf-8 -*- +class Ability + include CanCan::Ability + + def initialize(admin) + admin ||= Admin.new # guest user + can :manage, :all + + #if admin.super_admin? + # can :manage, :all + + #else + # puts "TESTs" + # + # if admin.is? :cms + # can :manage, [Article,Album,Block,Cible,DataFile,FileFolder,Folder,HomeBlock,Home,ImageFile,MenuAlias,MenuItem,MenuUrl,Menu,Page,Promotion,Slider,Slide] + # end + # if admin.is? :pharmacien + # + # can :manage, [Prescription] +# +# end +# end + + + +# Define abilities for the passed in user here. For example: + # + # user ||= User.new # guest user (not logged in) + # if user.admin? + # can :manage, :all + # else + # can :read, :all + # end + # + # The first argument to `can` is the action you are giving the user permission to do. + # If you pass :manage it will apply to every action. Other common actions here are + # :read, :create, :update and :destroy. + # + # The second argument is the resource the user can perform the action on. If you pass + # :all it will apply to every resource. Otherwise pass a Ruby class of the resource. + # + # The third argument is an optional hash of conditions to further filter the objects. + # For example, here the user can only update published articles. + # + # can :update, Article, :published => true + # + # See the wiki for details: https://github.com/ryanb/cancan/wiki/Defining-Abilities + end +end diff --git a/app/models/adherent.rb b/app/models/adherent.rb new file mode 100644 index 0000000..c26923e --- /dev/null +++ b/app/models/adherent.rb @@ -0,0 +1,2 @@ +class Adherent < ActiveRecord::Base +end diff --git a/app/models/authentification_admin/admin.rb b/app/models/authentification_admin/admin.rb new file mode 100644 index 0000000..25dcb63 --- /dev/null +++ b/app/models/authentification_admin/admin.rb @@ -0,0 +1,43 @@ +# -*- encoding : utf-8 -*- +class Admin < ActiveRecord::Base + + + devise :database_authenticatable, :recoverable, :rememberable, :trackable, :validatable + + attr_accessor :login + + attr_accessible :login, :username, :surname, :firstname, :email, :password, :password_confirmation, :roles_mask, :roles, :super_admin + + + validates :username, :presence => true, :uniqueness => true + + ROLES = %w[SuperAdmin] + + def super_admin? + true if self.is? :SuperAdmin + end + + + def roles=(roles) + self.roles_mask = (roles & ROLES).map { |r| 2**ROLES.index(r) }.sum + end + + def roles + ROLES.reject do |r| + ((roles_mask || 0) & 2**ROLES.index(r)).zero? + end + end + + def is?(role) + roles.include?(role.to_s) + end + + protected + + def self.find_for_database_authentication(warden_conditions) + conditions = warden_conditions.dup + login = conditions.delete(:login) + where(conditions).where(["username = :value OR email = :value", { :value => login }]).first + end + +end diff --git a/app/models/cible/cible_alias.rb b/app/models/cible/cible_alias.rb new file mode 100644 index 0000000..e41e50b --- /dev/null +++ b/app/models/cible/cible_alias.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CibleAlias < ActiveRecord::Base + include Rails.application.routes.url_helpers + belongs_to :menu_item + + + validates :menu_item_id, :presence => true + #has_one :link_content, :as => :cible + has_one :cibleable, :as => :cible + + + def url + if self.menu_item + menu_item_path(:url => self.menu_item.permalink) + end + + end + +end diff --git a/app/models/cible/cible_article.rb b/app/models/cible/cible_article.rb new file mode 100644 index 0000000..7c86830 --- /dev/null +++ b/app/models/cible/cible_article.rb @@ -0,0 +1,14 @@ +# -*- encoding : utf-8 -*- +class CibleArticle < ActiveRecord::Base + include Rails.application.routes.url_helpers + belongs_to :article + + + def url + if self.article and self.article.folder + article_path(:slug => self.article.slug, :folder_slug => self.article.folder.slug) + end + + end + +end diff --git a/app/models/cible/cible_folder.rb b/app/models/cible/cible_folder.rb new file mode 100644 index 0000000..08d47a0 --- /dev/null +++ b/app/models/cible/cible_folder.rb @@ -0,0 +1,13 @@ +# -*- encoding : utf-8 -*- +class CibleFolder < ActiveRecord::Base + include Rails.application.routes.url_helpers + belongs_to :folder + + + def url + if self.folder + folder_path(:slug => self.folder.slug) + end + + end +end diff --git a/app/models/cible/cible_type.rb b/app/models/cible/cible_type.rb new file mode 100644 index 0000000..c40505f --- /dev/null +++ b/app/models/cible/cible_type.rb @@ -0,0 +1,3 @@ +# -*- encoding : utf-8 -*- +class CibleType < ActiveRecord::Base +end diff --git a/app/models/cible/cible_url.rb b/app/models/cible/cible_url.rb new file mode 100644 index 0000000..564353a --- /dev/null +++ b/app/models/cible/cible_url.rb @@ -0,0 +1,5 @@ +# -*- encoding : utf-8 -*- +class CibleUrl < ActiveRecord::Base + validates :url, :presence => true + +end diff --git a/app/models/cms/allowed_block_content.rb b/app/models/cms/allowed_block_content.rb new file mode 100644 index 0000000..d642807 --- /dev/null +++ b/app/models/cms/allowed_block_content.rb @@ -0,0 +1,5 @@ +# -*- encoding : utf-8 -*- +class AllowedBlockContent < ActiveRecord::Base + belongs_to :block + belongs_to :content_type +end diff --git a/app/models/cms/block.rb b/app/models/cms/block.rb new file mode 100644 index 0000000..063802d --- /dev/null +++ b/app/models/cms/block.rb @@ -0,0 +1,14 @@ +# -*- encoding : utf-8 -*- +class Block < ActiveRecord::Base + + + belongs_to :blockable, :polymorphic => true + + has_many :portlets, :order => :position, :dependent => :destroy + accepts_nested_attributes_for :portlets + + +has_many :allowed_block_contents + +has_many :content_types, :through => :allowed_block_contents +end diff --git a/app/models/cms/content_type.rb b/app/models/cms/content_type.rb new file mode 100644 index 0000000..3ef55a8 --- /dev/null +++ b/app/models/cms/content_type.rb @@ -0,0 +1,3 @@ +# -*- encoding : utf-8 -*- +class ContentType < ActiveRecord::Base +end diff --git a/app/models/cms/page.rb b/app/models/cms/page.rb new file mode 100644 index 0000000..5a5313a --- /dev/null +++ b/app/models/cms/page.rb @@ -0,0 +1,28 @@ +# -*- encoding : utf-8 -*- +class Page < ActiveRecord::Base + + + has_one :menu_item, :as => :menu_content + + has_many :blocks, :as => :blockable, :dependent => :destroy + + + validates :title, :presence => true + + HUMAN_NAME = "Page" + + after_create :after_creation + + def after_creation + @block = Block.new(:block_name => "general") + @block.blockable = self + @block.save + + ContentType.all.each do |content_type| + @block.content_types << content_type + + end + + end + +end diff --git a/app/models/cms/portlet.rb b/app/models/cms/portlet.rb new file mode 100644 index 0000000..e24536a --- /dev/null +++ b/app/models/cms/portlet.rb @@ -0,0 +1,30 @@ +# -*- encoding : utf-8 -*- +class Portlet < ActiveRecord::Base + belongs_to :block + belongs_to :content, :polymorphic => true + accepts_nested_attributes_for :content + + attr_accessor :skip_before_update + + + + + + + + + before_create do + + end + + before_update do + + end + + before_destroy do + + + end + + +end diff --git a/app/models/cms/tag.rb b/app/models/cms/tag.rb new file mode 100644 index 0000000..2cc3c47 --- /dev/null +++ b/app/models/cms/tag.rb @@ -0,0 +1,7 @@ +# -*- encoding : utf-8 -*- +class Tag < ActiveRecord::Base + + before_validation do + self.slug = self.name.to_slug + end +end diff --git a/app/models/foyer.rb b/app/models/foyer.rb new file mode 100644 index 0000000..584f33a --- /dev/null +++ b/app/models/foyer.rb @@ -0,0 +1,4 @@ +class Foyer < ActiveRecord::Base + +has_many :studients, :dependent => :destroy +end diff --git a/app/models/manager/album.rb b/app/models/manager/album.rb new file mode 100644 index 0000000..2be406e --- /dev/null +++ b/app/models/manager/album.rb @@ -0,0 +1,5 @@ +# -*- encoding : utf-8 -*- +class Album < ActiveRecord::Base + validates :name, :presence => true, :uniqueness => true + +end diff --git a/app/models/manager/data_file.rb b/app/models/manager/data_file.rb new file mode 100644 index 0000000..6b212d9 --- /dev/null +++ b/app/models/manager/data_file.rb @@ -0,0 +1,33 @@ +# -*- encoding : utf-8 -*- +class DataFile < ActiveRecord::Base + belongs_to :file_folder + + + mount_uploader :file, FileUploader + + before_save do + if !self.name? + self.name = File.basename(self.file.filename, File.extname(self.file.filename)).to_s if self.file? + end + + end + + + + def file_type + + + mime = `file --mime -br "#{self.file.path}"`.strip.split(';')[0] + mime + + end + + def abstract_file_name + self.name+File.extname(self.file.to_s) + end + + def abstract_file_name_slug + self.name.to_slug+File.extname(self.file.to_s) + end + +end diff --git a/app/models/manager/file_folder.rb b/app/models/manager/file_folder.rb new file mode 100644 index 0000000..9e9b11b --- /dev/null +++ b/app/models/manager/file_folder.rb @@ -0,0 +1,3 @@ +# -*- encoding : utf-8 -*- +class FileFolder < ActiveRecord::Base +end diff --git a/app/models/manager/image_file.rb b/app/models/manager/image_file.rb new file mode 100644 index 0000000..f7fa496 --- /dev/null +++ b/app/models/manager/image_file.rb @@ -0,0 +1,29 @@ +# -*- encoding : utf-8 -*- +class ImageFile < ActiveRecord::Base + mount_uploader :file, ImageUploader + + before_save do + if !self.name? + self.name = File.basename(self.file.filename, File.extname(self.file.filename)).to_s if self.file? + end + + end + + before_validation do + if self.tags? + self.tags = self.tags.gsub(/ +?,/, ',') + self.tags = self.tags.gsub(/, +?/, ',') + self.tags = self.tags.gsub(/,/, ', ') + end + + end + + after_save do + tags_to_save = self.tags.to_s.split(',') + tags_to_save.each do |t| + name = t.to_s.strip + + Tag.find_or_create_by_name(t.to_s.strip) if name.size > 0 + end + end +end diff --git a/app/models/menus/menu.rb b/app/models/menus/menu.rb new file mode 100644 index 0000000..82e137d --- /dev/null +++ b/app/models/menus/menu.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class Menu < ActiveRecord::Base + + + #field :name, :type => String + #field :max_levels, :type => Integer + has_many :menu_items + + + validates_presence_of :name, :max_levels + validates_uniqueness_of :name + +# references_many :menu_items + +end diff --git a/app/models/menus/menu_alias.rb b/app/models/menus/menu_alias.rb new file mode 100644 index 0000000..ce85d09 --- /dev/null +++ b/app/models/menus/menu_alias.rb @@ -0,0 +1,13 @@ +# -*- encoding : utf-8 -*- +class MenuAlias < ActiveRecord::Base + belongs_to :menu_item_alias, :foreign_key => :menu_item_id, :class_name => "MenuItem" + + has_one :menu_item, :as => :menu_content + + validates :menu_item_id, :presence => true + + HUMAN_NAME = "Alias" + + + +end diff --git a/app/models/menus/menu_article.rb b/app/models/menus/menu_article.rb new file mode 100644 index 0000000..57fc71d --- /dev/null +++ b/app/models/menus/menu_article.rb @@ -0,0 +1,10 @@ +# -*- encoding : utf-8 -*- +class MenuArticle < ActiveRecord::Base + belongs_to :article + + + + HUMAN_NAME = "Article" + + +end diff --git a/app/models/menus/menu_folder.rb b/app/models/menus/menu_folder.rb new file mode 100644 index 0000000..e4c2c71 --- /dev/null +++ b/app/models/menus/menu_folder.rb @@ -0,0 +1,8 @@ +# -*- encoding : utf-8 -*- +class MenuFolder < ActiveRecord::Base + belongs_to :folder + + HUMAN_NAME = "Dossier" + + +end diff --git a/app/models/menus/menu_item.rb b/app/models/menus/menu_item.rb new file mode 100644 index 0000000..ce5c74d --- /dev/null +++ b/app/models/menus/menu_item.rb @@ -0,0 +1,180 @@ +# -*- encoding : utf-8 -*- +class MenuItem < ActiveRecord::Base + + belongs_to :menu_content, :polymorphic => true + belongs_to :menu + validates :name, :presence => true + validates :slug, :presence => true + + + attr_accessor :skip_before_update, :skip_permalink + + + accepts_nested_attributes_for :menu_content + + acts_as_tree + + def url + if menu_content + self.permalink + + else + "/404.html" + end + end + + before_validation do + self.slug = self.slug.to_slug + + end + + before_save do + #self.set_permalink + end + + def generate_permalink + r = "" + + node, ancestors = self, [] + ancestors << node = MenuItem.find(node.parent_id) while node.parent_id? + + + + ancestors.reverse.each do |ancestor| + r += ancestor.slug.to_s + r+= "/" + end + r+= self.slug.to_s + end + + def set_permalink + + + if !skip_permalink + + self.permalink = self.generate_permalink + self.skip_permalink = true + self.skip_before_update = true + + + + self.save + + + # self.children.each do |child| + # child.save + # end + end + + end + + + + def validate + self.parent_id = nil if self.parent_id == 0 + errors.add(:parent_id, 'doit être différent de la page actuelle') if parent_id == id and id != nil + + if self.id + errors.add(:parent_id, 'attention la page parente à pour page parente celle-ci = boucle') if self.parent_id and self.id == MenuItem.find(self.parent_id).parent_id + end + + conditions = ["menu_id = ? and parent_id "+(self.parent_id ? "=" : "IS")+" ? and slug = ? "+("and id != ?" if self.id).to_s, self.menu_id,self.parent_id ,self.slug] + conditions << self.id if self.id + if MenuItem.where(conditions).first + errors.add(:slug, 'est déjà utilisé') + + end + + end + + + + + + + before_create do + if !position + top = MenuItem.find(:first, :conditions =>{ :parent_id => self.parent_id, :menu_id => self.menu_id}, :order => "position DESC") + if top + self.position = top.position.to_i + 1 + else + self.position = 1 + end + end + if position + MenuItem.find(:all, :conditions => ["menu_id = ? and position >= ? and parent_id "+(self.parent_id ? "=" : "IS")+" ?",self.menu_id,self.position,self.parent_id]).each do |portlet| + portlet.position = portlet.position + 1 + portlet.skip_before_update = true + portlet.save! + end + end + end + + before_update do + if !skip_before_update + if self.parent_id_changed? + + MenuItem.find(:all, :conditions => ["menu_id = ? and position > ? and parent_id "+(self.changes['parent_id'][0] ? "=" : "IS")+" ?",self.menu_id,self.position,self.changes['parent_id'][0]]).each do |portlet| + portlet.position = portlet.position - 1 + portlet.skip_before_update = true + portlet.save! + end + + self.position = 1 + + MenuItem.find(:all, :conditions => ["menu_id = ? and parent_id "+(self.parent_id ? "=" : "IS")+" ?",self.menu_id,self.parent_id]).each do |portlet| + portlet.position = portlet.position + 1 + portlet.skip_before_update = true + portlet.save! + end + + + + + elsif self.position_changed? + + top = MenuItem.find(:first, :conditions =>{ :parent_id => self.parent_id, :menu_id => self.menu_id}, :order => "position DESC") + + if self.changes['position'][1] > self.changes['position'][0] + self.position = self.position - 1 + self.changes['position'][1] = self.changes['position'][1] - 1 + + MenuItem.find(:all, :conditions => ["menu_id = ? and position > ? and position <= ? and parent_id "+(self.parent_id ? "=" : "IS")+" ?",self.menu_id,self.changes['position'][0],self.changes['position'][1],self.parent_id]).each do |portlet| + portlet.position = portlet.position - 1 + portlet.skip_before_update = true + portlet.save! + end + + + + + #si la position est plus petite que l'ancienne. + elsif self.changes['position'][1] < self.changes['position'][0] + MenuItem.find(:all, :conditions => ["menu_id = ? and position >= ? and position < ? and parent_id "+(self.parent_id ? "=" : "IS")+" ?",self.menu_id,self.changes['position'][1],self.changes['position'][0],self.parent_id]).each do |portlet| + portlet.position = portlet.position + 1 + portlet.skip_before_update = true + portlet.save! + end + end + end + end + end + + before_destroy do + MenuItem.find(:all, :conditions => ["menu_id = ? and position > ? and parent_id "+(self.parent_id ? "=" : "IS")+" ?",self.menu_id,self.position,self.parent_id]).each do |portlet| + portlet.position = portlet.position - 1 + portlet.skip_before_update = true + portlet.save! + end + + end + + + + + + + + + +end diff --git a/app/models/menus/menu_item_content_type.rb b/app/models/menus/menu_item_content_type.rb new file mode 100644 index 0000000..c76101b --- /dev/null +++ b/app/models/menus/menu_item_content_type.rb @@ -0,0 +1,3 @@ +# -*- encoding : utf-8 -*- +class MenuItemContentType < ActiveRecord::Base +end diff --git a/app/models/menus/menu_url.rb b/app/models/menus/menu_url.rb new file mode 100644 index 0000000..c92081c --- /dev/null +++ b/app/models/menus/menu_url.rb @@ -0,0 +1,9 @@ +# -*- encoding : utf-8 -*- +class MenuUrl < ActiveRecord::Base + has_one :menu_item, :as => :menu_content + + validates :url, :presence => true + + HUMAN_NAME = "Lien externe" + +end diff --git a/app/models/newsletter.rb b/app/models/newsletter.rb new file mode 100644 index 0000000..a6d33cd --- /dev/null +++ b/app/models/newsletter.rb @@ -0,0 +1,2 @@ +class Newsletter < ActiveRecord::Base +end diff --git a/app/models/portlets/block_content.rb b/app/models/portlets/block_content.rb new file mode 100644 index 0000000..b726e18 --- /dev/null +++ b/app/models/portlets/block_content.rb @@ -0,0 +1,9 @@ +# -*- encoding : utf-8 -*- +class BlockContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + has_many :blocks, :as => :blockable, :dependent => :destroy + + validates :nbr_columns, :presence => true + + STYLES = []#[["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/break_content.rb b/app/models/portlets/break_content.rb new file mode 100644 index 0000000..5ccc09e --- /dev/null +++ b/app/models/portlets/break_content.rb @@ -0,0 +1,6 @@ +# -*- encoding : utf-8 -*- +class BreakContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + + STYLES = []#[["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/cel_table.rb b/app/models/portlets/cel_table.rb new file mode 100644 index 0000000..a223770 --- /dev/null +++ b/app/models/portlets/cel_table.rb @@ -0,0 +1,67 @@ +# -*- encoding : utf-8 -*- +class CelTable < ActiveRecord::Base + belongs_to :table_row + #belongs_to :table_content possible + + has_one :block, :as => :blockable, :dependent => :destroy + + attr_accessor :skip_before_update + + + + + before_create do + if !position + self.position = 1 + end + if position + CelTable.find(:all, :conditions => ["position >= ? and table_row_id = ?",self.position,self.table_row_id]).each do |cel_table| + cel_table.position = cel_table.position + 1 + cel_table.skip_before_update = true + cel_table.save! + end + end + + + + end + + after_create do + block = Block.create() + puts "CREATION DU BLOCK "+block.id.to_s + self.block = block + end + + before_update do + if !skip_before_update + if self.position_changed? + #si la position est plus grande que l'ancienne + if self.changes['position'][1] > self.changes['position'][0] + CelTable.find(:all, :conditions => ["position > ? and position <= ? and table_row_id = ?",self.changes['position'][0],self.changes['position'][1],self.table_row_id]).each do |cel_table| + cel_table.position = cel_table.position - 1 + cel_table.skip_before_update = true + cel_table.save! + end + end + #si la position est plus petite que l'ancienne. + if self.changes['position'][1] < self.changes['position'][0] + CelTable.find(:all, :conditions => ["position >= ? and position < ? and table_row_id = ?",self.changes['position'][1],self.changes['position'][0],self.table_row_id]).each do |cel_table| + cel_table.position = cel_table.position + 1 + cel_table.skip_before_update = true + cel_table.save! + end + end + end + end + end + + before_destroy do + CelTable.find(:all, :conditions => ["position > ? and table_row_id = ?",self.position,self.table_row_id]).each do |cel_table| + cel_table.position = cel_table.position - 1 + cel_table.skip_before_update = true + cel_table.save! + end + + end + +end diff --git a/app/models/portlets/download_content.rb b/app/models/portlets/download_content.rb new file mode 100644 index 0000000..b24e232 --- /dev/null +++ b/app/models/portlets/download_content.rb @@ -0,0 +1,9 @@ +# -*- encoding : utf-8 -*- +class DownloadContent < ActiveRecord::Base + belongs_to :data_file + + has_one :portlet, :as => :content, :dependent => :destroy + + STYLES = []#[["Medium","1"], ["Small","2"], ["Square","3"], ["Thumb","4"]] + +end diff --git a/app/models/portlets/dynamic_content.rb b/app/models/portlets/dynamic_content.rb new file mode 100644 index 0000000..95d5575 --- /dev/null +++ b/app/models/portlets/dynamic_content.rb @@ -0,0 +1,9 @@ +# -*- encoding : utf-8 -*- +class DynamicContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + + belongs_to :item + + NAMES = {"formulaire_ordonnances" => "Formulaire dépôt ordonnances", "folder_list" => "Liste des dossiers", "promotions-list" => "Liste des promotions"} + +end diff --git a/app/models/portlets/gallery_content.rb b/app/models/portlets/gallery_content.rb new file mode 100644 index 0000000..359259c --- /dev/null +++ b/app/models/portlets/gallery_content.rb @@ -0,0 +1,8 @@ +# -*- encoding : utf-8 -*- +class GalleryContent < ActiveRecord::Base + has_many :gallery_images, :order => :position + + has_one :portlet, :as => :content, :dependent => :destroy + + STYLES = []#[["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/gallery_image.rb b/app/models/portlets/gallery_image.rb new file mode 100644 index 0000000..5ade930 --- /dev/null +++ b/app/models/portlets/gallery_image.rb @@ -0,0 +1,7 @@ +# -*- encoding : utf-8 -*- +class GalleryImage < ActiveRecord::Base + belongs_to :image_file, :dependent => :destroy + belongs_to :gallery + +validates :title, :presence => true +end diff --git a/app/models/portlets/html_content.rb b/app/models/portlets/html_content.rb new file mode 100644 index 0000000..bf79de1 --- /dev/null +++ b/app/models/portlets/html_content.rb @@ -0,0 +1,6 @@ +# -*- encoding : utf-8 -*- +class HtmlContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + + STYLES = []#[["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/image_content.rb b/app/models/portlets/image_content.rb new file mode 100644 index 0000000..d813ca5 --- /dev/null +++ b/app/models/portlets/image_content.rb @@ -0,0 +1,8 @@ +# -*- encoding : utf-8 -*- +class ImageContent < ActiveRecord::Base + belongs_to :image_file + + has_one :portlet, :as => :content, :dependent => :destroy + STYLES = [["Taille moyenne","1"], ["Petite taille","2"], ["Petit carré","3"], ["Miniature","4"]] + ALIGNS = ["center", "left", "right"] +end diff --git a/app/models/portlets/link_content.rb b/app/models/portlets/link_content.rb new file mode 100644 index 0000000..4928766 --- /dev/null +++ b/app/models/portlets/link_content.rb @@ -0,0 +1,24 @@ +# -*- encoding : utf-8 -*- +class LinkContent < ActiveRecord::Base + belongs_to :item + + belongs_to :cible, :polymorphic => true + + has_one :portlet, :as => :content, :dependent => :destroy + + validates :name, :presence => true + + accepts_nested_attributes_for :cible + + def url + + if self.cible + cible.url + else + "" + end + + end + + STYLES = [["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/map_content.rb b/app/models/portlets/map_content.rb new file mode 100644 index 0000000..94ebbdb --- /dev/null +++ b/app/models/portlets/map_content.rb @@ -0,0 +1,12 @@ +# -*- encoding : utf-8 -*- +class MapContent < ActiveRecord::Base + + has_one :portlet, :as => :content, :dependent => :destroy + + validates :address, :presence => true + + VIEWS = [["Plan",1], ["Mixte",2], ["Satelite",3]] + + ZOOMS = [1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21] + +end diff --git a/app/models/portlets/table_content.rb b/app/models/portlets/table_content.rb new file mode 100644 index 0000000..4eebc9f --- /dev/null +++ b/app/models/portlets/table_content.rb @@ -0,0 +1,26 @@ +# -*- encoding : utf-8 -*- +class TableContent < ActiveRecord::Base + has_one :portlet, :as => :content, :dependent => :destroy + has_many :table_rows, :include => :cel_tables, :order => :position + has_many :cel_tables, :through => :table_rows + + + after_create do + + self.nbr_rows.to_i.times do + table_row = TableRow.create(:position => 1, :table_content_id => self.id) + + self.nbr_cols.to_i.times do + cel_table = CelTable.new + table_row.cel_tables << cel_table + end + + + + end + + + end + + +end diff --git a/app/models/portlets/table_row.rb b/app/models/portlets/table_row.rb new file mode 100644 index 0000000..20517f7 --- /dev/null +++ b/app/models/portlets/table_row.rb @@ -0,0 +1,62 @@ +# -*- encoding : utf-8 -*- +class TableRow < ActiveRecord::Base + has_many :cel_tables, :order => :position + belongs_to :table_content + + attr_accessor :skip_before_update + + + + + before_create do + if !position + self.position = 1 + end + if position + TableRow.find(:all, :conditions => ["position >= ? and table_content_id = ?",self.position,self.table_content_id]).each do |table_row| + table_row.position = table_row.position + 1 + table_row.skip_before_update = true + table_row.save! + end + end + end + + before_update do + if !skip_before_update + if self.position_changed? + #si la position est plus grande que l'ancienne + if self.changes['position'][1] > self.changes['position'][0] + TableRow.find(:all, :conditions => ["position > ? and position <= ? and table_content_id = ?",self.changes['position'][0],self.changes['position'][1],self.table_content_id]).each do |table_row| + table_row.position = table_row.position - 1 + table_row.skip_before_update = true + table_row.save! + end + end + #si la position est plus petite que l'ancienne. + if self.changes['position'][1] < self.changes['position'][0] + TableRow.find(:all, :conditions => ["position >= ? and position < ? and table_content_id = ?",self.changes['position'][1],self.changes['position'][0],self.table_content_id]).each do |table_row| + table_row.position = table_row.position + 1 + table_row.skip_before_update = true + table_row.save! + end + end + end + end + end + + before_destroy do + TableRow.find(:all, :conditions => ["position > ? and table_content_id = ?",self.position,self.table_content_id]).each do |table_row| + table_row.position = table_row.position - 1 + table_row.skip_before_update = true + table_row.save! + end + + table = self.table_content + table_past_count = table.nbr_rows + table.nbr_rows = table_past_count - 1 + table.save + + end + + +end diff --git a/app/models/portlets/text_content.rb b/app/models/portlets/text_content.rb new file mode 100644 index 0000000..0b6ef33 --- /dev/null +++ b/app/models/portlets/text_content.rb @@ -0,0 +1,6 @@ +# -*- encoding : utf-8 -*- +class TextContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + + STYLES = [["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/portlets/title_content.rb b/app/models/portlets/title_content.rb new file mode 100644 index 0000000..b90e607 --- /dev/null +++ b/app/models/portlets/title_content.rb @@ -0,0 +1,7 @@ +# -*- encoding : utf-8 -*- +class TitleContent < ActiveRecord::Base + has_many :portlets, :as => :content, :dependent => :destroy + validates :content, :presence => true + LEVELS = [1,2,3,4,5,6] + STYLES = []#[["Style 1",1], ["Style 2",2]] +end diff --git a/app/models/studient.rb b/app/models/studient.rb new file mode 100644 index 0000000..59b9129 --- /dev/null +++ b/app/models/studient.rb @@ -0,0 +1,3 @@ +class Studient < ActiveRecord::Base + belongs_to :foyer +end diff --git a/app/uploaders/file_uploader.rb b/app/uploaders/file_uploader.rb new file mode 100644 index 0000000..eddeb5e --- /dev/null +++ b/app/uploaders/file_uploader.rb @@ -0,0 +1,58 @@ +# -*- encoding : utf-8 -*- + +class FileUploader < CarrierWave::Uploader::Base + + # Include RMagick or ImageScience support: + # include CarrierWave::RMagick + # include CarrierWave::ImageScience + + # Choose what kind of storage to use for this uploader: + storage :file + # storage :s3 + + # Override the directory where uploaded files will be stored. + # This is a sensible default for uploaders that are meant to be mounted: + def store_dir + "#{Rails.root}/private_medias/#{model.class.to_s.underscore}/#{mounted_as}/#{model.id}" + end + + def url + "/download_data_files/#{model.id}" + + end + + # Provide a default URL as a default if there hasn't been a file uploaded: + def default_url + "/images/fallback/" + [version_name, "default.png"].compact.join('_') + end + + # Process files as they are uploaded: + # process :scale => [200, 300] + # + # def scale(width, height) + # # do something + # end + + # Create different versions of your uploaded files: + # version :thumb do + # process :scale => [50, 50] + # end + + # Add a white list of extensions which are allowed to be uploaded. + # For images you might use something like this: + # def extension_white_list + # %w(jpg jpeg gif png) + # end + + # Override the filename of the uploaded files: + # def filename + # "something.jpg" if original_filename + # end + + def filename + File.basename(original_filename, File.extname(original_filename)).to_s.to_slug + File.extname(original_filename).to_s if original_filename + + + end + +end diff --git a/app/uploaders/image_uploader.rb b/app/uploaders/image_uploader.rb new file mode 100644 index 0000000..aac575c --- /dev/null +++ b/app/uploaders/image_uploader.rb @@ -0,0 +1,79 @@ +# -*- encoding : utf-8 -*- + +class ImageUploader < CarrierWave::Uploader::Base + + # Include RMagick or ImageScience support: + include CarrierWave::RMagick + # include CarrierWave::ImageScience + + # Choose what kind of storage to use for this uploader: + storage :file + # storage :s3 + + # Override the directory where uploaded files will be stored. + # This is a sensible default for uploaders that are meant to be mounted: + def store_dir + "public_medias/#{model.class.to_s.underscore}/#{mounted_as}/#{model.id}" + end + + # Provide a default URL as a default if there hasn't been a file uploaded: + # def default_url + # "/images/fallback/" + [version_name, "default.png"].compact.join('_') + # end + + # Process files as they are uploaded: + process :resize_to_fit => [1200, 1200] + # + # def scale(width, height) + # # do something + # end + + + + + + + # Create different versions of your uploaded files: + version :large do + process :resize_to_fit => [980, 980] + + + version :medium do + process :resize_to_fit => [570, 400] + + version :small do + process :resize_to_fit => [300, 400] + + version :thumb do + process :resize_to_fit => [250, 250] + end + + end + + + end + + + + + + end + + version :square do + process :resize_to_fill => [120, 120] + end + + # Add a white list of extensions which are allowed to be uploaded. + # For images you might use something like this: + def extension_white_list + %w(jpg jpeg gif png) + end + + # Override the filename of the uploaded files: + def filename + File.basename(original_filename, File.extname(original_filename)).to_s.to_slug + File.extname(original_filename).to_s if original_filename + + + end + +end diff --git a/app/uploaders/prescription_uploader.rb b/app/uploaders/prescription_uploader.rb new file mode 100644 index 0000000..14e944b --- /dev/null +++ b/app/uploaders/prescription_uploader.rb @@ -0,0 +1,57 @@ +# -*- encoding : utf-8 -*- + +class PrescriptionUploader < CarrierWave::Uploader::Base + # Include RMagick or ImageScience support: + # include CarrierWave::RMagick + # include CarrierWave::ImageScience + + # Choose what kind of storage to use for this uploader: + storage :file + # storage :s3 + + # Override the directory where uploaded files will be stored. + # This is a sensible default for uploaders that are meant to be mounted: + def store_dir + "#{Rails.root}/private_medias/#{model.class.to_s.underscore}/#{mounted_as}/#{model.id}" + end + + def url + "/admin/prescriptions/#{model.id}/file" + + end + + # Provide a default URL as a default if there hasn't been a file uploaded: + def default_url + "/images/fallback/" + [version_name, "default.png"].compact.join('_') + end + + # Process files as they are uploaded: + # process :scale => [200, 300] + # + # def scale(width, height) + # # do something + # end + + # Create different versions of your uploaded files: + # version :thumb do + # process :scale => [50, 50] + # end + + # Add a white list of extensions which are allowed to be uploaded. + # For images you might use something like this: + def extension_white_list + %w(jpg jpeg gif png) + end + + # Override the filename of the uploaded files: + # def filename + # "something.jpg" if original_filename + # end + + def filename + File.basename(original_filename, File.extname(original_filename)).to_s.to_slug + File.extname(original_filename).to_s if original_filename + + + end + +end diff --git a/app/views/admin/admins/_admin.html.haml b/app/views/admin/admins/_admin.html.haml new file mode 100644 index 0000000..3b8f75b --- /dev/null +++ b/app/views/admin/admins/_admin.html.haml @@ -0,0 +1,12 @@ +%tr#admin_row.admin_row.row{:id => admin.id, :class => (cycle("row_1", "row_2", :name => "admins"))} + %td=admin.username + %td=admin.email + %td=admin.surname + %td=admin.firstname + + + %td.actions + = link_to i(:trash_stroke, :blue), [:admin, admin], :confirm => 'Voulez-vous vraiment supprimer cet admin ?', :method => :delete + + = link_to i(:pen_alt_fill, :blue), edit_admin_admin_path(admin), :remote => true + \ No newline at end of file diff --git a/app/views/admin/admins/_form.html.haml b/app/views/admin/admins/_form.html.haml new file mode 100644 index 0000000..95972e0 --- /dev/null +++ b/app/views/admin/admins/_form.html.haml @@ -0,0 +1,46 @@ += form_for([:admin, @admin], :remote => true) do |f| + + + .content + = f.error_messages + + %table + + + %tr + %td.label= f.label :email,"Email :" + %td= f.text_field :email, :class => "inputText" + + %tr + %td.label= f.label :username,"Login :" + %td= f.text_field :username, :class => "inputText" + %tr + %td.label= f.label :surname,"Nom :" + %td= f.text_field :surname, :class => "inputText" + + %tr + %td.label= f.label :firstname,"Prénom :" + %td= f.text_field :firstname, :class => "inputText" + + %tr + %td.label= f.label :password, "Mot de passe :" + %td= f.text_field :password, :class => "inputText" + + %tr + %td.label= f.label :password_confirmation, "Confirmation :" + %td= f.text_field :password_confirmation, :class => "inputText" + + + %tr + %td{:style => "vertical-align:top;"} Roles : + %td + - for role in Admin::ROLES + = check_box_tag "admin[roles][]", role, @admin.roles.include?(role) + =h role.humanize + %br + = hidden_field_tag "admin[roles][]", "" + + .actions + %button{:type => "submit"} Sauvegarder + + \ No newline at end of file diff --git a/app/views/admin/admins/_index_block.haml b/app/views/admin/admins/_index_block.haml new file mode 100644 index 0000000..f3bb5bd --- /dev/null +++ b/app/views/admin/admins/_index_block.haml @@ -0,0 +1,39 @@ +#Admin_index_block.index_block{:data_add_url => url_for({}.merge!(params).merge!({"format" => "js", "page" => 1, "order" => "created_at", "a_d" => "DESC"})), :data_current_url => url_for({}.merge!(params).merge!({:format => "js"}))} + + + + %table + + + %table.normal_table + %thead#Admin_rows_header.rows_header + + %tr + %td + =link_to_sort_results("Nom d'utilisateur", "username") + %td + =link_to_sort_results("Email", "email") + %td + =link_to_sort_results("Nom", "surname") + %td + =link_to_sort_results("Prénom", "firstname") + + + + %td{:style => "width:70px"} +   + + + + + %tbody#admin_rows.rows + + =render @admins + + + + + + + + diff --git a/app/views/admin/admins/create.js.erb b/app/views/admin/admins/create.js.erb new file mode 100644 index 0000000..bf858d3 --- /dev/null +++ b/app/views/admin/admins/create.js.erb @@ -0,0 +1,2 @@ +close_pane_hover(); +$('#admin_rows').prepend("<%= escape_javascript(render(@admin))%>"); \ No newline at end of file diff --git a/app/views/admin/admins/edit.html.haml b/app/views/admin/admins/edit.html.haml new file mode 100644 index 0000000..85b2ff3 --- /dev/null +++ b/app/views/admin/admins/edit.html.haml @@ -0,0 +1,6 @@ +.grid_12 + %h1 Modifier un administrateur + + + =render :partial => "form" + diff --git a/app/views/admin/admins/edit.js.erb b/app/views/admin/admins/edit.js.erb new file mode 100644 index 0000000..3d94bc2 --- /dev/null +++ b/app/views/admin/admins/edit.js.erb @@ -0,0 +1 @@ +show_pane_hover("<%= escape_javascript(render(:partial => "form"))%>"); \ No newline at end of file diff --git a/app/views/admin/admins/index.html.haml b/app/views/admin/admins/index.html.haml new file mode 100644 index 0000000..5e82d0a --- /dev/null +++ b/app/views/admin/admins/index.html.haml @@ -0,0 +1,6 @@ +.header + .right= link_to 'Ajouter un administrateur', new_admin_admin_path, :remote => true, :class => "button" + %h1 Liste des administrateurs + +.grid_12 + =render :partial => "index_block" diff --git a/app/views/admin/admins/index.js.erb b/app/views/admin/admins/index.js.erb new file mode 100644 index 0000000..6a4e08d --- /dev/null +++ b/app/views/admin/admins/index.js.erb @@ -0,0 +1,2 @@ + +$('#Admin_index_block').replaceWith("<%= escape_javascript(render(:partial => "index_block")) %>"); \ No newline at end of file diff --git a/app/views/admin/admins/new.js.erb b/app/views/admin/admins/new.js.erb new file mode 100644 index 0000000..3d94bc2 --- /dev/null +++ b/app/views/admin/admins/new.js.erb @@ -0,0 +1 @@ +show_pane_hover("<%= escape_javascript(render(:partial => "form"))%>"); \ No newline at end of file diff --git a/app/views/admin/admins/show.html.haml b/app/views/admin/admins/show.html.haml new file mode 100644 index 0000000..3a2a8f2 --- /dev/null +++ b/app/views/admin/admins/show.html.haml @@ -0,0 +1,31 @@ +.header + %h1 Détails de l'utilisateur + .back + = link_to "Retour",admin_users_path +.links + = link_to "Modifier", edit_admin_user_path(@user), :class => "lien" + +.shadow_box{:style => "padding:10px;"} + %p + Login: + =h @user.login + + %p + + Email: + =mail_to @user.email + + + +.shadow_box.padding + %h2 Logs + %table.admin_table + -for log in @user.user_logs.find(:all, :order => "created_at DESC") + %tr + %td=l log.created_at + %td=h log.message + + + + + diff --git a/app/views/admin/admins/update.js.erb b/app/views/admin/admins/update.js.erb new file mode 100644 index 0000000..07ff358 --- /dev/null +++ b/app/views/admin/admins/update.js.erb @@ -0,0 +1,2 @@ +close_pane_hover(); +$('#admin_row_<%= @admin.id %>').replaceWith("<%= escape_javascript(render(@admin))%>"); \ No newline at end of file diff --git a/app/views/admin/albums/_album.html.haml b/app/views/admin/albums/_album.html.haml new file mode 100644 index 0000000..86e830e --- /dev/null +++ b/app/views/admin/albums/_album.html.haml @@ -0,0 +1 @@ +=link_to album.name, admin_image_files_path(:album_id => album.id, :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :class => "album"+(" active" if album.id == params[:album_id].to_i).to_s, :id => "album_"+album.id.to_s,:data_album_id => album.id, :data_album_path => admin_album_path(:format => "js",:album_id => album.id, :manager => params[:manager], :multiple => params[:multiple], :id => album.id), :data_edit_album_path => edit_admin_album_path(:format => "js",:album_id => album.id, :manager => params[:manager], :multiple => params[:multiple], :id => album.id) \ No newline at end of file diff --git a/app/views/admin/albums/_albums.html.haml b/app/views/admin/albums/_albums.html.haml new file mode 100644 index 0000000..4b16f98 --- /dev/null +++ b/app/views/admin/albums/_albums.html.haml @@ -0,0 +1,2 @@ +#albums{:data_albums_url => admin_albums_url(:album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple])} + =render @albums \ No newline at end of file diff --git a/app/views/admin/albums/create.js.erb b/app/views/admin/albums/create.js.erb new file mode 100644 index 0000000..7f37b68 --- /dev/null +++ b/app/views/admin/albums/create.js.erb @@ -0,0 +1,2 @@ +$('#albums').html("<%= escape_javascript(render(:partial => "albums")) %>"); +image_files_load(); \ No newline at end of file diff --git a/app/views/admin/albums/destroy.js.erb b/app/views/admin/albums/destroy.js.erb new file mode 100644 index 0000000..511c764 --- /dev/null +++ b/app/views/admin/albums/destroy.js.erb @@ -0,0 +1,4 @@ + + + +$.ajax({url : $('#image_files_container').attr('data_reset_url')}); \ No newline at end of file diff --git a/app/views/admin/albums/edit.js.erb b/app/views/admin/albums/edit.js.erb new file mode 100644 index 0000000..3a35d3a --- /dev/null +++ b/app/views/admin/albums/edit.js.erb @@ -0,0 +1,16 @@ +var new_album_name = prompt("Nom de l'album :\n <%= "Le nom que vous avez chosi existe déjà." if @album_update %>", "<%=escape_javascript(@album.name) %>"); + +if(new_album_name){ + + + $.ajax({url : $("#album_<%=@album.id %>").attr('data_album_path'), type: "PUT", data : { + album : { + name: new_album_name + } + } + + }); + + + +} \ No newline at end of file diff --git a/app/views/admin/albums/index.js.erb b/app/views/admin/albums/index.js.erb new file mode 100644 index 0000000..eec3101 --- /dev/null +++ b/app/views/admin/albums/index.js.erb @@ -0,0 +1,4 @@ + + +$('#albums').html("<%= escape_javascript(render(:partial => "albums")) %>"); +image_files_load(); \ No newline at end of file diff --git a/app/views/admin/albums/new.js.erb b/app/views/admin/albums/new.js.erb new file mode 100644 index 0000000..5614376 --- /dev/null +++ b/app/views/admin/albums/new.js.erb @@ -0,0 +1,16 @@ +var new_album_name = prompt("Nom de l'album :\n <%= "Vous n'avez spécifié aucuns nom pour ce nouvel album, ou le nom que vous avez chosi existe déjà." if @album_create %>", "<%=escape_javascript(@album.name) %>"); + +if(new_album_name){ + + + $.ajax({url : $("#albums").attr('data_albums_url'), type: "POST", data : { + album : { + name: new_album_name + } + } + + }); + + + +} \ No newline at end of file diff --git a/app/views/admin/albums/update.js.erb b/app/views/admin/albums/update.js.erb new file mode 100644 index 0000000..e914805 --- /dev/null +++ b/app/views/admin/albums/update.js.erb @@ -0,0 +1,2 @@ +$("#album_<%=@album.id %>").replaceWith("<%= escape_javascript(render(@album))%>"); +image_files_load(); \ No newline at end of file diff --git a/app/views/admin/blocks/_block.html.haml b/app/views/admin/blocks/_block.html.haml new file mode 100644 index 0000000..6ad0f9b --- /dev/null +++ b/app/views/admin/blocks/_block.html.haml @@ -0,0 +1,4 @@ +#block_portlets.block_portlets{:id => block.id, :"data-block_id"=>block.id} + + =render :partial => "portlet/portlets/portlet", :collection => block.portlets.find(:all, :order => :position, :include => :content) + diff --git a/app/views/admin/blocks/_edit.html.haml b/app/views/admin/blocks/_edit.html.haml new file mode 100644 index 0000000..e69de29 diff --git a/app/views/admin/blocks/_form.html.haml b/app/views/admin/blocks/_form.html.haml new file mode 100644 index 0000000..05100f2 --- /dev/null +++ b/app/views/admin/blocks/_form.html.haml @@ -0,0 +1,16 @@ + +%a.tab_link{:href => "#block-"+block.id.to_s}= block.block_name + + +.tab{:id => "#block-"+block.id.to_s} + + + + + + .block_content{:id => "block_content-"+block.id.to_s} + + + =render block + + diff --git a/app/views/admin/blocks/edit.html.haml b/app/views/admin/blocks/edit.html.haml new file mode 100644 index 0000000..e559c9b --- /dev/null +++ b/app/views/admin/blocks/edit.html.haml @@ -0,0 +1 @@ +=render :partial => "form", :locals => {:block => @block} \ No newline at end of file diff --git a/app/views/admin/blocks/edit.js.erb b/app/views/admin/blocks/edit.js.erb new file mode 100644 index 0000000..85c7d96 --- /dev/null +++ b/app/views/admin/blocks/edit.js.erb @@ -0,0 +1,8 @@ + +//$("#admin").html("<%= escape_javascript(render(:partial => "form", :locals => {:block => @block})) %>"); + +$("#admin_block").load("<%= edit_admin_block_path(@block) %>", function() {when_admin_load();$('#front').hide();$('#admin_front').show();}); + + + + diff --git a/app/views/admin/blocks/show.html.haml b/app/views/admin/blocks/show.html.haml new file mode 100644 index 0000000..3bef0b7 --- /dev/null +++ b/app/views/admin/blocks/show.html.haml @@ -0,0 +1,19 @@ + + +#content_types_draggables + + -@block.content_types.each do |content_type| + + .content_types_draggable{:id => content_type.id, :data_type => content_type.slug} + =image_tag("content_type/type_"+content_type.slug.to_s+".png", :alt => content_type.name) + + +.grid_12 + + =render @block + + %div{:style => "height:70px;"} + +:javascript + block_js_initialize(); + \ No newline at end of file diff --git a/app/views/admin/cibles/new.html.haml b/app/views/admin/cibles/new.html.haml new file mode 100644 index 0000000..a8a4a97 --- /dev/null +++ b/app/views/admin/cibles/new.html.haml @@ -0,0 +1,15 @@ += semantic_form_for [@namespace, @resource], :remote => true do |form| + + + + #link_content_cible_form.form2 + #link_content_cible_form_content + = form.inputs do + = form.input :cible_type,:as => :hidden + = form.input :cible_id,:as => :hidden + =render :partial => "portlet/link_contents/"+@resource.cible_type.tableize.singularize.to_s+"_form", :locals => {:form => form} + + = form.buttons do + = form.commit_button "Sauvegarder" + + diff --git a/app/views/admin/dashboard/index.html.haml b/app/views/admin/dashboard/index.html.haml new file mode 100644 index 0000000..5706a5e --- /dev/null +++ b/app/views/admin/dashboard/index.html.haml @@ -0,0 +1,39 @@ +.grid_12 + .message.notice + %p + ="Bonjour #{current_admin.email}," + %br/ + =" votre dernière connexion à été effectuée le#{l(current_admin.last_sign_in_at)} depuis l'adresse ip #{current_admin.last_sign_in_ip}" + + +.clear +#dashboard_actions + + .grid_4 + .panel + + %h3=link_to image_tag("admin/dashboard/icones_admins.png")+"utilisateurs", admin_admins_path() + + + .clear + + .grid_4 + .panel + -Menu.all.each do |menu| + %h3= link_to image_tag("admin/dashboard/icones_menu_items.png")+"pages/menu", admin_menu_items_path(:menu_id => menu.id) + + .grid_4 + .panel + %h3=link_to image_tag("admin/dashboard/icones_image_files.png")+"images", admin_image_files_path() + + .grid_4 + .panel + %h3=link_to image_tag("admin/dashboard/icones_data_files.png")+"fichiers", admin_data_files_path() + + + .clear + + + + + diff --git a/app/views/admin/data_files/_data_file.html.haml b/app/views/admin/data_files/_data_file.html.haml new file mode 100644 index 0000000..f5671ac --- /dev/null +++ b/app/views/admin/data_files/_data_file.html.haml @@ -0,0 +1,20 @@ +- if data_file.file? + + + #data_file.data_file{:id => data_file.id, :"data-id" => data_file.id, :"data-name" => data_file.abstract_file_name, :"data-description" => data_file.description, :"data-show_url" => admin_data_file_path(:id => data_file.id, :manager => params[:manager], :multiple => params[:multiple]), :"data-edit_url" => edit_admin_data_file_path(:id => data_file.id, :manager => params[:manager], :multiple => params[:multiple]) , :class => ("new" if @data_file_create)} + + %table + %tr + %td{:style => "width:35%"} + =data_file.abstract_file_name + %td{:style => "width:15%"} + + + =data_file.file_type + %td{:style => "width:10%"} + =link_to i(:arrow_down_alt1), data_file.file.url + + = link_to i(:trash_stroke), admin_data_file_path(:id => data_file.id, :manager => params[:manager], :multiple => params[:multiple]), :confirm => 'Voulez-vous vraiment supprimer cette image ?', :method => :delete, :remote => true + = link_to i(:check_alt), "#",:onclick => "manager_send_data_file("+data_file.id.to_s+");return false;" if params[:manager] and !params[:multiple] + + \ No newline at end of file diff --git a/app/views/admin/data_files/_data_files_container.html.haml b/app/views/admin/data_files/_data_files_container.html.haml new file mode 100644 index 0000000..d418d74 --- /dev/null +++ b/app/views/admin/data_files/_data_files_container.html.haml @@ -0,0 +1,3 @@ +#data_files_container{ :data_reset_url => admin_data_files_path(:format => "js",:manager => params[:manager], :multiple => params[:multiple]), :data_current_url => url_for({}.merge!(params).merge!({:format => "js"}))} + #data_files=render @data_files + %p{:style => "clear:both;"} diff --git a/app/views/admin/data_files/_form.html.haml b/app/views/admin/data_files/_form.html.haml new file mode 100644 index 0000000..4eea331 --- /dev/null +++ b/app/views/admin/data_files/_form.html.haml @@ -0,0 +1,15 @@ +- form_for @data_file, :url => admin_data_file_path(:id => @data_file.id, :file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true do |form| + %table{:style => "width:100%"} + %tr + %td{:style => "width:120px"} Nom : + %td= form.text_field :name, :style => "width:90%" + %tr + %td{:style => "vertical-align:top;"} Description : + %td= form.text_area :description, :style => "max-width:90%;width:90%;height:100px;" + %tr.submit_tr + %td=link_to "Annuler", admin_data_file_path(:id => @data_file.id, :manager => params[:manager], :multiple => params[:multiple]), :remote => true + %td + + =form.submit "Sauvegarder" + + \ No newline at end of file diff --git a/app/views/admin/data_files/_index_block.html.haml b/app/views/admin/data_files/_index_block.html.haml new file mode 100644 index 0000000..0fc1321 --- /dev/null +++ b/app/views/admin/data_files/_index_block.html.haml @@ -0,0 +1,58 @@ +#data_files_big_container + #sidebar + + + =render :partial => "admin/file_folders/file_folders" + + + #main_workspace_view + + + =render :partial => "data_files_container" + + + + + #data_file_container + + + #data_file_container_content + + .close_link{:onclick => "close_data_file_container();"} + + %p{:style => "clear:both;"} + #left_buttons + = link_to i(:pen_alt_stroke),edit_admin_file_folder_url(:id => params[:file_folder_id], :file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "edit_current_file_folder" + + = link_to i(:trash_stroke), admin_file_folder_url(:id => params[:file_folder_id],:file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "remove_current_file_folder", :method => :delete, :confirm => "Voulez-vous vraiment supprimer cet file_folder ? Attention, toutes les images de celui-ci seront définitevement supprimées." + + = link_to i(:plus), new_admin_file_folder_url(:file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "add_file_folder" + + #right_bar + #multiple_selection + #multiple_menu + %a{:href => "#", :onclick => "delete_multiple_files();return false;"} Supprimer ces fichiers + %a{:href => "#", :onclick => "unselect_all_files();return false;"} Tout désélectionner + %a{:href => "#", :onclick => "select_all_files();return false;"} Tout sélectionner + %span#data_files_multiple_selection_text + + + #data_file_form + = form_for @data_file, :url => admin_data_files_path(:id => @data_file.id, :file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]), :html => { :id => "data_file_upload_field", :multipart => true } do |f| + + %label Ajouter des fichiers dans ce dossier + + = f.file_field :file, :multiple => true + = f.hidden_field :file_cache + = f.hidden_field :file_folder_id + + #data_file_queue + %table#files + + + + + +:javascript + set_data_files_big_container_size(); + diff --git a/app/views/admin/data_files/_show.html.haml b/app/views/admin/data_files/_show.html.haml new file mode 100644 index 0000000..526e688 --- /dev/null +++ b/app/views/admin/data_files/_show.html.haml @@ -0,0 +1,18 @@ +.img{:style => ("background-image:url('"+(@data_file.file.url).to_s+"');")} + +.form + %table{:style => "width:100%"} + %tr + %td{:style => "width:120px"} Date d'ajout : + %td= l @data_file.created_at + =render :partial => "form" +#right_bar_clone + #right_bar_clone_buttons_left + = link_to i(:trash_stroke, :gray_light), admin_data_file_path(:id => @data_file.id, :manager => params[:manager], :multiple => params[:multiple]), :confirm => 'Voulez-vous vraiment supprimer cette image ?', :method => :delete, :remote => true + + + = link_to i(:check_alt, :gray_light), "#",:onclick => "manager_send_data_file("+@data_file.id.to_s+");return false;" if params[:manager] and !params[:multiple] + + + + diff --git a/app/views/admin/data_files/create.js.erb b/app/views/admin/data_files/create.js.erb new file mode 100644 index 0000000..c7a4a7d --- /dev/null +++ b/app/views/admin/data_files/create.js.erb @@ -0,0 +1,5 @@ +$("#data_files").prepend("<%= escape_javascript(render(@data_file)) %>"); +$('#data_file_<%=@data_file.id %>').addClass('active'); + +update_data_multiple_selection_text(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/admin/data_files/destroy.js.erb b/app/views/admin/data_files/destroy.js.erb new file mode 100644 index 0000000..d763a5f --- /dev/null +++ b/app/views/admin/data_files/destroy.js.erb @@ -0,0 +1,4 @@ +$('#data_file_prevualize_box').fadeOut(); +$("#data_file_<%= @data_file.id.to_s %>").fadeOut(200).delay(6000).remove(); +close_data_file_container(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/admin/data_files/index.html.haml b/app/views/admin/data_files/index.html.haml new file mode 100644 index 0000000..891b211 --- /dev/null +++ b/app/views/admin/data_files/index.html.haml @@ -0,0 +1,2 @@ + +=render :partial => "index_block" \ No newline at end of file diff --git a/app/views/admin/data_files/index.js.erb b/app/views/admin/data_files/index.js.erb new file mode 100644 index 0000000..479d0f5 --- /dev/null +++ b/app/views/admin/data_files/index.js.erb @@ -0,0 +1,18 @@ + +unselect_all_image(); + +$('#file_folders').data('file_folders_url', "<%=escape_javascript(admin_file_folders_url(:file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]))%>"); + +$.ajax({url : $("#file_folders").data('file_folders_url')}); + +$('#data_files_container').replaceWith("<%= escape_javascript(render(:partial => "data_files_container")) %>"); +$('#file_folders .file_folder').removeClass('active'); +$('#file_folders #file_folder_<%=@file_folder.id%>').addClass('active'); + + +$('#file_folders').data("file_folders_url", "<%= escape_javascript(admin_file_folders_url(:file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple]))%>") +$('#data_file_file_folder_id').val(<%=@file_folder.id%>); + + +$('#edit_current_file_folder').attr("href", $("#file_folder_<%=@file_folder.id%>").data('edit_file_folder_path')); +$('#remove_current_file_folder').attr("href", $("#file_folder_<%=@file_folder.id%>").data('file_folder_path')); diff --git a/app/views/admin/data_files/show.js.erb b/app/views/admin/data_files/show.js.erb new file mode 100644 index 0000000..d932dfe --- /dev/null +++ b/app/views/admin/data_files/show.js.erb @@ -0,0 +1,3 @@ + + +$('#data_file_container_content').html("<%= escape_javascript(render(:partial => "show")) %>"); diff --git a/app/views/admin/data_files/update.js.erb b/app/views/admin/data_files/update.js.erb new file mode 100644 index 0000000..3e4a78c --- /dev/null +++ b/app/views/admin/data_files/update.js.erb @@ -0,0 +1,5 @@ + +$('#data_file_<%= @data_file.id %>').replaceWith("<%= escape_javascript(render(@data_file))%>"); +$('#data_files_big_container #main_workspace_view #data_file_container .form').html("<%= escape_javascript(render(:partial => 'form'))%>"); + +data_files_load(); \ No newline at end of file diff --git a/app/views/admin/file_folders/_file_folder.html.haml b/app/views/admin/file_folders/_file_folder.html.haml new file mode 100644 index 0000000..53df6c8 --- /dev/null +++ b/app/views/admin/file_folders/_file_folder.html.haml @@ -0,0 +1,2 @@ +=link_to file_folder.name, admin_data_files_path(:file_folder_id => file_folder.id, :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :class => "file_folder"+(" active" if file_folder.id == params[:file_folder_id].to_i).to_s, :id => "file_folder_"+file_folder.id.to_s,:"data-file_folder_id" => file_folder.id, :"data-file_folder_path" => admin_file_folder_path(:format => "js",:file_folder_id => file_folder.id, :manager => params[:manager], :multiple => params[:multiple], :id => file_folder.id), :"data-edit_file_folder_path" => edit_admin_file_folder_path(:format => "js",:file_folder_id => file_folder.id, :manager => params[:manager], :multiple => params[:multiple], :id => file_folder.id) + diff --git a/app/views/admin/file_folders/_file_folders.html.haml b/app/views/admin/file_folders/_file_folders.html.haml new file mode 100644 index 0000000..75ff1c9 --- /dev/null +++ b/app/views/admin/file_folders/_file_folders.html.haml @@ -0,0 +1,2 @@ +#file_folders{:"data-file_folders_url" => admin_file_folders_url(:file_folder_id => params[:file_folder_id], :manager => params[:manager], :multiple => params[:multiple])} + =render @file_folders \ No newline at end of file diff --git a/app/views/admin/file_folders/create.js.erb b/app/views/admin/file_folders/create.js.erb new file mode 100644 index 0000000..f204123 --- /dev/null +++ b/app/views/admin/file_folders/create.js.erb @@ -0,0 +1,2 @@ +$('#file_folders').html("<%= escape_javascript(render(:partial => "file_folders")) %>"); +data_files_load(); \ No newline at end of file diff --git a/app/views/admin/file_folders/destroy.js.erb b/app/views/admin/file_folders/destroy.js.erb new file mode 100644 index 0000000..68700f2 --- /dev/null +++ b/app/views/admin/file_folders/destroy.js.erb @@ -0,0 +1,4 @@ + + + +$.ajax({url : $('#data_files_container').attr('data_reset_url')}); \ No newline at end of file diff --git a/app/views/admin/file_folders/edit.js.erb b/app/views/admin/file_folders/edit.js.erb new file mode 100644 index 0000000..ee769f2 --- /dev/null +++ b/app/views/admin/file_folders/edit.js.erb @@ -0,0 +1,16 @@ +var new_file_folder_name = prompt("Nom de l'file_folder :\n <%= "Le nom que vous avez chosi existe déjà." if @file_folder_update %>", "<%=escape_javascript(@file_folder.name) %>"); + +if(new_file_folder_name){ + + + $.ajax({url : $("#file_folder_<%=@file_folder.id %>").data('file_folder_path'), type: "PUT", data : { + file_folder : { + name: new_file_folder_name + } + } + + }); + + + +} \ No newline at end of file diff --git a/app/views/admin/file_folders/index.js.erb b/app/views/admin/file_folders/index.js.erb new file mode 100644 index 0000000..d8807f0 --- /dev/null +++ b/app/views/admin/file_folders/index.js.erb @@ -0,0 +1,3 @@ + +$('#file_folders').html("<%= escape_javascript(render(:partial => "file_folders")) %>"); +data_files_load(); \ No newline at end of file diff --git a/app/views/admin/file_folders/new.js.erb b/app/views/admin/file_folders/new.js.erb new file mode 100644 index 0000000..2bf1ab0 --- /dev/null +++ b/app/views/admin/file_folders/new.js.erb @@ -0,0 +1,16 @@ +var new_file_folder_name = prompt("Nom de l'file_folder :\n <%= "Vous n'avez spécifié aucuns nom pour ce nouvel file_folder, ou le nom que vous avez chosi existe déjà." if @file_folder_create %>", "<%=escape_javascript(@file_folder.name) %>"); + +if(new_file_folder_name){ + + + $.ajax({url : $("#file_folders").data('file_folders_url'), type: "POST", data : { + file_folder : { + name: new_file_folder_name + } + } + + }); + + + +} \ No newline at end of file diff --git a/app/views/admin/file_folders/update.js.erb b/app/views/admin/file_folders/update.js.erb new file mode 100644 index 0000000..a5db14e --- /dev/null +++ b/app/views/admin/file_folders/update.js.erb @@ -0,0 +1,2 @@ +$("#file_folder_<%=@file_folder.id %>").replaceWith("<%= escape_javascript(render(@file_folder))%>"); +data_files_load(); \ No newline at end of file diff --git a/app/views/admin/image_files/_form.html.haml b/app/views/admin/image_files/_form.html.haml new file mode 100644 index 0000000..9258fb6 --- /dev/null +++ b/app/views/admin/image_files/_form.html.haml @@ -0,0 +1,17 @@ += form_for @image_file, :url => admin_image_file_path(:id => @image_file.id, :album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true do |form| + %table{:style => "width:100%"} + %tr + %td{:style => "width:120px"} Nom : + %td= form.text_field :name, :style => "width:90%" + %tr + %td{:style => "vertical-align:top;"} Description : + %td= form.text_area :description, :style => "max-width:90%;width:90%;height:90px;" + %tr + %td{:style => "vertical-align:top;"} Page d'accueil ? : + %td= form.check_box :home, :onclick => "$('.submit_tr').show();" + + .actions.submit_tr + =link_to "Annuler", admin_image_file_path(:id => @image_file.id, :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :class => "button" + =form.submit "Sauvegarder" + + \ No newline at end of file diff --git a/app/views/admin/image_files/_image_file.html.haml b/app/views/admin/image_files/_image_file.html.haml new file mode 100644 index 0000000..23e3859 --- /dev/null +++ b/app/views/admin/image_files/_image_file.html.haml @@ -0,0 +1,11 @@ +- if image_file.file? + #image_file.image_file{:id => image_file.id, :data_thumb => image_file.file.large.medium.small.thumb.url, :data_id => image_file.id, :data_name => image_file.name, :data_description => image_file.description, :data_tags => image_file.tags, :data_show_url => admin_image_file_path(:id => image_file.id, :manager => params[:manager], :multiple => params[:multiple]), :data_edit_url => edit_admin_image_file_path(:id => image_file.id, :manager => params[:manager], :multiple => params[:multiple]) , :class => ("new" if @image_file_create)} + %a{:name => "image_file_#{image_file.id}_anchor"} + .img.QI_background_resize{:style => ("background-image:url('"+(image_file.file.large.medium.small.thumb.url).to_s+"');")} + =#s + =#image_tag image_file.file.medium.thumb.url if image_file.file? + .name + =image_file.name ? truncate(image_file.name, :length => 17) : raw(" ") + = link_to i(:check_alt, :gray_light,12), "#",:onclick => "manager_send_image_file("+image_file.id.to_s+");return false;" if params[:manager] and !params[:multiple] + + \ No newline at end of file diff --git a/app/views/admin/image_files/_image_files_container.html.haml b/app/views/admin/image_files/_image_files_container.html.haml new file mode 100644 index 0000000..70599bd --- /dev/null +++ b/app/views/admin/image_files/_image_files_container.html.haml @@ -0,0 +1,3 @@ +#image_files_container{ :data_reset_url => admin_image_files_path(:format => "js",:manager => params[:manager], :multiple => params[:multiple]), :data_current_url => url_for({}.merge!(params).merge!({:format => "js"}))} + #image_files=render @image_files + %p{:style => "clear:both;"} diff --git a/app/views/admin/image_files/_index_block.html.haml b/app/views/admin/image_files/_index_block.html.haml new file mode 100644 index 0000000..4a01cf0 --- /dev/null +++ b/app/views/admin/image_files/_index_block.html.haml @@ -0,0 +1,62 @@ +#image_files_big_container + #sidebar + + + =render :partial => "admin/albums/albums" + + + #main_workspace_view + + + =render :partial => "image_files_container" + + + + + #image_file_container + + + #image_file_container_content + + .close_link{:onclick => "close_image_file_container();"} + + %p{:style => "clear:both;"} + #left_buttons + = link_to i(:pen_alt_stroke),edit_admin_album_url(:id => params[:album_id], :album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "edit_current_album" + + = link_to i(:trash_stroke), admin_album_url(:id => params[:album_id],:album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "remove_current_album", :method => :delete, :confirm => "Voulez-vous vraiment supprimer cet album ? Attention, toutes les images de celui-ci seront définitivement supprimées." + + = link_to i(:plus), new_admin_album_url(:album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]), :remote => true, :id => "add_album" + + #right_bar + #multiple_selection + #multiple_menu + + -if params[:multiple] + %a{:href => "#", :onclick => "manager_send_multiple_image_files();return false;"} Sélectionner ces images + %a{:href => "#", :onclick => "delete_multiple_images();return false;"} Supprimer ces images + %a{:href => "#", :onclick => "unselect_all_image();return false;"} Tout désélectionner + %a{:href => "#", :onclick => "select_all_image();return false;"} Tout sélectionner + %span#multiple_selection_text + + + #image_file_form + = form_for @image_file, :url => admin_image_files_path(:id => @image_file.id, :album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]), :html => { :id => "image_upload_field", :multipart => true } do |f| + + %label Ajouter des images dans cet album + + = f.file_field :file, :multiple => true + = f.hidden_field :file_cache + = f.hidden_field :album_id + + #image_file_queue + %table#files + #grid_slider + .ui-slider-handle + + + + +:javascript + set_image_files_big_container_size(); + diff --git a/app/views/admin/image_files/_show.html.haml b/app/views/admin/image_files/_show.html.haml new file mode 100644 index 0000000..9c7f891 --- /dev/null +++ b/app/views/admin/image_files/_show.html.haml @@ -0,0 +1,15 @@ +.img{:style => ("background-image:url('"+(@image_file.file.url).to_s+"');")} + +.form + + =render :partial => "form" +#right_bar_clone + #right_bar_clone_buttons_left + = link_to i(:trash_stroke, :gray_light), admin_image_file_path(:id => @image_file.id, :manager => params[:manager], :multiple => params[:multiple]), :confirm => 'Voulez-vous vraiment supprimer cette image ?', :method => :delete, :remote => true + + + = link_to i(:check_alt, :gray_light), "#",:onclick => "manager_send_image_file("+@image_file.id.to_s+");return false;" if params[:manager] and !params[:multiple] + + + + diff --git a/app/views/admin/image_files/create.js.erb b/app/views/admin/image_files/create.js.erb new file mode 100644 index 0000000..96b6655 --- /dev/null +++ b/app/views/admin/image_files/create.js.erb @@ -0,0 +1,5 @@ +$("#image_files").prepend("<%= escape_javascript(render(@image_file)) %>"); +$('#image_file_<%=@image_file.id %>').addClass('active'); + +set_image_files_img_size(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/admin/image_files/destroy.js.erb b/app/views/admin/image_files/destroy.js.erb new file mode 100644 index 0000000..8f247f4 --- /dev/null +++ b/app/views/admin/image_files/destroy.js.erb @@ -0,0 +1,4 @@ +$('#image_file_prevualize_box').fadeOut(); +$("#image_file_<%= @image_file.id.to_s %>").fadeOut(200).delay(6000).remove(); +close_image_file_container(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/admin/image_files/index.html.haml b/app/views/admin/image_files/index.html.haml new file mode 100644 index 0000000..891b211 --- /dev/null +++ b/app/views/admin/image_files/index.html.haml @@ -0,0 +1,2 @@ + +=render :partial => "index_block" \ No newline at end of file diff --git a/app/views/admin/image_files/index.js.erb b/app/views/admin/image_files/index.js.erb new file mode 100644 index 0000000..ce0153a --- /dev/null +++ b/app/views/admin/image_files/index.js.erb @@ -0,0 +1,18 @@ + +unselect_all_image(); + +$('#albums').attr('data_albums_url', "<%=escape_javascript(admin_albums_url(:album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]))%>"); +$.ajax({url : $("#albums").attr('data_albums_url')}); + +$('#image_files_container').replaceWith("<%= escape_javascript(render(:partial => "image_files_container")) %>"); +$('#albums .album').removeClass('active'); +$('#albums #album_<%=@album.id%>').addClass('active'); + + +$('#albums').attr("data_albums_url", "<%= escape_javascript(admin_albums_url(:album_id => params[:album_id], :manager => params[:manager], :multiple => params[:multiple]))%>") +$('#image_file_album_id').val(<%=@album.id%>); + + +$('#edit_current_album').attr("href", $("#album_<%=@album.id%>").attr('data_edit_album_path')); +$('#remove_current_album').attr("href", $("#album_<%=@album.id%>").attr('data_album_path')); +set_image_files_img_size(); diff --git a/app/views/admin/image_files/show.js.erb b/app/views/admin/image_files/show.js.erb new file mode 100644 index 0000000..06ad059 --- /dev/null +++ b/app/views/admin/image_files/show.js.erb @@ -0,0 +1,3 @@ + + +$('#image_file_container_content').html("<%= escape_javascript(render(:partial => "show")) %>"); diff --git a/app/views/admin/image_files/update.js.erb b/app/views/admin/image_files/update.js.erb new file mode 100644 index 0000000..fdaae54 --- /dev/null +++ b/app/views/admin/image_files/update.js.erb @@ -0,0 +1,5 @@ + +$('#image_file_<%= @image_file.id %>').replaceWith("<%= escape_javascript(render(@image_file))%>"); +$('#image_files_big_container #main_workspace_view #image_file_container .form').html("<%= escape_javascript(render(:partial => 'form'))%>"); +set_image_files_img_size($("#image_files_big_container #right_bar #grid_slider").slider("value")); +image_files_load(); \ No newline at end of file diff --git a/app/views/admin/menu_aliases/_form.html.haml b/app/views/admin/menu_aliases/_form.html.haml new file mode 100644 index 0000000..5b91a46 --- /dev/null +++ b/app/views/admin/menu_aliases/_form.html.haml @@ -0,0 +1,6 @@ + +=form.semantic_fields_for :menu_content do |content| + = content.inputs do + + -MenuItem.find(:all, :conditions => {:parent_id => nil}, :order => :position).each do |m| + =render :partial => "form_line", :locals => {:menu_item => m, :f => content} \ No newline at end of file diff --git a/app/views/admin/menu_aliases/_menu_alias.html.haml b/app/views/admin/menu_aliases/_menu_alias.html.haml new file mode 100644 index 0000000..0029f0c --- /dev/null +++ b/app/views/admin/menu_aliases/_menu_alias.html.haml @@ -0,0 +1,4 @@ +%table + %tr + %td{:style => "width:150px;"} élément de menu : + %td= link_to menu_alias.menu_item_alias.name, edit_admin_menu_item_path(menu_alias.menu_item_alias) if menu_alias.menu_item_alias diff --git a/app/views/admin/menu_aliases/edit.html.haml b/app/views/admin/menu_aliases/edit.html.haml new file mode 100644 index 0000000..e69de29 diff --git a/app/views/admin/menu_articles/_form.html.haml b/app/views/admin/menu_articles/_form.html.haml new file mode 100644 index 0000000..8af6da3 --- /dev/null +++ b/app/views/admin/menu_articles/_form.html.haml @@ -0,0 +1,13 @@ + +=form.semantic_fields_for :menu_content do |menu_content| + - menu_content.inputs do + -Folder.all.each do |folder| + + %h4=folder.title + + -folder.articles.each do |article| + %p + =menu_content.radio_button :article_id, article.id + %label{:for => "menu_item_menu_content_attributes_article_id_"+article.id.to_s}=article.title + %br + %br \ No newline at end of file diff --git a/app/views/admin/menu_articles/_menu_article.html.haml b/app/views/admin/menu_articles/_menu_article.html.haml new file mode 100644 index 0000000..9701d38 --- /dev/null +++ b/app/views/admin/menu_articles/_menu_article.html.haml @@ -0,0 +1,5 @@ + +%table + %tr + %td{:style => "width:150px;"} article : + %td=menu_article.article.title if menu_article.article diff --git a/app/views/admin/menu_folders/_form.html.haml b/app/views/admin/menu_folders/_form.html.haml new file mode 100644 index 0000000..f1b49a8 --- /dev/null +++ b/app/views/admin/menu_folders/_form.html.haml @@ -0,0 +1,7 @@ + +=form.semantic_fields_for :menu_content do |menu_content| + - menu_content.inputs do + -Folder.all.each do |folder| + %p + =menu_content.radio_button :folder_id, folder.id + %label{:for => "menu_item_menu_content_attributes_folder_id_"+folder.id.to_s}=folder.title diff --git a/app/views/admin/menu_folders/_menu_folder.html.haml b/app/views/admin/menu_folders/_menu_folder.html.haml new file mode 100644 index 0000000..e96597e --- /dev/null +++ b/app/views/admin/menu_folders/_menu_folder.html.haml @@ -0,0 +1,5 @@ + +%table + %tr + %td{:style => "width:150px;"} dossier : + %td=menu_folder.folder.title if menu_folder.folder diff --git a/app/views/admin/menu_items/_edit_form.html.haml b/app/views/admin/menu_items/_edit_form.html.haml new file mode 100644 index 0000000..88c4395 --- /dev/null +++ b/app/views/admin/menu_items/_edit_form.html.haml @@ -0,0 +1,12 @@ +#menu_item_edit + = semantic_form_for [:admin,@menu_item], :remote => true do |form| + .form1=render :partial => "form", :locals => {:form => form} + + + .form2 + =render :partial => "admin/"+@menu_item.menu_content_type.tableize.to_s+"/form", :locals => {:form => form} + + .actions + =link_to "annuler", admin_menu_item_path(@menu_item), :remote => true, :class => "button" + = form.submit "Sauvegarder" + diff --git a/app/views/admin/menu_items/_form.html.haml b/app/views/admin/menu_items/_form.html.haml new file mode 100644 index 0000000..241e88e --- /dev/null +++ b/app/views/admin/menu_items/_form.html.haml @@ -0,0 +1,9 @@ += form.inputs do + = form.input :name, :label => "Nom :" + = form.input :slug, :label => "slug :" if current_admin.super_admin? || !@menu_item.super_admin + = form.input :super_admin,:as => :boolean , :label => "Super Admin" if current_admin.super_admin? + = form.input :enabled,:as => :boolean , :label => "Actif" + = form.input :menu_id,:as => :hidden + = form.input :parent_id,:as => :hidden + + diff --git a/app/views/admin/menu_items/_form_line.html.haml b/app/views/admin/menu_items/_form_line.html.haml new file mode 100644 index 0000000..43b1e46 --- /dev/null +++ b/app/views/admin/menu_items/_form_line.html.haml @@ -0,0 +1,7 @@ +-menu_item.ancestors.size.times do +    +=f.radio_button :menu_item_id, menu_item.id, :disabled => ("disabled" if menu_item.menu_content_type =="MenuAlias" or menu_item == @menu_item) +%label{:for => "menu_item_id_"+menu_item.id.to_s}=menu_item.name +%br +-menu_item.children.find(:all, :order => :position).each do |m| + =render :partial => "form_line", :locals => {:menu_item => m, :f => f} diff --git a/app/views/admin/menu_items/_index_block.html.haml b/app/views/admin/menu_items/_index_block.html.haml new file mode 100644 index 0000000..68fb12c --- /dev/null +++ b/app/views/admin/menu_items/_index_block.html.haml @@ -0,0 +1,30 @@ + + +#menu_item_index_block + + #menu_items_breadcrumbs.QI_box_shadow + = link_to 'Ajouter un élément au menu', new_admin_menu_item_path(:menu_id => @menu.id, :parent_id => params[:parent_id]), :class => "button add_menu_item_link" + -if @menu_parent + + + .receptable{:"data-parent_id" => "no-menu-selected"}=link_to "racine", admin_menu_items_path(:menu_id => @menu.id) + .separate + > + -@menu_parent.ancestors.reverse.each do |menu_item| + .ancest_menu_item.receptable{:"data-parent_id" => (@menu_parent.parent_id || "no-menu-selected")} + =link_to menu_item.name, admin_menu_items_path(:menu_id => @menu.id, :parent_id =>menu_item.id) + .separate + > + .actual=@menu_parent.name + -else + .receptable{:"data-parent_id" => "no-menu-selected"} + racine + + + #sortable_menu_item + .receptable_position{:"data-position" => "1"} + -if @menu_items.size > 0 + =render @menu_items + -else + .no_menu_items + Il n'y a aucun éléments de menu actuellement. diff --git a/app/views/admin/menu_items/_menu_item.html.haml b/app/views/admin/menu_items/_menu_item.html.haml new file mode 100644 index 0000000..c09faf0 --- /dev/null +++ b/app/views/admin/menu_items/_menu_item.html.haml @@ -0,0 +1,26 @@ +#menu_item_row.menu_item_row.draggable{:id => menu_item.id,:"data-menu_item_id" => menu_item.id} + %table + %tr + %td.receptable{:"data-parent_id" => menu_item.id} + =link_to i(:plus, :blue)+"#{menu_item.children.size}", admin_menu_items_path(:menu_id => menu_item.menu_id, :parent_id => menu_item.id) + %td.grip + =i(:move, :blue) + + %td{:style => "width:150px"}=menu_item.menu_content_type.constantize::HUMAN_NAME + + %td{:style => "width:200px"} + =menu_item.name + + %td + ="/"+menu_item.permalink+".html" + + + + + + %td.actions{:style => "width:50px"} + = link_to i(:trash_stroke, :blue), [:admin, menu_item], :confirm => 'Voulez-vous vraiment supprimer cet élément de menu ?', :method => :delete if current_admin.super_admin? || !menu_item.super_admin + + = link_to i(:pen_alt_fill, :blue), edit_admin_menu_item_path(menu_item) + +.receptable_position{:"data-position" => (menu_item.position.to_i+1)} diff --git a/app/views/admin/menu_items/_menu_item_content_form.html.haml b/app/views/admin/menu_items/_menu_item_content_form.html.haml new file mode 100644 index 0000000..9c14336 --- /dev/null +++ b/app/views/admin/menu_items/_menu_item_content_form.html.haml @@ -0,0 +1,7 @@ +#select_menu_item_content_type_bar + -MenuItemContentType.all.each do |menu_item_content_type| + =link_to menu_item_content_type.name, new_admin_menu_item_path(:menu_id => @menu_item.menu_id, :parent_id =>@menu_item.parent_id, :menu_item_content_type => menu_item_content_type.slug ), :remote => true, :class => ("active" if menu_item_content_type.slug == @menu_item.menu_content_type).to_s +.form2=render :partial => "admin/"+@menu_item.menu_content_type.tableize.to_s+"/form", :locals => {:form => form} + +- form.buttons do + = form.commit_button "Sauvegarder" \ No newline at end of file diff --git a/app/views/admin/menu_items/_new_form.html.haml b/app/views/admin/menu_items/_new_form.html.haml new file mode 100644 index 0000000..e22952a --- /dev/null +++ b/app/views/admin/menu_items/_new_form.html.haml @@ -0,0 +1,15 @@ += semantic_form_for [:admin,@menu_item] do |form| + .form1=render :partial => "form", :locals => {:form => form} + + + + #select_menu_item_content_type_bar.bar.dark_blue + -MenuItemContentType.all.each do |menu_item_content_type| + =link_to menu_item_content_type.name, new_admin_menu_item_path(:menu_id => @menu_item.menu_id, :parent_id =>@menu_item.parent_id, :menu_item_content_type => menu_item_content_type.slug ), :onclick => "$('#menu_item_content_form').load($(this).attr('href')+' #menu_item_content_form');$('#select_menu_item_content_type_bar .active').removeClass('active');$(this).addClass('active');return false;",:class => ("active" if menu_item_content_type.slug == @menu_item.menu_content_type).to_s + #menu_item_content_form.form2 + = form.inputs do + = form.input :menu_content_type,:as => :hidden + =render :partial => "admin/"+@menu_item.menu_content_type.tableize.to_s+"/form", :locals => {:form => form} + + = form.buttons do + = form.commit_button "Sauvegarder" diff --git a/app/views/admin/menu_items/_show.html.haml b/app/views/admin/menu_items/_show.html.haml new file mode 100644 index 0000000..430a4b5 --- /dev/null +++ b/app/views/admin/menu_items/_show.html.haml @@ -0,0 +1,15 @@ +#menu_item_show + %table + %tr + %td{:style => "width:150px;"} Nom : + %td=@menu_item.name + %tr + %td Permalink : + %td=@menu_item.permalink + %tr + %td Statut : + %td=@menu_item.enabled ? "Publié" : "Brouillon" + + + + =render @menu_item.menu_content \ No newline at end of file diff --git a/app/views/admin/menu_items/create.html.haml b/app/views/admin/menu_items/create.html.haml new file mode 100644 index 0000000..aee69cb --- /dev/null +++ b/app/views/admin/menu_items/create.html.haml @@ -0,0 +1,2 @@ +=debug @menu_item +=debug @menu_item.content \ No newline at end of file diff --git a/app/views/admin/menu_items/edit.html.haml b/app/views/admin/menu_items/edit.html.haml new file mode 100644 index 0000000..ed47914 --- /dev/null +++ b/app/views/admin/menu_items/edit.html.haml @@ -0,0 +1,15 @@ +.header + .right + =link_to "modifier", edit_admin_menu_item_path(@menu_item), :remote => true,:class => "button" + =link_to "Masquer", "#", :onclick => "$('#edit_pane').toggle();if($(this).html()=='Masquer'){$(this).html('Voir')}else{$(this).html('Masquer')};return false;", :id => "#edit_pane_toggle", :class => "button" + + %h1 + %span.menu_item_name=@menu_item.name + + + + +#edit_pane=render :partial => "show" + +-if @menu_item.menu_content_type == "Page" + =auto_load_div(eval("edit_admin_#{@menu_item.menu_content_type.tableize.singularize}_path(@menu_item.menu_content)")) diff --git a/app/views/admin/menu_items/edit.js.erb b/app/views/admin/menu_items/edit.js.erb new file mode 100644 index 0000000..873445f --- /dev/null +++ b/app/views/admin/menu_items/edit.js.erb @@ -0,0 +1,7 @@ + + +$('#menu_item_edit').replaceWith("<%= escape_javascript(render(:partial => "edit_form")) %>"); +$('#menu_item_show').replaceWith("<%= escape_javascript(render(:partial => "edit_form")) %>"); + +$('#edit_pane_toggle').html('Masquer'); +$('#edit_pane').show(); \ No newline at end of file diff --git a/app/views/admin/menu_items/index.html.haml b/app/views/admin/menu_items/index.html.haml new file mode 100644 index 0000000..da89e70 --- /dev/null +++ b/app/views/admin/menu_items/index.html.haml @@ -0,0 +1,7 @@ +.header + %h1="Liste des éléments du #{@menu.name}" + +.grid_12 + + =render :partial => "index_block" + \ No newline at end of file diff --git a/app/views/admin/menu_items/index.js.erb b/app/views/admin/menu_items/index.js.erb new file mode 100644 index 0000000..8f7cc62 --- /dev/null +++ b/app/views/admin/menu_items/index.js.erb @@ -0,0 +1,2 @@ + +$('#menu_item_index_block').replaceWith("<%= escape_javascript(render(:partial => "index_block")) %>"); \ No newline at end of file diff --git a/app/views/admin/menu_items/new.html.haml b/app/views/admin/menu_items/new.html.haml new file mode 100644 index 0000000..5c02fd1 --- /dev/null +++ b/app/views/admin/menu_items/new.html.haml @@ -0,0 +1,4 @@ +.header + %h1 Ajouter un élément de menu + +=render "new_form" diff --git a/app/views/admin/menu_items/show.html.haml b/app/views/admin/menu_items/show.html.haml new file mode 100644 index 0000000..46de3ad --- /dev/null +++ b/app/views/admin/menu_items/show.html.haml @@ -0,0 +1,2 @@ +%h1 Admin::MenuItems#show +%p Find me in app/views/admin/menu_items/show.html.haml \ No newline at end of file diff --git a/app/views/admin/menu_items/show.js.erb b/app/views/admin/menu_items/show.js.erb new file mode 100644 index 0000000..f8c24f3 --- /dev/null +++ b/app/views/admin/menu_items/show.js.erb @@ -0,0 +1,2 @@ +$('#menu_item_edit').replaceWith("<%= escape_javascript(render(:partial => "show")) %>"); +$('.menu_item_name').html("<%= escape_javascript(@menu_item.name) %>"); \ No newline at end of file diff --git a/app/views/admin/menu_items/update.js.erb b/app/views/admin/menu_items/update.js.erb new file mode 100644 index 0000000..0a5d10a --- /dev/null +++ b/app/views/admin/menu_items/update.js.erb @@ -0,0 +1,3 @@ +$('#menu_item_index_block').replaceWith("<%= escape_javascript(render(:partial => "index_block")) %>"); + + diff --git a/app/views/admin/menu_items/update_reorder_failled.js.erb b/app/views/admin/menu_items/update_reorder_failled.js.erb new file mode 100644 index 0000000..e162849 --- /dev/null +++ b/app/views/admin/menu_items/update_reorder_failled.js.erb @@ -0,0 +1,5 @@ +$('#menu_item_index_block').replaceWith("<%= escape_javascript(render(:partial => "index_block")) %>"); + + + +<%= flashs() %> \ No newline at end of file diff --git a/app/views/admin/menu_urls/_form.html.haml b/app/views/admin/menu_urls/_form.html.haml new file mode 100644 index 0000000..afd9a99 --- /dev/null +++ b/app/views/admin/menu_urls/_form.html.haml @@ -0,0 +1,5 @@ + +=form.semantic_fields_for :menu_content do |content| + - content.inputs do + = content.input :url, :as => :string, :label => "Url :" + \ No newline at end of file diff --git a/app/views/admin/menu_urls/_menu_url.html.haml b/app/views/admin/menu_urls/_menu_url.html.haml new file mode 100644 index 0000000..ae056e7 --- /dev/null +++ b/app/views/admin/menu_urls/_menu_url.html.haml @@ -0,0 +1,4 @@ +%table + %tr + %td{:style => "width:150px;"} Url : + %td=menu_url.url diff --git a/app/views/admin/menu_urls/edit.html.haml b/app/views/admin/menu_urls/edit.html.haml new file mode 100644 index 0000000..e69de29 diff --git a/app/views/admin/menus/_form.html.haml b/app/views/admin/menus/_form.html.haml new file mode 100644 index 0000000..2b32805 --- /dev/null +++ b/app/views/admin/menus/_form.html.haml @@ -0,0 +1,8 @@ +- semantic_form_for [:admin,@menu] do |form| + - form.inputs do + = form.input :name, :label => "Nom :" + = form.input :max_levels, :label => "Nombre de niveau max :" + + + - form.buttons do + = form.commit_button "Sauvegarder" diff --git a/app/views/admin/menus/_index_block.html.haml b/app/views/admin/menus/_index_block.html.haml new file mode 100644 index 0000000..7ab159a --- /dev/null +++ b/app/views/admin/menus/_index_block.html.haml @@ -0,0 +1,43 @@ +#menu_index_block.index_block{:data_add_url => url_for({}.merge!(params).merge!({"format" => "js", "page" => 1, "order" => "created_at", "a_d" => "DESC"})), :data_current_url => url_for({}.merge!(params).merge!({:format => "js"}))} + + + + %table + -if @menus.num_pages > 1 + %tr.pagination + %td.per_page_cel + =per_page_links(params[:per_page], @menus.num_pages) + %td.paginate_cel{:colspan => 4} + = paginate(@menus, :remote => true) + + %table.normal_table + %thead#menu_rows_header.rows_header + + %tr + %td + =link_to_sort_results("Date de création", "created_at") + %td + =link_to_sort_results("Nom", "name") + + + %td.right{:style => "width:70px"} + + + + + %tbody#Admin_rows.rows + + =render @menus + + + %table + %tr.pagination + %td.per_page_cel + + %td.paginate_cel{:colspan => 4} + = paginate(@menus, :remote => true) + + + + + diff --git a/app/views/admin/menus/_menu.html.haml b/app/views/admin/menus/_menu.html.haml new file mode 100644 index 0000000..157c7e6 --- /dev/null +++ b/app/views/admin/menus/_menu.html.haml @@ -0,0 +1,9 @@ +%tr#menu_row.admin_row.row{:id => menu.id, :class => (cycle("row_1", "row_2", :name => "menus"))} + %td=l menu.created_at + %td=menu.name + + + %td.actions + = link_to image_tag("/quartz_admin/icons/round_delete.png"), [:admin, menu], :confirm => 'Voulez-vous vraiment supprimer ce menu ?', :method => :delete + + = link_to image_tag("/quartz_admin/icons/round_edit.png"), edit_admin_menu_path(menu) diff --git a/app/views/admin/menus/edit.html.haml b/app/views/admin/menus/edit.html.haml new file mode 100644 index 0000000..e95d57c --- /dev/null +++ b/app/views/admin/menus/edit.html.haml @@ -0,0 +1,4 @@ +.grid_12 + %h1 Modifier un menu + + =render "form" diff --git a/app/views/admin/menus/index.html.haml b/app/views/admin/menus/index.html.haml new file mode 100644 index 0000000..4957639 --- /dev/null +++ b/app/views/admin/menus/index.html.haml @@ -0,0 +1,5 @@ +.grid_12 + %h1 Gestion des menus + =link_to "Ajouter un menu", new_admin_menu_path + + =render :partial => "index_block" \ No newline at end of file diff --git a/app/views/admin/menus/index.js.erb b/app/views/admin/menus/index.js.erb new file mode 100644 index 0000000..696ccd6 --- /dev/null +++ b/app/views/admin/menus/index.js.erb @@ -0,0 +1,2 @@ + +$('#menu_index_block').replaceWith("<%= escape_javascript(render(:partial => "index_block")) %>"); \ No newline at end of file diff --git a/app/views/admin/menus/new.html.haml b/app/views/admin/menus/new.html.haml new file mode 100644 index 0000000..3e6652a --- /dev/null +++ b/app/views/admin/menus/new.html.haml @@ -0,0 +1,4 @@ +.grid_12 + %h1 Ajouter un menu + + =render "form" diff --git a/app/views/admin/menus/show.html.haml b/app/views/admin/menus/show.html.haml new file mode 100644 index 0000000..a9e8c01 --- /dev/null +++ b/app/views/admin/menus/show.html.haml @@ -0,0 +1,2 @@ +%h1 Admin::Menus#show +%p Find me in app/views/admin/menus/show.html.haml \ No newline at end of file diff --git a/app/views/admin/pages/_form.html.haml b/app/views/admin/pages/_form.html.haml new file mode 100644 index 0000000..31be5b7 --- /dev/null +++ b/app/views/admin/pages/_form.html.haml @@ -0,0 +1,6 @@ + +=form.semantic_fields_for :menu_content do |content| + = content.inputs do + = content.input :title, :as => :string, :label => "Titre :" + = content.input :keywords, :as => :string, :label => "Mots clefs :" + = content.input :description, :as => :string, :label => "Description :" diff --git a/app/views/admin/pages/_page.html.haml b/app/views/admin/pages/_page.html.haml new file mode 100644 index 0000000..6b42e1c --- /dev/null +++ b/app/views/admin/pages/_page.html.haml @@ -0,0 +1,11 @@ +%table + %tr + %td{:style => "width:150px;"} Balise "title" : + %td=page.title + %tr + %td Balise "description" : + %td=page.description + + %tr + %td Balise "keywords" : + %td=page.keywords \ No newline at end of file diff --git a/app/views/admin/pages/edit.html.haml b/app/views/admin/pages/edit.html.haml new file mode 100644 index 0000000..d833801 --- /dev/null +++ b/app/views/admin/pages/edit.html.haml @@ -0,0 +1,8 @@ +.header_2 + %h3 + Blocks : + -@page.blocks.each do |block| + =link_to block.block_name, admin_block_path(block), :data_div_id => "Page_"+@page.id.to_s+"_blocks_part", :class => "update_auto_load_div "+("selected" if block == @page.blocks[0]).to_s + + +=auto_load_div(admin_block_path(@page.blocks[0]),"Page_"+@page.id.to_s+"_blocks_part") \ No newline at end of file diff --git a/app/views/admin/pages/update.html.haml b/app/views/admin/pages/update.html.haml new file mode 100644 index 0000000..88939f4 --- /dev/null +++ b/app/views/admin/pages/update.html.haml @@ -0,0 +1,2 @@ +%h1 Admin::Pages#update +%p Find me in app/views/admin/pages/update.html.haml \ No newline at end of file diff --git a/app/views/admins/confirmations/new.html.haml b/app/views/admins/confirmations/new.html.haml new file mode 100644 index 0000000..810b8ca --- /dev/null +++ b/app/views/admins/confirmations/new.html.haml @@ -0,0 +1,9 @@ +%h2 Resend confirmation instructions += form_for(resource, :as => resource_name, :url => confirmation_path(resource_name), :html => { :method => :post }) do |f| + = devise_error_messages! + %p + = f.label :email + %br/ + = f.text_field :email + %p= f.submit "Resend confirmation instructions" += render :partial => "devise/shared/links" diff --git a/app/views/admins/mailer/confirmation_instructions.html.haml b/app/views/admins/mailer/confirmation_instructions.html.haml new file mode 100644 index 0000000..7840b9c --- /dev/null +++ b/app/views/admins/mailer/confirmation_instructions.html.haml @@ -0,0 +1,4 @@ +%p + Welcome #{@resource.email}! +%p You can confirm your account through the link below: +%p= link_to 'Confirm my account', confirmation_url(@resource, :confirmation_token => @resource.confirmation_token) diff --git a/app/views/admins/mailer/reset_password_instructions.html.haml b/app/views/admins/mailer/reset_password_instructions.html.haml new file mode 100644 index 0000000..968cd38 --- /dev/null +++ b/app/views/admins/mailer/reset_password_instructions.html.haml @@ -0,0 +1,6 @@ +%p + Bonjour #{@resource.email}! +%p Quelqu'un a demandé un lien pour changer votre mot de passe, et vous pouvez le faire en suivant le lien ci-dessous : +%p= link_to edit_password_url(@resource, :reset_password_token => @resource.reset_password_token), edit_password_url(@resource, :reset_password_token => @resource.reset_password_token) +%p Si vous n'avez pas demandé cela, merci d'ignorer ce mail. +%p Votre mot de passe ne sera pas changé tant que vous n'aurez pas suivi ce lien et spécifié un nouveau mot de passe. diff --git a/app/views/admins/mailer/unlock_instructions.html.haml b/app/views/admins/mailer/unlock_instructions.html.haml new file mode 100644 index 0000000..34b0e9e --- /dev/null +++ b/app/views/admins/mailer/unlock_instructions.html.haml @@ -0,0 +1,5 @@ +%p + Hello #{@resource.email}! +%p Your account has been locked due to an excessive amount of unsuccessful sign in attempts. +%p Click the link below to unlock your account: +%p= link_to 'Unlock my account', unlock_url(@resource, :unlock_token => @resource.unlock_token) diff --git a/app/views/admins/passwords/edit.html.haml b/app/views/admins/passwords/edit.html.haml new file mode 100644 index 0000000..0cbfd4e --- /dev/null +++ b/app/views/admins/passwords/edit.html.haml @@ -0,0 +1,18 @@ +-content_for :title do + %h1 Changer mon mot de passe. += form_for(resource, :as => resource_name, :url => password_path(resource_name), :html => { :method => :put }) do |f| + = error_messages_for resource, :header_message => "Impossible d'enregistrer votre nouveau mot de passe." + + + = f.hidden_field :reset_password_token + %p + = f.label :password, "Nouveau mot de passe :" + %br/ + = f.password_field :password + %p + = f.label :password_confirmation, "Confirmation :" + %br/ + = f.password_field :password_confirmation + %p + %button{:type => "submit"} Changer mon mot de passe +%p= link_to "Se connecter", new_session_path(resource_name) diff --git a/app/views/admins/passwords/new.html.haml b/app/views/admins/passwords/new.html.haml new file mode 100644 index 0000000..383ac01 --- /dev/null +++ b/app/views/admins/passwords/new.html.haml @@ -0,0 +1,11 @@ +-content_for :title do + %h1 Mot de passe perdu ? += form_for(resource, :as => resource_name, :url => password_path(resource_name), :html => { :method => :post }) do |f| + + %p + = f.label :email, "Email :" + %br/ + = f.text_field :email + %button{:type => "submot"} Recevoir les instructions pour changer de mot de passe. + +%p= link_to "Se connecter", new_session_path(resource_name) diff --git a/app/views/admins/registrations/edit.html.haml b/app/views/admins/registrations/edit.html.haml new file mode 100644 index 0000000..d252d9a --- /dev/null +++ b/app/views/admins/registrations/edit.html.haml @@ -0,0 +1,27 @@ +%h2 + Edit #{resource_name.to_s.humanize} += form_for(resource, :as => resource_name, :url => registration_path(resource_name), :html => { :method => :put }) do |f| + = devise_error_messages! + %p + = f.label :email + %br/ + = f.text_field :email + %p + = f.label :password + %i (leave blank if you don't want to change it) + %br/ + = f.password_field :password + %p + = f.label :password_confirmation + %br/ + = f.password_field :password_confirmation + %p + = f.label :current_password + %i (we need your current password to confirm your changes) + %br/ + = f.password_field :current_password + %p= f.submit "Update" +%h3 Cancel my account +%p + Unhappy? #{link_to "Cancel my account", registration_path(resource_name), :confirm => "Are you sure?", :method => :delete}. += link_to "Back", :back diff --git a/app/views/admins/registrations/new.html.haml b/app/views/admins/registrations/new.html.haml new file mode 100644 index 0000000..b03da35 --- /dev/null +++ b/app/views/admins/registrations/new.html.haml @@ -0,0 +1,17 @@ +%h2 Sign up += form_for(resource, :as => resource_name, :url => registration_path(resource_name)) do |f| + = devise_error_messages! + %p + = f.label :email + %br/ + = f.text_field :email + %p + = f.label :password + %br/ + = f.password_field :password + %p + = f.label :password_confirmation + %br/ + = f.password_field :password_confirmation + %p= f.submit "Sign up" += render :partial => "devise/shared/links" diff --git a/app/views/admins/sessions/new.html.haml b/app/views/admins/sessions/new.html.haml new file mode 100644 index 0000000..197ff4d --- /dev/null +++ b/app/views/admins/sessions/new.html.haml @@ -0,0 +1,21 @@ +-content_for :title do + %h1 Espace d'administration += form_for(resource, :as => resource_name, :url => session_path(resource_name)) do |f| + %p + = f.label :login, "Email ou Login:" + %br/ + = f.text_field :login + + %p + = f.label :password, "Mot de passe :" + %br/ + = f.password_field :password + + %p + = f.check_box :remember_me + = f.label :remember_me, "Se rappeler de moi (connexion automatique)" + + %button{:type => "submit"} Connexion + + +%p= link_to "Mot de passe perdu ?", new_password_path(resource_name) diff --git a/app/views/admins/shared/_links.haml b/app/views/admins/shared/_links.haml new file mode 100644 index 0000000..a754735 --- /dev/null +++ b/app/views/admins/shared/_links.haml @@ -0,0 +1,15 @@ +- if controller_name != 'sessions' + = link_to "Sign in", new_session_path(resource_name) + %br/ +- if devise_mapping.registerable? && controller_name != 'registrations' + = link_to "Sign up", new_registration_path(resource_name) + %br/ +- if devise_mapping.recoverable? && controller_name != 'passwords' + = link_to "Forgot your password?", new_password_path(resource_name) + %br/ +- if devise_mapping.confirmable? && controller_name != 'confirmations' + = link_to "Didn't receive confirmation instructions?", new_confirmation_path(resource_name) + %br/ +- if devise_mapping.lockable? && resource_class.unlock_strategy_enabled?(:email) && controller_name != 'unlocks' + = link_to "Didn't receive unlock instructions?", new_unlock_path(resource_name) + %br/ diff --git a/app/views/admins/unlocks/new.html.haml b/app/views/admins/unlocks/new.html.haml new file mode 100644 index 0000000..afb0daa --- /dev/null +++ b/app/views/admins/unlocks/new.html.haml @@ -0,0 +1,9 @@ +%h2 Resend unlock instructions += form_for(resource, :as => resource_name, :url => unlock_path(resource_name), :html => { :method => :post }) do |f| + = devise_error_messages! + %p + = f.label :email + %br/ + = f.text_field :email + %p= f.submit "Resend unlock instructions" += render :partial => "devise/shared/links" diff --git a/app/views/download_data_files/index.html.haml b/app/views/download_data_files/index.html.haml new file mode 100644 index 0000000..b6bd1fc --- /dev/null +++ b/app/views/download_data_files/index.html.haml @@ -0,0 +1,2 @@ +%h1 DownloadDataFiles#index +%p Find me in app/views/download_data_files/index.html.haml \ No newline at end of file diff --git a/app/views/general/send_newsletter.html.erb b/app/views/general/send_newsletter.html.erb new file mode 100644 index 0000000..12db676 --- /dev/null +++ b/app/views/general/send_newsletter.html.erb @@ -0,0 +1,54 @@ + + + +R-Renaissance - La Fête des Mères approche … + + + + + +
+ + +
+
+<%=raw @newsletter %> +
+
+Vous recevez cet email car vous êtes adhérent à la FCPE du lycée Pierre Beghin, à Moirans. Si vous ne souhaitez plus recevoir de mail de notre part, envoyez nous un email à secretaire@fcpe-lycee-moirans.fr en précisant bien votre adresse mail. +
+
+
+ + + + \ No newline at end of file diff --git a/app/views/kaminari/_current_page.html.haml b/app/views/kaminari/_current_page.html.haml new file mode 100644 index 0000000..ff94f26 --- /dev/null +++ b/app/views/kaminari/_current_page.html.haml @@ -0,0 +1,9 @@ +-# The current page + - available local variables + page: the page number of this page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.page.current + = page diff --git a/app/views/kaminari/_first_page_link.html.haml b/app/views/kaminari/_first_page_link.html.haml new file mode 100644 index 0000000..d753d12 --- /dev/null +++ b/app/views/kaminari/_first_page_link.html.haml @@ -0,0 +1,11 @@ +-# Link with page number that appears at the leftmost + - available local variables + page: the page number of this page + url: url to this page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.page.first + = link_to page, url+("&page=1"if page == 1).to_s, :remote => remote + diff --git a/app/views/kaminari/_last_page_link.html.haml b/app/views/kaminari/_last_page_link.html.haml new file mode 100644 index 0000000..138a6d5 --- /dev/null +++ b/app/views/kaminari/_last_page_link.html.haml @@ -0,0 +1,10 @@ +-# Link with page number that appears at the rightmost + - available local variables + page: the page number of this page + url: url to this page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.page.last + = link_to page, url, :remote => remote diff --git a/app/views/kaminari/_next_link.html.haml b/app/views/kaminari/_next_link.html.haml new file mode 100644 index 0000000..6355245 --- /dev/null +++ b/app/views/kaminari/_next_link.html.haml @@ -0,0 +1,9 @@ +-# "Next" with link + - available local variables + url: url to the next page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.next + = link_to ">", url, :class => 'next', :rel => 'next', :remote => remote diff --git a/app/views/kaminari/_next_span.html.haml b/app/views/kaminari/_next_span.html.haml new file mode 100644 index 0000000..e4ebab0 --- /dev/null +++ b/app/views/kaminari/_next_span.html.haml @@ -0,0 +1,7 @@ +-# "Next" without link + - available local variables + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.next diff --git a/app/views/kaminari/_page_link.html.haml b/app/views/kaminari/_page_link.html.haml new file mode 100644 index 0000000..f3dda88 --- /dev/null +++ b/app/views/kaminari/_page_link.html.haml @@ -0,0 +1,10 @@ +-# Link showing page number + - available local variables + page: the page number of this page + url: url to this page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.page + = link_to page, url, :remote => remote diff --git a/app/views/kaminari/_paginator.html.haml b/app/views/kaminari/_paginator.html.haml new file mode 100644 index 0000000..2dbfe1c --- /dev/null +++ b/app/views/kaminari/_paginator.html.haml @@ -0,0 +1,23 @@ +-# The container tag + - available local variables + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote + paginator: the paginator that renders the pagination tags inside += paginator.render do + %nav.pagination + = current_page > 1 ? prev_link_tag : prev_span_tag + - each_page do |page| + - if page.current? + = current_page_tag + - elsif page.left_outer? || page.right_outer? || page.inside_window? + - if page.first? + = first_page_link_tag + - elsif page.last? + = last_page_link_tag + - else + = page_link_tag + - elsif !page.was_truncated? + = truncated_span_tag + = num_pages > current_page ? next_link_tag : next_span_tag diff --git a/app/views/kaminari/_prev_link.html.haml b/app/views/kaminari/_prev_link.html.haml new file mode 100644 index 0000000..677f0be --- /dev/null +++ b/app/views/kaminari/_prev_link.html.haml @@ -0,0 +1,9 @@ +-# "Previous" with link + - available local variables + url: url to the previous page + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.prev + = link_to "<", url+("&page=1"if (page) == 1).to_s, :class => 'prev', :rel => 'prev', :remote => remote diff --git a/app/views/kaminari/_prev_span.html.haml b/app/views/kaminari/_prev_span.html.haml new file mode 100644 index 0000000..b8a8b61 --- /dev/null +++ b/app/views/kaminari/_prev_span.html.haml @@ -0,0 +1,7 @@ +-# "Previous" without link + - available local variables + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.prev diff --git a/app/views/kaminari/_truncated_span.html.haml b/app/views/kaminari/_truncated_span.html.haml new file mode 100644 index 0000000..cc1f26c --- /dev/null +++ b/app/views/kaminari/_truncated_span.html.haml @@ -0,0 +1,8 @@ +-# Non-link tag that stands for skipped pages... + - available local variables + current_page: the page number of currently displayed page + num_pages: total number of pages + per_page: number of items to fetch per page + remote: data-remote +%span.page + ="..." diff --git a/app/views/layouts/admin.html.haml b/app/views/layouts/admin.html.haml new file mode 100644 index 0000000..791fa17 --- /dev/null +++ b/app/views/layouts/admin.html.haml @@ -0,0 +1,124 @@ + + +%html{:lang => "fr"} + %head + %meta{:"http-equiv" => "content-type" ,:content =>"text/html;charset=UTF-8" } + %title + Administration + + :javascript + GENTICS_Aloha_base = "/aloha/" + + = csrf_meta_tag + + + =javascript_include_tag "/assets/javascripts/core/jquery-1.6.1.min.js" + + =javascript_include_tag "/assets/javascripts/core/jquery.reject.min.js" + =javascript_include_tag "/assets/javascripts/core/rails.js" + + + + + + =javascript_include_tag "/assets/javascripts/core/jquery-ui.min.js" + + =javascript_include_tag "/assets/javascripts/core/jcarousellite_1.0.1.min.js" + =javascript_include_tag "/assets/javascripts/core/jquery.easing.compatibility.js" + =javascript_include_tag "/assets/javascripts/core/jquery.prettyPhoto.js" + + =javascript_include_tag "/assets/javascripts/core/jquery.fileupload.js" + =javascript_include_tag "/assets/javascripts/core/jquery.fileupload-ui.js" + =javascript_include_tag "/assets/javascripts/core/tiny_mce/jquery.tinymce.js" + + + + =javascript_include_tag '/assets/javascripts/admin/admin' + =javascript_include_tag '/assets/javascripts/admin/pane_hover' + =javascript_include_tag '/assets/javascripts/admin/menu_items' + =javascript_include_tag '/assets/javascripts/admin/block' + + =javascript_include_tag '/assets/javascripts/admin/manager/data_files' + =javascript_include_tag '/assets/javascripts/admin/manager/image_files' + =javascript_include_tag '/assets/javascripts/admin/manager/manager' + =javascript_include_tag '/assets/javascripts/admin/manager/uploads' + + + = stylesheet_link_tag '/assets/stylesheets/admin/admin' + = stylesheet_link_tag '/assets/stylesheets/qi/general' + = stylesheet_link_tag '/assets/stylesheets/qi/forms' + = stylesheet_link_tag '/assets/stylesheets/qi/qi' + + = stylesheet_link_tag '/assets/stylesheets_core/jquery.fileupload-ui.css' + = stylesheet_link_tag '/assets/stylesheets_core/ui-lightness/jquery-ui-1.8.11.custom.css' + = stylesheet_link_tag '/assets/stylesheets_core/formtastic' + + + + + + + + + + + + + %body + #manager_box_place + #manager_box + + + + + + #breadcrumb + =#%span{:onclick => '$("#main_slide .page_slide_content").css("width", $(this).parent().outerWidth());$("#main_slide").css("margin-left", "-"+$(this).parent().outerWidth()+"px")//$("#main_slide").animate({width: "toggle"});'} dfsdf + =link_to "Se déconnecter", destroy_admin_session_path, :class => "logout_link" + =render_navigation(:renderer => :breadcrumbs, :join_with => ' > ') + + + + .page_slide#main_slide + .page_slide_content + .container_12 + + = yield + .clear + + + + =# #big_slider + =# #page_slides + =# .page_slide#main_slide + =# .page_slide_content + =# .container_12 + + =# = yield + =# .clear + + =# .page_slide + =# .page_slide_content + =# .container_12 + + =# =# yield + =# .clear + =# .clear + + + + + + + + #flash + + -if flash[:alert] or (@flash_i and @flash_i[:alert]) + .message.closeable.alert + = flash[:alert] + = @flash_i[:alert] if @flash_i and @flash_i[:alert] + -if flash[:notice] + .message.closeable.notice + = flash[:notice] + + diff --git a/app/views/layouts/application.js.erb b/app/views/layouts/application.js.erb new file mode 100644 index 0000000..8a0453e --- /dev/null +++ b/app/views/layouts/application.js.erb @@ -0,0 +1,2 @@ +<%= flashs() %> +<%= yield %> \ No newline at end of file diff --git a/app/views/layouts/connexion.html.haml b/app/views/layouts/connexion.html.haml new file mode 100644 index 0000000..64bb518 --- /dev/null +++ b/app/views/layouts/connexion.html.haml @@ -0,0 +1,45 @@ +!!! + +%html{:xmlns=>"http://www.w3.org/1999/xhtml", :"xml:lang"=>"fr", :lang=>"fr"} + %head + %meta{:"http-equiv" => "content-type" ,:content =>"text/html;charset=UTF-8" } + %title + Administration + + + + = csrf_meta_tag + + =javascript_include_tag "/assets/javascripts/core/jquery-1.6.1.min.js" + =javascript_include_tag "/assets/javascripts/core/jquery.reject.min.js" + =javascript_include_tag '/assets/javascripts/admin/browser.js' + + = stylesheet_link_tag '/assets/stylesheets/connexion' + = stylesheet_link_tag '/assets/stylesheets/qi/general' + = stylesheet_link_tag '/assets/stylesheets/qi/forms' + + + + + + + %body + #title=yield :title + #main + + + + = yield + #flash + -if flash[:alert] or (@flash_i and @flash_i[:alert]) + .message.closeable.alert + = flash[:alert] + = @flash_i[:alert] if @flash_i and @flash_i[:alert] + -if flash[:notice] + .message.closeable.notice + = flash[:notice] + + + + + diff --git a/app/views/layouts/public.html.haml b/app/views/layouts/public.html.haml new file mode 100644 index 0000000..92adc43 --- /dev/null +++ b/app/views/layouts/public.html.haml @@ -0,0 +1,131 @@ +!!! + +%html{:xmlns=>"http://www.w3.org/1999/xhtml", :"xml:lang"=>"fr", :lang=>"fr"} + %head + %meta{:"http-equiv" => "content-type" ,:content =>"text/html;charset=UTF-8" } + %title=@title || "" + %meta{:name => "keywords", :content => @keywords || "" } + %meta{:name => "description", :content => @description || "" } + + = javascript_include_tag "/javascripts/core/jquery-1.4.2.js" + = javascript_include_tag "/javascripts/core/jquery-ui-1.8.2.js" + + = javascript_include_tag 'front' + + = csrf_meta_tag + = javascript_include_tag "plugins/jquery.prettyPhoto" + = javascript_include_tag "plugins/jquery.cycle.all" + + + + + = stylesheet_link_tag 'front' + = stylesheet_link_tag 'plugins/prettyPhoto' + + + + + + + + %body + #struct + #struct_top + %a{:name => "back_to_top"} + =link_to image_tag( "/front/logo.png", :alt => "accescible spécialiste contrôle d'accès, interphones, haute savoie, suisse, genève, annemasse"), "/", :id => "logo", :title => "accescible spécialiste contrôle d'accès, interphones, haute savoie, suisse, genève, annemasse" + .menu_first_level + + -MenuItem.find(:all, :conditions => {:parent_id =>nil, :enabled => true}, :order => :position, :limit => 7).each do |mi| + -if mi.slug != "accueil" + =menu_item_link mi + + + + -if @menu_item and @menu_item.slug == "accueil" + #main2 + #digicode + + #diapo{:style => "height:245px"} + -menu_item = MenuItem.find_by_slug('nos-installations') || MenuItem.first + -ImageFile.all(:conditions => {:home => true}).each do |sample| + + + .item + =link_to image_tag( sample.file.large.medium.small.url, :style => "width:370px"), menu_item_path(:url => menu_item.url) + + + .title + =link_to sample.name, menu_item_path(:url => menu_item.url) + + + + #infos_buttons + #title2 + #legend2 + + =link_to "", "", :id => "fleche-left", :title => "accescible spécialiste contrôle d'accès, interphones, haute savoie, suisse, genève, annemasse" + =link_to "", "", :id => "fleche-right", :title => "accescible spécialiste contrôle d'accès, interphones, haute savoie, suisse, genève, annemasse" + + =lien_bouton(1,"qui-sommes-nous") + =lien_bouton(2,"nos-produits") + =lien_bouton(3,"nos-partenaires") + =lien_bouton(4,"nos-clients") + =lien_bouton(5,"notre-equipe") + =lien_bouton(6,"notre-savoir-faire") + =lien_bouton(7,"nos-installations") + =lien_bouton(8,"nos-tarifs") + =lien_bouton(9,"contacts") + =lien_bouton(0,"telechargez-notre-plaquette-de-presentation") + + #accueil_corps=yield :body + %p{:style => "clear:both;"} + %br + -else + =yield :center + .rounded_block + #main + + #sidebar + #content=yield :sidebar + #corps=yield :body + + + %p{:style => "clear:both;"} + %br + + #struct_bottom + + + .menu_first_level + -MenuItem.find(:all, :conditions => {:parent_id =>nil, :enabled => true}, :order => :position,:limit => 6, :offset => 7).each do |mi| + =menu_item_link mi + %a{:href => "#back_to_top"} Retour en haut de page + + %br + %br + %br + %br + %br + + + + + + + + + + + \ No newline at end of file diff --git a/app/views/portlet/block_contents/_block_content.html.haml b/app/views/portlet/block_contents/_block_content.html.haml new file mode 100644 index 0000000..ec83a29 --- /dev/null +++ b/app/views/portlet/block_contents/_block_content.html.haml @@ -0,0 +1,18 @@ + +-if block_content.nbr_columns == 1 + -block_content.blocks.each do |block| + + .container_12{:style => "padding:0px;"} + .grid_12 + =render :partial => "admin/blocks/block", :locals => {:block => block} + .clear +-else + .container_12{:style => "padding:0px;"} + -i = 0 + -block_content.blocks.each do |block| + -i+=1 + .grid_6.col{:class => ("col_"+i.to_s)} + + =render :partial => "admin/blocks/block", :locals => {:block => block} + + .clear \ No newline at end of file diff --git a/app/views/portlet/block_contents/_form.html.haml b/app/views/portlet/block_contents/_form.html.haml new file mode 100644 index 0000000..2c8e849 --- /dev/null +++ b/app/views/portlet/block_contents/_form.html.haml @@ -0,0 +1,25 @@ + +=form_for( [:portlet, @block_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + -if !@block_content.id + %table + %tr + %td Nombre de colonnes : + %td + -if 1==2 + %p + =f.radio_button :nbr_columns, 1 + Une colonne + %p + =f.radio_button :nbr_columns, 2 + Deux colonnes + + -if BlockContent::STYLES.size > 0 + Style : + = f.select :style, BlockContent::STYLES + %br + =f.submit "Sauvegarder" + diff --git a/app/views/portlet/break_contents/_break_content.html.haml b/app/views/portlet/break_contents/_break_content.html.haml new file mode 100644 index 0000000..a287381 --- /dev/null +++ b/app/views/portlet/break_contents/_break_content.html.haml @@ -0,0 +1 @@ +%hr \ No newline at end of file diff --git a/app/views/portlet/break_contents/_form.html.haml b/app/views/portlet/break_contents/_form.html.haml new file mode 100644 index 0000000..96e4222 --- /dev/null +++ b/app/views/portlet/break_contents/_form.html.haml @@ -0,0 +1,17 @@ +=form_for( [:portlet, @break_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + %table.form_table + %tr + %td Trait ? + %td=f.check_box :line + + -if BreakContent::STYLES.size > 0 + %tr + %td Style : + %td= f.select :style, BreakContent::STYLES + + =f.submit 'Sauvegarder' + diff --git a/app/views/portlet/download_contents/_download_content.html.haml b/app/views/portlet/download_contents/_download_content.html.haml new file mode 100644 index 0000000..701df56 --- /dev/null +++ b/app/views/portlet/download_contents/_download_content.html.haml @@ -0,0 +1,8 @@ + +%p + Titre : + =download_content.title + +%p + Téléchargement : + =download_content.data_file.abstract_file_name if download_content.data_file diff --git a/app/views/portlet/download_contents/_form.html.haml b/app/views/portlet/download_contents/_form.html.haml new file mode 100644 index 0000000..2a6f266 --- /dev/null +++ b/app/views/portlet/download_contents/_form.html.haml @@ -0,0 +1,37 @@ +=form_for( [:portlet, @download_content], :remote => true) do |f| + + + + %table.form_table + + %tr + %td Titre : + %td=f.text_field :title + + %tr + %td + -r = rand(1000000000000000000000000000) + Fichier : + %td + #name{:id => r} + =f.object.data_file.abstract_file_name if f.object.data_file + =f.hidden_field :data_file_id, :id => "input_"+r.to_s + + =link_to "Modifier ce fichier", "#", :onclick => "select_file_from_manager('"+r.to_s+"');return false;" + + + + -if DownloadContent::STYLES.size >0 + %tr + %td Style : + %td= f.select :style, DownloadContent::STYLES + + + + + =f.submit "Sauvegarder" + + + + + diff --git a/app/views/portlet/dynamic_contents/_dynamic_content.html.haml b/app/views/portlet/dynamic_contents/_dynamic_content.html.haml new file mode 100644 index 0000000..aa8aa31 --- /dev/null +++ b/app/views/portlet/dynamic_contents/_dynamic_content.html.haml @@ -0,0 +1 @@ +=DynamicContent::NAMES[dynamic_content.name] if dynamic_content.name \ No newline at end of file diff --git a/app/views/portlet/dynamic_contents/_form.html.haml b/app/views/portlet/dynamic_contents/_form.html.haml new file mode 100644 index 0000000..defd7d6 --- /dev/null +++ b/app/views/portlet/dynamic_contents/_form.html.haml @@ -0,0 +1,18 @@ +=form_for( [:portlet, @dynamic_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + %table.form_table + + %tr + + %td= f.select :name, DynamicContent::NAMES.map {|u| [u[1], u[0]] } + + + + + + + =f.submit 'Sauvegarder' + diff --git a/app/views/portlet/gallery_contents/_form.html.haml b/app/views/portlet/gallery_contents/_form.html.haml new file mode 100644 index 0000000..06fd483 --- /dev/null +++ b/app/views/portlet/gallery_contents/_form.html.haml @@ -0,0 +1,11 @@ += semantic_form_for [:portlet, @gallery_content], :remote => true do |form| + + = form.inputs do + = form.input :name, :label => "Titre :" + = form.input :description, :label => "Description :", :as => :text, :input_html => {:class => "text_editor"} + + + = form.buttons do + = form.commit_button "Sauvegarder" + + diff --git a/app/views/portlet/gallery_contents/_gallery_content.html.haml b/app/views/portlet/gallery_contents/_gallery_content.html.haml new file mode 100644 index 0000000..653b29d --- /dev/null +++ b/app/views/portlet/gallery_contents/_gallery_content.html.haml @@ -0,0 +1,24 @@ +%h2=gallery_content.name +.description + =raw gallery_content.description + +.add_gallery_images=link_to "Ajouter des images", "#", :onclick => "select_gallery_images_from_manager('"+gallery_content.id.to_s+"');return false;", :class => "button" + +.gallery_images + =render :collection => gallery_content.gallery_images, :partial => "portlet/gallery_images/gallery_image" + %p{:style => "clear:both;"} + +:javascript + $('.gallery_images').sortable({ + cursorAt: 0, + opacity:0.5, + update : function () { + var order = $(this).sortable('serialize'); + + $.ajax({url : "/portlet/gallery_images/reorder.js?"+order}); + } + + }); + + + \ No newline at end of file diff --git a/app/views/portlet/gallery_images/_form.html.haml b/app/views/portlet/gallery_images/_form.html.haml new file mode 100644 index 0000000..7deddc6 --- /dev/null +++ b/app/views/portlet/gallery_images/_form.html.haml @@ -0,0 +1,10 @@ += semantic_form_for [:portlet, @gallery_image], :remote => true do |form| + .content + = form.inputs do + = form.input :title, :label => "Titre :" + = form.input :description, :label => "Description :", :as => :text, :input_html => {:class => "text_editor"} + + + .actions= form.submit "Sauvegarder" + + diff --git a/app/views/portlet/gallery_images/_gallery_image.html.haml b/app/views/portlet/gallery_images/_gallery_image.html.haml new file mode 100644 index 0000000..97067b6 --- /dev/null +++ b/app/views/portlet/gallery_images/_gallery_image.html.haml @@ -0,0 +1,9 @@ +-if gallery_image.image_file + .gallery_image.image_square#gallery_image{:id => gallery_image.id, :"data-title" => gallery_image.title , :"data-description" => gallery_image.description } + .img{:style => "background-image : url('#{gallery_image.image_file.file.large.medium.small.thumb.url}');"} + + .actions + =link_to i(:trash_stroke, :gray_light, 12), [:portlet, gallery_image], :confirm => 'Voulez-vous vraiment supprimer cette image ?', :method => :delete, :remote => true + =link_to i(:pen_alt_fill, :gray_light, 12), edit_portlet_gallery_image_path(gallery_image), :remote => true + + \ No newline at end of file diff --git a/app/views/portlet/gallery_images/create.js.erb b/app/views/portlet/gallery_images/create.js.erb new file mode 100644 index 0000000..8b50597 --- /dev/null +++ b/app/views/portlet/gallery_images/create.js.erb @@ -0,0 +1 @@ +$('#portlet_<%= @gallery_content.portlet.id %> .gallery_images').prepend("<%= escape_javascript(render(@gallery_images)) %>"); \ No newline at end of file diff --git a/app/views/portlet/gallery_images/destroy.js.erb b/app/views/portlet/gallery_images/destroy.js.erb new file mode 100644 index 0000000..e97094c --- /dev/null +++ b/app/views/portlet/gallery_images/destroy.js.erb @@ -0,0 +1,4 @@ + +$("#gallery_image_<%= @gallery_image.id.to_s %>").fadeOut(500).delay(6000).remove(); + +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/gallery_images/edit.js.erb b/app/views/portlet/gallery_images/edit.js.erb new file mode 100644 index 0000000..3d94bc2 --- /dev/null +++ b/app/views/portlet/gallery_images/edit.js.erb @@ -0,0 +1 @@ +show_pane_hover("<%= escape_javascript(render(:partial => "form"))%>"); \ No newline at end of file diff --git a/app/views/portlet/gallery_images/new.html.haml b/app/views/portlet/gallery_images/new.html.haml new file mode 100644 index 0000000..2d47d2f --- /dev/null +++ b/app/views/portlet/gallery_images/new.html.haml @@ -0,0 +1,2 @@ +%h1 Portlet::GalleryImages#new +%p Find me in app/views/portlet/gallery_images/new.html.haml \ No newline at end of file diff --git a/app/views/portlet/gallery_images/reorder.js.erb b/app/views/portlet/gallery_images/reorder.js.erb new file mode 100644 index 0000000..e69de29 diff --git a/app/views/portlet/gallery_images/show.html.haml b/app/views/portlet/gallery_images/show.html.haml new file mode 100644 index 0000000..d5127e5 --- /dev/null +++ b/app/views/portlet/gallery_images/show.html.haml @@ -0,0 +1,2 @@ +%h1 Portlet::GalleryImages#show +%p Find me in app/views/portlet/gallery_images/show.html.haml \ No newline at end of file diff --git a/app/views/portlet/gallery_images/update.js.erb b/app/views/portlet/gallery_images/update.js.erb new file mode 100644 index 0000000..db16dd2 --- /dev/null +++ b/app/views/portlet/gallery_images/update.js.erb @@ -0,0 +1,2 @@ +close_pane_hover(); +$('#gallery_image_<%= @gallery_image.id %>').effect("highlight", 1000); \ No newline at end of file diff --git a/app/views/portlet/html_contents/_form.html.haml b/app/views/portlet/html_contents/_form.html.haml new file mode 100644 index 0000000..62f2127 --- /dev/null +++ b/app/views/portlet/html_contents/_form.html.haml @@ -0,0 +1,16 @@ +=form_for( [:portlet, @html_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + =f.text_area :content, :style => "width:98%;height:400px;", :class => "inputText" + + -if HtmlContent::STYLES.size > 0 + %table.form_table + %tr + %td Style : + %td= f.select :style, HtmlContent::STYLES + + + =f.submit 'Sauvegarder' + diff --git a/app/views/portlet/html_contents/_html_content.html.haml b/app/views/portlet/html_contents/_html_content.html.haml new file mode 100644 index 0000000..3225efc --- /dev/null +++ b/app/views/portlet/html_contents/_html_content.html.haml @@ -0,0 +1 @@ +HTML \ No newline at end of file diff --git a/app/views/portlet/image_contents/_form.html.haml b/app/views/portlet/image_contents/_form.html.haml new file mode 100644 index 0000000..11e4d62 --- /dev/null +++ b/app/views/portlet/image_contents/_form.html.haml @@ -0,0 +1,45 @@ +=form_for( [:portlet, @image_content], :remote => true) do |f| + + + %table.form_table + %tr + %td + -r = rand(1000000000000000000000000000) + -if f.object.image_file + =image_tag f.object.image_file.file.large.medium.small.thumb.url, :id => "img_"+r.to_s + -else + =image_tag "", :id => "img_"+r.to_s + + + %td + + =f.hidden_field :image_file_id, :class => "inputText", :id => "input_"+r.to_s + =link_to "Modifier cette image", "#", :onclick => "select_image_from_manager('"+r.to_s+"');return false;" + + + %tr + %td + Texte alternatif : + %td=f.text_field :alt, :class => "inputText", :id => "name_"+r.to_s + + %tr + %td Alignement : + %td= f.select :alignement, ImageContent::ALIGNS + + %tr + %td Style : + %td= f.select :style, ImageContent::STYLES + + %tr + %td L'image peut être agrandie ? : + %td=f.check_box :expandable + + + + + + + + + =f.submit 'Sauvegarder' + diff --git a/app/views/portlet/image_contents/_image_content.html.haml b/app/views/portlet/image_contents/_image_content.html.haml new file mode 100644 index 0000000..b51231c --- /dev/null +++ b/app/views/portlet/image_contents/_image_content.html.haml @@ -0,0 +1,31 @@ + +-if image_content.image_file + + -if image_content.style== "1" + -url =image_content.image_file.file.large.medium.url + + -elsif image_content.style== "2" + -url =image_content.image_file.file.large.medium.small.url + + -elsif image_content.style== "3" + -url =image_content.image_file.file.square.url + + -elsif image_content.style== "4" + -url =image_content.image_file.file.large.medium.small.thumb.url + +-else + -url ="" +-style = "" +-style = "text-align:center;" if image_content.alignement == "center" + + +-style = "text-align:right;" if image_content.alignement == "right" + + +-style = "text-align:left;" if image_content.alignement == "left" + +%p.img{:style =>style} + =image_tag(url, :alt => image_content.alt.to_s) + + +="L'image peut être agrandie si l'on clique dessus" if image_content.expandable \ No newline at end of file diff --git a/app/views/portlet/link_contents/_alias_form_line.html.haml b/app/views/portlet/link_contents/_alias_form_line.html.haml new file mode 100644 index 0000000..2998bfd --- /dev/null +++ b/app/views/portlet/link_contents/_alias_form_line.html.haml @@ -0,0 +1,7 @@ +-menu_item.ancestors.size.times do +    +=f.radio_button :menu_item_id, menu_item.id, :disabled => ("disabled" if menu_item.menu_content_type =="MenuAlias") +%label{:for => params[:resource].to_s+"_cible_attributes_menu_item_id_"+menu_item.id.to_s}=menu_item.name +%br +-menu_item.children.find(:all, :order => :position).each do |m| + =render :partial => "portlet/link_contents/alias_form_line", :locals => {:f => f, :menu_item => m} diff --git a/app/views/portlet/link_contents/_cible_alias.html.haml b/app/views/portlet/link_contents/_cible_alias.html.haml new file mode 100644 index 0000000..bb63453 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_alias.html.haml @@ -0,0 +1,2 @@ +Lien vers l'élément de menu +=cible.menu_item.name if cible.menu_item \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_alias_form.html.haml b/app/views/portlet/link_contents/_cible_alias_form.html.haml new file mode 100644 index 0000000..6cb465f --- /dev/null +++ b/app/views/portlet/link_contents/_cible_alias_form.html.haml @@ -0,0 +1,5 @@ +=form.semantic_fields_for :cible do |cible| + = cible.inputs do + + -MenuItem.find(:all, :conditions => {:parent_id => nil}, :order => :position).each do |m| + =render :partial => "portlet/link_contents/alias_form_line", :locals => {:f => cible, :menu_item => m} \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_article.html.haml b/app/views/portlet/link_contents/_cible_article.html.haml new file mode 100644 index 0000000..5a462d7 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_article.html.haml @@ -0,0 +1,2 @@ +Lien vers l'article +=cible.article.title if cible.article \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_article_form.html.haml b/app/views/portlet/link_contents/_cible_article_form.html.haml new file mode 100644 index 0000000..a749532 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_article_form.html.haml @@ -0,0 +1,13 @@ + +=form.semantic_fields_for :cible do |cible| + = cible.inputs do + -Folder.all.each do |folder| + + %h4=folder.title + + -folder.articles.each do |article| + %p + =cible.radio_button :article_id, article.id + %label{:for => "link_content_cible_attributes_article_id_"+article.id.to_s}=article.title + %br + %br \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_folder.html.haml b/app/views/portlet/link_contents/_cible_folder.html.haml new file mode 100644 index 0000000..bcb10e2 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_folder.html.haml @@ -0,0 +1,2 @@ +Lien vers le dossier +=cible.folder.title if cible.folder \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_folder_form.html.haml b/app/views/portlet/link_contents/_cible_folder_form.html.haml new file mode 100644 index 0000000..901c1ae --- /dev/null +++ b/app/views/portlet/link_contents/_cible_folder_form.html.haml @@ -0,0 +1,8 @@ + +=form.semantic_fields_for :cible do |cible| + = cible.inputs do + -Folder.all.each do |folder| + %p + =cible.radio_button :folder_id, folder.id + %label{:for => "link_content_cible_attributes_folder_id_"+folder.id.to_s}=folder.title + \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_url.html.haml b/app/views/portlet/link_contents/_cible_url.html.haml new file mode 100644 index 0000000..4b653f1 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_url.html.haml @@ -0,0 +1,2 @@ +Lien vers l'url +=cible.url \ No newline at end of file diff --git a/app/views/portlet/link_contents/_cible_url_form.html.haml b/app/views/portlet/link_contents/_cible_url_form.html.haml new file mode 100644 index 0000000..8458283 --- /dev/null +++ b/app/views/portlet/link_contents/_cible_url_form.html.haml @@ -0,0 +1,6 @@ + + + +=form.semantic_fields_for :cible do |cible| + = cible.inputs do + = cible.input :url, :as => :string, :label => "Url :" diff --git a/app/views/portlet/link_contents/_form.html.haml b/app/views/portlet/link_contents/_form.html.haml new file mode 100644 index 0000000..38c0b88 --- /dev/null +++ b/app/views/portlet/link_contents/_form.html.haml @@ -0,0 +1,28 @@ += semantic_form_for [:portlet, @link_content], :remote => true do |form| + + .form1 + = form.inputs do + = form.input :name, :label => "Texte à afficher :" + =# form.input :title, :label => "Title :" + = form.input :popup,:as => :boolean , :label => "Ouvrir dans une nouvelle fenêtre ?" + + + + + #select_cible_type_bar.bar.dark_blue + -CibleType.all.each do |cible_type| + =link_to cible_type.name, new_portlet_link_content_path(:link_content_cible_type => cible_type.slug ), :onclick => "$('#link_content_cible_form').load($(this).attr('href')+' #link_content_cible_form_content');$('#select_cible_type_bar .active').removeClass('active');$(this).addClass('active');return false;",:class => ("active" if cible_type.slug == @link_content.cible_type).to_s + + + + #link_content_cible_form.form2 + #link_content_cible_form_content + = form.inputs do + = form.input :cible_type,:as => :hidden + = form.input :cible_id,:as => :hidden + =render :partial => "portlet/link_contents/"+@link_content.cible_type.tableize.singularize.to_s+"_form", :locals => {:form => form} + + = form.buttons do + = form.commit_button "Sauvegarder" + + diff --git a/app/views/portlet/link_contents/_link_content.html.haml b/app/views/portlet/link_contents/_link_content.html.haml new file mode 100644 index 0000000..9fd0808 --- /dev/null +++ b/app/views/portlet/link_contents/_link_content.html.haml @@ -0,0 +1,7 @@ + +Texte affiché : +%strong=link_content.name.to_s +%br +="s'ouvre dans une nouvelle page" if link_content.popup + +=render :partial => "portlet/link_contents/"+link_content.cible_type.tableize.singularize, :locals => {:cible => link_content.cible} \ No newline at end of file diff --git a/app/views/portlet/link_contents/new.html.haml b/app/views/portlet/link_contents/new.html.haml new file mode 100644 index 0000000..038bb12 --- /dev/null +++ b/app/views/portlet/link_contents/new.html.haml @@ -0,0 +1 @@ +=render :partial => "form" \ No newline at end of file diff --git a/app/views/portlet/map_contents/_form.html.haml b/app/views/portlet/map_contents/_form.html.haml new file mode 100644 index 0000000..b459532 --- /dev/null +++ b/app/views/portlet/map_contents/_form.html.haml @@ -0,0 +1,24 @@ +=form_for( [:portlet, @map_content], :remote => true) do |f| + + %p + Adresse : + =f.text_field :address, :style => "width:98%;", :class => "inputText" + + %p + Nom du lieu : + =f.text_field :name, :style => "width:98%;", :class => "inputText" + + %p + Infobule + =f.check_box :info_bule + + %p + Vue + = f.select :view, MapContent::VIEWS + + %p + Zoom + = f.select :zoom, MapContent::ZOOMS + %br + =f.submit "Sauvegarder" + diff --git a/app/views/portlet/map_contents/_map_content.html.haml b/app/views/portlet/map_contents/_map_content.html.haml new file mode 100644 index 0000000..54e9ac9 --- /dev/null +++ b/app/views/portlet/map_contents/_map_content.html.haml @@ -0,0 +1,64 @@ +#map_content_map.map_content_map{:id => map_content.id, :style => "width:400px; height:300px;margin:auto;"} + + + + \ No newline at end of file diff --git a/app/views/portlet/portlets/_portlet.html.haml b/app/views/portlet/portlets/_portlet.html.haml new file mode 100644 index 0000000..d82328e --- /dev/null +++ b/app/views/portlet/portlets/_portlet.html.haml @@ -0,0 +1,16 @@ +#portlet.portlet{:id => portlet.id,:"data-portlet_id" => portlet.id, :class => "portlet_"+portlet.content_type.tableize.singularize} + .actions + %span.move=i(:move) + =link_to i(:pen_alt_fill), eval("edit_portlet_"+portlet.content_type.tableize.singularize+"_path(portlet.content, :portlet_id => portlet.id)"), :remote => true + + =link_to i(:trash_stroke), eval("portlet_"+portlet.content_type.tableize.singularize+"_path(portlet.content, :portlet_id => portlet.id)"), :method => :delete, :confirm => "Etes-vous sur ?", :remote => true + + + + .render_admin{:class => "render_admin_"+portlet.content_type.tableize.singularize} + =render :partial => "portlet/"+portlet.content_type.tableize+"/"+portlet.content_type.tableize.singularize, :object => portlet.content + + + + + \ No newline at end of file diff --git a/app/views/portlet/portlets/new.html.haml b/app/views/portlet/portlets/new.html.haml new file mode 100644 index 0000000..80d216a --- /dev/null +++ b/app/views/portlet/portlets/new.html.haml @@ -0,0 +1,7 @@ +.portlet_types + -ContentType.all.each do |content_type| + =link_to content_type.name, eval("new_portlet_"+content_type.slug.tableize.singularize+"_path(:block_id => @portlet.block_id, :position => params[:position])"), :remote => true + +%br +%br +#new_portlet_content_form \ No newline at end of file diff --git a/app/views/portlet/portlets/new.js.erb b/app/views/portlet/portlets/new.js.erb new file mode 100644 index 0000000..6092f7b --- /dev/null +++ b/app/views/portlet/portlets/new.js.erb @@ -0,0 +1,12 @@ +$.ajax({ + url:"<%= eval("new_portlet_"+params[:content_type].tableize.singularize+"_path(:format => 'js')") %>", + type: "GET", + data: { + block_id : "<%= params[:block_id] %>", + position : "<%= params[:position] %>" + } , + success : function (){ + after_load_document(); + } +}); + diff --git a/app/views/portlet/portlets/update.js.erb b/app/views/portlet/portlets/update.js.erb new file mode 100644 index 0000000..3438a65 --- /dev/null +++ b/app/views/portlet/portlets/update.js.erb @@ -0,0 +1,8 @@ + + + +$("#block_portlets_<%= @portlet.block.id %>").replaceWith("<%= escape_javascript(render(:partial => 'admin/blocks/block', :locals => {:block => @portlet.block})) %>"); +$("#portlet_<%= @portlet.id %>").effect("highlight", {}, 3000); +block_js_initialize(); + +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/shared/_new.html.haml b/app/views/portlet/shared/_new.html.haml new file mode 100644 index 0000000..038bb12 --- /dev/null +++ b/app/views/portlet/shared/_new.html.haml @@ -0,0 +1 @@ +=render :partial => "form" \ No newline at end of file diff --git a/app/views/portlet/shared/create.js.erb b/app/views/portlet/shared/create.js.erb new file mode 100644 index 0000000..d4a4a70 --- /dev/null +++ b/app/views/portlet/shared/create.js.erb @@ -0,0 +1,6 @@ +$("#new_portlet_form_inline").replaceWith("<%= escape_javascript(render(@portlet)) %>"); +$("#portlet_<%= @portlet.id %>").effect("highlight", {}, 3000); +block_js_initialize(); +update_portlet_order(); + +<%= flashs() %> \ No newline at end of file diff --git a/app/views/portlet/shared/destroy.js.erb b/app/views/portlet/shared/destroy.js.erb new file mode 100644 index 0000000..dedb56a --- /dev/null +++ b/app/views/portlet/shared/destroy.js.erb @@ -0,0 +1,4 @@ +$("#portlet_<%= @portlet.id %>").remove(); +<%= flash_notice() %> +block_js_initialize(); +update_portlet_order(); \ No newline at end of file diff --git a/app/views/portlet/shared/edit.html.haml b/app/views/portlet/shared/edit.html.haml new file mode 100644 index 0000000..40af0c4 --- /dev/null +++ b/app/views/portlet/shared/edit.html.haml @@ -0,0 +1,8 @@ +#edit_portlet_content_form=render :partial => "form" +:javascript + + $("#edit_portlet_content_form .text_editor").each(function() { + auto_tiny_mce($(this)); + + }); + \ No newline at end of file diff --git a/app/views/portlet/shared/edit.js.erb b/app/views/portlet/shared/edit.js.erb new file mode 100644 index 0000000..94f6959 --- /dev/null +++ b/app/views/portlet/shared/edit.js.erb @@ -0,0 +1,11 @@ +$("#portlet_<%= @portlet.id %>").html("
"); + +$("#edit_portlet_content_form").html("<%= escape_javascript(render( :partial => "form")) %>"); +$("#edit_portlet_content_form").effect("highlight", {color:"#E9F2F9"}, 500); + +$("#edit_portlet_content_form .text_editor").each(function() { + + + auto_tiny_mce($(this)); +}); + diff --git a/app/views/portlet/shared/new.js.erb b/app/views/portlet/shared/new.js.erb new file mode 100644 index 0000000..307369b --- /dev/null +++ b/app/views/portlet/shared/new.js.erb @@ -0,0 +1,24 @@ +$("#new_portlet_content_form").html("<%= escape_javascript(render( :partial => "portlet/shared/new")) %>"); + +$("#new_portlet_content_form .text_editor").each(function() { + + + auto_tiny_mce($(this)); + +}); + +var first_form_element = $("#new_portlet_content_form input:text:visible:first") +if(first_form_element.length == 0){ + first_form_element = $("#new_portlet_content_form .text_editor:first") + + //first_form_element.tinymce().focus(); +} + +if(first_form_element.length == 0){ + first_form_element = $("#new_portlet_content_form textarea:first") +} + + +first_form_element.focus(); + + diff --git a/app/views/portlet/shared/update.js.erb b/app/views/portlet/shared/update.js.erb new file mode 100644 index 0000000..97c292d --- /dev/null +++ b/app/views/portlet/shared/update.js.erb @@ -0,0 +1,5 @@ + +$("#portlet_<%= @portlet.id %>").replaceWith("<%= escape_javascript(render(@portlet)) %>"); +$("#portlet_<%= @portlet.id %>").effect("highlight", {}, 3000); +block_js_initialize(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/table_cols/create.js.erb b/app/views/portlet/table_cols/create.js.erb new file mode 100644 index 0000000..38c4a21 --- /dev/null +++ b/app/views/portlet/table_cols/create.js.erb @@ -0,0 +1,5 @@ + +$("#portlet_<%= @table_content.portlet.id %>").replaceWith("<%= escape_javascript(render(@table_content.portlet)) %>"); + +block_js_initialize(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/table_cols/destroy.js.erb b/app/views/portlet/table_cols/destroy.js.erb new file mode 100644 index 0000000..38c4a21 --- /dev/null +++ b/app/views/portlet/table_cols/destroy.js.erb @@ -0,0 +1,5 @@ + +$("#portlet_<%= @table_content.portlet.id %>").replaceWith("<%= escape_javascript(render(@table_content.portlet)) %>"); + +block_js_initialize(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/table_cols/update.js.erb b/app/views/portlet/table_cols/update.js.erb new file mode 100644 index 0000000..9eee80d --- /dev/null +++ b/app/views/portlet/table_cols/update.js.erb @@ -0,0 +1,2 @@ +%h1 Portlet::TableCols#update +%p Find me in app/views/portlet/table_cols/update.html.haml \ No newline at end of file diff --git a/app/views/portlet/table_contents/_form.html.haml b/app/views/portlet/table_contents/_form.html.haml new file mode 100644 index 0000000..c262121 --- /dev/null +++ b/app/views/portlet/table_contents/_form.html.haml @@ -0,0 +1,17 @@ + +=form_for( [:portlet, @table_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + -if !@table_content.id + %table + %tr + %td Nombre de lignes : + %td=f.text_field :nbr_rows + %tr + %td Nombre de colonnes : + %td=f.text_field :nbr_cols + %br + =f.submit "Sauvegarder" + diff --git a/app/views/portlet/table_contents/_table_content.html.haml b/app/views/portlet/table_contents/_table_content.html.haml new file mode 100644 index 0000000..77e503b --- /dev/null +++ b/app/views/portlet/table_contents/_table_content.html.haml @@ -0,0 +1,45 @@ + + + +%table.table_content + -table_rows = table_content.table_rows + %tr + -i = 0 + -table_content.nbr_cols.times do + -i += 1 + %td.add_col + %span.innerWrapper + .col_menu + =link_to "Ajouter une colonne avant", portlet_table_cols_path(:position => i, :table_content_id =>table_content.id ), :method => :post, :remote => true + + =link_to "Ajouter une colonne après", portlet_table_cols_path(:position => i+1, :table_content_id =>table_content.id ), :method => :post, :remote => true + + -if table_content.nbr_cols > 1 + =link_to "Supprimer cette colonne", portlet_table_col_path(:id => i, :table_content_id =>table_content.id ), :method => :delete, :remote => true, :confirm => "Voulez-vous vraiment supprimer cette colonne ?" + = i(:cog_alt, :gray_light, 12) + + %td + + -table_rows.each do |table_row| + %tr{:id => table_row.id} + + + -CelTable.where(:table_row_id => table_row.id).order("position ASC").each do |cel_table| + + %td.table_content_cel{:id => cel_table.id} + =render :partial => "admin/blocks/block", :locals => {:block => cel_table.block} + + %td.add_cel + + .innerWrapper + .row_menu + =link_to "Ajouter un rang avant", portlet_table_rows_path(:table_row => {:table_content_id => table_content.id, :position => (table_row.position)}), :method => :post, :remote => true + + =link_to "Ajouter un rang après", portlet_table_rows_path(:table_row => {:table_content_id => table_content.id, :position => (table_row.position+1)}), :method => :post, :remote => true + -if table_content.nbr_rows > 1 + =link_to "Supprimer ce rang", portlet_table_row_path(table_row), :method => :delete, :remote => true, :confirm => "Voulez-vous vraiment supprimer ce rang ?" + = i(:cog_alt, :gray_light, 12) + + + + \ No newline at end of file diff --git a/app/views/portlet/table_contents/_table_content_edit_pane.html.haml b/app/views/portlet/table_contents/_table_content_edit_pane.html.haml new file mode 100644 index 0000000..7d42a41 --- /dev/null +++ b/app/views/portlet/table_contents/_table_content_edit_pane.html.haml @@ -0,0 +1,33 @@ +%table.table_content + -table_rows = @table_content.table_rows + %tr + + + + + -table_rows.each do |table_row| + %tr + %td.row_left + .crl + %a{:href => "#", :onclick => "$('.table_row_menu').hide();$('#table_row_menu_"+table_row.id.to_s+"').toggle();return false;"}+ + + + + + .table_row_menu#table_row_menu{:id => table_row.id} + =link_to "ajouter un rang avant", portlet_table_rows_path(:table_row => {:table_content_id => @table_content.id, :position => (table_row.position)}), :method => :post + %br + =link_to "ajouter un rang après", portlet_table_rows_path(:table_row => {:table_content_id => @table_content.id, :position => (table_row.position+1)}), :method => :post + %br + =link_to "supprimer ce rang", [:portlet, table_row], :method => :delete, :confirm => "Voulez-vous vraiment supprimer ce rang ainsi que son contenu ?", :remote => true + + -table_row.cel_tables.each do |cel_table| + + %td.table_content_cel + =auto_load_div(admin_block_path(cel_table.block),"Page_"+"@page.id.to_s"+"_blocks_part") + + %td.add_col + %span + + -@table_content.nbr_cols.times do + %td.add_col + %span +f diff --git a/app/views/portlet/table_contents/destroy_row.js.erb b/app/views/portlet/table_contents/destroy_row.js.erb new file mode 100644 index 0000000..8fd1b2d --- /dev/null +++ b/app/views/portlet/table_contents/destroy_row.js.erb @@ -0,0 +1,6 @@ + + + + +$("#table_content_edit_pane_<%= @table_content.id %>").html("<%= escape_javascript(render(:partial => "portlet/table_contents/table_content_edit_pane")) %>"); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/table_rows/create.js.erb b/app/views/portlet/table_rows/create.js.erb new file mode 100644 index 0000000..f00e0bc --- /dev/null +++ b/app/views/portlet/table_rows/create.js.erb @@ -0,0 +1,5 @@ + +$("#portlet_<%= @portlet.id %>").replaceWith("<%= escape_javascript(render(@portlet)) %>"); + +block_js_initialize(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/table_rows/destroy.js.erb b/app/views/portlet/table_rows/destroy.js.erb new file mode 100644 index 0000000..600b479 --- /dev/null +++ b/app/views/portlet/table_rows/destroy.js.erb @@ -0,0 +1,5 @@ + +$("#portlet_<%= @table_row.table_content.portlet.id %>").replaceWith("<%= escape_javascript(render(@table_row.table_content.portlet)) %>"); + +block_js_initialize(); +<%= flash_notice() %> \ No newline at end of file diff --git a/app/views/portlet/text_contents/_form.html.haml b/app/views/portlet/text_contents/_form.html.haml new file mode 100644 index 0000000..6715e17 --- /dev/null +++ b/app/views/portlet/text_contents/_form.html.haml @@ -0,0 +1,14 @@ +=form_for( [:portlet, @text_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + + =f.text_area :content, :style => "width:98%;", :class => "text_editor" + -if TextContent::STYLES.size > 0 + Style : + = f.select :style, TextContent::STYLES + + + + =f.submit 'Sauvegarder' + diff --git a/app/views/portlet/text_contents/_text_content.html.haml b/app/views/portlet/text_contents/_text_content.html.haml new file mode 100644 index 0000000..afdbae0 --- /dev/null +++ b/app/views/portlet/text_contents/_text_content.html.haml @@ -0,0 +1 @@ +%p=raw text_content.content \ No newline at end of file diff --git a/app/views/portlet/title_contents/_form.html.haml b/app/views/portlet/title_contents/_form.html.haml new file mode 100644 index 0000000..f85bd1f --- /dev/null +++ b/app/views/portlet/title_contents/_form.html.haml @@ -0,0 +1,14 @@ +=form_for( [:portlet, @title_content], :remote => true) do |f| + =hidden_field_tag "block_id", params[:block_id] + =hidden_field_tag "portlet_id", params[:portlet_id] + =hidden_field_tag "position", params[:position] + =f.text_field :content, :style => "width:98%;", :class => "inputText" + + Importance : + = f.select :level, TitleContent::LEVELS + -if TitleContent::STYLES.size > 0 + Style : + = f.select :style, TitleContent::STYLES + %br + =f.submit "Sauvegarder" + diff --git a/app/views/portlet/title_contents/_title_content.html.haml b/app/views/portlet/title_contents/_title_content.html.haml new file mode 100644 index 0000000..c394932 --- /dev/null +++ b/app/views/portlet/title_contents/_title_content.html.haml @@ -0,0 +1,4 @@ +=raw '" +=title_content.content +=raw "" + diff --git a/app/views/portlets/dynamic_contents/_folder_list.html.haml b/app/views/portlets/dynamic_contents/_folder_list.html.haml new file mode 100644 index 0000000..669fb53 --- /dev/null +++ b/app/views/portlets/dynamic_contents/_folder_list.html.haml @@ -0,0 +1 @@ +=render(:partial => "public/folders/folder",:collection => Folder.where(:enabled => true).order(:title)) \ No newline at end of file diff --git a/app/views/portlets/dynamic_contents/_formulaire_ordonnances.html.haml b/app/views/portlets/dynamic_contents/_formulaire_ordonnances.html.haml new file mode 100644 index 0000000..08b87f6 --- /dev/null +++ b/app/views/portlets/dynamic_contents/_formulaire_ordonnances.html.haml @@ -0,0 +1,35 @@ +-@prescription = @prescription || Prescription.new + +=form_for @prescription, :url => create_prescription_path(), :html => {:multipart => true} do |form| + + %h2 Etape 1 : Vos coordonnées + %table + %tr + %td + Nom * : + %td + =form.text_field :name + %tr + %td + Téléphone * : + %td + =form.text_field :tel + %h2 Etape 2 : Votre demande + %p.infos Si vous disposez d'un scanner vous pouvez nous envoyer directement un scan de votre ordonnance au format image (jpg ou png) en utilisant le champ suivant : + %table + %tr + %td + Scan de l'ordonnance : + %td + =form.file_field :file + %p.infos Si vous ne disposez pas de scanner, ou que vous souhaitez apporter des précisions à votre commande, vous pouvez recopier votre ordonnance ou ajouter des notes ci-dessous. + %p Notes : + %p=form.text_area :notes, :style => "width:100%;" + + %h2 Valider votre demande + %p.infos + Une fois que vous avez remplit les champs précédent vous pouvez nous envoyer votre ordonnance en cliquant sur le bouton ci-dessous. + %br + %br + Nous vous appelerons dès que votre commande sera prête ou vous indiquer la date de livraison prévue. + =form.submit "Envoyer mon ordonnance" \ No newline at end of file diff --git a/app/views/portlets/dynamic_contents/_promotions-list.html.haml b/app/views/portlets/dynamic_contents/_promotions-list.html.haml new file mode 100644 index 0000000..ea715ad --- /dev/null +++ b/app/views/portlets/dynamic_contents/_promotions-list.html.haml @@ -0,0 +1,6 @@ +%h2 Hygiène +=render(:partial => "public/promotions/promotion", :collection => Promotion.where(:promotion_type_id => 1).order("month ASC, title ASC")) +%h2 Cosmétiques +=render(:partial => "public/promotions/promotion", :collection => Promotion.where(:promotion_type_id => 2).order("month ASC, title ASC")) +%h2 Bébés +=render(:partial => "public/promotions/promotion", :collection => Promotion.where(:promotion_type_id => 3).order("month ASC, title ASC")) \ No newline at end of file diff --git a/app/views/portlets/render_public/_blockcontent.html.haml b/app/views/portlets/render_public/_blockcontent.html.haml new file mode 100644 index 0000000..8fc2dca --- /dev/null +++ b/app/views/portlets/render_public/_blockcontent.html.haml @@ -0,0 +1,17 @@ +.portlet.block_content + -if input.nbr_columns == 1 + -input.blocks.each do |block| + .block + =render block + .clear + + -else + .two_column + -i = 0 + -input.blocks.each do |block| + -i+=1 + .column{:class => ("column_"+i.to_s)} + .block + =render block + + .clear \ No newline at end of file diff --git a/app/views/portlets/render_public/_breakcontent.html.haml b/app/views/portlets/render_public/_breakcontent.html.haml new file mode 100644 index 0000000..399a270 --- /dev/null +++ b/app/views/portlets/render_public/_breakcontent.html.haml @@ -0,0 +1,9 @@ + +-if input.line + %hr + + +-else + %div.line_break{:class => ""} + =#%div.break + \ No newline at end of file diff --git a/app/views/portlets/render_public/_downloadcontent.html.haml b/app/views/portlets/render_public/_downloadcontent.html.haml new file mode 100644 index 0000000..8165052 --- /dev/null +++ b/app/views/portlets/render_public/_downloadcontent.html.haml @@ -0,0 +1,11 @@ +-if input.data_file + + + + .portlet.download_content + =link_to input.title.to_s, input.data_file.file.url + +-else + + .portlet.download_content + =link_to input.title.to_s, "" diff --git a/app/views/portlets/render_public/_dynamiccontent.html.haml b/app/views/portlets/render_public/_dynamiccontent.html.haml new file mode 100644 index 0000000..7b58256 --- /dev/null +++ b/app/views/portlets/render_public/_dynamiccontent.html.haml @@ -0,0 +1,3 @@ + + +=render :partial => "portlets/dynamic_contents/"+input.name.to_s.downcase if input.name \ No newline at end of file diff --git a/app/views/portlets/render_public/_gallerycontent.html.haml b/app/views/portlets/render_public/_gallerycontent.html.haml new file mode 100644 index 0000000..7548a06 --- /dev/null +++ b/app/views/portlets/render_public/_gallerycontent.html.haml @@ -0,0 +1,10 @@ +.portlet.gallery_content + %h2=input.name + .description + =raw input.description + .gallery_images + -input.gallery_images.each do |gallery_images| + =link_to image_tag(gallery_images.image_file.file.square.url, :alt => "#{gallery_images.title}"), gallery_images.image_file.file.large.url, :rel => "prettyPhoto[gallery_#{input.id}]" + %p{:style => "clear:both;"} + + diff --git a/app/views/portlets/render_public/_htmlcontent.html.haml b/app/views/portlets/render_public/_htmlcontent.html.haml new file mode 100644 index 0000000..b027e7d --- /dev/null +++ b/app/views/portlets/render_public/_htmlcontent.html.haml @@ -0,0 +1 @@ +=raw input.content \ No newline at end of file diff --git a/app/views/portlets/render_public/_imagecontent.html.haml b/app/views/portlets/render_public/_imagecontent.html.haml new file mode 100644 index 0000000..a278cb1 --- /dev/null +++ b/app/views/portlets/render_public/_imagecontent.html.haml @@ -0,0 +1,37 @@ + +-if input.image_file + + -if input.style== "1" + -url =input.image_file.file.large.medium.url + + -elsif input.style== "2" + -url =input.image_file.file.large.medium.small.url + + -elsif input.style== "3" + -url =input.image_file.file.square.url + + -elsif input.style== "4" + -url =input.image_file.file.large.medium.small.thumb.url + +-else + -url ="" + +-url = "http://"+HOSTNAME+url +-style = "" +-style = "text-align:center;" if input.alignement == "center" + + +-style = "float:right;" if input.alignement == "right" + + +-style = "float:left;" if input.alignement == "left" + +-if input.expandable + %p.img{:style =>style} + =link_to image_tag(url, :alt => input.alt.to_s), (input.image_file ? input.image_file.file.large.url : ""), :rel => "prettyPhoto", :title => input.alt.to_s + +-else + %p.img{:style =>style} + =image_tag(url, :alt => input.alt.to_s) + + \ No newline at end of file diff --git a/app/views/portlets/render_public/_linkcontent.html.haml b/app/views/portlets/render_public/_linkcontent.html.haml new file mode 100644 index 0000000..36b7941 --- /dev/null +++ b/app/views/portlets/render_public/_linkcontent.html.haml @@ -0,0 +1,3 @@ +.portlet.link_content + + =link_to input.name.to_s, input.url.to_s, :class => "external_link", :target => ("_blank" if input.popup).to_s \ No newline at end of file diff --git a/app/views/portlets/render_public/_mapcontent.html.haml b/app/views/portlets/render_public/_mapcontent.html.haml new file mode 100644 index 0000000..f0fcecf --- /dev/null +++ b/app/views/portlets/render_public/_mapcontent.html.haml @@ -0,0 +1,64 @@ +#map_content_map.map_content_map{:id => input.id, :style => "width:400px; height:300px;margin:auto;"} + + + + \ No newline at end of file diff --git a/app/views/portlets/render_public/_tablecontent.html.haml b/app/views/portlets/render_public/_tablecontent.html.haml new file mode 100644 index 0000000..b271195 --- /dev/null +++ b/app/views/portlets/render_public/_tablecontent.html.haml @@ -0,0 +1,18 @@ + +.portlet.table_content + + %table.input + -table_rows = input.table_rows + + + -table_rows.each do |table_row| + %tr + + -table_row.cel_tables.each do |cel_table| + + %td + + =render cel_table.block + + + diff --git a/app/views/portlets/render_public/_textcontent.html.haml b/app/views/portlets/render_public/_textcontent.html.haml new file mode 100644 index 0000000..81883ed --- /dev/null +++ b/app/views/portlets/render_public/_textcontent.html.haml @@ -0,0 +1 @@ +=raw(input.content) \ No newline at end of file diff --git a/app/views/portlets/render_public/_titlecontent.html.haml b/app/views/portlets/render_public/_titlecontent.html.haml new file mode 100644 index 0000000..72e2a08 --- /dev/null +++ b/app/views/portlets/render_public/_titlecontent.html.haml @@ -0,0 +1,5 @@ +-level = (input.level || "1").to_s + +=raw '" +=input.content +=raw '" diff --git a/app/views/public/blocks/_block.html.haml b/app/views/public/blocks/_block.html.haml new file mode 100644 index 0000000..a5e42b4 --- /dev/null +++ b/app/views/public/blocks/_block.html.haml @@ -0,0 +1,4 @@ +-block.portlets.each do |p| + -if p.content_type + + =render :partial => "portlets/render_public/"+p.content_type.to_s.downcase, :locals => {:input => p.content} \ No newline at end of file diff --git a/app/views/public/menu_items/show.html.haml b/app/views/public/menu_items/show.html.haml new file mode 100644 index 0000000..39a5612 --- /dev/null +++ b/app/views/public/menu_items/show.html.haml @@ -0,0 +1,52 @@ + +-content_for :sidebar do + -if @menu_item.parent_id + -if @menu_item.ancestors.reverse[0] + -first_level_menu = @menu_item.ancestors.reverse[0] + + -else + + -first_level_menu = @menu_item + + -if first_level_menu.children.size > 0 + + #menu + -first_level_menu.children.where(:enabled => true).order(:position).each do |menu_item| + + =menu_item_link(menu_item) + + +-content_for :body do + + + -if @menu_item.slug != "accueil" + #breadcrumb + + -if @menu_item.ancestors.reverse[0] and @menu_item.ancestors.reverse[0].slug != "accueil" + =link_to "Accueil", "/" + > + -@menu_item.ancestors.reverse.each do |menu_item| + =menu_item_link(menu_item) + > + =@menu_item.name + + -if flash[:notice] + #flash_notice=raw(flash[:notice]) + + + + + =render @menu_item.menu_content.blocks[0] +.clear + diff --git a/app/views/public/shared/_contact_block.html.haml b/app/views/public/shared/_contact_block.html.haml new file mode 100644 index 0000000..ad4b92b --- /dev/null +++ b/app/views/public/shared/_contact_block.html.haml @@ -0,0 +1,49 @@ +#contact_block + #horaires.content + Horaire d'ouverture pour cette semaine : + %br + -if (Date.today.cweek).to_i%2 == 0 + =render :partial => "/public/shared/odd" + -else + =render :partial => "/public/shared/even" + %br + + + + =link_to "Horaires pour la semaine prochaine", "#next_week", :rel => "prettyPhoto", :title => "" + + #next_week{:style => "display:none"} + %div{:style => "padding:1px"} + %h2 Horaires d'ouverture pour la semaine prochaine + %p + du lundi + =l Date.today.next_week, :format => :long + au dimanche + =l Date.today.next_week.end_of_week, :format => :long + =":" + + %p + -if (Date.today.cweek).to_i%2 == 0 + =render :partial => "/public/shared/even" + -else + =render :partial => "/public/shared/odd" + + + #garde.content + Pour connaître la pharmacie de garde : + %br + =link_to "- consultez la liste des pharmacie de garde", "/pages/infos-utiles/pharmacies-gardes.html" + %br + ="- appelez le 3915" + #contact.content + 63 route du Plan + %br + 38140 RIVES + %br + %br + info@pharmacieboissier.com + %br + %br + tel : 04 76 65 35 69 + %br + fax : 04 76 66 83 50 \ No newline at end of file diff --git a/app/views/public/shared/_even.html.haml b/app/views/public/shared/_even.html.haml new file mode 100644 index 0000000..cc560f7 --- /dev/null +++ b/app/views/public/shared/_even.html.haml @@ -0,0 +1,4 @@ +=raw"- du mardi au vendredi : 8h30 à 12h15 et 14h15 à 19h" +%br +=raw"- le samedi : 8h30 à 12h15 et 14h15 à 18h" +%br diff --git a/app/views/public/shared/_first_menu.html.haml b/app/views/public/shared/_first_menu.html.haml new file mode 100644 index 0000000..43eac74 --- /dev/null +++ b/app/views/public/shared/_first_menu.html.haml @@ -0,0 +1,2 @@ +-MenuItem.where(:parent_id => nil, :enabled => true).order(:position).each do |menu_item| + =menu_item_link menu_item \ No newline at end of file diff --git a/app/views/public/shared/_odd.html.haml b/app/views/public/shared/_odd.html.haml new file mode 100644 index 0000000..05f7d54 --- /dev/null +++ b/app/views/public/shared/_odd.html.haml @@ -0,0 +1,4 @@ +="- du lundi au vendredi : 8h30 à 12h15 et 14h15 à 19h" +%br +="- le samedi : 8h30 à 12h15" +%br diff --git a/config.ru b/config.ru new file mode 100644 index 0000000..5c3f7c5 --- /dev/null +++ b/config.ru @@ -0,0 +1,4 @@ +# This file is used by Rack-based servers to start the application. + +require ::File.expand_path('../config/environment', __FILE__) +run PharmacieboissierCom::Application diff --git a/config/application.rb b/config/application.rb new file mode 100644 index 0000000..d1e2c65 --- /dev/null +++ b/config/application.rb @@ -0,0 +1,74 @@ +# -*- encoding : utf-8 -*- +require File.expand_path('../boot', __FILE__) + +require 'rails/all' + +# If you have a Gemfile, require the gems listed there, including any gems +# you've limited to :test, :development, or :production. +Bundler.require(:default, Rails.env) if defined?(Bundler) + +module PharmacieboissierCom + class Application < Rails::Application + # Settings in config/environments/* take precedence over those specified here. + # Application configuration should go into files in config/initializers + # -- all .rb files in that directory are automatically loaded. + + # Custom directories with classes and modules you want to be autoloadable. + # config.autoload_paths += %W(#{config.root}/extras) + + # Only load the plugins named here, in the order given (default is alphabetical). + # :all can be used as a placeholder for all plugins not explicitly named. + # config.plugins = [ :exception_notification, :ssl_requirement, :all ] + + # Activate observers that should always be running. + # config.active_record.observers = :cacher, :garbage_collector, :forum_observer + + # Set Time.zone default to the specified zone and make Active Record auto-convert to this zone. + # Run "rake -D time" for a list of tasks for finding time zone names. Default is UTC. + # config.time_zone = 'Central Time (US & Canada)' + + # The default locale is :en and all translations from config/locales/*.rb,yml are auto loaded. + # config.i18n.load_path += Dir[Rails.root.join('my', 'locales', '*.{rb,yml}').to_s] + # config.i18n.default_locale = :de + + # Please note that JavaScript expansions are *ignored altogether* if the asset + # pipeline is enabled (see config.assets.enabled below). Put your defaults in + # app/assets/javascripts/application.js in that case. + # + # JavaScript files you want as :defaults (application.js is always included). + # config.action_view.javascript_expansions[:defaults] = %w(prototype prototype_ujs) + + config.time_zone = 'Paris' + + # The default locale is :en and all translations from config/locales/*.rb,yml are auto loaded. + config.i18n.load_path += Dir[Rails.root.join('my', 'locales', '*.{rb,yml}').to_s] + config.i18n.default_locale = :fr + + # Configure the default encoding used in templates for Ruby 1.9. + config.encoding = "utf-8" + + # Configure sensitive parameters which will be filtered from the log file. + config.filter_parameters += [:password] + + + + + + # Configure generators + config.generators do |g| + g.template_engine :haml + end + + + #Ajoute la possibilité de pouvoir mettre des models dans les sous répertoires. + Dir.entries("#{Rails.root}/app/models").each do |file| + next if file.eql?('.') || file.eql?('..') + full_path = "#{Rails.root}/app/models/#{file}" + + config.autoload_paths << full_path if File.directory?(full_path) + end + + + +end +end diff --git a/config/boot.rb b/config/boot.rb new file mode 100644 index 0000000..f488c9a --- /dev/null +++ b/config/boot.rb @@ -0,0 +1,7 @@ +# -*- encoding : utf-8 -*- +require 'rubygems' + +# Set up gems listed in the Gemfile. +ENV['BUNDLE_GEMFILE'] ||= File.expand_path('../../Gemfile', __FILE__) + +require 'bundler/setup' if File.exists?(ENV['BUNDLE_GEMFILE']) diff --git a/config/database.yml b/config/database.yml new file mode 100644 index 0000000..c2712be --- /dev/null +++ b/config/database.yml @@ -0,0 +1,22 @@ +# SQLite version 3.x +# gem install sqlite3 +development: + adapter: sqlite3 + database: ../sqlite3_databases/development.sqlite3 + pool: 5 + timeout: 5000 + +# Warning: The database defined as "test" will be erased and +# re-generated from your development database when you run "rake". +# Do not set this db to the same as development or production. +test: + adapter: sqlite3 + database: ../sqlite3_databases/test.sqlite3 + pool: 5 + timeout: 5000 + +production: + adapter: sqlite3 + database: db/production.sqlite3 + pool: 5 + timeout: 5000 diff --git a/config/deploy.rb b/config/deploy.rb new file mode 100644 index 0000000..81ed0b4 --- /dev/null +++ b/config/deploy.rb @@ -0,0 +1,57 @@ +set :user, 'web' + +set :application, 'test.accescible-solutions.com' # use your folder app name +set :deploy_to, "/home/#{user}/apps/#{application}/" # the live app will be in the "current" subdir +set :deploy_via, :remote_cache + +#set :keep_releases, 1 + + +#use trunk to deploy to production + set :branch, "master" + set :rails_env, "production" + +#production + set :domain, 'test.accescible-solutions.com' # your http://publicdomain.com + role :app, domain + role :web, domain + role :db, domain, :primary => true + + + +set :scm, :git +set :repository, "git@box1.quartz-agence.com:fcpe.git" + +set :use_sudo, false +set :ssh_options, {:forward_agent => true} + +after "deploy", "deploy:bundle_gems" +after "deploy:bundle_gems", "deploy:make_simlinks" +after "deploy:make_simlinks", "deploy:restart" +after "deploy:restart", "deploy:cleanup" + +# if you're still using the script/reaper helper you will need +# these http://github.com/rails/irs_process_scripts + +# If you are using Passenger mod_rails uncomment this: +namespace :deploy do + task :bundle_gems do + run "cd #{deploy_to}current && bundle install" + end + + task :make_simlinks do + run "rm -rf #{deploy_to}current/db/production.sqlite3" + run "ln -s #{deploy_to}shared/sqlite3_databases/production.sqlite3 #{deploy_to}current/db/production.sqlite3" + + run "rm -rf #{deploy_to}current/private_medias" + run "ln -s #{deploy_to}shared/medias/private #{deploy_to}current/private_medias" + + run "rm -rf #{deploy_to}current/public/public_medias" + run "ln -s #{deploy_to}shared/medias/public #{deploy_to}current/public/public_medias" + end + task :start do ; end + task :stop do ; end + task :restart, :roles => :app, :except => { :no_release => true } do + run "touch #{File.join(current_path,'tmp','restart.txt')}" + end +end diff --git a/config/environment.rb b/config/environment.rb new file mode 100644 index 0000000..171060b --- /dev/null +++ b/config/environment.rb @@ -0,0 +1,8 @@ + +# Load the rails application +require File.expand_path('../application', __FILE__) + +# Initialize the rails application +PharmacieboissierCom::Application.initialize! + + diff --git a/config/environments/development.rb b/config/environments/development.rb new file mode 100644 index 0000000..d00dc80 --- /dev/null +++ b/config/environments/development.rb @@ -0,0 +1,43 @@ +# -*- encoding : utf-8 -*- +PharmacieboissierCom::Application.configure do + # Settings specified here will take precedence over those in config/application.rb + + # In the development environment your application's code is reloaded on + # every request. This slows down response time but is perfect for development + # since you don't have to restart the web server when you make code changes. + config.cache_classes = false + + # Log error messages when you accidentally call methods on nil. + config.whiny_nils = true + + # Show full error reports and disable caching + config.consider_all_requests_local = true + config.action_view.debug_rjs = true + config.action_controller.perform_caching = false + + # Don't care if the mailer can't send + config.action_mailer.raise_delivery_errors = false + + # Print deprecation notices to the Rails logger + config.active_support.deprecation = :log + + # Only use best-standards-support built into browsers + config.action_dispatch.best_standards_support = :builtin + + config.action_mailer.default_url_options = { :host => 'localhost:3000' } + + config.action_mailer.delivery_method = :sendmail + + config.action_mailer.smtp_settings = { + :tls => true, + :address => "smtp.gmail.com", + :port => "587", + :domain => "quartz-agence.com", + :authentication => :plain, + :user_name => "n.bally@quartz-agence.com", + :password => "sio2mail" + } +end + +HOSTNAME = "localhost:3000" + diff --git a/config/environments/production.rb b/config/environments/production.rb new file mode 100644 index 0000000..20ed0c8 --- /dev/null +++ b/config/environments/production.rb @@ -0,0 +1,55 @@ +# -*- encoding : utf-8 -*- +PharmacieboissierCom::Application.configure do + # Settings specified here will take precedence over those in config/application.rb + + # Code is not reloaded between requests + config.cache_classes = true + + # Full error reports are disabled and caching is turned on + config.consider_all_requests_local = false + config.action_controller.perform_caching = true + + # Disable Rails's static asset server (Apache or nginx will already do this) + config.serve_static_assets = false + + + # Specifies the header that your server uses for sending files + # (comment out if your front-end server doesn't support this) + config.action_dispatch.x_sendfile_header = "X-Accel-Redirect" # Use 'X-Accel-Redirect' for nginx + + # Force all access to the app over SSL, use Strict-Transport-Security, and use secure cookies. + # config.force_ssl = true + + # See everything in the log (default is :info) + # config.log_level = :debug + + # Use a different logger for distributed setups + # config.logger = SyslogLogger.new + + # Use a different cache store in production + # config.cache_store = :mem_cache_store + + # Enable serving of images, stylesheets, and javascripts from an asset server + # config.action_controller.asset_host = "http://assets.example.com" + + # Precompile additional assets (application.js, application.css, and all non-JS/CSS are already added) + # config.assets.precompile += %w( search.js ) + + # Disable delivery errors, bad email addresses will be ignored + # config.action_mailer.raise_delivery_errors = false + + # Enable threaded mode + # config.threadsafe! + + # Enable locale fallbacks for I18n (makes lookups for any locale fall back to + # the I18n.default_locale when a translation can not be found) + config.i18n.fallbacks = true + + # Send deprecation notices to registered listeners + config.active_support.deprecation = :notify + + config.action_mailer.default_url_options = { :host => "www.fcpe-lycee-moirans.fr" } + + config.action_mailer.delivery_method = :sendmail +end +HOSTNAME = "test.accescible-solutions.com" diff --git a/config/environments/test.rb b/config/environments/test.rb new file mode 100644 index 0000000..09b06e0 --- /dev/null +++ b/config/environments/test.rb @@ -0,0 +1,40 @@ +# -*- encoding : utf-8 -*- +PharmacieboissierCom::Application.configure do + # Settings specified here will take precedence over those in config/application.rb + + # The test environment is used exclusively to run your application's + # test suite. You never need to work with it otherwise. Remember that + # your test database is "scratch space" for the test suite and is wiped + # and recreated between test runs. Don't rely on the data there! + config.cache_classes = true + + # Configure static asset server for tests with Cache-Control for performance + config.serve_static_assets = true + config.static_cache_control = "public, max-age=3600" + + # Log error messages when you accidentally call methods on nil + config.whiny_nils = true + + # Show full error reports and disable caching + config.consider_all_requests_local = true + config.action_controller.perform_caching = false + + # Raise exceptions instead of rendering exception templates + config.action_dispatch.show_exceptions = false + + # Disable request forgery protection in test environment + config.action_controller.allow_forgery_protection = false + + # Tell Action Mailer not to deliver emails to the real world. + # The :test delivery method accumulates sent emails in the + # ActionMailer::Base.deliveries array. + config.action_mailer.delivery_method = :test + + # Use SQL instead of Active Record's schema dumper when creating the test database. + # This is necessary if your schema can't be completely dumped by the schema dumper, + # like if you have constraints or database-specific column types + # config.active_record.schema_format = :sql + + # Print deprecation notices to the stderr + config.active_support.deprecation = :stderr +end diff --git a/config/initializers/backtrace_silencers.rb b/config/initializers/backtrace_silencers.rb new file mode 100644 index 0000000..b5e9a55 --- /dev/null +++ b/config/initializers/backtrace_silencers.rb @@ -0,0 +1,8 @@ +# -*- encoding : utf-8 -*- +# Be sure to restart your server when you modify this file. + +# You can add backtrace silencers for libraries that you're using but don't wish to see in your backtraces. +# Rails.backtrace_cleaner.add_silencer { |line| line =~ /my_noisy_library/ } + +# You can also remove all the silencers if you're trying to debug a problem that might stem from framework code. +# Rails.backtrace_cleaner.remove_silencers! diff --git a/config/initializers/carrierwave.rb b/config/initializers/carrierwave.rb new file mode 100644 index 0000000..a32b05e --- /dev/null +++ b/config/initializers/carrierwave.rb @@ -0,0 +1,2 @@ +# -*- encoding : utf-8 -*- +require 'carrierwave/orm/activerecord' diff --git a/config/initializers/devise.rb b/config/initializers/devise.rb new file mode 100644 index 0000000..c0843df --- /dev/null +++ b/config/initializers/devise.rb @@ -0,0 +1,144 @@ +# -*- encoding : utf-8 -*- +# Use this hook to configure devise mailer, warden hooks and so forth. The first +# four configuration values can also be set straight in your models. +Devise.setup do |config| + # ==> Mailer Configuration + # Configure the e-mail address which will be shown in DeviseMailer. + config.mailer_sender = "n.bally@quartz-agence.com" + + # Configure the class responsible to send e-mails. + # config.mailer = "Devise::Mailer" + + # ==> ORM configuration + # Load and configure the ORM. Supports :active_record (default) and + # :mongoid (bson_ext recommended) by default. Other ORMs may be + # available as additional gems. + require 'devise/orm/active_record' + + # ==> Configuration for any authentication mechanism + # Configure which keys are used when authenticating an user. By default is + # just :email. You can configure it to use [:username, :subdomain], so for + # authenticating an user, both parameters are required. Remember that those + # parameters are used only when authenticating and not when retrieving from + # session. If you need permissions, you should implement that in a before filter. + # config.authentication_keys = [ :email ] + + # Tell if authentication through request.params is enabled. True by default. + # config.params_authenticatable = true + + # Tell if authentication through HTTP Basic Auth is enabled. False by default. + # config.http_authenticatable = false + + # Set this to true to use Basic Auth for AJAX requests. True by default. + # config.http_authenticatable_on_xhr = true + + # The realm used in Http Basic Authentication + # config.http_authentication_realm = "Application" + + # ==> Configuration for :database_authenticatable + # For bcrypt, this is the cost for hashing the password and defaults to 10. If + # using other encryptors, it sets how many times you want the password re-encrypted. + config.stretches = 10 + + # Define which will be the encryption algorithm. Devise also supports encryptors + # from others authentication tools as :clearance_sha1, :authlogic_sha512 (then + # you should set stretches above to 20 for default behavior) and :restful_authentication_sha1 + # (then you should set stretches to 10, and copy REST_AUTH_SITE_KEY to pepper) + config.encryptor = :bcrypt + + # Setup a pepper to generate the encrypted password. + config.pepper = "04dcd46f0ea82d5d5238e37dd08d75529296d044c20e3311df2f09407337c859e340ef7d69fcf5f4d90625c66d7b0eb0e471efa36d9d43f1fe63f6b268a8021a" + + # ==> Configuration for :confirmable + # The time you want to give your user to confirm his account. During this time + # he will be able to access your application without confirming. Default is nil. + # When confirm_within is zero, the user won't be able to sign in without confirming. + # You can use this to let your user access some features of your application + # without confirming the account, but blocking it after a certain period + # (ie 2 days). + # config.confirm_within = 2.days + + # ==> Configuration for :rememberable + # The time the user will be remembered without asking for credentials again. + # config.remember_for = 2.weeks + + # If true, a valid remember token can be re-used between multiple browsers. + # config.remember_across_browsers = true + + # If true, extends the user's remember period when remembered via cookie. + # config.extend_remember_period = false + + # ==> Configuration for :validatable + # Range for password length + # config.password_length = 6..20 + + # Regex to use to validate the email address + # config.email_regexp = /\A([\w\.%\+\-]+)@([\w\-]+\.)+([\w]{2,})\z/i + + # ==> Configuration for :timeoutable + # The time you want to timeout the user session without activity. After this + # time the user will be asked for credentials again. + # config.timeout_in = 10.minutes + + # ==> Configuration for :lockable + # Defines which strategy will be used to lock an account. + # :failed_attempts = Locks an account after a number of failed attempts to sign in. + # :none = No lock strategy. You should handle locking by yourself. + # config.lock_strategy = :failed_attempts + + # Defines which strategy will be used to unlock an account. + # :email = Sends an unlock link to the user email + # :time = Re-enables login after a certain amount of time (see :unlock_in below) + # :both = Enables both strategies + # :none = No unlock strategy. You should handle unlocking by yourself. + # config.unlock_strategy = :both + + # Number of authentication tries before locking an account if lock_strategy + # is failed attempts. + # config.maximum_attempts = 20 + + # Time interval to unlock the account if :time is enabled as unlock_strategy. + # config.unlock_in = 1.hour + + # ==> Configuration for :token_authenticatable + # Defines name of the authentication token params key + # config.token_authentication_key = :auth_token + + # ==> Scopes configuration + # Turn scoped views on. Before rendering "sessions/new", it will first check for + # "users/sessions/new". It's turned off by default because it's slower if you + # are using only default views. + config.scoped_views = true + + # Configure the default scope given to Warden. By default it's the first + # devise role declared in your routes. + # config.default_scope = :user + + # Configure sign_out behavior. + # By default sign_out is scoped (i.e. /users/sign_out affects only :user scope). + # In case of sign_out_all_scopes set to true any logout action will sign out all active scopes. + # config.sign_out_all_scopes = false + + # ==> Navigation configuration + # Lists the formats that should be treated as navigational. Formats like + # :html, should redirect to the sign in page when the user does not have + # access, but formats like :xml or :json, should return 401. + # If you have any extra navigational formats, like :iphone or :mobile, you + # should add them to the navigational formats lists. Default is [:html] + # config.navigational_formats = [:html, :iphone] + + # ==> Warden configuration + # If you want to use other strategies, that are not (yet) supported by Devise, + # you can configure them inside the config.warden block. The example below + # allows you to setup OAuth, using http://github.com/roman/warden_oauth + # + # config.warden do |manager| + # manager.oauth(:twitter) do |twitter| + # twitter.consumer_secret = + # twitter.consumer_key = + # twitter.options :site => 'http://twitter.com' + # end + # manager.default_strategies(:scope => :user).unshift :twitter_oauth + # end + config.authentication_keys = [ :login ] +end diff --git a/config/initializers/inflections.rb b/config/initializers/inflections.rb new file mode 100644 index 0000000..e3c680d --- /dev/null +++ b/config/initializers/inflections.rb @@ -0,0 +1,11 @@ +# -*- encoding : utf-8 -*- +# Be sure to restart your server when you modify this file. + +# Add new inflection rules using the following format +# (all these examples are active by default): +# ActiveSupport::Inflector.inflections do |inflect| +# inflect.plural /^(ox)$/i, '\1en' +# inflect.singular /^(ox)en/i, '\1' +# inflect.irregular 'person', 'people' +# inflect.uncountable %w( fish sheep ) +# end diff --git a/config/initializers/mime_types.rb b/config/initializers/mime_types.rb new file mode 100644 index 0000000..9070e0c --- /dev/null +++ b/config/initializers/mime_types.rb @@ -0,0 +1,6 @@ +# -*- encoding : utf-8 -*- +# Be sure to restart your server when you modify this file. + +# Add new mime types for use in respond_to blocks: +# Mime::Type.register "text/richtext", :rtf +# Mime::Type.register_alias "text/html", :iphone diff --git a/config/initializers/sass.rb b/config/initializers/sass.rb new file mode 100644 index 0000000..2379a21 --- /dev/null +++ b/config/initializers/sass.rb @@ -0,0 +1,3 @@ +Sass::Plugin.options[:template_location] = { + "#{RAILS_ROOT}/app/assets/stylesheets" => "#{RAILS_ROOT}/public/assets/stylesheets" +} \ No newline at end of file diff --git a/config/initializers/secret_token.rb b/config/initializers/secret_token.rb new file mode 100644 index 0000000..e4a1c66 --- /dev/null +++ b/config/initializers/secret_token.rb @@ -0,0 +1,8 @@ +# -*- encoding : utf-8 -*- +# Be sure to restart your server when you modify this file. + +# Your secret key for verifying the integrity of signed cookies. +# If you change this key, all old signed cookies will become invalid! +# Make sure the secret is at least 30 characters and all random, +# no regular words or you'll be exposed to dictionary attacks. +PharmacieboissierCom::Application.config.secret_token = 'fa914363864abe6b6892e6e8043000d9bbe7c1f750bc5875d09010776616b5b7ba14cf7e5870fb804531792830ce9eae1fbcd671260894ba1c94a2d448bd4322' diff --git a/config/initializers/session_store.rb b/config/initializers/session_store.rb new file mode 100644 index 0000000..d9937ae --- /dev/null +++ b/config/initializers/session_store.rb @@ -0,0 +1,9 @@ +# -*- encoding : utf-8 -*- +# Be sure to restart your server when you modify this file. + +PharmacieboissierCom::Application.config.session_store :cookie_store, :key => '_pharmacieboissier.com_session' + +# Use the database for sessions instead of the cookie-based default, +# which shouldn't be used to store highly confidential information +# (create the session table with "rails generate session_migration") +# PharmacieboissierCom::Application.config.session_store :active_record_store diff --git a/config/initializers/simple_navigation.rb b/config/initializers/simple_navigation.rb new file mode 100644 index 0000000..8454180 --- /dev/null +++ b/config/initializers/simple_navigation.rb @@ -0,0 +1,2 @@ +# -*- encoding : utf-8 -*- +require 'simple_navigation/rails_controller_methods' diff --git a/config/locales/devise.fr.yml b/config/locales/devise.fr.yml new file mode 100644 index 0000000..07772c1 --- /dev/null +++ b/config/locales/devise.fr.yml @@ -0,0 +1,77 @@ +fr: + errors: + messages: + not_found: "n'a pas été trouvé(e)" + already_confirmed: "a déjà été confirmé(e)" + not_locked: "n'était pas verrouillé(e)" + not_saved: + one: "1 erreur a empéché ce %{resource} d'être sauvegardé:" + other: "%{count} erreurs ont empéché ce %{resource} d'être sauvegardé:" + devise: + shared: + sign_in: "Se connecter" + sign_up: "S'enregistrer" + forgot_password: "Mot de passe oublié ?" + didnt_receive_confirmation_instructions?: "Vous n'avez pas reçu de courriel de confirmation ?" + didnt_receive_unlock_instructions?: "Vous n'avez pas reçu de courriel de déverrouillage de votre compte ?" + sign_in_with_omniauth: "Se connecter avec %{provider}" + failure: + unauthenticated: "Vous devez vous connecter ou vous inscrire pour continuer." + unconfirmed: "Vous devez confirmer votre compte pour continuer." + locked: "Votre compte est verrouillé." + invalid: "Courriel ou mot de passe incorrect." + invalid_token: "Jeton d'authentification incorrect." + timeout: "Votre session est expirée, veuillez vous reconnecter pour continuer." + inactive: "Votre compte n'est pas encore activé." + sessions: + signed_in: "Connecté." + signed_out: "Déconnecté." + passwords: + change_your_password: "Changez votre mot de passe" + new_password: "Nouveau mot de passe" + confirm_new_password: "Confirmer le nouveau mot de passe" + change_my_password: "Changer mon mot de passe" + send_reset_password_instructions: "Envoyez moi les instructions de réinitialisation du mot de passe" + send_instructions: 'Vous allez recevoir un mail contenant les instructions de réinitialisation de mot de passe dans quelques minutes' + updated: 'Votre mot de passe a été édité avec succès, vous êtes maintenant connectés' + confirmations: + resend_instructions: 'Ré-envoyer les instructions de confirmation' + send_instructions: 'Vous allez recevoir contenant les instructions nécessaires à la confirmation de votre compte dans quelques minutes' + confirmed: 'Votre compte a été confirmé avec succès, vous êtes maintenant connectés' + registrations: + signed_up: 'Bienvenue, vous êtes connectés avec succès' + edit: "Editer %{resourcename}" + leave_blank: "laissez vide si vous ne désirez pas le changer" + current_password_label: "Nous avons besoin de votre mot de passe actuel pour confirmer les changements" + update: 'Modifier' + unhappy: "Mécontent" + cancel_my_account: "Annuler mon compte" + confirm: "Etes vous sur?" + back: "Retour" + inactive_signed_up: "Vous vous êtes connectés avec succès. Cependant, nous n'avons pas pu vous identifier car votre compte est %{reason}." + updated: 'Votre compte a été modifié avec succès.' + destroyed: 'Au revoir! Votre compte a été annulé avec succès. Nous espérons vous revoir bientôt.' + unlocks: + resend_instructions: "Ré-envoyer les instructions de débloquage" + send_instructions: 'Vous allez recevoir contenant les instructions nécessaires au débloquage de votre compte dans quelques minutes' + unlocked: 'Votre compte a été débloqué avec succès, vous êtes maintenant connectés.' + omniauth_callbacks: + success: 'Authorisé avec succès avec votre compte %{kind} .' + failure: "Nous n'avons pas pu vous authoriser à %{kind} pour la raison suivante: '%{reason}'." + mailer: + hello: "Bienvenue %{email}!" + welcome: "Bienvenue %{email}!" + confirm: "Confirmer mon compte" + change: 'Changer mon mot de passe' + someone_requested: "Un changement de mot de passe a été demandé. Vous pouvez le faire en cliquant sur le lien ci-dessous." + please_ignore: "Si vous n'avez pas fait cette demande, veuillez ignorer cet email." + password_wont_change: "Votre mot de passe ne sera pas changé tant que vous n'aurez pas accédé au lien ci-dessus pour en créer un nouveau." + locked: "Votre compte a été bloqué à cause d'un nombre excessif de tentatives de connection." + click_to_unlock: "Cliquez sur le lien ci-dessous pour déverrouiller votre compte" + unlock: "Déverrouiller mon compte" + confirmation_instructions: + subject: "Instructions de confirmation" + reset_password_instructions: + subject: "Instructions pour changer le mot de passe" + unlock_instructions: + subject: "Instructions pour déverrouiller le compte" \ No newline at end of file diff --git a/config/locales/fr.yml b/config/locales/fr.yml new file mode 100644 index 0000000..21a7206 --- /dev/null +++ b/config/locales/fr.yml @@ -0,0 +1,184 @@ +# French translations for Ruby on Rails +# by Christian Lescuyer (christian@flyingcoders.com) +# contributors: +# - Sebastien Grosjean - ZenCocoon.com +# - Bruno Michel - http://github.com/nono +# - Tsutomu Kuroda - http://github.com/kuroda (t-kuroda@oiax.jp) + +fr: + date: + formats: + default: "%d/%m/%Y" + short: "%e %b" + long: "%e %B %Y" + only_month: "%B %Y" + day_names: [dimanche, lundi, mardi, mercredi, jeudi, vendredi, samedi] + abbr_day_names: [dim, lun, mar, mer, jeu, ven, sam] + month_names: [~, janvier, février, mars, avril, mai, juin, juillet, août, septembre, octobre, novembre, décembre] + abbr_month_names: [~, jan., fév., mar., avr., mai, juin, juil., août, sept., oct., nov., déc.] + order: + - :day + - :month + - :year + + time: + formats: + default: "%d %B %Y %H:%M:%S" + short: "%d %b %H:%M" + long: "%A %d %B %Y %H:%M" + am: 'am' + pm: 'pm' + + datetime: + distance_in_words: + half_a_minute: "une demi-minute" + less_than_x_seconds: + zero: "moins d'une seconde" + one: "moins d'une seconde" + other: "moins de %{count} secondes" + x_seconds: + one: "1 seconde" + other: "%{count} secondes" + less_than_x_minutes: + zero: "moins d'une minute" + one: "moins d'une minute" + other: "moins de %{count} minutes" + x_minutes: + one: "1 minute" + other: "%{count} minutes" + about_x_hours: + one: "environ une heure" + other: "environ %{count} heures" + x_days: + one: "1 jour" + other: "%{count} jours" + about_x_months: + one: "environ un mois" + other: "environ %{count} mois" + x_months: + one: "1 mois" + other: "%{count} mois" + about_x_years: + one: "environ un an" + other: "environ %{count} ans" + over_x_years: + one: "plus d'un an" + other: "plus de %{count} ans" + almost_x_years: + one: "presqu'un an" + other: "presque %{count} ans" + prompts: + year: "Année" + month: "Mois" + day: "Jour" + hour: "Heure" + minute: "Minute" + second: "Seconde" + + number: + format: + separator: "," + delimiter: " " + precision: 3 + significant: false + strip_insignificant_zeros: false + currency: + format: + format: "%n %u" + unit: "€" + separator: "," + delimiter: " " + precision: 2 + significant: false + strip_insignificant_zeros: false + percentage: + format: + delimiter: "" + precision: + format: + delimiter: "" + human: + format: + delimiter: "" + precision: 2 + significant: true + strip_insignificant_zeros: true + storage_units: + format: "%n %u" + units: + byte: + one: "octet" + other: "octets" + kb: "ko" + mb: "Mo" + gb: "Go" + tb: "To" + decimal_units: + format: "%n %u" + units: + unit: "" + thousand: "millier" + million: "million" + billion: "milliard" + trillion: "billion" + quadrillion: "million de milliards" + + support: + array: + words_connector: ", " + two_words_connector: " et " + last_word_connector: " et " + select: + prompt: "Veuillez sélectionner" + + helpers: + select: + prompt: "Veuillez sélectionner" + submit: + create: "Créer un %{model}" + update: "Modifier ce %{model}" + submit: "Enregistrer ce %{model}" + + attributes: + created_at: "Créé le" + updated_at: "Modifié le" + password: "mot de passe" + + errors: + format: "Le %{attribute} %{message}" + messages: &errors_messages + inclusion: "n'est pas inclus(e) dans la liste" + exclusion: "n'est pas disponible" + invalid: "n'est pas valide" + confirmation: "ne concorde pas avec la confirmation" + accepted: "doit être accepté(e)" + empty: "doit être rempli(e)" + blank: "doit être rempli(e)" + too_long: "est trop long (pas plus de %{count} caractères)" + too_short: "est trop court (au moins %{count} caractères)" + wrong_length: "ne fait pas la bonne longueur (doit comporter %{count} caractères)" + not_a_number: "n'est pas un nombre" + not_an_integer: "doit être un nombre entier" + greater_than: "doit être supérieur à %{count}" + greater_than_or_equal_to: "doit être supérieur ou égal à %{count}" + equal_to: "doit être égal à %{count}" + less_than: "doit être inférieur à %{count}" + less_than_or_equal_to: "doit être inférieur ou égal à %{count}" + odd: "doit être impair" + even: "doit être pair" + template: &errors_template + header: + one: "Impossible d'enregistrer ce %{model} : 1 erreur" + other: "Impossible d'enregistrer ce %{model} : %{count} erreurs" + body: "Veuillez vérifier les champs suivants : " + + activerecord: + errors: + messages: + taken: "n'est pas disponible" + record_invalid: "La validation a échoué : %{errors}" + <<: *errors_messages + template: + <<: *errors_template + full_messages: + format: "%{attribute} %{message}" \ No newline at end of file diff --git a/config/navigation.rb b/config/navigation.rb new file mode 100644 index 0000000..b2bce22 --- /dev/null +++ b/config/navigation.rb @@ -0,0 +1,40 @@ +# -*- encoding : utf-8 -*- +# Configures your navigation +SimpleNavigation::Configuration.run do |navigation| + + navigation.auto_highlight = false + + navigation.items do |primary| + + + + + primary.item :dahsboard, 'Dashboard', admin_root_path() do |dahsboard| + dahsboard.item :image_files, 'Gestion des images', admin_image_files_path + dahsboard.item :data_files, 'Gestion des fichiers', admin_data_files_path + + + dahsboard.item :admins, 'liste des administrateurs du site', admin_admins_path do |sub_nav| + sub_nav.item :edit_admins, 'Editer un administrateur',(@admin ? edit_admin_admin_path(@admin) : "") + sub_nav.item :new_admins, 'Ajouter un administrateur',new_admin_admin_path + end + + + + + dahsboard.item :menu_items, 'liste des éléments de menu', (@menu_item ? admin_menu_items_path(:menu_id => @menu_item.menu_id, :parent_id => @menu_item.parent_id) : admin_menu_items_path) do |sub_nav| + sub_nav.item :edit_menu_items, 'Modifier un éléments de menu',(@menu_item and @menu_item.id ? edit_admin_menu_item_path(@menu_item) : "") + sub_nav.item :new_menu_items, 'Ajouter un élément de menu',(@menu_item ? new_admin_menu_item_path(:menu_id => @menu_item.menu_id, :parent_id => @menu_item.parent_id) : "") + end + + + + end + + + + + + end + +end diff --git a/config/routes.rb b/config/routes.rb new file mode 100644 index 0000000..cb2da37 --- /dev/null +++ b/config/routes.rb @@ -0,0 +1,148 @@ +# -*- encoding : utf-8 -*- +PharmacieboissierCom::Application.routes.draw do + + + + + + + get "prescriptions/index" + + get "prescriptions/show" + + get "prescriptions/delete" + + get "prescriptions/done" + + get "prescriptions/undone" + + get "prescriptions/new" + + get "prescriptions/create" + + get "articles/show" + + get "folders/show" + + get "home/show" + + get "menu_items/show" + + resources :download_data_files + + + + devise_for :admins, :controllers => {:sessions => "admins/sessions", :passwords => "admins/passwords"} + + namespace :portlet do + resources :break_contents + resources :download_contents + resources :dynamic_contents + resources :gallery_contents + resources :gallery_images do + collection do + get :reorder + end + end + resources :html_contents + resources :image_contents + resources :link_contents + resources :text_contents + resources :map_contents + resources :title_contents + resources :table_contents + resources :block_contents + resources :table_rows + resources :table_cols + resources :portlets do + collection do + get :reorder + end + end + end + + namespace :admin do + root :to => "dashboard#index" + + resources :admins + resources :menus + resources :menu_items + resources :image_files + resources :file_folders + resources :data_files + resources :pages + resources :menu_urls + resources :menu_aliases + resources :blocks + resources :albums + + + resources :cibles + + + + + end + + + + # The priority is based upon order of creation: + # first created -> highest priority. + + # Sample of regular route: + # match 'products/:id' => 'catalog#view' + # Keep in mind you can assign values other than :controller and :action + + # Sample of named route: + # match 'products/:id/purchase' => 'catalog#purchase', :as => :purchase + # This route can be invoked with purchase_url(:id => product.id) + + # Sample resource route (maps HTTP verbs to controller actions automatically): + # resources :products + + # Sample resource route with options: + # resources :products do + # member do + # get 'short' + # post 'toggle' + # end + # + # collection do + # get 'sold' + # end + # end + + # Sample resource route with sub-resources: + # resources :products do + # resources :comments, :sales + # resource :seller + # end + + # Sample resource route with more complex sub-resources + # resources :products do + # resources :comments + # resources :sales do + # get 'recent', :on => :collection + # end + # end + + # Sample resource route within a namespace: + # namespace :admin do + # # Directs /admin/products/* to Admin::ProductsController + # # (app/controllers/admin/products_controller.rb) + # resources :products + # end + + match 'pages/*url.:f' => 'public/menu_items#show', :as => :menu_item, :f => "html" + # You can have the root of your site routed with "root" + # just remember to delete public/index.html. + root :to => "public/menu_items#home" + + # See how all your routes lay out with "rake routes" + + # This is a legacy wild controller route that's not recommended for RESTful applications. + # Note: This route will make all actions in every controller accessible via GET requests. + # match ':controller(/:action(/:id(.:format)))' + + #root :to => "admin/dashboard#index" +end diff --git a/db/migrate/0001_add_sessions_table.rb b/db/migrate/0001_add_sessions_table.rb new file mode 100644 index 0000000..f2396e9 --- /dev/null +++ b/db/migrate/0001_add_sessions_table.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class AddSessionsTable < ActiveRecord::Migration + def self.up + create_table :sessions do |t| + t.string :session_id, :null => false + t.text :data + t.timestamps + end + + add_index :sessions, :session_id + add_index :sessions, :updated_at + end + + def self.down + drop_table :sessions + end +end diff --git a/db/migrate/0002_create_admin.rb b/db/migrate/0002_create_admin.rb new file mode 100644 index 0000000..77cd7e3 --- /dev/null +++ b/db/migrate/0002_create_admin.rb @@ -0,0 +1,22 @@ +# -*- encoding : utf-8 -*- +class CreateAdmin < ActiveRecord::Migration + def self.up + create_table :admins do |t| + t.database_authenticatable + t.confirmable + t.recoverable + t.rememberable + t.trackable + t.string :username + t.string :surname + t.string :firstname + t.integer :roles_mask + t.timestamps + + end + end + + def self.down + drop_table :admins + end +end diff --git a/db/migrate/0003_create_menu.rb b/db/migrate/0003_create_menu.rb new file mode 100644 index 0000000..a52848d --- /dev/null +++ b/db/migrate/0003_create_menu.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateMenu < ActiveRecord::Migration + def self.up + create_table :menus do |t| + t.string :name + t.string :max_levels + t.timestamps + end + + end + + def self.down + drop_table :menus + end +end diff --git a/db/migrate/0004_menu_items.rb b/db/migrate/0004_menu_items.rb new file mode 100644 index 0000000..be38f32 --- /dev/null +++ b/db/migrate/0004_menu_items.rb @@ -0,0 +1,34 @@ +# -*- encoding : utf-8 -*- +class MenuItems < ActiveRecord::Migration + def self.up + + + create_table :menu_items do |t| + t.string :name + t.string :slug + t.string :permalink + + t.integer :parent_id + t.integer :position + + t.boolean :super_admin + t.boolean :enabled + t.boolean :visible + t.boolean :deleted + + t.references :menu + + #polymorphic + t.integer :menu_content_id + t.string :menu_content_type + + + t.timestamps + end + + end + + def self.down + drop_table :menu_items + end +end diff --git a/db/migrate/0005_create_menu_item_content_types.rb b/db/migrate/0005_create_menu_item_content_types.rb new file mode 100644 index 0000000..aaa9f95 --- /dev/null +++ b/db/migrate/0005_create_menu_item_content_types.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateMenuItemContentTypes < ActiveRecord::Migration + def self.up + create_table :menu_item_content_types do |t| + t.string :name + t.string :slug + t.boolean :super_admin + + t.timestamps + end + end + + def self.down + drop_table :menu_item_content_types + end +end diff --git a/db/migrate/0010_create_pages.rb b/db/migrate/0010_create_pages.rb new file mode 100644 index 0000000..914c5df --- /dev/null +++ b/db/migrate/0010_create_pages.rb @@ -0,0 +1,20 @@ +# -*- encoding : utf-8 -*- +class CreatePages < ActiveRecord::Migration + def self.up + create_table :pages do |t| + t.text :title + t.text :description + t.text :keywords + + + t.timestamps + end + + MenuItemContentType.create(:slug => "Page", :name => "page") + + end + + def self.down + drop_table :pages + end +end diff --git a/db/migrate/0011_create_allowed_block_contents.rb b/db/migrate/0011_create_allowed_block_contents.rb new file mode 100644 index 0000000..a430056 --- /dev/null +++ b/db/migrate/0011_create_allowed_block_contents.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateAllowedBlockContents < ActiveRecord::Migration + def self.up + create_table :allowed_block_contents do |t| + t.references :block + t.references :content_type + + t.timestamps + end + end + + def self.down + drop_table :allowed_block_contents + end +end diff --git a/db/migrate/0065_create_blocks.rb b/db/migrate/0065_create_blocks.rb new file mode 100644 index 0000000..51882f5 --- /dev/null +++ b/db/migrate/0065_create_blocks.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CreateBlocks < ActiveRecord::Migration + def self.up + create_table :blocks do |t| + + t.string :block_name + t.string :blockable_type + t.integer :blockable_id + + t.text :content + + t.timestamps + end + end + + def self.down + drop_table :blocks + end +end diff --git a/db/migrate/0070_create_portlets.rb b/db/migrate/0070_create_portlets.rb new file mode 100644 index 0000000..daf118e --- /dev/null +++ b/db/migrate/0070_create_portlets.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CreatePortlets < ActiveRecord::Migration + def self.up + create_table :portlets do |t| + t.references :block + t.integer :content_id + t.string :content_type + t.integer :position + + + + t.timestamps + end + end + + def self.down + drop_table :portlets + end +end diff --git a/db/migrate/0071_create_content_types.rb b/db/migrate/0071_create_content_types.rb new file mode 100644 index 0000000..34301a9 --- /dev/null +++ b/db/migrate/0071_create_content_types.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateContentTypes < ActiveRecord::Migration + def self.up + create_table :content_types do |t| + t.string :slug + t.string :name + + t.timestamps + end + end + + def self.down + drop_table :content_types + end +end diff --git a/db/migrate/0075_create_title_contents.rb b/db/migrate/0075_create_title_contents.rb new file mode 100644 index 0000000..7ea1156 --- /dev/null +++ b/db/migrate/0075_create_title_contents.rb @@ -0,0 +1,18 @@ +# -*- encoding : utf-8 -*- +class CreateTitleContents < ActiveRecord::Migration + def self.up + create_table :title_contents do |t| + t.text :content + t.integer :level + t.string :style + + t.timestamps + end + + ContentType.create(:slug => "TitleContent", :name => "Titre") + end + + def self.down + drop_table :title_contents + end +end diff --git a/db/migrate/0076_create_text_contents.rb b/db/migrate/0076_create_text_contents.rb new file mode 100644 index 0000000..abe1c40 --- /dev/null +++ b/db/migrate/0076_create_text_contents.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class CreateTextContents < ActiveRecord::Migration + def self.up + create_table :text_contents do |t| + t.string :style + t.text :content + + t.timestamps + end + + ContentType.create(:slug => "TextContent", :name => "Texte") + end + + def self.down + drop_table :text_contents + end +end diff --git a/db/migrate/0077_create_image_contents.rb b/db/migrate/0077_create_image_contents.rb new file mode 100644 index 0000000..a0b4112 --- /dev/null +++ b/db/migrate/0077_create_image_contents.rb @@ -0,0 +1,22 @@ +# -*- encoding : utf-8 -*- +class CreateImageContents < ActiveRecord::Migration + def self.up + create_table :image_contents do |t| + t.references :image_file + t.integer :width + t.integer :height + t.string :alignement + t.boolean :expandable + t.string :style + t.string :alt + + t.timestamps + end + + ContentType.create(:slug => "ImageContent", :name => "Image") + end + + def self.down + drop_table :image_contents + end +end diff --git a/db/migrate/0078_create_link_contents.rb b/db/migrate/0078_create_link_contents.rb new file mode 100644 index 0000000..7158134 --- /dev/null +++ b/db/migrate/0078_create_link_contents.rb @@ -0,0 +1,25 @@ +# -*- encoding : utf-8 -*- +class CreateLinkContents < ActiveRecord::Migration + def self.up + create_table :link_contents do |t| + t.integer :type + t.string :name + t.string :title + t.boolean :popup + + t.string :url + t.string :style + + t.integer :cible_id + t.string :cible_type + + t.timestamps + end + + ContentType.create(:slug => "LinkContent", :name => "Lien") + end + + def self.down + drop_table :link_contents + end +end diff --git a/db/migrate/0079_create_break_contents.rb b/db/migrate/0079_create_break_contents.rb new file mode 100644 index 0000000..55542b9 --- /dev/null +++ b/db/migrate/0079_create_break_contents.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class CreateBreakContents < ActiveRecord::Migration + def self.up + create_table :break_contents do |t| + t.boolean :line + t.integer :height + t.string :style + t.timestamps + end + + ContentType.create(:slug => "BreakContent", :name => "Séparation") + end + + def self.down + drop_table :break_contents + end +end diff --git a/db/migrate/0080_create_html_contents.rb b/db/migrate/0080_create_html_contents.rb new file mode 100644 index 0000000..db94f65 --- /dev/null +++ b/db/migrate/0080_create_html_contents.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateHtmlContents < ActiveRecord::Migration + def self.up + create_table :html_contents do |t| + t.text :content + t.string :style + t.timestamps + end + + ContentType.create(:slug => "HtmlContent", :name => "Code HTML") + end + + def self.down + drop_table :html_contents + end +end diff --git a/db/migrate/0081_create_download_contents.rb b/db/migrate/0081_create_download_contents.rb new file mode 100644 index 0000000..6e1a26c --- /dev/null +++ b/db/migrate/0081_create_download_contents.rb @@ -0,0 +1,20 @@ +# -*- encoding : utf-8 -*- +class CreateDownloadContents < ActiveRecord::Migration + def self.up + create_table :download_contents do |t| + t.string :title + t.string :style + t.text :description + t.references :data_file + + + t.timestamps + end + + ContentType.create(:slug => "DownloadContent", :name => "Téléchargement") + end + + def self.down + drop_table :download_contents + end +end diff --git a/db/migrate/0082_create_gallery_contents.rb b/db/migrate/0082_create_gallery_contents.rb new file mode 100644 index 0000000..72e72cc --- /dev/null +++ b/db/migrate/0082_create_gallery_contents.rb @@ -0,0 +1,20 @@ +# -*- encoding : utf-8 -*- +class CreateGalleryContents < ActiveRecord::Migration + def self.up + create_table :gallery_contents do |t| + t.string :name + t.text :description + + t.integer :style + t.integer :nbr_img + + t.timestamps + end + + ContentType.create(:slug => "GalleryContent", :name => "Galerie") + end + + def self.down + drop_table :gallery_contents + end +end diff --git a/db/migrate/0101_create_gallery_images.rb b/db/migrate/0101_create_gallery_images.rb new file mode 100644 index 0000000..aadf169 --- /dev/null +++ b/db/migrate/0101_create_gallery_images.rb @@ -0,0 +1,18 @@ +# -*- encoding : utf-8 -*- +class CreateGalleryImages < ActiveRecord::Migration + def self.up + create_table :gallery_images do |t| + t.string :title + t.text :description + t.integer :position + t.references :image_file + t.references :gallery_content + + t.timestamps + end + end + + def self.down + drop_table :gallery_images + end +end diff --git a/db/migrate/0102_create_dynamic_contents.rb b/db/migrate/0102_create_dynamic_contents.rb new file mode 100644 index 0000000..1b48b74 --- /dev/null +++ b/db/migrate/0102_create_dynamic_contents.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateDynamicContents < ActiveRecord::Migration + def self.up + create_table :dynamic_contents do |t| + t.string :name + + t.timestamps + end + + # ContentType.create(:slug => "DynamicContent", :name => "Contenu dynamique") + end + + def self.down + drop_table :dynamic_contents + end +end diff --git a/db/migrate/20110215144022_create_table_contents.rb b/db/migrate/20110215144022_create_table_contents.rb new file mode 100644 index 0000000..177eed3 --- /dev/null +++ b/db/migrate/20110215144022_create_table_contents.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CreateTableContents < ActiveRecord::Migration + def self.up + create_table :table_contents do |t| + t.integer :style + t.integer :nbr_rows + t.integer :nbr_cols + + t.timestamps + end + + ContentType.create(:slug => "TableContent", :name => "Tableau") + + end + + def self.down + drop_table :table_contents + end +end diff --git a/db/migrate/20110215144326_create_table_rows.rb b/db/migrate/20110215144326_create_table_rows.rb new file mode 100644 index 0000000..c415836 --- /dev/null +++ b/db/migrate/20110215144326_create_table_rows.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateTableRows < ActiveRecord::Migration + def self.up + create_table :table_rows do |t| + t.integer :position + t.integer :style + t.references :table_content + t.timestamps + end + end + + def self.down + drop_table :table_rows + end +end diff --git a/db/migrate/20110215144501_create_cel_tables.rb b/db/migrate/20110215144501_create_cel_tables.rb new file mode 100644 index 0000000..710be0f --- /dev/null +++ b/db/migrate/20110215144501_create_cel_tables.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class CreateCelTables < ActiveRecord::Migration + def self.up + create_table :cel_tables do |t| + t.integer :position + t.integer :style + t.references :table_row + t.references :table_content + + t.timestamps + end + end + + def self.down + drop_table :cel_tables + end +end diff --git a/db/migrate/20110412073417_create_tags.rb b/db/migrate/20110412073417_create_tags.rb new file mode 100644 index 0000000..8638ec2 --- /dev/null +++ b/db/migrate/20110412073417_create_tags.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CreateTags < ActiveRecord::Migration + def self.up + create_table :tags do |t| + t.string :name + t.string :slug + t.integer :parent_id + t.boolean :public + t.string :taggable_type + t.integer :taggable_id + + t.timestamps + end + end + + def self.down + drop_table :tags + end +end diff --git a/db/migrate/20110412080316_create_image_files.rb b/db/migrate/20110412080316_create_image_files.rb new file mode 100644 index 0000000..ea69e40 --- /dev/null +++ b/db/migrate/20110412080316_create_image_files.rb @@ -0,0 +1,20 @@ +# -*- encoding : utf-8 -*- +class CreateImageFiles < ActiveRecord::Migration + def self.up + create_table :image_files do |t| + t.string :file + t.string :name + t.string :slug + t.text :description + t.string :tags + t.references :album + t.boolean :home + + t.timestamps + end + end + + def self.down + drop_table :image_files + end +end diff --git a/db/migrate/20110414184246_create_albums.rb b/db/migrate/20110414184246_create_albums.rb new file mode 100644 index 0000000..a35a875 --- /dev/null +++ b/db/migrate/20110414184246_create_albums.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateAlbums < ActiveRecord::Migration + def self.up + create_table :albums do |t| + t.string :name + t.boolean :super_admin + + t.timestamps + end + end + + def self.down + drop_table :albums + end +end diff --git a/db/migrate/20110418153215_create_block_contents.rb b/db/migrate/20110418153215_create_block_contents.rb new file mode 100644 index 0000000..02da5aa --- /dev/null +++ b/db/migrate/20110418153215_create_block_contents.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class CreateBlockContents < ActiveRecord::Migration + def self.up + create_table :block_contents do |t| + t.integer :style + t.integer :nbr_columns + + t.timestamps + end + + ContentType.create(:slug => "BlockContent", :name => "Bloc") + end + + def self.down + drop_table :block_contents + end +end diff --git a/db/migrate/20110420132008_create_menu_aliases.rb b/db/migrate/20110420132008_create_menu_aliases.rb new file mode 100644 index 0000000..0b3652c --- /dev/null +++ b/db/migrate/20110420132008_create_menu_aliases.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateMenuAliases < ActiveRecord::Migration + def self.up + create_table :menu_aliases do |t| + t.references :menu_item + + t.timestamps + end + + MenuItemContentType.create(:slug => "MenuAlias", :name => "Alias") + end + + def self.down + drop_table :menu_aliases + end +end diff --git a/db/migrate/20110420132127_create_menu_urls.rb b/db/migrate/20110420132127_create_menu_urls.rb new file mode 100644 index 0000000..ccc4ea1 --- /dev/null +++ b/db/migrate/20110420132127_create_menu_urls.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateMenuUrls < ActiveRecord::Migration + def self.up + create_table :menu_urls do |t| + t.string :url + + t.timestamps + end + + MenuItemContentType.create(:slug => "MenuUrl", :name => "Lien externe") + end + + def self.down + drop_table :menu_urls + end +end diff --git a/db/migrate/20110421125532_create_file_folders.rb b/db/migrate/20110421125532_create_file_folders.rb new file mode 100644 index 0000000..6c51ccd --- /dev/null +++ b/db/migrate/20110421125532_create_file_folders.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateFileFolders < ActiveRecord::Migration + def self.up + create_table :file_folders do |t| + t.string :name + t.boolean :super_admin + + t.timestamps + end + end + + def self.down + drop_table :file_folders + end +end diff --git a/db/migrate/20110421125631_create_data_files.rb b/db/migrate/20110421125631_create_data_files.rb new file mode 100644 index 0000000..60b92bc --- /dev/null +++ b/db/migrate/20110421125631_create_data_files.rb @@ -0,0 +1,18 @@ +# -*- encoding : utf-8 -*- +class CreateDataFiles < ActiveRecord::Migration + def self.up + create_table :data_files do |t| + t.string :file + t.string :name + t.string :slug + t.string :description + t.references :file_folder + + t.timestamps + end + end + + def self.down + drop_table :data_files + end +end diff --git a/db/migrate/20110422144800_create_cible_types.rb b/db/migrate/20110422144800_create_cible_types.rb new file mode 100644 index 0000000..5a95406 --- /dev/null +++ b/db/migrate/20110422144800_create_cible_types.rb @@ -0,0 +1,15 @@ +# -*- encoding : utf-8 -*- +class CreateCibleTypes < ActiveRecord::Migration + def self.up + create_table :cible_types do |t| + t.string :slug + t.string :name + + t.timestamps + end + end + + def self.down + drop_table :cible_types + end +end diff --git a/db/migrate/20110422144907_create_cible_aliases.rb b/db/migrate/20110422144907_create_cible_aliases.rb new file mode 100644 index 0000000..5a1188d --- /dev/null +++ b/db/migrate/20110422144907_create_cible_aliases.rb @@ -0,0 +1,17 @@ +# -*- encoding : utf-8 -*- +class CreateCibleAliases < ActiveRecord::Migration + def self.up + create_table :cible_aliases do |t| + t.references :menu_item + + t.timestamps + end + + CibleType.create(:slug => "CibleAlias", :name => "Alias") + + end + + def self.down + drop_table :cible_aliases + end +end diff --git a/db/migrate/20110422144942_create_cible_urls.rb b/db/migrate/20110422144942_create_cible_urls.rb new file mode 100644 index 0000000..f1f1738 --- /dev/null +++ b/db/migrate/20110422144942_create_cible_urls.rb @@ -0,0 +1,16 @@ +# -*- encoding : utf-8 -*- +class CreateCibleUrls < ActiveRecord::Migration + def self.up + create_table :cible_urls do |t| + t.string :url + + t.timestamps + end + CibleType.create(:slug => "CibleUrl", :name => "Lien externe") + + end + + def self.down + drop_table :cible_urls + end +end diff --git a/db/migrate/20110427164514_create_map_contents.rb b/db/migrate/20110427164514_create_map_contents.rb new file mode 100644 index 0000000..1a0eef7 --- /dev/null +++ b/db/migrate/20110427164514_create_map_contents.rb @@ -0,0 +1,19 @@ +# -*- encoding : utf-8 -*- +class CreateMapContents < ActiveRecord::Migration + def self.up + create_table :map_contents do |t| + t.string :address + t.string :name + t.integer :view + t.boolean :info_bule + t.integer :zoom + + t.timestamps + end + ContentType.create(:slug => "MapContent", :name => "Plan") + end + + def self.down + drop_table :map_contents + end +end diff --git a/db/seeds.rb b/db/seeds.rb new file mode 100644 index 0000000..be514d8 --- /dev/null +++ b/db/seeds.rb @@ -0,0 +1,10 @@ +# -*- encoding : utf-8 -*- + +Admin.create(:email => "n.bally@quartz-agence.com", :username => "quartz", :surname => "Bally", :firstname => "Nicolas", :password => "cloudofdreams", :password_confirmation => "cloudofdreams") +puts "Création du super admin" +Menu.create(:name => "Menu principal", :max_levels => 3) +puts "Création du menu principal" +Album.create(:name => "Photos diverses", :super_admin => true) +puts "Création du premier album" +FileFolder.create(:name => "Dossier principal", :super_admin => true) +puts "Création du premier dossier" diff --git a/doc/README_FOR_APP b/doc/README_FOR_APP new file mode 100644 index 0000000..fe41f5c --- /dev/null +++ b/doc/README_FOR_APP @@ -0,0 +1,2 @@ +Use this README file to introduce your application and point to useful places in the API for learning more. +Run "rake doc:app" to generate API documentation for your models, controllers, helpers, and libraries. diff --git a/lib/tasks/.gitkeep b/lib/tasks/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/log/.gitkeep b/log/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/private_medias b/private_medias new file mode 120000 index 0000000..7c18fcb --- /dev/null +++ b/private_medias @@ -0,0 +1 @@ +../medias/private \ No newline at end of file diff --git a/public/404.html b/public/404.html new file mode 100644 index 0000000..d1e96cb --- /dev/null +++ b/public/404.html @@ -0,0 +1,47 @@ + + + + + + + Erreur 404 + + + + + + + + +

Erreur 404

+
+

La page que vous avez demandée n'existe pas, + ou n'est pas disponible... +

+
+ + diff --git a/public/422.html b/public/422.html new file mode 100644 index 0000000..3e91e6f --- /dev/null +++ b/public/422.html @@ -0,0 +1,46 @@ + + + + + + + Erreur 422 + + + + + + + + +

Erreur 422

+
+

Nous sommes désolé mais votre demande n'a pas pue être exécutée. +

+
+ + diff --git a/public/500.html b/public/500.html new file mode 100644 index 0000000..17d4bd3 --- /dev/null +++ b/public/500.html @@ -0,0 +1,46 @@ + + + + + + + Erreur 500 + + + + + + + + +

Erreur 500

+
+

Nous sommes désolé mais une erreur est survenue. +

+
+ + diff --git a/public/assets/javascripts/admin/admin.js b/public/assets/javascripts/admin/admin.js new file mode 100644 index 0000000..554802e --- /dev/null +++ b/public/assets/javascripts/admin/admin.js @@ -0,0 +1,180 @@ +function auto_load_divs() { + $('div[data-load]').live("resize",function () { + + auto_load_div($(this)); + + + }); + + + +} + +function auto_load_div(div_to_load) { + + + url = div_to_load.attr("data-url"); + + + load_block = div_to_load.children(".loading") ; + div_to_load.children(".ajax_load_content").hide(); + load_block.show(); + + div_to_load.children(".ajax_load_content").load(url, function() {div_to_load.children(".loading").hide();$(this).show();block_js_initialize(); resize_page_slide();}) + + + + + +} +function update_auto_load_div(url, div_to_load) +{ + + div = $("#"+div_to_load); + + div.attr("data-url", url); + auto_load_div(div); + + +} + +function when_admin_load() { + + $('.closeable').hide().fadeIn().delay(2000).fadeOut(); + + set_prescriptions_big_container_size(); + + + $('#slides').sortable({ + + opacity:0.5, + update : function () { + var order = $(this).sortable('serialize'); + + $.ajax({url : "/admin/slides/reorder.js?"+order}); + } + + }); + + + + auto_load_divs(); + resize_page_slide(); + + $(window).bind('resize', function(){ + + resize_page_slide(); + }); + + $(".update_auto_load_div").live("click",function() { + + + update_auto_load_div($(this).attr("href"), $(this).attr("data_div_id")); + + $(this).parent().children("a").removeClass("selected"); + $(this).addClass("selected"); + + return false; + }); + + +} +function flash_notice(text) { + $('#flash').html(''); + $('#flash').html(''); + + $('#flash_notice').fadeIn(); + $('#flash_notice').delay(2000).fadeOut(); + + + +} + +function flash_alert(text) { + $('#flash').html(''); + $('#flash').html(''); + + $('#flash_alert').fadeIn(); + $('#flash_alert').delay(4000).fadeOut(); + + + +} + +function resize_page_slide(){ + + $('.page_slide').css('width', $("#breadcrumb").outerWidth()); + + + +} + +function auto_tiny_mce(div) +{ + + + div.css("width", "100%"); + div.css("height", "400px"); + div.tinymce({ + // Location of TinyMCE script + script_url : '/assets/javascripts/core/tiny_mce/tiny_mce.js', + content_css : "/assets/stylesheets/admin/admin.css", + // General options + theme : "advanced", + skin: "cirkuit", + plugins : "pagebreak,style,contextmenu,paste,directionality,noneditable,visualchars,nonbreaking,xhtmlxtras", + + // Theme options + theme_advanced_buttons1 : "bold,italic,underline,strikethrough,|,justifyleft,justifycenter,justifyright,justifyfull,fontsizeselect,|,cut,copy,paste,pastetext,pasteword,|,bullist,numlist,|,forecolor,backcolor,sub,sup,|,charmap,|,removeformat", + theme_advanced_buttons2 : "", + theme_advanced_buttons3 : "", + + theme_advanced_toolbar_location : "top", + theme_advanced_toolbar_align : "left", + theme_advanced_statusbar_location : false, + theme_advanced_resizing : false, + theme_advanced_text_colors : "#D2232A,#40AF49,#00ADEF", + theme_advanced_background_colors : "#D2232A,#40AF49,#00ADEF", + + //theme_advanced_toolbar_location : "external", + + + + }); + +} +function set_prescriptions_big_container_size(){ + + + $("#prescriptions_big_container").css("height",( $(window).height() - 36)+"px"); + +} + + + +$(document).ready(function () { + + + + + +when_admin_load(); + + $(".text_editor").each(function() { + + + auto_tiny_mce($(this)); + }); + + + + $(window).bind("resize", function() { + set_prescriptions_big_container_size(); + }) + + + + + +}); + diff --git a/public/assets/javascripts/admin/block.js b/public/assets/javascripts/admin/block.js new file mode 100644 index 0000000..64a7308 --- /dev/null +++ b/public/assets/javascripts/admin/block.js @@ -0,0 +1,159 @@ + + + + +function block_js_initialize(){ + + initialize_receptables(); + + $( ".content_types_draggable" ).draggable({ + revert:"invalid", + //handle:".grip", + connectToSortable: ".block_portlets", + opacity: 0.5, + zIndex:1000, + + helper: 'clone', + + }); + + + $('.portlet').live('mouseover', function(){ + + //$('.portlet').removeClass('portlet_hover'); + $(this).addClass('portlet_hover'); + + $(this).parents('.portlet').children(".actions").css({'display':'none'}); + $(this).parents('.portlet').css({ "border" : "1px solid #FBFBFB"}); + + }); + + $('.portlet').live('mouseout', function(){ + + $(this).removeClass('portlet_hover'); + + + + $(this).parents('.portlet').children(".actions").css('display',''); + $(this).parents('.portlet').css({ "border" : ""}); + + + + }); + + + + + + + +} + + +function update_portlet_order(){ + var return_order = []; + + + + $('.block_portlets').each(function(){ + + var block_data = {block_id : $(this).data('block_id'), block_portlet_ids : []}; + + $(this).children('.portlet').each(function(){ + if($(this).data('portlet_id')){ + block_data.block_portlet_ids.push($(this).data('portlet_id')); + } + + }); + return_order.push(block_data); + }); + + + $.ajax({url : "/portlet/portlets/reorder", data : {blocks:return_order} }); + +} + + +function initialize_receptables(){ + $('.portlet_place_holder').remove(); + $('.block_portlets').prepend('
'); + $('.portlet').after('
'); + + $( ".portlet" ).draggable({ + revert:"invalid", + handle:".move", + zIndex:600, + opacity: 0.5, + appendTo:"body", + scrollSensitivity : 20, + scrollSpeed : 40 + + + + + }); + + + $(".portlet_place_holder").droppable({ + hoverClass:"portlet_receptable_hover", + tolerance : "pointer", + accept: '.portlet, .content_types_draggable' , + over: function(event, ui) { + + $(this).attr("data_height", $(this).height()); + $(this).css("height", ui.draggable.attr("data_height")) + + }, + + out: function(event, ui) { + $(this).css("height", $(this).attr("data_height")) + + }, + + drop: function( event, ui ) { + + + + + if(ui.draggable.data("portlet_id")){ + + $(this).after(ui.draggable); + ui.draggable.removeClass("ui-draggable"); + ui.draggable.removeClass("ui-draggable-dragging"); + ui.draggable.css({"top":"", "left":""}); + initialize_receptables(); + + update_portlet_order(); + + + } + else + { + + + $(this).after('
'); + initialize_receptables(); + $.ajax({ + url:"/portlet/portlets/new.js", + type: "GET", + data: { + block_id : $(this).attr("data_block_id"), + position : $(this).attr("data_position"), + content_type : ui.draggable.attr("data_type") + } , + success : function (){ + after_load_document(); + } + }); + + + } + + + + } + }); + + + +} \ No newline at end of file diff --git a/public/assets/javascripts/admin/browser.js b/public/assets/javascripts/admin/browser.js new file mode 100644 index 0000000..875de26 --- /dev/null +++ b/public/assets/javascripts/admin/browser.js @@ -0,0 +1,64 @@ +$(document).ready(function ($) { + + var browser_test = $.reject({ + header: "Le navigateur que vous utilisez actuellement n'est pas pris en charge", // Header Text + paragraph1: "Notre interface d'administration étant conçu pour être la plus ergonomique et agréable à utiliser nécéssite l'usage d'un navigateur récent et respectueux des standards.", // Paragraph 1 + paragraph2: "Nous vous remercions d'installer l'un des navigateurs suivant :", // Paragraph 2 + + imagePath:"/images/browser/", + + + close:false, + reject : { + msie: true, + + chrome9 : true, + chrome8 : true, + chrome7 : true, + chrome6 : true, + chrome5 : true, + chrome4 : true, + chrome3 : true, + chrome2 : true, + + konqueror : true, + opera:true, + safari2 : true, + safari3:true, + safari4:true, + + + firefox1: true, + firefox2: true, + firefox3: true + + + + }, + + + display: ['safari','chrome','firefox'], + browserInfo: { + safari: { + text: 'Safari 5+', + img: "/browser/safari.png", + url: 'http://www.apple.com/fr/safari/download/' + } , + chrome: { + text: "Chrome 11+", + url: 'http://www.google.com/chrome/' + } + + } + + + }); // Default Settings + + + if( browser_test){ + $('#main').hide(); + $('#title').hide(); + + } + +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/editor.js b/public/assets/javascripts/admin/editor.js new file mode 100644 index 0000000..37d5a18 --- /dev/null +++ b/public/assets/javascripts/admin/editor.js @@ -0,0 +1,53 @@ +GENTICS.Aloha.settings = { + errorhandling : false, + ribbon: false, + "i18n": {"current": "fr"}, + "plugins": { + "com.gentics.aloha.plugins.GCN": { + "enabled": false + }, + "com.gentics.aloha.plugins.Align": { + // Allow align left, center and justify only for all elements + // 4 possibilities : left, center, right and justify + config : [ 'left','center','right','justify'], + + }, + "Paste": { + + enable: true + + }, + "com.gentics.aloha.plugins.FontSize": { + + + config : ['increase', 'decrease'] + + }, + "com.gentics.aloha.plugins.Format": { + config : [ 'b', 'i','u','del','sub','sup','removeFormat'], + }, + "com.gentics.aloha.plugins.TextColor": { + + enable: true + + } + + + + + } +}; + +jQuery(document).ready(function($) { + + $(".notice").each(function(index) { + + var self = $(this); + var postId = self.attr("data-id"); + var postField = self.attr("data-field"); + + // add callbacks to update post data fields: + self.aloha() + }); + +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/manager/data_files.js b/public/assets/javascripts/admin/manager/data_files.js new file mode 100644 index 0000000..01be7fe --- /dev/null +++ b/public/assets/javascripts/admin/manager/data_files.js @@ -0,0 +1,271 @@ +function data_files_load() +{ + + update_data_multiple_selection_text(); + set_data_files_big_container_size(); + + + + + + + $( ".data_file" ).draggable({ + revert:"invalid", + + opacity: 0.5, + helper: 'clone', + appendTo: '#main_workspace_view', + start: function(event, ui) { + + }, + drag: function(){ + }, + stop: function(){ + + } + }); + + + $(".file_folder:not(.active)").droppable({ + hoverClass:"album_highlight", + tolerance : "pointer", + + drop: function( event, ui ) { + ui.draggable.fadeOut().remove(); + + + $.ajax({ + url:ui.draggable.data('show_url'), + type: "PUT", + data: { + data_file : { + file_folder_id : $(this).data("file_folder_id") + } + } + }); + $( this ).effect("highlight", {}, 3000); + + } + }); + + + + + +} + + + +function update_data_multiple_selection_text() +{ + + var multiple_ids = multiple_data_selection_ids() + var text = "" + if (multiple_ids.length == 0) + { + text = "Aucun fichier séléctionné"; + } + else if(multiple_ids.length == 1) + { + text= "Un fichier séléctionné"; + } + else + { + text= multiple_ids.length+" fichiers séléctionnés"; + } + + + $('#data_files_multiple_selection_text').html(text); + +} + +function multiple_data_selection_ids() +{ + var multiple_selection_ids = [] + + $('#data_files .active').each(function () + { + multiple_selection_ids.push($(this).data("id")) + + }); + + return multiple_selection_ids + +} + +function close_data_file_container(data_file_id) +{ + $('#data_file_container').removeClass("data_file_container_active"); + $('#data_files_container').css("overflow", ""); + $('#right_bar').show(); + +} + +function set_data_files_big_container_size(){ + + if($("#data_files_big_container").parent().attr("id") == "manager_box") + { + $("#data_files_big_container").css("height",( $("#manager_box").height())+"px"); + $("#data_files_big_container").css("top","0px"); + } + else + { + $("#data_files_big_container").css("height",( $(window).height() - 36)+"px"); + } +} + + +function delete_multiple_files(){ + if(confirm("Voulez-vous vraiment supprimer ces fichiers ?")) + { + + var multiple_ids = multiple_data_selection_ids(); + $.each(multiple_ids, function(index, value) + { + $.ajax({ + url:"/admin/data_files/"+value+".js", + type : "DELETE", + success : function (){ + update_data_multiple_selection_text(); + } + }); + } + ); + + return false; + + } + +} + +function select_all_files(){ + $('#data_files .data_file').each(function (){ + + + $(this).addClass("active"); + + + }); + update_data_multiple_selection_text(); + +} + +function unselect_all_files(){ + + $('#data_files .data_file').each(function (){ + + + $(this).removeClass("active"); + + + }); + update_data_multiple_selection_text(); +} + +function initialize_slider(){ +$("#grid_slider").slider({ +value: $('.data_file .img').width(), +max: 250, +min: 80, +slide: + function(event, ui) + { + slider_value = ui.value + set_data_files_img_size(); + }, +create : + function(event, ui) + { + slider_enabled = true + } + +}); +} + +$(document).ready(function ($) { + + + $(window).bind("resize", function() { + set_data_files_big_container_size(); + }) + + + $("#left_buttons").live("click", function() { + multiple_selection_ids(); + }) + + $(".data_file").live('dblclick', function (event){ + + + $.ajax({url : $(this).data('show_url'), success: function (){ + $('#data_file_container').addClass("data_file_container_active"); + $('#right_bar').hide(); + + + + + + }}); + + + + + + + }); + + $("#data_files_container").live("click",function (e){ + + + + + if ($(e.target).parents(".data_file").length == 0){ + unselect_all_image(); + + } + + }); + + $("#data_file_container .img").live("dblclick",function (){ + close_data_file_container(); + + }); + + + + $('#data_files_big_container #main_workspace_view #data_file_container .form input').live('keydown', function(){ + $('#data_files_big_container #main_workspace_view #data_file_container .form .submit_tr').show(); + }) + $('#data_files_big_container #main_workspace_view #data_file_container .form textarea').live('keydown', function(){ + $('#data_files_big_container #main_workspace_view #data_file_container .form .submit_tr').show(); + }) + + $(".data_file").live("click",function (){ + if ($(this).hasClass('active')){ + $(this).removeClass('active'); + + } + else + { + $(this).addClass('active'); + } + + update_data_multiple_selection_text(); + + }); + + set_data_files_big_container_size(); + + + + initialize_slider(); + + + + data_files_load(); + + + + + +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/manager/image_files.js b/public/assets/javascripts/admin/manager/image_files.js new file mode 100644 index 0000000..eb6ce79 --- /dev/null +++ b/public/assets/javascripts/admin/manager/image_files.js @@ -0,0 +1,284 @@ +var slider_value = null; +var slider_enabled = null; +function image_files_load() +{ + + update_multiple_selection_text(); + set_image_files_big_container_size(); + set_image_files_img_size(); + + if(!slider_enabled){ + initialize_slider(); + + } + + + + + + + + $( ".image_file" ).draggable({ + revert:"invalid", + + opacity: 0.5, + helper: 'clone', + appendTo: '#main_workspace_view', + start: function(event, ui) { + + }, + drag: function(){ + }, + stop: function(){ + + } + }); + + + $(".album:not(.active)").droppable({ + hoverClass:"album_highlight", + tolerance : "pointer", + drop: function( event, ui ) { + ui.draggable.fadeOut().remove(); + + + $.ajax({ + url:ui.draggable.attr('data_show_url'), + type: "PUT", + data: { + image_file : { + album_id : $(this).attr("data_album_id") + } + }, + success: function(){ + + } + + + }); + $( this ).effect("highlight", {}, 3000); + + } + }); + + + + + +} + +function set_image_files_img_size(){ + $('.image_file .img').css('width',slider_value+"px"); + $('.image_file .img').css('height',slider_value+"px"); + +} + +function update_multiple_selection_text() +{ + + var multiple_ids = multiple_selection_ids() + var text = "" + if (multiple_ids.length == 0) + { + text = "Aucune image séléctionnée"; + } + else if(multiple_ids.length == 1) + { + text= "Une image séléctionnée"; + } + else + { + text= multiple_ids.length+" images séléctionnées"; + } + + + $('#multiple_selection_text').html(text); + +} + +function multiple_selection_ids() +{ + var multiple_selection_ids = [] + + $('#image_files .active').each(function () + { + multiple_selection_ids.push($(this).attr("data_id")) + }); + + return multiple_selection_ids +} + +function close_image_file_container(image_file_id) +{ + $('#image_file_container').removeClass("image_file_container_active"); + $('#image_files_container').css("overflow", ""); + $('#right_bar').show(); + +} + +function set_image_files_big_container_size(){ + + if($("#image_files_big_container").parent().attr("id") == "manager_box") + { + $("#image_files_big_container").css("height",( $("#manager_box").height())+"px"); + $("#image_files_big_container").css("top","0px"); + } + else + { + $("#image_files_big_container").css("height",( $(window).height() - 36)+"px"); + //alert($("#breadcrumb").outerHeight()); + } +} + + +function delete_multiple_images(){ + if(confirm("Voulez-vous vraiment supprimer ces images ?")) + { + + var multiple_ids = multiple_selection_ids(); + $.each(multiple_ids, function(index, value) + { + $.ajax({ + url:"/admin/image_files/"+value+".js", + type : "DELETE", + success : function (){ + update_multiple_selection_text(); + } + }); + } + ); + + return false; + + } + +} + +function select_all_image(){ + $('#image_files .image_file').each(function (){ + + + $(this).addClass("active"); + + + }); + update_multiple_selection_text(); + +} + +function unselect_all_image(){ + + $('#image_files .image_file').each(function (){ + + + $(this).removeClass("active"); + + + }); + update_multiple_selection_text(); +} + +function initialize_slider(){ +$("#grid_slider").slider({ +value: $('.image_file .img').width(), +max: 250, +min: 80, +slide: + function(event, ui) + { + slider_value = ui.value + set_image_files_img_size(); + }, +create : + function(event, ui) + { + slider_enabled = true + } + +}); +} + +$(document).ready(function ($) { + + + $(window).bind("resize", function() { + set_image_files_big_container_size(); + }) + + + $("#left_buttons").live("click", function() { + multiple_selection_ids(); + }) + + $(".image_file").live('dblclick', function (event){ + + + $.ajax({url : $(this).attr('data_show_url'), success: function (){ + $('#image_file_container').addClass("image_file_container_active"); + $('#right_bar').hide(); + + + + + + }}); + + + + + + + }); + + $("#image_files_container").live("click",function (e){ + + + + + if ($(e.target).parents(".image_file").length == 0){ + unselect_all_image(); + + } + + }); + + $("#image_file_container .img").live("dblclick",function (){ + close_image_file_container(); + + }); + + + + $('#image_files_big_container #main_workspace_view #image_file_container .form input').live('keydown', function(){ + $('#image_files_big_container #main_workspace_view #image_file_container .form .submit_tr').show(); + }) + $('#image_files_big_container #main_workspace_view #image_file_container .form textarea').live('keydown', function(){ + $('#image_files_big_container #main_workspace_view #image_file_container .form .submit_tr').show(); + }) + + $(".image_file").live("click",function (){ + if ($(this).hasClass('active')){ + $(this).removeClass('active'); + + } + else + { + $(this).addClass('active'); + } + update_multiple_selection_text(); + + }); + + set_image_files_big_container_size(); + + + + initialize_slider(); + + + + image_files_load(); + + + +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/manager/manager.js b/public/assets/javascripts/admin/manager/manager.js new file mode 100644 index 0000000..0c7b0b5 --- /dev/null +++ b/public/assets/javascripts/admin/manager/manager.js @@ -0,0 +1,145 @@ +var manager_response = ""; +var manager_callback_function = null; + +function manager_load() { + + + $(document).bind("keydown",function(e) { + // ESCAPE key pressed + if (e.keyCode == 27) { + manager_hide(); + } + }); + + + +} + +function manager_show(url){ + manager_response = null; + $('#manager_box').html(""); + + $("#manager_box_place").show("fast", function (){ + $("#manager_box_place").addClass("manager_box_place_active"); + $('#manager_box').load(url, function (){ + image_files_load(); + data_files_load(); + initialize_uploads(); + } + ) + + + }); + + + + + + +} + + +function manager_hide(){ + $("#manager_box_place").removeClass("manager_box_place_active"); + + $("body").css("overflow", "auto"); + slider_enabled = null; + + + +} +$(document).ready(function ($) { + manager_load(); + + $('#test_manager').live('click', function (){ + + + manager_prompt(function(m_return){alert(m_return);}); + + + + + }); + + + + +}); + + + +function manager_prompt(url, callback) { + manager_callback_function = callback; + manager_show(url); +} + +function manager_send_response(send_value){ + + manager_hide(); + manager_callback_function(send_value); + + +} + +function select_image_from_manager(input_id){ + manager_prompt("/admin/image_files/?manager=true",function(m_return){ + + $('#input_'+input_id).val(m_return.image_file_id); + $('#img_'+input_id).attr("src",m_return.thumb); + $('#name_'+input_id).val(m_return.name); + + }); + +} + +function select_gallery_images_from_manager(gallery_content_id){ + + manager_prompt("/admin/image_files/?manager=true&multiple=true",function(m_return){ + + $.ajax({url:"/portlet/gallery_images/", type: "POST", data : { image_file_ids : m_return, gallery_content_id : gallery_content_id }}); + + + }); + +} + + + +function select_file_from_manager(input_id){ + manager_prompt("/admin/data_files/?manager=true",function(m_return){ + + $('#input_'+input_id).val(m_return.data_file_id); + + $('#name_'+input_id).html(m_return.name); + + }); + +} + + + +function manager_send_multiple_image_files(){ + + + + manager_send_response(multiple_selection_ids()); +} + + + +function manager_send_image_file(image_file_id){ + + + var image_file_div = $('#image_file_'+image_file_id); + + manager_send_response({thumb : image_file_div.attr("data_thumb"), image_file_id : image_file_div.attr("data_id"), name : image_file_div.attr("data_name")}); +} + + +function manager_send_data_file(data_file_id){ + + + var image_file_div = $('#data_file_'+data_file_id); + + manager_send_response({data_file_id : image_file_div.data("id"), name : image_file_div.data("name")}); +} diff --git a/public/assets/javascripts/admin/manager/uploads.js b/public/assets/javascripts/admin/manager/uploads.js new file mode 100644 index 0000000..71a10d0 --- /dev/null +++ b/public/assets/javascripts/admin/manager/uploads.js @@ -0,0 +1,87 @@ +function initialize_uploads() +{ + + + + $('#data_file_upload_field').fileUploadUI({ + uploadTable: $('#files'), + namespace : "data_file_upload", + downloadTable: $('#files'), + dragDropSupport : true, + onLoad : function (event, files, index, xhr, handler) { + var json; + if (typeof xhr.responseText !== "undefinied") { + eval(xhr.responseText); + } else { + + eval(xhr.contents().text()); + } + handler.uploadRow.remove(); + + + } , + onLoadAll: function (){ + $('#data_files .new').each(function (){ + + $(this).removeClass("new"); + + + }); + update_multiple_selection_text(); + + }, + buildUploadRow: function (files, index) { + return $('' + files[index].name + '<\/td>' + + '
<\/div><\/td>' + + '' + + 'Pen_alt_stroke_16x16' + + + '<\/td><\/tr>'); + } + }); + + + + $('#image_upload_field').fileUploadUI({ + uploadTable: $('#files'), + downloadTable: $('#files'), + namespace : "image_file_upload", + dragDropSupport : true, + onLoad : function (event, files, index, xhr, handler) { + var json; + if (typeof xhr.responseText !== "undefinied") { + eval(xhr.responseText); + } else { + + eval(xhr.contents().text()); + } + handler.uploadRow.remove(); + + + } , + onLoadAll: function (){ + $('#image_files .new').each(function (){ + + $(this).removeClass("new"); + + + }); + update_multiple_selection_text(); + + }, + buildUploadRow: function (files, index) { + return $('' + files[index].name + '<\/td>' + + '
<\/div><\/td>' + + '' + + 'Pen_alt_stroke_16x16' + + + '<\/td><\/tr>'); + } + }); + + +}; + +$(document).ready(function ($) { + initialize_uploads(); +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/menu_items.js b/public/assets/javascripts/admin/menu_items.js new file mode 100644 index 0000000..b962e38 --- /dev/null +++ b/public/assets/javascripts/admin/menu_items.js @@ -0,0 +1,83 @@ +function after_load_document(){ + $( ".menu_item_row" ).draggable({ + revert:"invalid", + handle:".grip", + zIndex: 2700, + opacity: 0.35, + cursorAt: { left: 400 }, + //snap: true, + //snapTolerance: 40, + helper: 'clone', + start: function(event, ui) { + $( this ).css("background", "#F9F9F9" ); + $( this ).next().droppable( "option", "disabled", true ); + $( this ).prev().droppable( "option", "disabled", true ); + }, + drag: function(){ + }, + stop: function(){ + $( this ).next().droppable( "option", "disabled", false ); + $( this ).prev().droppable( "option", "disabled", false ); + $( this ).css("background", "white" ); + } + }); + + $(".receptable").droppable({ + hoverClass:"hoverhighlight", + tolerance : "pointer", + drop: function( event, ui ) { + ui.draggable.fadeOut(); + load_img = "
"; + $('#sortable_menu_item').html(load_img); + $.ajax({ + url:"/admin/menu_items/"+ui.draggable.attr("data-menu_item_id")+".js", + type: "PUT", + data: { + reorder : true, + menu_item : { + parent_id : $(this).attr("data-parent_id") + } + }, + success : function (){ + after_load_document(); + } + }); + + + } + }); + + $(".receptable_position").droppable({ + hoverClass:"hoverhighlight_position", + tolerance : "pointer", + drop: function( event, ui ) { + ui.draggable.fadeOut(); + + load_img = "
"; + $('#sortable_menu_item').html(load_img); + $.ajax({ + url:"/admin/menu_items/"+ui.draggable.attr("data-menu_item_id")+".js", + type: "PUT", + data: { + reorder : true, + menu_item : { + position : $(this).attr("data-position") + } + }, + success : function (){ + after_load_document(); + } + }); + + + + } + }); + + +} + +$(document).ready(function(){ + after_load_document(); + +}); \ No newline at end of file diff --git a/public/assets/javascripts/admin/pane_hover.js b/public/assets/javascripts/admin/pane_hover.js new file mode 100644 index 0000000..11c39f1 --- /dev/null +++ b/public/assets/javascripts/admin/pane_hover.js @@ -0,0 +1,48 @@ + + +function show_pane_hover(content, width, height){ + var width = width || 500; + var height = height || 500; + + initialize_pane_hover() + + + + + + $('#qi_pane_hover_content').html(content); + $('#qi_pane_hover_content').css({"width" : width+"px","height" : height+"px"}); + + $('#qi_pane_hover_content .actions').prepend('Annuler'); + +} + + + + +function close_pane_hover(){ + + + $('#qi_pane_hover').remove(); + + + +} + +function initialize_pane_hover(){ + if($('#qi_pane_hover').length == 0){ + + $('body').append('
'); + + } + + +} + + + +$(document).ready(function (){ + + //show_pane_hover("pigloute"); + +}); \ No newline at end of file diff --git a/public/assets/javascripts/core/aloha b/public/assets/javascripts/core/aloha new file mode 160000 index 0000000..e7d72a2 --- /dev/null +++ b/public/assets/javascripts/core/aloha @@ -0,0 +1 @@ +Subproject commit e7d72a2c3022ee2b540d1611d274dfd916b8f296 diff --git a/public/assets/javascripts/core/jcarousellite_1.0.1.min.js b/public/assets/javascripts/core/jcarousellite_1.0.1.min.js new file mode 100644 index 0000000..f16734a --- /dev/null +++ b/public/assets/javascripts/core/jcarousellite_1.0.1.min.js @@ -0,0 +1 @@ +(function($){$.fn.jCarouselLite=function(o){o=$.extend({btnPrev:null,btnNext:null,btnGo:null,mouseWheel:false,auto:null,speed:200,easing:null,vertical:false,circular:true,visible:3,start:0,scroll:1,beforeStart:null,afterEnd:null},o||{});return this.each(function(){var b=false,animCss=o.vertical?"top":"left",sizeCss=o.vertical?"height":"width";var c=$(this),ul=$("ul",c),tLi=$("li",ul),tl=tLi.size(),v=o.visible;if(o.circular){ul.prepend(tLi.slice(tl-v-1+1).clone()).append(tLi.slice(0,v).clone());o.start+=v}var f=$("li",ul),itemLength=f.size(),curr=o.start;c.css("visibility","visible");f.css({overflow:"hidden",float:o.vertical?"none":"left"});ul.css({margin:"0",padding:"0",position:"relative","list-style-type":"none","z-index":"1"});c.css({overflow:"hidden",position:"relative","z-index":"2",left:"0px"});var g=o.vertical?height(f):width(f);var h=g*itemLength;var j=g*v;f.css({width:f.width(),height:f.height()});ul.css(sizeCss,h+"px").css(animCss,-(curr*g));c.css(sizeCss,j+"px");if(o.btnPrev)$(o.btnPrev).click(function(){return go(curr-o.scroll)});if(o.btnNext)$(o.btnNext).click(function(){return go(curr+o.scroll)});if(o.btnGo)$.each(o.btnGo,function(i,a){$(a).click(function(){return go(o.circular?o.visible+i:i)})});if(o.mouseWheel&&c.mousewheel)c.mousewheel(function(e,d){return d>0?go(curr-o.scroll):go(curr+o.scroll)});if(o.auto)setInterval(function(){go(curr+o.scroll)},o.auto+o.speed);function vis(){return f.slice(curr).slice(0,v)};function go(a){if(!b){if(o.beforeStart)o.beforeStart.call(this,vis());if(o.circular){if(a<=o.start-v-1){ul.css(animCss,-((itemLength-(v*2))*g)+"px");curr=a==o.start-v-1?itemLength-(v*2)-1:itemLength-(v*2)-o.scroll}else if(a>=itemLength-v+1){ul.css(animCss,-((v)*g)+"px");curr=a==itemLength-v+1?v+1:v+o.scroll}else curr=a}else{if(a<0||a>itemLength-v)return;else curr=a}b=true;ul.animate(animCss=="left"?{left:-(curr*g)}:{top:-(curr*g)},o.speed,o.easing,function(){if(o.afterEnd)o.afterEnd.call(this,vis());b=false});if(!o.circular){$(o.btnPrev+","+o.btnNext).removeClass("disabled");$((curr-o.scroll<0&&o.btnPrev)||(curr+o.scroll>itemLength-v&&o.btnNext)||[]).addClass("disabled")}}return false}})};function css(a,b){return parseInt($.css(a[0],b))||0};function width(a){return a[0].offsetWidth+css(a,'marginLeft')+css(a,'marginRight')};function height(a){return a[0].offsetHeight+css(a,'marginTop')+css(a,'marginBottom')}})(jQuery); \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery-1.6.1.min.js b/public/assets/javascripts/core/jquery-1.6.1.min.js new file mode 100644 index 0000000..eb6a596 --- /dev/null +++ b/public/assets/javascripts/core/jquery-1.6.1.min.js @@ -0,0 +1,18 @@ +/*! + * jQuery JavaScript Library v1.6.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu May 12 15:04:36 2011 -0400 + */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;ic)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c
a",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
t
",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem +)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(h=g;h0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument|| +b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]===""&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("
").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b
";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery-ui.min.js b/public/assets/javascripts/core/jquery-ui.min.js new file mode 100755 index 0000000..f8709e0 --- /dev/null +++ b/public/assets/javascripts/core/jquery-ui.min.js @@ -0,0 +1,783 @@ +/*! + * jQuery UI 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate); +if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); +d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&& +this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| +0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(), +height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"), +10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"), +10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&& +d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g= +this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])? +e:!(e-this.offset.click.left
').css({width:this.offsetWidth+ +"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity", +a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio: +this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize", +b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height; +f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing"); +this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top= +null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+ +this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b, +a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a, +c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize, +originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.11"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize= +b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width", +"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})}; +if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height- +g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width, +height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d= +e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options, +d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper? +d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height= +a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&& +/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable"); +b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/ +(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]= +b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false; +d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left- +this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left= +e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0]; +if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder); +c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length=== +1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top< +this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0], +this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out", +g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.11", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0); +e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e, +g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){e.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&& +c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex", +-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", +"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose= +b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&& +a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index"); +isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ); +d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}}); +c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f, +h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g= +d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize, +position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f, +h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length=== +1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in +l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled"); +break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e= +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&& +this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.11",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length=== +0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("
    ");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("").appendTo(this.element).addClass("ui-slider-handle"); +if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur(); +else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e= +false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h=== +b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b, +g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a; +if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value= +this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate); +if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.11"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
  • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.11"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k')}function F(a,b){d.extend(a,b);for(var c in b)if(b[c]== +null||b[c]==A)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.11"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){F(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase(); +f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('
    ')}}, +_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&& +b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f== +""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a, +c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b), +true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}F(a.settings,e||{}); +b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs, +function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null: +f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target); +if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a); +d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");F(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-= +document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim"); +var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst= +b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover"); +this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+ +this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&& +a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth(): +0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a), +"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"? +"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a= +d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a= +d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c== +"M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth= +b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker(); +this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0); +a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c? +c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y", +RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+r+"":f?"":''+r+"";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z= +this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",D=0;D1)switch(E){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]- +1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='
    '+(/all|left/.test(t)&&D==0?c?f:n:"")+(/all|right/.test(t)&&D==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,D>0||E>0,z,w)+'
    ';var B=j?'":"";for(t=0;t<7;t++){var q= +(t+h)%7;B+="=5?' class="ui-datepicker-week-end"':"")+'>'+s[q]+""}x+=B+"";B=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,B);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;B=l?6:Math.ceil((t+B)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O";var P=!j?"":'";for(t=0;t<7;t++){var G= +p?p.apply(a.input?a.input[0]:null,[q]):[true,""],C=q.getMonth()!=g,J=C&&!H||!G[0]||k&&qo;P+='";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+= +P+""}g++;if(g>11){g=0;m++}x+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(q)+""+(C&&!v?" ":J?''+q.getDate()+"":''+q.getDate()+"")+"
    "+(l?""+(i[0]>0&&E==i[1]-1?'
    ':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ', +o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&& +l)?" ":""));a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";if(d.browser.mozilla)k+='";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e= +a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a, +"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.11";window["DP_jQuery_"+y]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.11"})})(jQuery); +;/* + * jQuery UI Effects 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0]; +h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c, +a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.11",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent", +border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c); +return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments); +else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c), +b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c, +a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c, +a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a== +e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.11 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.ba-resize.min.js b/public/assets/javascripts/core/jquery.ba-resize.min.js new file mode 100644 index 0000000..c678883 --- /dev/null +++ b/public/assets/javascripts/core/jquery.ba-resize.min.js @@ -0,0 +1,9 @@ +/* + * jQuery resize event - v1.1 - 3/14/2010 + * http://benalman.com/projects/jquery-resize-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ +(function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this); \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.easing.compatibility.js b/public/assets/javascripts/core/jquery.easing.compatibility.js new file mode 100644 index 0000000..eea539e --- /dev/null +++ b/public/assets/javascripts/core/jquery.easing.compatibility.js @@ -0,0 +1,205 @@ +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +jQuery.easing['jswing'] = jQuery.easing['swing']; + +jQuery.extend( jQuery.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert(jQuery.easing.default); + return jQuery.easing[jQuery.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright © 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.fileupload-ui.js b/public/assets/javascripts/core/jquery.fileupload-ui.js new file mode 100755 index 0000000..0c086f2 --- /dev/null +++ b/public/assets/javascripts/core/jquery.fileupload-ui.js @@ -0,0 +1,490 @@ +/* + * jQuery File Upload User Interface Plugin 4.2.1 + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2010, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * http://creativecommons.org/licenses/MIT/ + */ + +/*jslint browser: true */ +/*global jQuery, FileReader, URL, webkitURL */ + +(function ($) { + + var undef = 'undefined', + func = 'function', + UploadHandler, + methods, + + MultiLoader = function (callBack) { + var loaded = 0, + list = []; + this.complete = function () { + loaded += 1; + if (loaded === list.length + 1) { + // list.length * onComplete + 1 * onLoadAll + callBack(list); + loaded = 0; + list = []; + } + }; + this.push = function (item) { + list.push(item); + }; + this.getList = function () { + return list; + }; + }; + + UploadHandler = function (container, options) { + var uploadHandler = this, + dragOverTimeout, + isDropZoneEnlarged, + multiLoader = new MultiLoader(function (list) { + uploadHandler.hideProgressBarAll(function () { + uploadHandler.resetProgressBarAll(); + if (typeof uploadHandler.onCompleteAll === func) { + uploadHandler.onCompleteAll(list); + } + }); + }), + getUploadTable = function (handler) { + return typeof handler.uploadTable === func ? + handler.uploadTable(handler) : handler.uploadTable; + }, + getDownloadTable = function (handler) { + return typeof handler.downloadTable === func ? + handler.downloadTable(handler) : handler.downloadTable; + }; + + this.requestHeaders = {'Accept': 'application/json, text/javascript, */*; q=0.01'}; + this.dropZone = container; + this.imageTypes = /^image\/(gif|jpeg|png)$/; + this.previewMaxWidth = this.previewMaxHeight = 80; + this.previewLoadDelay = 100; + this.previewAsCanvas = true; + this.previewSelector = '.file_upload_preview'; + this.progressSelector = '.file_upload_progress div'; + this.cancelSelector = '.file_upload_cancel img'; + this.cssClassSmall = 'file_upload_small'; + this.cssClassLarge = 'file_upload_large'; + this.cssClassHighlight = 'file_upload_highlight'; + this.dropEffect = 'highlight'; + this.uploadTable = this.downloadTable = null; + this.buildUploadRow = this.buildDownloadRow = null; + this.progressAllNode = null; + + this.loadImage = function (file, callBack, maxWidth, maxHeight, imageTypes, noCanvas) { + var img, + scaleImage, + urlAPI, + fileReader; + if (imageTypes && !imageTypes.test(file.type)) { + return null; + } + scaleImage = function (img) { + var canvas = document.createElement('canvas'), + scale = Math.min( + (maxWidth || img.width) / img.width, + (maxHeight || img.height) / img.height + ); + if (scale > 1) { + scale = 1; + } + img.width = parseInt(img.width * scale, 10); + img.height = parseInt(img.height * scale, 10); + if (noCanvas || typeof canvas.getContext !== func) { + return img; + } + canvas.width = img.width; + canvas.height = img.height; + canvas.getContext('2d').drawImage(img, 0, 0, img.width, img.height); + return canvas; + }; + img = document.createElement('img'); + urlAPI = typeof URL !== undef ? URL : typeof webkitURL !== undef ? webkitURL : null; + if (urlAPI && typeof urlAPI.createObjectURL === func) { + img.onload = function () { + urlAPI.revokeObjectURL(this.src); + callBack(scaleImage(img)); + }; + img.src = urlAPI.createObjectURL(file); + } else if (typeof FileReader !== undef && + typeof FileReader.prototype.readAsDataURL === func) { + img.onload = function () { + callBack(scaleImage(img)); + }; + fileReader = new FileReader(); + fileReader.onload = function (e) { + img.src = e.target.result; + }; + fileReader.readAsDataURL(file); + } else { + callBack(null); + } + }; + + this.addNode = function (parentNode, node, callBack) { + if (parentNode && node) { + node.css('display', 'none').appendTo(parentNode).fadeIn(function () { + if (typeof callBack === func) { + try { + callBack(); + } catch (e) { + // Fix endless exception loop: + node.stop(); + throw e; + } + } + }); + } else if (typeof callBack === func) { + callBack(); + } + }; + + this.removeNode = function (node, callBack) { + if (node) { + node.fadeOut(function () { + node.remove(); + if (typeof callBack === func) { + try { + callBack(); + } catch (e) { + // Fix endless exception loop: + node.stop(); + throw e; + } + } + }); + } else if (typeof callBack === func) { + callBack(); + } + }; + + this.replaceNode = function (oldNode, newNode, callBack) { + if (oldNode && newNode) { + oldNode.fadeOut(function () { + newNode.css('display', 'none'); + oldNode.replaceWith(newNode); + newNode.fadeIn(function () { + if (typeof callBack === func) { + try { + callBack(); + } catch (e) { + // Fix endless exception loop: + oldNode.stop(); + newNode.stop(); + throw e; + } + } + }); + }); + } else if (typeof callBack === func) { + callBack(); + } + }; + + this.resetProgressBarAll = function () { + if (uploadHandler.progressbarAll) { + uploadHandler.progressbarAll.progressbar( + 'value', + 0 + ); + } + }; + + this.hideProgressBarAll = function (callBack) { + if (uploadHandler.progressbarAll && !$(getUploadTable(uploadHandler)) + .find(uploadHandler.progressSelector + ':visible:first').length) { + uploadHandler.progressbarAll.fadeOut(callBack); + } else if (typeof callBack === func) { + callBack(); + } + }; + + this.onAbort = function (event, files, index, xhr, handler) { + handler.removeNode(handler.uploadRow, handler.hideProgressBarAll); + }; + + this.cancelUpload = function (event, files, index, xhr, handler) { + var readyState = xhr.readyState; + xhr.abort(); + // If readyState is below 2, abort() has no effect: + if (typeof readyState !== 'number' || readyState < 2) { + handler.onAbort(event, files, index, xhr, handler); + } + }; + + this.initProgressBar = function (node, value) { + if (!node || !node.length) { + return null; + } + if (typeof node.progressbar === func) { + return node.progressbar({ + value: value + }); + } else { + var progressbar = $('').appendTo(node); + progressbar.progressbar = function (key, value) { + progressbar.attr('value', value); + }; + return progressbar; + } + }; + + this.initUploadProgress = function (xhr, handler) { + if (!xhr.upload && handler.progressbar) { + handler.progressbar.progressbar( + 'value', + 100 // indeterminate progress displayed by a full animated progress bar + ); + } + }; + + this.onSend = function (event, files, index, xhr, handler) { + handler.initUploadProgress(xhr, handler); + }; + + this.onProgressAll = function (event, list) { + if (uploadHandler.progressbarAll && event.lengthComputable) { + uploadHandler.progressbarAll.progressbar( + 'value', + parseInt(event.loaded / event.total * 100, 10) + ); + } + }; + + this.onProgress = function (event, files, index, xhr, handler) { + if (handler.progressbar && event.lengthComputable) { + handler.progressbar.progressbar( + 'value', + parseInt(event.loaded / event.total * 100, 10) + ); + } + }; + + this.onLoadAll = function (list) { + multiLoader.complete(); + }; + + this.initProgressBarAll = function () { + if (!uploadHandler.progressbarAll) { + uploadHandler.progressbarAll = uploadHandler.initProgressBar( + (typeof uploadHandler.progressAllNode === func ? + uploadHandler.progressAllNode(uploadHandler) : uploadHandler.progressAllNode), + 0 + ); + } + if (uploadHandler.progressbarAll && uploadHandler.progressbarAll.is(':hidden')) { + uploadHandler.progressbarAll.fadeIn(); + } + }; + + this.initUploadRow = function (event, files, index, xhr, handler) { + var uploadRow = handler.uploadRow = (typeof handler.buildUploadRow === func ? + handler.buildUploadRow(files, index, handler) : null); + if (uploadRow) { + handler.progressbar = handler.initProgressBar( + uploadRow.find(handler.progressSelector), + 0 + ); + uploadRow.find(handler.cancelSelector).click(function (e) { + handler.cancelUpload(e, files, index, xhr, handler); + return false; + }); + uploadRow.find(handler.previewSelector).each(function () { + var previewNode = $(this), + file = files[index]; + if (file) { + setTimeout(function () { + handler.loadImage( + file, + function (img) { + handler.addNode( + previewNode, + $(img) + ); + }, + handler.previewMaxWidth, + handler.previewMaxHeight, + handler.imageTypes, + !handler.previewAsCanvas + ); + }, handler.previewLoadDelay); + } + }); + } + }; + + this.initUpload = function (event, files, index, xhr, handler, callBack) { + handler.initUploadRow(event, files, index, xhr, handler); + handler.addNode( + getUploadTable(handler), + handler.uploadRow, + function () { + if (typeof handler.beforeSend === func) { + handler.beforeSend(event, files, index, xhr, handler, callBack); + } else { + callBack(); + } + } + ); + handler.initProgressBarAll(); + }; + + this.parseResponse = function (xhr) { + if (typeof xhr.responseText !== undef) { + return $.parseJSON(xhr.responseText); + } else { + // Instead of an XHR object, an iframe is used for legacy browsers: + return $.parseJSON(xhr.contents().text()); + } + }; + + this.initDownloadRow = function (event, files, index, xhr, handler) { + var json, downloadRow; + try { + json = handler.response = handler.parseResponse(xhr); + downloadRow = handler.downloadRow = (typeof handler.buildDownloadRow === func ? + handler.buildDownloadRow(json, handler) : null); + } catch (e) { + if (typeof handler.onError === func) { + handler.originalEvent = event; + handler.onError(e, files, index, xhr, handler); + } else { + throw e; + } + } + }; + + this.onLoad = function (event, files, index, xhr, handler) { + var uploadTable = getUploadTable(handler), + downloadTable = getDownloadTable(handler), + callBack = function () { + if (typeof handler.onComplete === func) { + handler.onComplete(event, files, index, xhr, handler); + } + multiLoader.complete(); + }; + multiLoader.push(Array.prototype.slice.call(arguments, 1)); + handler.initDownloadRow(event, files, index, xhr, handler); + if (uploadTable && (!downloadTable || uploadTable.get(0) === downloadTable.get(0))) { + handler.replaceNode(handler.uploadRow, handler.downloadRow, callBack); + } else { + handler.removeNode(handler.uploadRow, function () { + handler.addNode( + downloadTable, + handler.downloadRow, + callBack + ); + }); + } + }; + + this.dropZoneEnlarge = function () { + if (!isDropZoneEnlarged) { + if (typeof uploadHandler.dropZone.switchClass === func) { + uploadHandler.dropZone.switchClass( + uploadHandler.cssClassSmall, + uploadHandler.cssClassLarge + ); + } else { + uploadHandler.dropZone.addClass(uploadHandler.cssClassLarge); + uploadHandler.dropZone.removeClass(uploadHandler.cssClassSmall); + } + isDropZoneEnlarged = true; + } + }; + + this.dropZoneReduce = function () { + if (typeof uploadHandler.dropZone.switchClass === func) { + uploadHandler.dropZone.switchClass( + uploadHandler.cssClassLarge, + uploadHandler.cssClassSmall + ); + } else { + uploadHandler.dropZone.addClass(uploadHandler.cssClassSmall); + uploadHandler.dropZone.removeClass(uploadHandler.cssClassLarge); + } + isDropZoneEnlarged = false; + }; + + this.onDocumentDragEnter = function (event) { + uploadHandler.dropZoneEnlarge(); + }; + + this.onDocumentDragOver = function (event) { + if (dragOverTimeout) { + clearTimeout(dragOverTimeout); + } + dragOverTimeout = setTimeout(function () { + uploadHandler.dropZoneReduce(); + }, 200); + }; + + this.onDragEnter = this.onDragLeave = function (event) { + uploadHandler.dropZone.toggleClass(uploadHandler.cssClassHighlight); + }; + + this.onDrop = function (event) { + if (dragOverTimeout) { + clearTimeout(dragOverTimeout); + } + if (uploadHandler.dropEffect && typeof uploadHandler.dropZone.effect === func) { + //uploadHandler.dropZone.effect(uploadHandler.dropEffect, function () { + //uploadHandler.dropZone.removeClass(uploadHandler.cssClassHighlight); + uploadHandler.dropZoneReduce(); + uploadHandler.dropZone.toggleClass(uploadHandler.cssClassHighlight); + //}); + } else { + //uploadHandler.dropZone.removeClass(uploadHandler.cssClassHighlight); + uploadHandler.dropZoneReduce(); + } + }; + + $.extend(this, options); + }; + + methods = { + init : function (options) { + return this.each(function () { + $(this).fileUpload(new UploadHandler($(this), options)); + }); + }, + + option: function (option, value, namespace) { + if (!option || (typeof option === 'string' && typeof value === undef)) { + return $(this).fileUpload('option', option, value, namespace); + } + return this.each(function () { + $(this).fileUpload('option', option, value, namespace); + }); + }, + + destroy : function (namespace) { + return this.each(function () { + $(this).fileUpload('destroy', namespace); + }); + }, + + upload: function (files, namespace) { + return this.each(function () { + $(this).fileUpload('upload', files, namespace); + }); + } + }; + + $.fn.fileUploadUI = function (method) { + if (methods[method]) { + return methods[method].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof method === 'object' || !method) { + return methods.init.apply(this, arguments); + } else { + $.error('Method "' + method + '" does not exist on jQuery.fileUploadUI'); + } + }; + +}(jQuery)); \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.fileupload.js b/public/assets/javascripts/core/jquery.fileupload.js new file mode 100755 index 0000000..4432fe6 --- /dev/null +++ b/public/assets/javascripts/core/jquery.fileupload.js @@ -0,0 +1,906 @@ +/* + * jQuery File Upload Plugin 4.2.1 + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2010, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * http://creativecommons.org/licenses/MIT/ + */ + +/*jslint browser: true */ +/*global XMLHttpRequestUpload, File, FileReader, FormData, ProgressEvent, unescape, jQuery, upload */ + +(function ($) { + + var defaultNamespace = 'file_upload', + undef = 'undefined', + func = 'function', + FileUpload, + methods, + + MultiLoader = function (callBack, numOrList) { + var loaded = 0, + list = []; + if (numOrList) { + if (numOrList.length) { + list = numOrList; + } else { + list[numOrList - 1] = null; + } + } + this.complete = function () { + loaded += 1; + if (loaded === list.length) { + callBack(list); + loaded = 0; + list = []; + } + }; + this.push = function (item) { + list.push(item); + }; + this.getList = function () { + return list; + }; + }, + + SequenceHandler = function () { + var sequence = []; + this.push = function (callBack) { + sequence.push(callBack); + if (sequence.length === 1) { + callBack(); + } + }; + this.next = function () { + sequence.shift(); + if (sequence.length) { + sequence[0](); + } + }; + }; + + FileUpload = function (container) { + var fileUpload = this, + uploadForm, + fileInput, + settings = { + namespace: defaultNamespace, + uploadFormFilter: function (index) { + return true; + }, + fileInputFilter: function (index) { + return true; + }, + cssClass: defaultNamespace, + dragDropSupport: true, + dropZone: container, + url: function (form) { + return form.attr('action'); + }, + method: function (form) { + return form.attr('method'); + }, + fieldName: function (input) { + return input.attr('name'); + }, + formData: function (form) { + return form.serializeArray(); + }, + requestHeaders: null, + multipart: true, + multiFileRequest: false, + withCredentials: false, + forceIframeUpload: false, + sequentialUploads: false, + maxChunkSize: null + }, + multiLoader = new MultiLoader(function (list) { + if (typeof settings.onLoadAll === func) { + settings.onLoadAll(list); + } + }), + sequenceHandler = new SequenceHandler(), + documentListeners = {}, + dropZoneListeners = {}, + protocolRegExp = /^http(s)?:\/\//, + optionsReference, + + isXHRUploadCapable = function () { + return typeof XMLHttpRequest !== undef && typeof XMLHttpRequestUpload !== undef && + typeof File !== undef && (!settings.multipart || typeof FormData !== undef || + (typeof FileReader !== undef && typeof XMLHttpRequest.prototype.sendAsBinary === func)); + }, + + initEventHandlers = function () { + if (settings.dragDropSupport) { + if (typeof settings.onDocumentDragEnter === func) { + documentListeners['dragenter.' + settings.namespace] = function (e) { + settings.onDocumentDragEnter(e); + }; + } + if (typeof settings.onDocumentDragLeave === func) { + documentListeners['dragleave.' + settings.namespace] = function (e) { + settings.onDocumentDragLeave(e); + }; + } + documentListeners['dragover.' + settings.namespace] = fileUpload.onDocumentDragOver; + documentListeners['drop.' + settings.namespace] = fileUpload.onDocumentDrop; + $(document).bind(documentListeners); + if (typeof settings.onDragEnter === func) { + dropZoneListeners['dragenter.' + settings.namespace] = function (e) { + settings.onDragEnter(e); + }; + } + if (typeof settings.onDragLeave === func) { + dropZoneListeners['dragleave.' + settings.namespace] = function (e) { + settings.onDragLeave(e); + }; + } + dropZoneListeners['dragover.' + settings.namespace] = fileUpload.onDragOver; + dropZoneListeners['drop.' + settings.namespace] = fileUpload.onDrop; + settings.dropZone.bind(dropZoneListeners); + } + fileInput.bind('change.' + settings.namespace, fileUpload.onChange); + }, + + removeEventHandlers = function () { + $.each(documentListeners, function (key, value) { + $(document).unbind(key, value); + }); + $.each(dropZoneListeners, function (key, value) { + settings.dropZone.unbind(key, value); + }); + fileInput.unbind('change.' + settings.namespace); + }, + + isChunkedUpload = function (settings) { + return typeof settings.uploadedBytes !== undef; + }, + + createProgressEvent = function (lengthComputable, loaded, total) { + var event; + if (typeof document.createEvent === func && typeof ProgressEvent !== undef) { + event = document.createEvent('ProgressEvent'); + event.initProgressEvent( + 'progress', + false, + false, + lengthComputable, + loaded, + total + ); + } else { + event = { + lengthComputable: true, + loaded: loaded, + total: total + }; + } + return event; + }, + + getProgressTotal = function (files, index, settings) { + var i, + total; + if (typeof settings.progressTotal === undef) { + if (files[index]) { + total = files[index].size; + settings.progressTotal = total ? total : 1; + } else { + total = 0; + for (i = 0; i < files.length; i += 1) { + total += files[i].size; + } + settings.progressTotal = total; + } + } + return settings.progressTotal; + }, + + handleGlobalProgress = function (event, files, index, xhr, settings) { + var progressEvent, + loaderList, + globalLoaded = 0, + globalTotal = 0; + if (event.lengthComputable && typeof settings.onProgressAll === func) { + settings.progressLoaded = parseInt( + event.loaded / event.total * getProgressTotal(files, index, settings), + 10 + ); + loaderList = multiLoader.getList(); + $.each(loaderList, function (index, item) { + // item is an array with [files, index, xhr, settings] + globalLoaded += item[3].progressLoaded || 0; + globalTotal += getProgressTotal(item[0], item[1], item[3]); + }); + progressEvent = createProgressEvent( + true, + globalLoaded, + globalTotal + ); + settings.onProgressAll(progressEvent, loaderList); + } + }, + + handleLoadEvent = function (event, files, index, xhr, settings) { + var progressEvent; + if (isChunkedUpload(settings)) { + settings.uploadedBytes = settings.uploadedBytes + settings.chunkSize; + progressEvent = createProgressEvent( + true, + settings.uploadedBytes, + files[index].size + ); + if (typeof settings.onProgress === func) { + settings.onProgress(progressEvent, files, index, xhr, settings); + } + handleGlobalProgress(progressEvent, files, index, xhr, settings); + if (settings.uploadedBytes < files[index].size) { + if (typeof settings.resumeUpload === func) { + settings.resumeUpload( + event, + files, + index, + xhr, + settings, + function () { + upload(event, files, index, xhr, settings, true); + } + ); + } else { + upload(event, files, index, xhr, settings, true); + } + return; + } + } + settings.progressLoaded = getProgressTotal(files, index, settings); + if (typeof settings.onLoad === func) { + settings.onLoad(event, files, index, xhr, settings); + } + multiLoader.complete(); + sequenceHandler.next(); + }, + + handleProgressEvent = function (event, files, index, xhr, settings) { + var progressEvent = event; + if (isChunkedUpload(settings) && event.lengthComputable) { + progressEvent = createProgressEvent( + true, + settings.uploadedBytes + parseInt(event.loaded / event.total * settings.chunkSize, 10), + files[index].size + ); + } + if (typeof settings.onProgress === func) { + settings.onProgress(progressEvent, files, index, xhr, settings); + } + handleGlobalProgress(progressEvent, files, index, xhr, settings); + }, + + initUploadEventHandlers = function (files, index, xhr, settings) { + if (xhr.upload) { + xhr.upload.onprogress = function (e) { + handleProgressEvent(e, files, index, xhr, settings); + }; + } + xhr.onload = function (e) { + handleLoadEvent(e, files, index, xhr, settings); + }; + xhr.onabort = function (e) { + settings.progressTotal = settings.progressLoaded; + if (typeof settings.onAbort === func) { + settings.onAbort(e, files, index, xhr, settings); + } + multiLoader.complete(); + sequenceHandler.next(); + }; + xhr.onerror = function (e) { + settings.progressTotal = settings.progressLoaded; + if (typeof settings.onError === func) { + settings.onError(e, files, index, xhr, settings); + } + multiLoader.complete(); + sequenceHandler.next(); + }; + }, + + getUrl = function (settings) { + if (typeof settings.url === func) { + return settings.url(settings.uploadForm || uploadForm); + } + return settings.url; + }, + + getMethod = function (settings) { + if (typeof settings.method === func) { + return settings.method(settings.uploadForm || uploadForm); + } + return settings.method; + }, + + getFieldName = function (settings) { + if (typeof settings.fieldName === func) { + return settings.fieldName(settings.fileInput || fileInput); + } + return settings.fieldName; + }, + + getFormData = function (settings) { + var formData; + if (typeof settings.formData === func) { + return settings.formData(settings.uploadForm || uploadForm); + } else if ($.isArray(settings.formData)) { + return settings.formData; + } else if (settings.formData) { + formData = []; + $.each(settings.formData, function (name, value) { + formData.push({name: name, value: value}); + }); + return formData; + } + return []; + }, + + isSameDomain = function (url) { + if (protocolRegExp.test(url)) { + var host = location.host, + indexStart = location.protocol.length + 2, + index = url.indexOf(host, indexStart), + pathIndex = index + host.length; + if ((index === indexStart || index === url.indexOf('@', indexStart) + 1) && + (url.length === pathIndex || $.inArray(url.charAt(pathIndex), ['/', '?', '#']) !== -1)) { + return true; + } + return false; + } + return true; + }, + + initUploadRequest = function (files, index, xhr, settings) { + var file = files[index], + url = getUrl(settings), + sameDomain = isSameDomain(url); + xhr.open(getMethod(settings), url, true); + if (sameDomain) { + xhr.setRequestHeader('X-Requested-With', 'XMLHttpRequest'); + if (!settings.multipart || isChunkedUpload(settings)) { + xhr.setRequestHeader('X-File-Name', file.name); + xhr.setRequestHeader('X-File-Type', file.type); + xhr.setRequestHeader('X-File-Size', file.size); + if (!isChunkedUpload(settings)) { + xhr.setRequestHeader('Content-Type', file.type); + } else if (!settings.multipart) { + xhr.setRequestHeader('Content-Type', 'application/octet-stream'); + } + } + } else if (settings.withCredentials) { + xhr.withCredentials = true; + } + if ($.isArray(settings.requestHeaders)) { + $.each(settings.requestHeaders, function (index, header) { + xhr.setRequestHeader(header.name, header.value); + }); + } else if (settings.requestHeaders) { + $.each(settings.requestHeaders, function (name, value) { + xhr.setRequestHeader(name, value); + }); + } + }, + + formDataUpload = function (files, xhr, settings) { + var formData = new FormData(), + i; + $.each(getFormData(settings), function (index, field) { + formData.append(field.name, field.value); + }); + for (i = 0; i < files.length; i += 1) { + formData.append(getFieldName(settings), files[i]); + } + xhr.send(formData); + }, + + loadFileContent = function (file, callBack) { + var fileReader = new FileReader(); + fileReader.onload = function (e) { + file.content = e.target.result; + callBack(); + }; + fileReader.readAsBinaryString(file); + }, + + utf8encode = function (str) { + return unescape(encodeURIComponent(str)); + }, + + buildMultiPartFormData = function (boundary, files, filesFieldName, fields) { + var doubleDash = '--', + crlf = '\r\n', + formData = ''; + $.each(fields, function (index, field) { + formData += doubleDash + boundary + crlf + + 'Content-Disposition: form-data; name="' + + utf8encode(field.name) + + '"' + crlf + crlf + + utf8encode(field.value) + crlf; + }); + $.each(files, function (index, file) { + formData += doubleDash + boundary + crlf + + 'Content-Disposition: form-data; name="' + + utf8encode(filesFieldName) + + '"; filename="' + utf8encode(file.name) + '"' + crlf + + 'Content-Type: ' + utf8encode(file.type) + crlf + crlf + + file.content + crlf; + }); + formData += doubleDash + boundary + doubleDash + crlf; + return formData; + }, + + fileReaderUpload = function (files, xhr, settings) { + var boundary = '----MultiPartFormBoundary' + (new Date()).getTime(), + loader, + i; + xhr.setRequestHeader('Content-Type', 'multipart/form-data; boundary=' + boundary); + loader = new MultiLoader(function () { + xhr.sendAsBinary(buildMultiPartFormData( + boundary, + files, + getFieldName(settings), + getFormData(settings) + )); + }, files.length); + for (i = 0; i < files.length; i += 1) { + loadFileContent(files[i], loader.complete); + } + }, + + getBlob = function (file, settings) { + var blob, + ub = settings.uploadedBytes, + mcs = settings.maxChunkSize; + if (file && typeof file.slice === func && (ub || (mcs && mcs < file.size))) { + settings.uploadedBytes = ub = ub || 0; + blob = file.slice(ub, mcs || file.size - ub); + settings.chunkSize = blob.size; + return blob; + } + return file; + }, + + upload = function (event, files, index, xhr, settings, nextChunk) { + var send; + if (!nextChunk) { + if (typeof settings.onSend === func && + settings.onSend(event, files, index, xhr, settings) === false) { + return; + } + multiLoader.push(Array.prototype.slice.call(arguments, 1)); + } + send = function () { + var blob = getBlob(files[index], settings), + filesToUpload; + initUploadEventHandlers(files, index, xhr, settings); + initUploadRequest(files, index, xhr, settings); + if (!settings.multipart) { + if (xhr.upload) { + xhr.send(blob); + } else { + $.error('Browser does not support XHR file uploads'); + } + } else { + filesToUpload = (typeof index === 'number') ? [blob] : files; + if (typeof FormData !== undef) { + formDataUpload(filesToUpload, xhr, settings); + } else if (typeof FileReader !== undef && typeof xhr.sendAsBinary === func) { + fileReaderUpload(filesToUpload, xhr, settings); + } else { + $.error('Browser does not support multipart/form-data XHR file uploads'); + } + } + }; + if (!nextChunk && settings.sequentialUploads) { + sequenceHandler.push(send); + } else { + send(); + } + }, + + handleUpload = function (event, files, input, form, index) { + var xhr = new XMLHttpRequest(), + uploadSettings = $.extend({}, settings); + uploadSettings.fileInput = input; + uploadSettings.uploadForm = form; + if (typeof uploadSettings.initUpload === func) { + uploadSettings.initUpload( + event, + files, + index, + xhr, + uploadSettings, + function () { + upload(event, files, index, xhr, uploadSettings); + } + ); + } else { + upload(event, files, index, xhr, uploadSettings); + } + }, + + handleFiles = function (event, files, input, form) { + var i; + files = Array.prototype.slice.call(files, 0); + if (settings.multiFileRequest && settings.multipart && files.length) { + handleUpload(event, files, input, form); + } else { + for (i = 0; i < files.length; i += 1) { + handleUpload(event, files, input, form, i); + } + } + }, + + handleLegacyGlobalProgress = function (event, files, index, iframe, settings) { + var total = files[index].size ? files[index].size : 1, + progressEvent = createProgressEvent(true, total, total); + settings.progressLoaded = total; + handleGlobalProgress(progressEvent, files, index, iframe, settings); + }, + + legacyUploadFormDataInit = function (input, form, settings) { + var formData = getFormData(settings); + form.find(':input').not(':disabled') + .attr('disabled', true) + .addClass(settings.namespace + '_disabled'); + $.each(formData, function (index, field) { + $('') + .attr('name', field.name) + .val(field.value) + .addClass(settings.namespace + '_form_data') + .appendTo(form); + }); + input + .attr('name', getFieldName(settings)) + .appendTo(form); + }, + + legacyUploadFormDataReset = function (input, form, settings) { + input.detach(); + form.find('.' + settings.namespace + '_disabled') + .removeAttr('disabled') + .removeClass(settings.namespace + '_disabled'); + form.find('.' + settings.namespace + '_form_data').remove(); + }, + + legacyUpload = function (event, files, input, form, iframe, settings) { + var send; + if (typeof settings.onSend === func && settings.onSend(event, files, 0, iframe, settings) === false) { + return; + } + multiLoader.push([files, 0, iframe, settings]); + send = function () { + var originalAction = form.attr('action'), + originalMethod = form.attr('method'), + originalTarget = form.attr('target'); + iframe + .unbind('abort') + .bind('abort', function (e) { + iframe.readyState = 0; + // javascript:false as iframe src prevents warning popups on HTTPS in IE6 + // concat is used here to prevent the "Script URL" JSLint error: + iframe.unbind('load').attr('src', 'javascript'.concat(':false;')); + handleLegacyGlobalProgress(e, files, 0, iframe, settings); + if (typeof settings.onAbort === func) { + settings.onAbort(e, files, 0, iframe, settings); + } + multiLoader.complete(); + sequenceHandler.next(); + }) + .unbind('load') + .bind('load', function (e) { + iframe.readyState = 4; + handleLegacyGlobalProgress(e, files, 0, iframe, settings); + if (typeof settings.onLoad === func) { + settings.onLoad(e, files, 0, iframe, settings); + } + multiLoader.complete(); + sequenceHandler.next(); + // Fix for IE endless progress bar activity bug + // (happens on form submits to iframe targets): + $('') + .appendTo(form).remove(); + }); + form + .attr('action', getUrl(settings)) + .attr('method', getMethod(settings)) + .attr('target', iframe.attr('name')); + legacyUploadFormDataInit(input, form, settings); + iframe.readyState = 2; + form.get(0).submit(); + legacyUploadFormDataReset(input, form, settings); + form + .attr('action', originalAction) + .attr('method', originalMethod) + .attr('target', originalTarget); + }; + if (settings.sequentialUploads) { + sequenceHandler.push(send); + } else { + send(); + } + }, + + handleLegacyUpload = function (event, input, form) { + // javascript:false as iframe src prevents warning popups on HTTPS in IE6: + var iframe = $(''), + uploadSettings = $.extend({}, settings), + files = event.target.files; + files = files ? Array.prototype.slice.call(files, 0) : [{name: input.val(), type: null, size: null}]; + uploadSettings.fileInput = input; + uploadSettings.uploadForm = form; + iframe.readyState = 0; + iframe.abort = function () { + iframe.trigger('abort'); + }; + iframe.bind('load', function () { + iframe.unbind('load'); + if (typeof uploadSettings.initUpload === func) { + uploadSettings.initUpload( + event, + files, + 0, + iframe, + uploadSettings, + function () { + legacyUpload(event, files, input, form, iframe, uploadSettings); + } + ); + } else { + legacyUpload(event, files, input, form, iframe, uploadSettings); + } + }).appendTo(form); + }, + + initUploadForm = function () { + uploadForm = (container.is('form') ? container : container.find('form')) + .filter(settings.uploadFormFilter); + }, + + initFileInput = function () { + fileInput = (uploadForm.length ? uploadForm : container).find('input:file') + .filter(settings.fileInputFilter); + }, + + replaceFileInput = function (input) { + var inputClone = input.clone(true); + $('
    ').append(inputClone).get(0).reset(); + input.after(inputClone).detach(); + initFileInput(); + }; + + this.onDocumentDragOver = function (e) { + if (typeof settings.onDocumentDragOver === func && + settings.onDocumentDragOver(e) === false) { + return false; + } + e.preventDefault(); + }; + + this.onDocumentDrop = function (e) { + if (typeof settings.onDocumentDrop === func && + settings.onDocumentDrop(e) === false) { + return false; + } + e.preventDefault(); + }; + + this.onDragOver = function (e) { + if (typeof settings.onDragOver === func && + settings.onDragOver(e) === false) { + return false; + } + var dataTransfer = e.originalEvent.dataTransfer; + if (dataTransfer && dataTransfer.files) { + dataTransfer.dropEffect = dataTransfer.effectAllowed = 'copy'; + e.preventDefault(); + } + }; + + this.onDrop = function (e) { + if (typeof settings.onDrop === func && + settings.onDrop(e) === false) { + return false; + } + var dataTransfer = e.originalEvent.dataTransfer; + if (dataTransfer && dataTransfer.files && isXHRUploadCapable()) { + handleFiles(e, dataTransfer.files); + } + e.preventDefault(); + }; + + this.onChange = function (e) { + if (typeof settings.onChange === func && + settings.onChange(e) === false) { + return false; + } + var input = $(e.target), + form = $(e.target.form); + if (form.length === 1) { + input.data(defaultNamespace + '_form', form); + replaceFileInput(input); + } else { + form = input.data(defaultNamespace + '_form'); + } + if (!settings.forceIframeUpload && e.target.files && isXHRUploadCapable()) { + handleFiles(e, e.target.files, input, form); + } else { + handleLegacyUpload(e, input, form); + } + }; + + this.init = function (options) { + if (options) { + $.extend(settings, options); + optionsReference = options; + } + initUploadForm(); + initFileInput(); + if (container.data(settings.namespace)) { + $.error('FileUpload with namespace "' + settings.namespace + '" already assigned to this element'); + return; + } + container + .data(settings.namespace, fileUpload) + .addClass(settings.cssClass); + settings.dropZone.not(container).addClass(settings.cssClass); + initEventHandlers(); + }; + + this.options = function (options) { + var oldCssClass, + oldDropZone, + uploadFormFilterUpdate, + fileInputFilterUpdate; + if (typeof options === undef) { + return $.extend({}, settings); + } + if (optionsReference) { + $.extend(optionsReference, options); + } + removeEventHandlers(); + $.each(options, function (name, value) { + switch (name) { + case 'namespace': + $.error('The FileUpload namespace cannot be updated.'); + return; + case 'uploadFormFilter': + uploadFormFilterUpdate = true; + fileInputFilterUpdate = true; + break; + case 'fileInputFilter': + fileInputFilterUpdate = true; + break; + case 'cssClass': + oldCssClass = settings.cssClass; + break; + case 'dropZone': + oldDropZone = settings.dropZone; + break; + } + settings[name] = value; + }); + if (uploadFormFilterUpdate) { + initUploadForm(); + } + if (fileInputFilterUpdate) { + initFileInput(); + } + if (typeof oldCssClass !== undef) { + container + .removeClass(oldCssClass) + .addClass(settings.cssClass); + (oldDropZone ? oldDropZone : settings.dropZone).not(container) + .removeClass(oldCssClass); + settings.dropZone.not(container).addClass(settings.cssClass); + } else if (oldDropZone) { + oldDropZone.not(container).removeClass(settings.cssClass); + settings.dropZone.not(container).addClass(settings.cssClass); + } + initEventHandlers(); + }; + + this.option = function (name, value) { + var options; + if (typeof value === undef) { + return settings[name]; + } + options = {}; + options[name] = value; + fileUpload.options(options); + }; + + this.destroy = function () { + removeEventHandlers(); + container + .removeData(settings.namespace) + .removeClass(settings.cssClass); + settings.dropZone.not(container).removeClass(settings.cssClass); + }; + + this.upload = function (files) { + if (typeof files.length === undef) { + files = [files]; + } + handleFiles(null, files); + }; + }; + + methods = { + init : function (options) { + return this.each(function () { + (new FileUpload($(this))).init(options); + }); + }, + + option: function (option, value, namespace) { + namespace = namespace ? namespace : defaultNamespace; + var fileUpload = $(this).data(namespace); + if (fileUpload) { + if (!option) { + return fileUpload.options(); + } else if (typeof option === 'string' && typeof value === undef) { + return fileUpload.option(option); + } + } else { + $.error('No FileUpload with namespace "' + namespace + '" assigned to this element'); + } + return this.each(function () { + var fu = $(this).data(namespace); + if (fu) { + if (typeof option === 'string') { + fu.option(option, value); + } else { + fu.options(option); + } + } else { + $.error('No FileUpload with namespace "' + namespace + '" assigned to this element'); + } + }); + }, + + destroy: function (namespace) { + namespace = namespace ? namespace : defaultNamespace; + return this.each(function () { + var fileUpload = $(this).data(namespace); + if (fileUpload) { + fileUpload.destroy(); + } else { + $.error('No FileUpload with namespace "' + namespace + '" assigned to this element'); + } + }); + }, + + upload: function (files, namespace) { + namespace = namespace ? namespace : defaultNamespace; + return this.each(function () { + var fileUpload = $(this).data(namespace); + if (fileUpload) { + fileUpload.upload(files); + } else { + $.error('No FileUpload with namespace "' + namespace + '" assigned to this element'); + } + }); + } + }; + + $.fn.fileUpload = function (method) { + if (methods[method]) { + return methods[method].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof method === 'object' || !method) { + return methods.init.apply(this, arguments); + } else { + $.error('Method "' + method + '" does not exist on jQuery.fileUpload'); + } + }; + +}(jQuery)); \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.prettyPhoto.js b/public/assets/javascripts/core/jquery.prettyPhoto.js new file mode 100755 index 0000000..394692c --- /dev/null +++ b/public/assets/javascripts/core/jquery.prettyPhoto.js @@ -0,0 +1,27 @@ +/* ------------------------------------------------------------------------ + Class: prettyPhoto + Use: Lightbox clone for jQuery + Author: Stephane Caron (http://www.no-margin-for-errors.com) + Version: 3.1.2 +------------------------------------------------------------------------- */ + +(function($){$.prettyPhoto={version:'3.1.2'};$.fn.prettyPhoto=function(pp_settings){pp_settings=jQuery.extend({animation_speed:'fast',slideshow:5000,autoplay_slideshow:false,opacity:0.80,show_title:true,allow_resize:true,default_width:500,default_height:344,counter_separator_label:'/',theme:'pp_default',horizontal_padding:20,hideflash:false,wmode:'opaque',autoplay:true,modal:false,deeplinking:true,overlay_gallery:true,keyboard_shortcuts:true,changepicturecallback:function(){},callback:function(){},ie6_fallback:true,markup:'
    ',gallery_markup:'',image_markup:'',flash_markup:'',quicktime_markup:'',iframe_markup:'',inline_markup:'
    {content}
    ',custom_markup:'',social_tools:''},pp_settings);var matchedObjects=this,percentBased=false,pp_dimensions,pp_open,pp_contentHeight,pp_contentWidth,pp_containerHeight,pp_containerWidth,windowHeight=$(window).height(),windowWidth=$(window).width(),pp_slideshow;doresize=true,scroll_pos=_get_scroll();$(window).unbind('resize.prettyphoto').bind('resize.prettyphoto',function(){_center_overlay();_resize_overlay();});if(pp_settings.keyboard_shortcuts){$(document).unbind('keydown.prettyphoto').bind('keydown.prettyphoto',function(e){if(typeof $pp_pic_holder!='undefined'){if($pp_pic_holder.is(':visible')){switch(e.keyCode){case 37:$.prettyPhoto.changePage('previous');e.preventDefault();break;case 39:$.prettyPhoto.changePage('next');e.preventDefault();break;case 27:if(!settings.modal) +$.prettyPhoto.close();e.preventDefault();break;};};};});};$.prettyPhoto.initialize=function(){settings=pp_settings;if(settings.theme=='pp_default')settings.horizontal_padding=16;if(settings.ie6_fallback&&$.browser.msie&&parseInt($.browser.version)==6)settings.theme="light_square";theRel=$(this).attr('rel');galleryRegExp=/\[(?:.*)\]/;isSet=(galleryRegExp.exec(theRel))?true:false;pp_images=(isSet)?jQuery.map(matchedObjects,function(n,i){if($(n).attr('rel').indexOf(theRel)!=-1)return $(n).attr('href');}):$.makeArray($(this).attr('href'));pp_titles=(isSet)?jQuery.map(matchedObjects,function(n,i){if($(n).attr('rel').indexOf(theRel)!=-1)return($(n).find('img').attr('alt'))?$(n).find('img').attr('alt'):"";}):$.makeArray($(this).find('img').attr('alt'));pp_descriptions=(isSet)?jQuery.map(matchedObjects,function(n,i){if($(n).attr('rel').indexOf(theRel)!=-1)return($(n).attr('title'))?$(n).attr('title'):"";}):$.makeArray($(this).attr('title'));set_position=jQuery.inArray($(this).attr('href'),pp_images);rel_index=(isSet)?set_position:$("a[rel^='"+theRel+"']").index($(this));_build_overlay(this);if(settings.allow_resize) +$(window).bind('scroll.prettyphoto',function(){_center_overlay();});$.prettyPhoto.open();return false;} +$.prettyPhoto.open=function(event){if(typeof settings=="undefined"){settings=pp_settings;if($.browser.msie&&$.browser.version==6)settings.theme="light_square";pp_images=$.makeArray(arguments[0]);pp_titles=(arguments[1])?$.makeArray(arguments[1]):$.makeArray("");pp_descriptions=(arguments[2])?$.makeArray(arguments[2]):$.makeArray("");isSet=(pp_images.length>1)?true:false;set_position=0;_build_overlay(event.target);} +if($.browser.msie&&$.browser.version==6)$('select').css('visibility','hidden');if(settings.hideflash)$('object,embed,iframe[src*=youtube],iframe[src*=vimeo]').css('visibility','hidden');_checkPosition($(pp_images).size());$('.pp_loaderIcon').show();if($ppt.is(':hidden'))$ppt.css('opacity',0).show();$pp_overlay.show().fadeTo(settings.animation_speed,settings.opacity);$pp_pic_holder.find('.currentTextHolder').text((set_position+1)+settings.counter_separator_label+$(pp_images).size());if(pp_descriptions[set_position]!=""){$pp_pic_holder.find('.pp_description').show().html(unescape(pp_descriptions[set_position]));}else{$pp_pic_holder.find('.pp_description').hide();} +movie_width=(parseFloat(getParam('width',pp_images[set_position])))?getParam('width',pp_images[set_position]):settings.default_width.toString();movie_height=(parseFloat(getParam('height',pp_images[set_position])))?getParam('height',pp_images[set_position]):settings.default_height.toString();percentBased=false;if(movie_height.indexOf('%')!=-1){movie_height=parseFloat(($(window).height()*parseFloat(movie_height)/100)-150);percentBased=true;} +if(movie_width.indexOf('%')!=-1){movie_width=parseFloat(($(window).width()*parseFloat(movie_width)/100)-150);percentBased=true;} +$pp_pic_holder.fadeIn(function(){(settings.show_title&&pp_titles[set_position]!=""&&typeof pp_titles[set_position]!="undefined")?$ppt.html(unescape(pp_titles[set_position])):$ppt.html(' ');imgPreloader="";skipInjection=false;switch(_getFileType(pp_images[set_position])){case'image':imgPreloader=new Image();nextImage=new Image();if(isSet&&set_position<$(pp_images).size()-1)nextImage.src=pp_images[set_position+1];prevImage=new Image();if(isSet&&pp_images[set_position-1])prevImage.src=pp_images[set_position-1];$pp_pic_holder.find('#pp_full_res')[0].innerHTML=settings.image_markup.replace(/{path}/g,pp_images[set_position]);imgPreloader.onload=function(){pp_dimensions=_fitToViewport(imgPreloader.width,imgPreloader.height);_showContent();};imgPreloader.onerror=function(){alert('Image cannot be loaded. Make sure the path is correct and image exist.');$.prettyPhoto.close();};imgPreloader.src=pp_images[set_position];break;case'youtube':pp_dimensions=_fitToViewport(movie_width,movie_height);movie='http://www.youtube.com/embed/'+getParam('v',pp_images[set_position]);(getParam('rel',pp_images[set_position]))?movie+="?rel="+getParam('rel',pp_images[set_position]):movie+="?rel=1";if(settings.autoplay)movie+="&autoplay=1";toInject=settings.iframe_markup.replace(/{width}/g,pp_dimensions['width']).replace(/{height}/g,pp_dimensions['height']).replace(/{wmode}/g,settings.wmode).replace(/{path}/g,movie);break;case'vimeo':pp_dimensions=_fitToViewport(movie_width,movie_height);movie_id=pp_images[set_position];var regExp=/http:\/\/(www\.)?vimeo.com\/(\d+)/;var match=movie_id.match(regExp);movie='http://player.vimeo.com/video/'+match[2]+'?title=0&byline=0&portrait=0';if(settings.autoplay)movie+="&autoplay=1;";vimeo_width=pp_dimensions['width']+'/embed/?moog_width='+pp_dimensions['width'];toInject=settings.iframe_markup.replace(/{width}/g,vimeo_width).replace(/{height}/g,pp_dimensions['height']).replace(/{path}/g,movie);break;case'quicktime':pp_dimensions=_fitToViewport(movie_width,movie_height);pp_dimensions['height']+=15;pp_dimensions['contentHeight']+=15;pp_dimensions['containerHeight']+=15;toInject=settings.quicktime_markup.replace(/{width}/g,pp_dimensions['width']).replace(/{height}/g,pp_dimensions['height']).replace(/{wmode}/g,settings.wmode).replace(/{path}/g,pp_images[set_position]).replace(/{autoplay}/g,settings.autoplay);break;case'flash':pp_dimensions=_fitToViewport(movie_width,movie_height);flash_vars=pp_images[set_position];flash_vars=flash_vars.substring(pp_images[set_position].indexOf('flashvars')+10,pp_images[set_position].length);filename=pp_images[set_position];filename=filename.substring(0,filename.indexOf('?'));toInject=settings.flash_markup.replace(/{width}/g,pp_dimensions['width']).replace(/{height}/g,pp_dimensions['height']).replace(/{wmode}/g,settings.wmode).replace(/{path}/g,filename+'?'+flash_vars);break;case'iframe':pp_dimensions=_fitToViewport(movie_width,movie_height);frame_url=pp_images[set_position];frame_url=frame_url.substr(0,frame_url.indexOf('iframe')-1);toInject=settings.iframe_markup.replace(/{width}/g,pp_dimensions['width']).replace(/{height}/g,pp_dimensions['height']).replace(/{path}/g,frame_url);break;case'ajax':doresize=false;pp_dimensions=_fitToViewport(movie_width,movie_height);doresize=true;skipInjection=true;$.get(pp_images[set_position],function(responseHTML){toInject=settings.inline_markup.replace(/{content}/g,responseHTML);$pp_pic_holder.find('#pp_full_res')[0].innerHTML=toInject;_showContent();});break;case'custom':pp_dimensions=_fitToViewport(movie_width,movie_height);toInject=settings.custom_markup;break;case'inline':myClone=$(pp_images[set_position]).clone().append('
    ').css({'width':settings.default_width}).wrapInner('
    ').appendTo($('body')).show();doresize=false;pp_dimensions=_fitToViewport($(myClone).width(),$(myClone).height());doresize=true;$(myClone).remove();toInject=settings.inline_markup.replace(/{content}/g,$(pp_images[set_position]).html());break;};if(!imgPreloader&&!skipInjection){$pp_pic_holder.find('#pp_full_res')[0].innerHTML=toInject;_showContent();};});return false;};$.prettyPhoto.changePage=function(direction){currentGalleryPage=0;if(direction=='previous'){set_position--;if(set_position<0)set_position=$(pp_images).size()-1;}else if(direction=='next'){set_position++;if(set_position>$(pp_images).size()-1)set_position=0;}else{set_position=direction;};rel_index=set_position;if(!doresize)doresize=true;$('.pp_contract').removeClass('pp_contract').addClass('pp_expand');_hideContent(function(){$.prettyPhoto.open();});};$.prettyPhoto.changeGalleryPage=function(direction){if(direction=='next'){currentGalleryPage++;if(currentGalleryPage>totalPage)currentGalleryPage=0;}else if(direction=='previous'){currentGalleryPage--;if(currentGalleryPage<0)currentGalleryPage=totalPage;}else{currentGalleryPage=direction;};slide_speed=(direction=='next'||direction=='previous')?settings.animation_speed:0;slide_to=currentGalleryPage*(itemsPerPage*itemWidth);$pp_gallery.find('ul').animate({left:-slide_to},slide_speed);};$.prettyPhoto.startSlideshow=function(){if(typeof pp_slideshow=='undefined'){$pp_pic_holder.find('.pp_play').unbind('click').removeClass('pp_play').addClass('pp_pause').click(function(){$.prettyPhoto.stopSlideshow();return false;});pp_slideshow=setInterval($.prettyPhoto.startSlideshow,settings.slideshow);}else{$.prettyPhoto.changePage('next');};} +$.prettyPhoto.stopSlideshow=function(){$pp_pic_holder.find('.pp_pause').unbind('click').removeClass('pp_pause').addClass('pp_play').click(function(){$.prettyPhoto.startSlideshow();return false;});clearInterval(pp_slideshow);pp_slideshow=undefined;} +$.prettyPhoto.close=function(){if($pp_overlay.is(":animated"))return;$.prettyPhoto.stopSlideshow();$pp_pic_holder.stop().find('object,embed').css('visibility','hidden');$('div.pp_pic_holder,div.ppt,.pp_fade').fadeOut(settings.animation_speed,function(){$(this).remove();});$pp_overlay.fadeOut(settings.animation_speed,function(){if($.browser.msie&&$.browser.version==6)$('select').css('visibility','visible');if(settings.hideflash)$('object,embed,iframe[src*=youtube],iframe[src*=vimeo]').css('visibility','visible');$(this).remove();$(window).unbind('scroll.prettyphoto');settings.callback();doresize=true;pp_open=false;delete settings;});};function _showContent(){$('.pp_loaderIcon').hide();projectedTop=scroll_pos['scrollTop']+((windowHeight/2)-(pp_dimensions['containerHeight']/2));if(projectedTop<0)projectedTop=0;$ppt.fadeTo(settings.animation_speed,1);$pp_pic_holder.find('.pp_content').animate({height:pp_dimensions['contentHeight'],width:pp_dimensions['contentWidth']},settings.animation_speed);$pp_pic_holder.animate({'top':projectedTop,'left':(windowWidth/2)-(pp_dimensions['containerWidth']/2),width:pp_dimensions['containerWidth']},settings.animation_speed,function(){$pp_pic_holder.find('.pp_hoverContainer,#fullResImage').height(pp_dimensions['height']).width(pp_dimensions['width']);$pp_pic_holder.find('.pp_fade').fadeIn(settings.animation_speed);if(isSet&&_getFileType(pp_images[set_position])=="image"){$pp_pic_holder.find('.pp_hoverContainer').show();}else{$pp_pic_holder.find('.pp_hoverContainer').hide();} +if(pp_dimensions['resized']){$('a.pp_expand,a.pp_contract').show();}else{$('a.pp_expand').hide();} +if(settings.autoplay_slideshow&&!pp_slideshow&&!pp_open)$.prettyPhoto.startSlideshow();if(settings.deeplinking) +setHashtag();settings.changepicturecallback();pp_open=true;});_insert_gallery();};function _hideContent(callback){$pp_pic_holder.find('#pp_full_res object,#pp_full_res embed').css('visibility','hidden');$pp_pic_holder.find('.pp_fade').fadeOut(settings.animation_speed,function(){$('.pp_loaderIcon').show();callback();});};function _checkPosition(setCount){(setCount>1)?$('.pp_nav').show():$('.pp_nav').hide();};function _fitToViewport(width,height){resized=false;_getDimensions(width,height);imageWidth=width,imageHeight=height;if(((pp_containerWidth>windowWidth)||(pp_containerHeight>windowHeight))&&doresize&&settings.allow_resize&&!percentBased){resized=true,fitting=false;while(!fitting){if((pp_containerWidth>windowWidth)){imageWidth=(windowWidth-200);imageHeight=(height/width)*imageWidth;}else if((pp_containerHeight>windowHeight)){imageHeight=(windowHeight-200);imageWidth=(width/height)*imageHeight;}else{fitting=true;};pp_containerHeight=imageHeight,pp_containerWidth=imageWidth;};_getDimensions(imageWidth,imageHeight);if((pp_containerWidth>windowWidth)||(pp_containerHeight>windowHeight)){_fitToViewport(pp_containerWidth,pp_containerHeight)};};return{width:Math.floor(imageWidth),height:Math.floor(imageHeight),containerHeight:Math.floor(pp_containerHeight),containerWidth:Math.floor(pp_containerWidth)+(settings.horizontal_padding*2),contentHeight:Math.floor(pp_contentHeight),contentWidth:Math.floor(pp_contentWidth),resized:resized};};function _getDimensions(width,height){width=parseFloat(width);height=parseFloat(height);$pp_details=$pp_pic_holder.find('.pp_details');$pp_details.width(width);detailsHeight=parseFloat($pp_details.css('marginTop'))+parseFloat($pp_details.css('marginBottom'));$pp_details=$pp_details.clone().addClass(settings.theme).width(width).appendTo($('body')).css({'position':'absolute','top':-10000});detailsHeight+=$pp_details.height();detailsHeight=(detailsHeight<=34)?36:detailsHeight;if($.browser.msie&&$.browser.version==7)detailsHeight+=8;$pp_details.remove();$pp_title=$pp_pic_holder.find('.ppt');$pp_title.width(width);titleHeight=parseFloat($pp_title.css('marginTop'))+parseFloat($pp_title.css('marginBottom'));$pp_title=$pp_title.clone().appendTo($('body')).css({'position':'absolute','top':-10000});titleHeight+=$pp_title.height();$pp_title.remove();pp_contentHeight=height+detailsHeight;pp_contentWidth=width;pp_containerHeight=pp_contentHeight+titleHeight+$pp_pic_holder.find('.pp_top').height()+$pp_pic_holder.find('.pp_bottom').height();pp_containerWidth=width;} +function _getFileType(itemSrc){if(itemSrc.match(/youtube\.com\/watch/i)){return'youtube';}else if(itemSrc.match(/vimeo\.com/i)){return'vimeo';}else if(itemSrc.match(/\b.mov\b/i)){return'quicktime';}else if(itemSrc.match(/\b.swf\b/i)){return'flash';}else if(itemSrc.match(/\biframe=true\b/i)){return'iframe';}else if(itemSrc.match(/\bajax=true\b/i)){return'ajax';}else if(itemSrc.match(/\bcustom=true\b/i)){return'custom';}else if(itemSrc.substr(0,1)=='#'){return'inline';}else{return'image';};};function _center_overlay(){if(doresize&&typeof $pp_pic_holder!='undefined'){scroll_pos=_get_scroll();contentHeight=$pp_pic_holder.height(),contentwidth=$pp_pic_holder.width();projectedTop=(windowHeight/2)+scroll_pos['scrollTop']-(contentHeight/2);if(projectedTop<0)projectedTop=0;if(contentHeight>windowHeight) +return;$pp_pic_holder.css({'top':projectedTop,'left':(windowWidth/2)+scroll_pos['scrollLeft']-(contentwidth/2)});};};function _get_scroll(){if(self.pageYOffset){return{scrollTop:self.pageYOffset,scrollLeft:self.pageXOffset};}else if(document.documentElement&&document.documentElement.scrollTop){return{scrollTop:document.documentElement.scrollTop,scrollLeft:document.documentElement.scrollLeft};}else if(document.body){return{scrollTop:document.body.scrollTop,scrollLeft:document.body.scrollLeft};};};function _resize_overlay(){windowHeight=$(window).height(),windowWidth=$(window).width();if(typeof $pp_overlay!="undefined")$pp_overlay.height($(document).height()).width(windowWidth);};function _insert_gallery(){if(isSet&&settings.overlay_gallery&&_getFileType(pp_images[set_position])=="image"&&(settings.ie6_fallback&&!($.browser.msie&&parseInt($.browser.version)==6))){itemWidth=52+5;navWidth=(settings.theme=="facebook"||settings.theme=="pp_default")?50:30;itemsPerPage=Math.floor((pp_dimensions['containerWidth']-100-navWidth)/itemWidth);itemsPerPage=(itemsPerPage";};toInject=settings.gallery_markup.replace(/{gallery}/g,toInject);$pp_pic_holder.find('#pp_full_res').after(toInject);$pp_gallery=$('.pp_pic_holder .pp_gallery'),$pp_gallery_li=$pp_gallery.find('li');$pp_gallery.find('.pp_arrow_next').click(function(){$.prettyPhoto.changeGalleryPage('next');$.prettyPhoto.stopSlideshow();return false;});$pp_gallery.find('.pp_arrow_previous').click(function(){$.prettyPhoto.changeGalleryPage('previous');$.prettyPhoto.stopSlideshow();return false;});$pp_pic_holder.find('.pp_content').hover(function(){$pp_pic_holder.find('.pp_gallery:not(.disabled)').fadeIn();},function(){$pp_pic_holder.find('.pp_gallery:not(.disabled)').fadeOut();});itemWidth=52+5;$pp_gallery_li.each(function(i){$(this).find('a').click(function(){$.prettyPhoto.changePage(i);$.prettyPhoto.stopSlideshow();return false;});});};if(settings.slideshow){$pp_pic_holder.find('.pp_nav').prepend('Play') +$pp_pic_holder.find('.pp_nav .pp_play').click(function(){$.prettyPhoto.startSlideshow();return false;});} +$pp_pic_holder.attr('class','pp_pic_holder '+settings.theme);$pp_overlay.css({'opacity':0,'height':$(document).height(),'width':$(window).width()}).bind('click',function(){if(!settings.modal)$.prettyPhoto.close();});$('a.pp_close').bind('click',function(){$.prettyPhoto.close();return false;});$('a.pp_expand').bind('click',function(e){if($(this).hasClass('pp_expand')){$(this).removeClass('pp_expand').addClass('pp_contract');doresize=false;}else{$(this).removeClass('pp_contract').addClass('pp_expand');doresize=true;};_hideContent(function(){$.prettyPhoto.open();});return false;});$pp_pic_holder.find('.pp_previous, .pp_nav .pp_arrow_previous').bind('click',function(){$.prettyPhoto.changePage('previous');$.prettyPhoto.stopSlideshow();return false;});$pp_pic_holder.find('.pp_next, .pp_nav .pp_arrow_next').bind('click',function(){$.prettyPhoto.changePage('next');$.prettyPhoto.stopSlideshow();return false;});_center_overlay();};if(!pp_alreadyInitialized&&getHashtag()){pp_alreadyInitialized=true;hashIndex=getHashtag();hashRel=hashIndex;hashIndex=hashIndex.substring(hashIndex.indexOf('/')+1,hashIndex.length-1);hashRel=hashRel.substring(0,hashRel.indexOf('/'));setTimeout(function(){$("a[rel^='"+hashRel+"']:eq("+hashIndex+")").trigger('click');},50);} +return this.unbind('click.prettyphoto').bind('click.prettyphoto',$.prettyPhoto.initialize);};function getHashtag(){url=location.href;hashtag=(url.indexOf('#!')!=-1)?decodeURI(url.substring(url.indexOf('#!')+2,url.length)):false;return hashtag;};function setHashtag(){if(typeof theRel=='undefined')return;location.hash='!'+theRel+'/'+rel_index+'/';};function getParam(name,url){name=name.replace(/[\[]/,"\\\[").replace(/[\]]/,"\\\]");var regexS="[\\?&]"+name+"=([^&#]*)";var regex=new RegExp(regexS);var results=regex.exec(url);return(results==null)?"":results[1];}})(jQuery);var pp_alreadyInitialized=false; \ No newline at end of file diff --git a/public/assets/javascripts/core/jquery.reject.min.js b/public/assets/javascripts/core/jquery.reject.min.js new file mode 100644 index 0000000..e588e54 --- /dev/null +++ b/public/assets/javascripts/core/jquery.reject.min.js @@ -0,0 +1,34 @@ +/* + * jReject (jQuery Browser Rejection Plugin) + * Version 0.7-Beta + * URL: http://jreject.turnwheel.com/ + * Description: jReject gives you a customizable and easy solution to reject/allowing specific browsers access to your pages + * Author: Steven Bower (TurnWheel Designs) http://turnwheel.com/ + * Copyright: Copyright (c) 2009-2010 Steven Bower under dual MIT/GPL license. + * Depends On: jQuery Browser Plugin (http://jquery.thewikies.com/browser) + */ +(function(b){b.reject=function(a){a=b.extend(true,{reject:{all:false,msie5:true,msie6:true},display:[],browserInfo:{firefox:{text:"Firefox 3.5+",url:"http://www.mozilla.com/firefox/"},safari:{text:"Safari 4",url:"http://www.apple.com/safari/download/"},opera:{text:"Opera 10.5",url:"http://www.opera.com/download/"},chrome:{text:"Chrome 5",url:"http://www.google.com/chrome/"},msie:{text:"Internet Explorer 8",url:"http://www.microsoft.com/windows/Internet-explorer/"},gcf:{text:"Google Chrome Frame", +url:"http://code.google.com/chrome/chromeframe/",allow:{all:false,msie:true}}},header:"Did you know that your Internet Browser is out of date?",paragraph1:"Your browser is out of date, and may not be compatible with our website. A list of the most popular web browsers can be found below.",paragraph2:"Just click on the icons to get to the download page",close:true,closeMessage:"By closing this window you acknowledge that your experience on this website may be degraded",closeLink:"Close This Window", +closeURL:"#",closeESC:true,closeCookie:false,cookieSettings:{path:"/",expires:0},imagePath:"/images/",overlayBgColor:"#000",overlayOpacity:0.8,fadeInTime:"fast",fadeOutTime:"fast"},a);if(a.display.length<1)a.display=["firefox","chrome","msie","safari","opera","gcf"];b.isFunction(a.beforeReject)&&a.beforeReject(a);if(!a.close)a.closeESC=false;var d=function(c){return(c.all?true:false)||(c[b.os.name]?true:false)||(c[b.layout.name]?true:false)||(c[b.browser.name]?true:false)||(c[b.browser.className]? +true:false)};if(!d(a.reject)){b.isFunction(a.onFail)&&a.onFail(a);return false}if(a.close&&a.closeCookie){var f="jreject-close",h=function(c,g){if(typeof g!="undefined"){var e="";if(a.cookieSettings.expires!=0){e=new Date;e.setTime(e.getTime()+a.cookieSettings.expires);e="; expires="+e.toGMTString()}var k=a.cookieSettings.path||"/";document.cookie=c+"="+encodeURIComponent(g==null?"":g)+e+"; path="+k}else{k=null;if(document.cookie&&document.cookie!="")for(var o=document.cookie.split(";"),n=0;n"+(a.paragraph1===""?"":"

    "+a.paragraph1+"

    ")+(a.paragraph2===""?"":"

    "+a.paragraph2+"

    ")+"
      ",l=0;for(var s in a.display){var p=a.display[s],j=a.browserInfo[p]||false;if(!(!j||j.allow!=undefined&&!d(j.allow))){i+='
    • ";++l}}i+='
    '+(a.close?''+a.closeLink+"

    "+a.closeMessage+"

    ":"")+"
    ";var m=b("
    "+i+"
    ");d=q();i=r();m.bind("closejr",function(){if(!a.close)return false;b.isFunction(a.beforeClose)&&a.beforeClose(a);b(this).unbind("closejr");b("#jr_overlay,#jr_wrap").fadeOut(a.fadeOutTime,function(){b(this).remove();b.isFunction(a.afterClose)&&a.afterClose(a)});b("embed, object, select, applet").show(); +a.closeCookie&&h(f,"true");return true});m.find("#jr_overlay").css({width:d[0],height:d[1],position:"absolute",top:0,left:0,background:a.overlayBgColor,zIndex:200,opacity:a.overlayOpacity,padding:0,margin:0}).next("#jr_wrap").css({position:"absolute",width:"100%",top:i[1]+d[3]/4,left:i[0],zIndex:300,textAlign:"center",padding:0,margin:0}).children("#jr_inner").css({background:"#FFF",border:"1px solid #CCC",fontFamily:'"Lucida Grande","Lucida Sans Unicode",Arial,Verdana,sans-serif',color:"#4F4F4F", +margin:"0 auto",position:"relative",height:"auto",minWidth:l*100,maxWidth:l*140,width:b.layout.name=="trident"?l*155:"auto",padding:20,fontSize:12}).children("#jr_header").css({display:"block",fontSize:"1.3em",marginBottom:"0.5em",color:"#333",fontFamily:"Helvetica,Arial,sans-serif",fontWeight:"bold",textAlign:"left",padding:5,margin:0}).nextAll("p").css({textAlign:"left",padding:5,margin:0}).siblings("ul").css({listStyleImage:"none",listStylePosition:"outside",listStyleType:"none",margin:0,padding:0}).children("li").css({background:'transparent url("'+ +a.imagePath+'background_browser.gif") no-repeat scroll left top',cusor:"pointer","float":"left",width:120,height:122,margin:"0 10px 10px 10px",padding:0,textAlign:"center"}).children(".jr_icon").css({width:100,height:100,margin:"1px auto",padding:0,background:"transparent no-repeat scroll left top",cursor:"pointer"}).each(function(){var c=b(this);c.css("background","transparent url("+a.imagePath+c.parent("li").attr("id").replace(/jr_/,"")+".png) no-repeat scroll left top");c.click(function(){window.open(b(this).next("div").children("a").attr("href"), +"jr_"+Math.round(Math.random()*11));return false})}).siblings("div").css({color:"#808080",fontSize:"0.8em",height:18,lineHeight:"17px",margin:"1px auto",padding:0,width:118,textAlign:"center"}).children("a").css({color:"#333",textDecoration:"none",padding:0,margin:0}).hover(function(){b(this).css("textDecoration","underline")},function(){b(this).css("textDecoration","none")}).click(function(){window.open(b(this).attr("href"),"jr_"+Math.round(Math.random()*11));return false}).parents("#jr_inner").children("#jr_close").css({margin:"0 0 0 50px", +clear:"both",textAlign:"left",padding:0,margin:0}).children("a").css({color:"#000",display:"block",width:"auto",margin:0,padding:0,textDecoration:"underline"}).click(function(){b(this).trigger("closejr");if(a.closeURL==="#")return false}).nextAll("p").css({padding:"10px 0 0 0",margin:0});b("#jr_overlay").focus();b("embed, object, select, applet").hide();b("body").append(m.hide().fadeIn(a.fadeInTime));b(window).bind("resize scroll",function(){var c=q();b("#jr_overlay").css({width:c[0],height:c[1]}); +var g=r();b("#jr_wrap").css({top:g[1]+c[3]/4,left:g[0]})});a.closeESC&&b(document).bind("keydown",function(c){c.keyCode==27&&m.trigger("closejr")});b.isFunction(a.afterReject)&&a.afterReject(a);return true};var q=function(){var a=window.innerWidth&&window.scrollMaxX?window.innerWidth+window.scrollMaxX:document.body.scrollWidth>document.body.offsetWidth?document.body.scrollWidth:document.body.offsetWidth,d=window.innerHeight&&window.scrollMaxY?window.innerHeight+window.scrollMaxY:document.body.scrollHeight> +document.body.offsetHeight?document.body.scrollHeight:document.body.offsetHeight,f=window.innerWidth?window.innerWidth:document.documentElement&&document.documentElement.clientWidth?document.documentElement.clientWidth:document.body.clientWidth,h=window.innerHeight?window.innerHeight:document.documentElement&&document.documentElement.clientHeight?document.documentElement.clientHeight:document.body.clientHeight;return[a400){r.version='2.0';}if(r.name==='presto'){r.version=($.browser.version>9.27)?'futhark':'linear_b';}r.versionNumber=parseFloat(r.version,10)||0;r.versionX=(r.version!==x)?(r.version+'').substr(0,1):x;r.className=r.name+r.versionX;return r;};a=(a.match(/Opera|Navigator|Minefield|KHTML|Chrome/)?m(a,[[/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/,''],['Chrome Safari','Chrome'],['KHTML','Konqueror'],['Minefield','Firefox'],['Navigator','Netscape']]):a).toLowerCase();$.browser=$.extend((!z)?$.browser:{},c(a,/(camino|chrome|firefox|netscape|konqueror|lynx|msie|opera|safari)/,[],/(camino|chrome|firefox|netscape|netscape6|opera|version|konqueror|lynx|msie|safari)(\/|\s)([a-z0-9\.\+]*?)(\;|dev|rel|\s|$)/));$.layout=c(a,/(gecko|konqueror|msie|opera|webkit)/,[['konqueror','khtml'],['msie','trident'],['opera','presto']],/(applewebkit|rv|konqueror|msie)(\:|\/|\s)([a-z0-9\.]*?)(\;|\)|\s)/);$.os={name:(/(win|mac|linux|sunos|solaris|iphone)/.exec(navigator.platform.toLowerCase())||[u])[0].replace('sunos','solaris')};if(!z){$('html').addClass([$.os.name,$.browser.name,$.browser.className,$.layout.name,$.layout.className].join(' '));}};$.browserTest(navigator.userAgent);})(jQuery); \ No newline at end of file diff --git a/public/assets/javascripts/core/rails.js b/public/assets/javascripts/core/rails.js new file mode 100644 index 0000000..39341e6 --- /dev/null +++ b/public/assets/javascripts/core/rails.js @@ -0,0 +1,158 @@ +/** + * Unobtrusive scripting adapter for jQuery + * + * Requires jQuery 1.4.3 or later. + * https://github.com/rails/jquery-ujs + */ + +(function($) { + // Make sure that every Ajax request sends the CSRF token + function CSRFProtection(xhr) { + var token = $('meta[name="csrf-token"]').attr('content'); + if (token) xhr.setRequestHeader('X-CSRF-Token', token); + } + if ('ajaxPrefilter' in $) $.ajaxPrefilter(function(options, originalOptions, xhr){ CSRFProtection(xhr) }); + else $(document).ajaxSend(function(e, xhr){ CSRFProtection(xhr) }); + + // Triggers an event on an element and returns the event result + function fire(obj, name, data) { + var event = $.Event(name); + obj.trigger(event, data); + return event.result !== false; + } + + // Submits "remote" forms and links with ajax + function handleRemote(element) { + var method, url, data, + dataType = element.data('type') || ($.ajaxSettings && $.ajaxSettings.dataType); + + if (fire(element, 'ajax:before')) { + if (element.is('form')) { + method = element.attr('method'); + url = element.attr('action'); + data = element.serializeArray(); + // memoized value from clicked submit button + var button = element.data('ujs:submit-button'); + if (button) { + data.push(button); + element.data('ujs:submit-button', null); + } + } else { + method = element.data('method'); + url = element.attr('href'); + data = null; + } + $.ajax({ + url: url, type: method || 'GET', data: data, dataType: dataType, + // stopping the "ajax:beforeSend" event will cancel the ajax request + beforeSend: function(xhr, settings) { + if (settings.dataType === undefined) { + xhr.setRequestHeader('accept', '*/*;q=0.5, ' + settings.accepts.script); + } + return fire(element, 'ajax:beforeSend', [xhr, settings]); + }, + success: function(data, status, xhr) { + element.trigger('ajax:success', [data, status, xhr]); + }, + complete: function(xhr, status) { + element.trigger('ajax:complete', [xhr, status]); + }, + error: function(xhr, status, error) { + element.trigger('ajax:error', [xhr, status, error]); + } + }); + } + } + + // Handles "data-method" on links such as: + // Delete + function handleMethod(link) { + var href = link.attr('href'), + method = link.data('method'), + csrf_token = $('meta[name=csrf-token]').attr('content'), + csrf_param = $('meta[name=csrf-param]').attr('content'), + form = $(''), + metadata_input = ''; + + if (csrf_param !== undefined && csrf_token !== undefined) { + metadata_input += ''; + } + + form.hide().append(metadata_input).appendTo('body'); + form.submit(); + } + + function disableFormElements(form) { + form.find('input[data-disable-with]').each(function() { + var input = $(this); + input.data('ujs:enable-with', input.val()) + .val(input.data('disable-with')) + .attr('disabled', 'disabled'); + }); + } + + function enableFormElements(form) { + form.find('input[data-disable-with]').each(function() { + var input = $(this); + input.val(input.data('ujs:enable-with')).removeAttr('disabled'); + }); + } + + function allowAction(element) { + var message = element.data('confirm'); + return !message || (fire(element, 'confirm') && confirm(message)); + } + + function requiredValuesMissing(form) { + var missing = false; + form.find('input[name][required]').each(function() { + if (!$(this).val()) missing = true; + }); + return missing; + } + + $('a[data-confirm], a[data-method], a[data-remote]').live('click.rails', function(e) { + var link = $(this); + if (!allowAction(link)) return false; + + if (link.data('remote') != undefined) { + handleRemote(link); + return false; + } else if (link.data('method')) { + handleMethod(link); + return false; + } + }); + + $('form').live('submit.rails', function(e) { + var form = $(this), remote = form.data('remote') != undefined; + if (!allowAction(form)) return false; + + // skip other logic when required values are missing + if (requiredValuesMissing(form)) return !remote; + + if (remote) { + handleRemote(form); + return false; + } else { + // slight timeout so that the submit button gets properly serialized + setTimeout(function(){ disableFormElements(form) }, 13); + } + }); + + $('form input[type=submit], form button[type=submit], form button:not([type])').live('click.rails', function() { + var button = $(this); + if (!allowAction(button)) return false; + // register the pressed submit button + var name = button.attr('name'), data = name ? {name:name, value:button.val()} : null; + button.closest('form').data('ujs:submit-button', data); + }); + + $('form').live('ajax:beforeSend.rails', function(event) { + if (this == event.target) disableFormElements($(this)); + }); + + $('form').live('ajax:complete.rails', function(event) { + if (this == event.target) enableFormElements($(this)); + }); +})( jQuery ); diff --git a/public/assets/javascripts/core/tiny_mce/jquery.tinymce.js b/public/assets/javascripts/core/tiny_mce/jquery.tinymce.js new file mode 100644 index 0000000..8e61a3c --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/jquery.tinymce.js @@ -0,0 +1 @@ +(function(b){var e,d,a=[],c=window;b.fn.tinymce=function(j){var p=this,g,k,h,m,i,l="",n="";if(!p.length){return p}if(!j){return tinyMCE.get(p[0].id)}p.css("visibility","hidden");function o(){var r=[],q=0;if(f){f();f=null}p.each(function(t,u){var s,w=u.id,v=j.oninit;if(!w){u.id=w=tinymce.DOM.uniqueId()}s=new tinymce.Editor(w,j);r.push(s);s.onInit.add(function(){var x,y=v;p.css("visibility","");if(v){if(++q==r.length){if(tinymce.is(y,"string")){x=(y.indexOf(".")===-1)?null:tinymce.resolve(y.replace(/\.\w+$/,""));y=tinymce.resolve(y)}y.apply(x||tinymce,r)}}})});b.each(r,function(t,s){s.render()})}if(!c.tinymce&&!d&&(g=j.script_url)){d=1;h=g.substring(0,g.lastIndexOf("/"));if(/_(src|dev)\.js/g.test(g)){n="_src"}m=g.lastIndexOf("?");if(m!=-1){l=g.substring(m+1)}c.tinyMCEPreInit=c.tinyMCEPreInit||{base:h,suffix:n,query:l};if(g.indexOf("gzip")!=-1){i=j.language||"en";g=g+(/\?/.test(g)?"&":"?")+"js=true&core=true&suffix="+escape(n)+"&themes="+escape(j.theme)+"&plugins="+escape(j.plugins)+"&languages="+i;if(!c.tinyMCE_GZ){tinyMCE_GZ={start:function(){tinymce.suffix=n;function q(r){tinymce.ScriptLoader.markDone(tinyMCE.baseURI.toAbsolute(r))}q("langs/"+i+".js");q("themes/"+j.theme+"/editor_template"+n+".js");q("themes/"+j.theme+"/langs/"+i+".js");b.each(j.plugins.split(","),function(s,r){if(r){q("plugins/"+r+"/editor_plugin"+n+".js");q("plugins/"+r+"/langs/"+i+".js")}})},end:function(){}}}}b.ajax({type:"GET",url:g,dataType:"script",cache:true,success:function(){tinymce.dom.Event.domLoaded=1;d=2;if(j.script_loaded){j.script_loaded()}o();b.each(a,function(q,r){r()})}})}else{if(d===1){a.push(o)}else{o()}}return p};b.extend(b.expr[":"],{tinymce:function(g){return g.id&&!!tinyMCE.get(g.id)}});function f(){function i(l){if(l==="remove"){this.each(function(n,o){var m=h(o);if(m){m.remove()}})}this.find("span.mceEditor,div.mceEditor").each(function(n,o){var m=tinyMCE.get(o.id.replace(/_parent$/,""));if(m){m.remove()}})}function k(n){var m=this,l;if(n!==e){i.call(m);m.each(function(p,q){var o;if(o=tinyMCE.get(q.id)){o.setContent(n)}})}else{if(m.length>0){if(l=tinyMCE.get(m[0].id)){return l.getContent()}}}}function h(m){var l=null;(m)&&(m.id)&&(c.tinymce)&&(l=tinyMCE.get(m.id));return l}function g(l){return !!((l)&&(l.length)&&(c.tinymce)&&(l.is(":tinymce")))}var j={};b.each(["text","html","val"],function(n,l){var o=j[l]=b.fn[l],m=(l==="text");b.fn[l]=function(s){var p=this;if(!g(p)){return o.apply(p,arguments)}if(s!==e){k.call(p.filter(":tinymce"),s);o.apply(p.not(":tinymce"),arguments);return p}else{var r="";var q=arguments;(m?p:p.eq(0)).each(function(u,v){var t=h(v);r+=t?(m?t.getContent().replace(/<(?:"[^"]*"|'[^']*'|[^'">])*>/g,""):t.getContent()):o.apply(b(v),q)});return r}}});b.each(["append","prepend"],function(n,m){var o=j[m]=b.fn[m],l=(m==="prepend");b.fn[m]=function(q){var p=this;if(!g(p)){return o.apply(p,arguments)}if(q!==e){p.filter(":tinymce").each(function(s,t){var r=h(t);r&&r.setContent(l?q+r.getContent():r.getContent()+q)});o.apply(p.not(":tinymce"),arguments);return p}}});b.each(["remove","replaceWith","replaceAll","empty"],function(m,l){var n=j[l]=b.fn[l];b.fn[l]=function(){i.call(this,l);return n.apply(this,arguments)}});j.attr=b.fn.attr;b.fn.attr=function(n,q,o){var m=this;if((!n)||(n!=="value")||(!g(m))){return j.attr.call(m,n,q,o)}if(q!==e){k.call(m.filter(":tinymce"),q);j.attr.call(m.not(":tinymce"),n,q,o);return m}else{var p=m[0],l=h(p);return l?l.getContent():j.attr.call(b(p),n,q,o)}}}})(jQuery); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/langs/en.js b/public/assets/javascripts/core/tiny_mce/langs/en.js new file mode 100644 index 0000000..44a625e --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/langs/en.js @@ -0,0 +1,222 @@ +tinyMCE.addI18n({en:{ +common:{ +edit_confirm:"Do you want to use the WYSIWYG mode for this textarea?", +apply:"Apply", +insert:"Insert", +update:"Update", +cancel:"Cancel", +close:"Close", +browse:"Browse", +class_name:"Class", +not_set:"-- Not set --", +clipboard_msg:"Copy/Cut/Paste is not available in Mozilla and Firefox.\nDo you want more information about this issue?", +clipboard_no_support:"Currently not supported by your browser, use keyboard shortcuts instead.", +popup_blocked:"Sorry, but we have noticed that your popup-blocker has disabled a window that provides application functionality. You will need to disable popup blocking on this site in order to fully utilize this tool.", +invalid_data:"{#field} is invalid", +invalid_data_number:"{#field} must be a number", +invalid_data_min:"{#field} must be a number greater than {#min}", +invalid_data_size:"{#field} must be a number or percentage", +more_colors:"More colors" +}, +colors:{ +'000000':'Black', +'993300':'Burnt orange', +'333300':'Dark olive', +'003300':'Dark green', +'003366':'Dark azure', +'000080':'Navy Blue', +'333399':'Indigo', +'333333':'Very dark gray', +'800000':'Maroon', +'FF6600':'Orange', +'808000':'Olive', +'008000':'Green', +'008080':'Teal', +'0000FF':'Blue', +'666699':'Grayish blue', +'808080':'Gray', +'FF0000':'Red', +'FF9900':'Amber', +'99CC00':'Yellow green', +'339966':'Sea green', +'33CCCC':'Turquoise', +'3366FF':'Royal blue', +'800080':'Purple', +'999999':'Medium gray', +'FF00FF':'Magenta', +'FFCC00':'Gold', +'FFFF00':'Yellow', +'00FF00':'Lime', +'00FFFF':'Aqua', +'00CCFF':'Sky blue', +'993366':'Brown', +'C0C0C0':'Silver', +'FF99CC':'Pink', +'FFCC99':'Peach', +'FFFF99':'Light yellow', +'CCFFCC':'Pale green', +'CCFFFF':'Pale cyan', +'99CCFF':'Light sky blue', +'CC99FF':'Plum', +'FFFFFF':'White' +}, +contextmenu:{ +align:"Alignment", +left:"Left", +center:"Center", +right:"Right", +full:"Full" +}, +insertdatetime:{ +date_fmt:"%Y-%m-%d", +time_fmt:"%H:%M:%S", +insertdate_desc:"Insert date", +inserttime_desc:"Insert time", +months_long:"January,February,March,April,May,June,July,August,September,October,November,December", +months_short:"Jan,Feb,Mar,Apr,May,Jun,Jul,Aug,Sep,Oct,Nov,Dec", +day_long:"Sunday,Monday,Tuesday,Wednesday,Thursday,Friday,Saturday,Sunday", +day_short:"Sun,Mon,Tue,Wed,Thu,Fri,Sat,Sun" +}, +print:{ +print_desc:"Print" +}, +preview:{ +preview_desc:"Preview" +}, +directionality:{ +ltr_desc:"Direction left to right", +rtl_desc:"Direction right to left" +}, +layer:{ +insertlayer_desc:"Insert new layer", +forward_desc:"Move forward", +backward_desc:"Move backward", +absolute_desc:"Toggle absolute positioning", +content:"New layer..." +}, +save:{ +save_desc:"Save", +cancel_desc:"Cancel all changes" +}, +nonbreaking:{ +nonbreaking_desc:"Insert non-breaking space character" +}, +iespell:{ +iespell_desc:"Run spell checking", +download:"ieSpell not detected. Do you want to install it now?" +}, +advhr:{ +advhr_desc:"Horizontal rule" +}, +emotions:{ +emotions_desc:"Emotions" +}, +searchreplace:{ +search_desc:"Find", +replace_desc:"Find/Replace" +}, +advimage:{ +image_desc:"Insert/edit image" +}, +advlink:{ +link_desc:"Insert/edit link" +}, +xhtmlxtras:{ +cite_desc:"Citation", +abbr_desc:"Abbreviation", +acronym_desc:"Acronym", +del_desc:"Deletion", +ins_desc:"Insertion", +attribs_desc:"Insert/Edit Attributes" +}, +style:{ +desc:"Edit CSS Style" +}, +paste:{ +paste_text_desc:"Paste as Plain Text", +paste_word_desc:"Paste from Word", +selectall_desc:"Select All", +plaintext_mode_sticky:"Paste is now in plain text mode. Click again to toggle back to regular paste mode. After you paste something you will be returned to regular paste mode.", +plaintext_mode:"Paste is now in plain text mode. Click again to toggle back to regular paste mode." +}, +paste_dlg:{ +text_title:"Use CTRL+V on your keyboard to paste the text into the window.", +text_linebreaks:"Keep linebreaks", +word_title:"Use CTRL+V on your keyboard to paste the text into the window." +}, +table:{ +desc:"Inserts a new table", +row_before_desc:"Insert row before", +row_after_desc:"Insert row after", +delete_row_desc:"Delete row", +col_before_desc:"Insert column before", +col_after_desc:"Insert column after", +delete_col_desc:"Remove column", +split_cells_desc:"Split merged table cells", +merge_cells_desc:"Merge table cells", +row_desc:"Table row properties", +cell_desc:"Table cell properties", +props_desc:"Table properties", +paste_row_before_desc:"Paste table row before", +paste_row_after_desc:"Paste table row after", +cut_row_desc:"Cut table row", +copy_row_desc:"Copy table row", +del:"Delete table", +row:"Row", +col:"Column", +cell:"Cell" +}, +autosave:{ +unload_msg:"The changes you made will be lost if you navigate away from this page.", +restore_content:"Restore auto-saved content.", +warning_message:"If you restore the saved content, you will lose all the content that is currently in the editor.\n\nAre you sure you want to restore the saved content?." +}, +fullscreen:{ +desc:"Toggle fullscreen mode" +}, +media:{ +desc:"Insert / edit embedded media", +edit:"Edit embedded media" +}, +fullpage:{ +desc:"Document properties" +}, +template:{ +desc:"Insert predefined template content" +}, +visualchars:{ +desc:"Visual control characters on/off." +}, +spellchecker:{ +desc:"Toggle spellchecker", +menu:"Spellchecker settings", +ignore_word:"Ignore word", +ignore_words:"Ignore all", +langs:"Languages", +wait:"Please wait...", +sug:"Suggestions", +no_sug:"No suggestions", +no_mpell:"No misspellings found." +}, +pagebreak:{ +desc:"Insert page break." +}, +advlist:{ +types:"Types", +def:"Default", +lower_alpha:"Lower alpha", +lower_greek:"Lower greek", +lower_roman:"Lower roman", +upper_alpha:"Upper alpha", +upper_roman:"Upper roman", +circle:"Circle", +disc:"Disc", +square:"Square" +}, +aria:{ +rich_text_area:"Rich Text Area" +}, +wordcount:{ +words: 'Words: ' +} +}}); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/license.txt b/public/assets/javascripts/core/tiny_mce/license.txt new file mode 100644 index 0000000..60d6d4c --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/license.txt @@ -0,0 +1,504 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 2.1, February 1999 + + Copyright (C) 1991, 1999 Free Software Foundation, Inc. + 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + +[This is the first released version of the Lesser GPL. It also counts + as the successor of the GNU Library Public License, version 2, hence + the version number 2.1.] + + Preamble + + The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +Licenses are intended to guarantee your freedom to share and change +free software--to make sure the software is free for all its users. + + This license, the Lesser General Public License, applies to some +specially designated software packages--typically libraries--of the +Free Software Foundation and other authors who decide to use it. You +can use it too, but we suggest you first think carefully about whether +this license or the ordinary General Public License is the better +strategy to use in any particular case, based on the explanations below. + + When we speak of free software, we are referring to freedom of use, +not price. Our General Public Licenses are designed to make sure that +you have the freedom to distribute copies of free software (and charge +for this service if you wish); that you receive source code or can get +it if you want it; that you can change the software and use pieces of +it in new free programs; and that you are informed that you can do +these things. + + To protect your rights, we need to make restrictions that forbid +distributors to deny you these rights or to ask you to surrender these +rights. These restrictions translate to certain responsibilities for +you if you distribute copies of the library or if you modify it. + + For example, if you distribute copies of the library, whether gratis +or for a fee, you must give the recipients all the rights that we gave +you. You must make sure that they, too, receive or can get the source +code. If you link other code with the library, you must provide +complete object files to the recipients, so that they can relink them +with the library after making changes to the library and recompiling +it. And you must show them these terms so they know their rights. + + We protect your rights with a two-step method: (1) we copyright the +library, and (2) we offer you this license, which gives you legal +permission to copy, distribute and/or modify the library. + + To protect each distributor, we want to make it very clear that +there is no warranty for the free library. Also, if the library is +modified by someone else and passed on, the recipients should know +that what they have is not the original version, so that the original +author's reputation will not be affected by problems that might be +introduced by others. + + Finally, software patents pose a constant threat to the existence of +any free program. We wish to make sure that a company cannot +effectively restrict the users of a free program by obtaining a +restrictive license from a patent holder. Therefore, we insist that +any patent license obtained for a version of the library must be +consistent with the full freedom of use specified in this license. + + Most GNU software, including some libraries, is covered by the +ordinary GNU General Public License. This license, the GNU Lesser +General Public License, applies to certain designated libraries, and +is quite different from the ordinary General Public License. We use +this license for certain libraries in order to permit linking those +libraries into non-free programs. + + When a program is linked with a library, whether statically or using +a shared library, the combination of the two is legally speaking a +combined work, a derivative of the original library. The ordinary +General Public License therefore permits such linking only if the +entire combination fits its criteria of freedom. The Lesser General +Public License permits more lax criteria for linking other code with +the library. + + We call this license the "Lesser" General Public License because it +does Less to protect the user's freedom than the ordinary General +Public License. It also provides other free software developers Less +of an advantage over competing non-free programs. These disadvantages +are the reason we use the ordinary General Public License for many +libraries. However, the Lesser license provides advantages in certain +special circumstances. + + For example, on rare occasions, there may be a special need to +encourage the widest possible use of a certain library, so that it becomes +a de-facto standard. To achieve this, non-free programs must be +allowed to use the library. A more frequent case is that a free +library does the same job as widely used non-free libraries. In this +case, there is little to gain by limiting the free library to free +software only, so we use the Lesser General Public License. + + In other cases, permission to use a particular library in non-free +programs enables a greater number of people to use a large body of +free software. For example, permission to use the GNU C Library in +non-free programs enables many more people to use the whole GNU +operating system, as well as its variant, the GNU/Linux operating +system. + + Although the Lesser General Public License is Less protective of the +users' freedom, it does ensure that the user of a program that is +linked with the Library has the freedom and the wherewithal to run +that program using a modified version of the Library. + + The precise terms and conditions for copying, distribution and +modification follow. Pay close attention to the difference between a +"work based on the library" and a "work that uses the library". The +former contains code derived from the library, whereas the latter must +be combined with the library in order to run. + + GNU LESSER GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License Agreement applies to any software library or other +program which contains a notice placed by the copyright holder or +other authorized party saying it may be distributed under the terms of +this Lesser General Public License (also called "this License"). +Each licensee is addressed as "you". + + A "library" means a collection of software functions and/or data +prepared so as to be conveniently linked with application programs +(which use some of those functions and data) to form executables. + + The "Library", below, refers to any such software library or work +which has been distributed under these terms. A "work based on the +Library" means either the Library or any derivative work under +copyright law: that is to say, a work containing the Library or a +portion of it, either verbatim or with modifications and/or translated +straightforwardly into another language. (Hereinafter, translation is +included without limitation in the term "modification".) + + "Source code" for a work means the preferred form of the work for +making modifications to it. For a library, complete source code means +all the source code for all modules it contains, plus any associated +interface definition files, plus the scripts used to control compilation +and installation of the library. + + Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running a program using the Library is not restricted, and output from +such a program is covered only if its contents constitute a work based +on the Library (independent of the use of the Library in a tool for +writing it). Whether that is true depends on what the Library does +and what the program that uses the Library does. + + 1. You may copy and distribute verbatim copies of the Library's +complete source code as you receive it, in any medium, provided that +you conspicuously and appropriately publish on each copy an +appropriate copyright notice and disclaimer of warranty; keep intact +all the notices that refer to this License and to the absence of any +warranty; and distribute a copy of this License along with the +Library. + + You may charge a fee for the physical act of transferring a copy, +and you may at your option offer warranty protection in exchange for a +fee. + + 2. You may modify your copy or copies of the Library or any portion +of it, thus forming a work based on the Library, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: + + a) The modified work must itself be a software library. + + b) You must cause the files modified to carry prominent notices + stating that you changed the files and the date of any change. + + c) You must cause the whole of the work to be licensed at no + charge to all third parties under the terms of this License. + + d) If a facility in the modified Library refers to a function or a + table of data to be supplied by an application program that uses + the facility, other than as an argument passed when the facility + is invoked, then you must make a good faith effort to ensure that, + in the event an application does not supply such function or + table, the facility still operates, and performs whatever part of + its purpose remains meaningful. + + (For example, a function in a library to compute square roots has + a purpose that is entirely well-defined independent of the + application. Therefore, Subsection 2d requires that any + application-supplied function or table used by this function must + be optional: if the application does not supply it, the square + root function must still compute square roots.) + +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Library, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Library, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote +it. + +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Library. + +In addition, mere aggregation of another work not based on the Library +with the Library (or with a work based on the Library) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. + + 3. You may opt to apply the terms of the ordinary GNU General Public +License instead of this License to a given copy of the Library. To do +this, you must alter all the notices that refer to this License, so +that they refer to the ordinary GNU General Public License, version 2, +instead of to this License. (If a newer version than version 2 of the +ordinary GNU General Public License has appeared, then you can specify +that version instead if you wish.) Do not make any other change in +these notices. + + Once this change is made in a given copy, it is irreversible for +that copy, so the ordinary GNU General Public License applies to all +subsequent copies and derivative works made from that copy. + + This option is useful when you wish to copy part of the code of +the Library into a program that is not a library. + + 4. You may copy and distribute the Library (or a portion or +derivative of it, under Section 2) in object code or executable form +under the terms of Sections 1 and 2 above provided that you accompany +it with the complete corresponding machine-readable source code, which +must be distributed under the terms of Sections 1 and 2 above on a +medium customarily used for software interchange. + + If distribution of object code is made by offering access to copy +from a designated place, then offering equivalent access to copy the +source code from the same place satisfies the requirement to +distribute the source code, even though third parties are not +compelled to copy the source along with the object code. + + 5. A program that contains no derivative of any portion of the +Library, but is designed to work with the Library by being compiled or +linked with it, is called a "work that uses the Library". Such a +work, in isolation, is not a derivative work of the Library, and +therefore falls outside the scope of this License. + + However, linking a "work that uses the Library" with the Library +creates an executable that is a derivative of the Library (because it +contains portions of the Library), rather than a "work that uses the +library". The executable is therefore covered by this License. +Section 6 states terms for distribution of such executables. + + When a "work that uses the Library" uses material from a header file +that is part of the Library, the object code for the work may be a +derivative work of the Library even though the source code is not. +Whether this is true is especially significant if the work can be +linked without the Library, or if the work is itself a library. The +threshold for this to be true is not precisely defined by law. + + If such an object file uses only numerical parameters, data +structure layouts and accessors, and small macros and small inline +functions (ten lines or less in length), then the use of the object +file is unrestricted, regardless of whether it is legally a derivative +work. (Executables containing this object code plus portions of the +Library will still fall under Section 6.) + + Otherwise, if the work is a derivative of the Library, you may +distribute the object code for the work under the terms of Section 6. +Any executables containing that work also fall under Section 6, +whether or not they are linked directly with the Library itself. + + 6. As an exception to the Sections above, you may also combine or +link a "work that uses the Library" with the Library to produce a +work containing portions of the Library, and distribute that work +under terms of your choice, provided that the terms permit +modification of the work for the customer's own use and reverse +engineering for debugging such modifications. + + You must give prominent notice with each copy of the work that the +Library is used in it and that the Library and its use are covered by +this License. You must supply a copy of this License. If the work +during execution displays copyright notices, you must include the +copyright notice for the Library among them, as well as a reference +directing the user to the copy of this License. Also, you must do one +of these things: + + a) Accompany the work with the complete corresponding + machine-readable source code for the Library including whatever + changes were used in the work (which must be distributed under + Sections 1 and 2 above); and, if the work is an executable linked + with the Library, with the complete machine-readable "work that + uses the Library", as object code and/or source code, so that the + user can modify the Library and then relink to produce a modified + executable containing the modified Library. (It is understood + that the user who changes the contents of definitions files in the + Library will not necessarily be able to recompile the application + to use the modified definitions.) + + b) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (1) uses at run time a + copy of the library already present on the user's computer system, + rather than copying library functions into the executable, and (2) + will operate properly with a modified version of the library, if + the user installs one, as long as the modified version is + interface-compatible with the version that the work was made with. + + c) Accompany the work with a written offer, valid for at + least three years, to give the same user the materials + specified in Subsection 6a, above, for a charge no more + than the cost of performing this distribution. + + d) If distribution of the work is made by offering access to copy + from a designated place, offer equivalent access to copy the above + specified materials from the same place. + + e) Verify that the user has already received a copy of these + materials or that you have already sent this user a copy. + + For an executable, the required form of the "work that uses the +Library" must include any data and utility programs needed for +reproducing the executable from it. However, as a special exception, +the materials to be distributed need not include anything that is +normally distributed (in either source or binary form) with the major +components (compiler, kernel, and so on) of the operating system on +which the executable runs, unless that component itself accompanies +the executable. + + It may happen that this requirement contradicts the license +restrictions of other proprietary libraries that do not normally +accompany the operating system. Such a contradiction means you cannot +use both them and the Library together in an executable that you +distribute. + + 7. You may place library facilities that are a work based on the +Library side-by-side in a single library together with other library +facilities not covered by this License, and distribute such a combined +library, provided that the separate distribution of the work based on +the Library and of the other library facilities is otherwise +permitted, and provided that you do these two things: + + a) Accompany the combined library with a copy of the same work + based on the Library, uncombined with any other library + facilities. This must be distributed under the terms of the + Sections above. + + b) Give prominent notice with the combined library of the fact + that part of it is a work based on the Library, and explaining + where to find the accompanying uncombined form of the same work. + + 8. You may not copy, modify, sublicense, link with, or distribute +the Library except as expressly provided under this License. Any +attempt otherwise to copy, modify, sublicense, link with, or +distribute the Library is void, and will automatically terminate your +rights under this License. However, parties who have received copies, +or rights, from you under this License will not have their licenses +terminated so long as such parties remain in full compliance. + + 9. You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Library or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Library (or any work based on the +Library), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Library or works based on it. + + 10. Each time you redistribute the Library (or any work based on the +Library), the recipient automatically receives a license from the +original licensor to copy, distribute, link with or modify the Library +subject to these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties with +this License. + + 11. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Library at all. For example, if a patent +license would not permit royalty-free redistribution of the Library by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Library. + +If any portion of this section is held invalid or unenforceable under any +particular circumstance, the balance of the section is intended to apply, +and the section as a whole is intended to apply in other circumstances. + +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. + +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. + + 12. If the distribution and/or use of the Library is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Library under this License may add +an explicit geographical distribution limitation excluding those countries, +so that distribution is permitted only in or among countries not thus +excluded. In such case, this License incorporates the limitation as if +written in the body of this License. + + 13. The Free Software Foundation may publish revised and/or new +versions of the Lesser General Public License from time to time. +Such new versions will be similar in spirit to the present version, +but may differ in detail to address new problems or concerns. + +Each version is given a distinguishing version number. If the Library +specifies a version number of this License which applies to it and +"any later version", you have the option of following the terms and +conditions either of that version or of any later version published by +the Free Software Foundation. If the Library does not specify a +license version number, you may choose any version ever published by +the Free Software Foundation. + + 14. If you wish to incorporate parts of the Library into other free +programs whose distribution conditions are incompatible with these, +write to the author to ask for permission. For software which is +copyrighted by the Free Software Foundation, write to the Free +Software Foundation; we sometimes make exceptions for this. Our +decision will be guided by the two goals of preserving the free status +of all derivatives of our free software and of promoting the sharing +and reuse of software generally. + + NO WARRANTY + + 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO +WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW. +EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR +OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY +KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE +LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME +THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN +WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY +AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU +FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR +CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE +LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING +RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A +FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF +SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH +DAMAGES. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Libraries + + If you develop a new library, and you want it to be of the greatest +possible use to the public, we recommend making it free software that +everyone can redistribute and change. You can do so by permitting +redistribution under these terms (or, alternatively, under the terms of the +ordinary General Public License). + + To apply these terms, attach the following notices to the library. It is +safest to attach them to the start of each source file to most effectively +convey the exclusion of warranty; and each file should have at least the +"copyright" line and a pointer to where the full notice is found. + + + Copyright (C) + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + +Also add information on how to contact you by electronic and paper mail. + +You should also get your employer (if you work as a programmer) or your +school, if any, to sign a "copyright disclaimer" for the library, if +necessary. Here is a sample; alter the names: + + Yoyodyne, Inc., hereby disclaims all copyright interest in the + library `Frob' (a library for tweaking knobs) written by James Random Hacker. + + , 1 April 1990 + Ty Coon, President of Vice + +That's all there is to it! + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advhr/css/advhr.css b/public/assets/javascripts/core/tiny_mce/plugins/advhr/css/advhr.css new file mode 100644 index 0000000..0e22834 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advhr/css/advhr.css @@ -0,0 +1,5 @@ +input.radio {border:1px none #000; background:transparent; vertical-align:middle;} +.panel_wrapper div.current {height:80px;} +#width {width:50px; vertical-align:middle;} +#width2 {width:50px; vertical-align:middle;} +#size {width:100px;} diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin.js new file mode 100644 index 0000000..4d3b062 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedHRPlugin",{init:function(a,b){a.addCommand("mceAdvancedHr",function(){a.windowManager.open({file:b+"/rule.htm",width:250+parseInt(a.getLang("advhr.delta_width",0)),height:160+parseInt(a.getLang("advhr.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("advhr",{title:"advhr.advhr_desc",cmd:"mceAdvancedHr"});a.onNodeChange.add(function(d,c,e){c.setActive("advhr",e.nodeName=="HR")});a.onClick.add(function(c,d){d=d.target;if(d.nodeName==="HR"){c.selection.select(d)}})},getInfo:function(){return{longname:"Advanced HR",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advhr",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advhr",tinymce.plugins.AdvancedHRPlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin_src.js new file mode 100644 index 0000000..0c652d3 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advhr/editor_plugin_src.js @@ -0,0 +1,57 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedHRPlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceAdvancedHr', function() { + ed.windowManager.open({ + file : url + '/rule.htm', + width : 250 + parseInt(ed.getLang('advhr.delta_width', 0)), + height : 160 + parseInt(ed.getLang('advhr.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('advhr', { + title : 'advhr.advhr_desc', + cmd : 'mceAdvancedHr' + }); + + ed.onNodeChange.add(function(ed, cm, n) { + cm.setActive('advhr', n.nodeName == 'HR'); + }); + + ed.onClick.add(function(ed, e) { + e = e.target; + + if (e.nodeName === 'HR') + ed.selection.select(e); + }); + }, + + getInfo : function() { + return { + longname : 'Advanced HR', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advhr', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advhr', tinymce.plugins.AdvancedHRPlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advhr/js/rule.js b/public/assets/javascripts/core/tiny_mce/plugins/advhr/js/rule.js new file mode 100644 index 0000000..b6cbd66 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advhr/js/rule.js @@ -0,0 +1,43 @@ +var AdvHRDialog = { + init : function(ed) { + var dom = ed.dom, f = document.forms[0], n = ed.selection.getNode(), w; + + w = dom.getAttrib(n, 'width'); + f.width.value = w ? parseInt(w) : (dom.getStyle('width') || ''); + f.size.value = dom.getAttrib(n, 'size') || parseInt(dom.getStyle('height')) || ''; + f.noshade.checked = !!dom.getAttrib(n, 'noshade') || !!dom.getStyle('border-width'); + selectByValue(f, 'width2', w.indexOf('%') != -1 ? '%' : 'px'); + }, + + update : function() { + var ed = tinyMCEPopup.editor, h, f = document.forms[0], st = ''; + + h = ' + + + {#advhr.advhr_desc} + + + + + + + +
    + + +
    +
    + + + + + + + + + + + + + +
    + + + +
    +
    +
    + +
    + + +
    +
    + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/css/advimage.css b/public/assets/javascripts/core/tiny_mce/plugins/advimage/css/advimage.css new file mode 100644 index 0000000..0a6251a --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/css/advimage.css @@ -0,0 +1,13 @@ +#src_list, #over_list, #out_list {width:280px;} +.mceActionPanel {margin-top:7px;} +.alignPreview {border:1px solid #000; width:140px; height:140px; overflow:hidden; padding:5px;} +.checkbox {border:0;} +.panel_wrapper div.current {height:305px;} +#prev {margin:0; border:1px solid #000; width:428px; height:150px; overflow:auto;} +#align, #classlist {width:150px;} +#width, #height {vertical-align:middle; width:50px; text-align:center;} +#vspace, #hspace, #border {vertical-align:middle; width:30px; text-align:center;} +#class_list {width:180px;} +input {width: 280px;} +#constrain, #onmousemovecheck {width:auto;} +#id, #dir, #lang, #usemap, #longdesc {width:200px;} diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin.js new file mode 100644 index 0000000..4c7a9c3 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedImagePlugin",{init:function(a,b){a.addCommand("mceAdvImage",function(){if(a.dom.getAttrib(a.selection.getNode(),"class").indexOf("mceItem")!=-1){return}a.windowManager.open({file:b+"/image.htm",width:480+parseInt(a.getLang("advimage.delta_width",0)),height:385+parseInt(a.getLang("advimage.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("image",{title:"advimage.image_desc",cmd:"mceAdvImage"})},getInfo:function(){return{longname:"Advanced image",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advimage",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advimage",tinymce.plugins.AdvancedImagePlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin_src.js new file mode 100644 index 0000000..2625dd2 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/editor_plugin_src.js @@ -0,0 +1,50 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedImagePlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceAdvImage', function() { + // Internal image object like a flash placeholder + if (ed.dom.getAttrib(ed.selection.getNode(), 'class').indexOf('mceItem') != -1) + return; + + ed.windowManager.open({ + file : url + '/image.htm', + width : 480 + parseInt(ed.getLang('advimage.delta_width', 0)), + height : 385 + parseInt(ed.getLang('advimage.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('image', { + title : 'advimage.image_desc', + cmd : 'mceAdvImage' + }); + }, + + getInfo : function() { + return { + longname : 'Advanced image', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advimage', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advimage', tinymce.plugins.AdvancedImagePlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/image.htm b/public/assets/javascripts/core/tiny_mce/plugins/advimage/image.htm new file mode 100644 index 0000000..ed16b3d --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/image.htm @@ -0,0 +1,235 @@ + + + + {#advimage_dlg.dialog_title} + + + + + + + + + + +
    + + +
    +
    +
    + {#advimage_dlg.general} + + + + + + + + + + + + + + + + + + + +
    + +
    + {#advimage_dlg.preview} + +
    +
    + +
    +
    + {#advimage_dlg.tab_appearance} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + +
    + {#advimage_dlg.example_img} + Lorem ipsum, Dolor sit amet, consectetuer adipiscing loreum ipsum edipiscing elit, sed diam + nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam erat volutpat.Loreum ipsum + edipiscing elit, sed diam nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam + erat volutpat. +
    +
    + + x + + px +
      + + + + +
    +
    +
    +
    + +
    +
    + {#advimage_dlg.swap_image} + + + + + + + + + + + + + + + + + + + + + +
    + + + + +
     
    + + + + +
     
    +
    + +
    + {#advimage_dlg.misc} + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + +
    + +
    + +
    + + + + +
     
    +
    +
    +
    + +
    + + +
    +
    + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/img/sample.gif b/public/assets/javascripts/core/tiny_mce/plugins/advimage/img/sample.gif new file mode 100644 index 0000000..53bf689 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/advimage/img/sample.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/js/image.js b/public/assets/javascripts/core/tiny_mce/plugins/advimage/js/image.js new file mode 100644 index 0000000..d1bca64 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/js/image.js @@ -0,0 +1,445 @@ +var ImageDialog = { + preInit : function() { + var url; + + tinyMCEPopup.requireLangPack(); + + if (url = tinyMCEPopup.getParam("external_image_list_url")) + document.write(''); + }, + + init : function(ed) { + var f = document.forms[0], nl = f.elements, ed = tinyMCEPopup.editor, dom = ed.dom, n = ed.selection.getNode(); + + tinyMCEPopup.resizeToInnerSize(); + this.fillClassList('class_list'); + this.fillFileList('src_list', 'tinyMCEImageList'); + this.fillFileList('over_list', 'tinyMCEImageList'); + this.fillFileList('out_list', 'tinyMCEImageList'); + TinyMCE_EditableSelects.init(); + + if (n.nodeName == 'IMG') { + nl.src.value = dom.getAttrib(n, 'src'); + nl.width.value = dom.getAttrib(n, 'width'); + nl.height.value = dom.getAttrib(n, 'height'); + nl.alt.value = dom.getAttrib(n, 'alt'); + nl.title.value = dom.getAttrib(n, 'title'); + nl.vspace.value = this.getAttrib(n, 'vspace'); + nl.hspace.value = this.getAttrib(n, 'hspace'); + nl.border.value = this.getAttrib(n, 'border'); + selectByValue(f, 'align', this.getAttrib(n, 'align')); + selectByValue(f, 'class_list', dom.getAttrib(n, 'class'), true, true); + nl.style.value = dom.getAttrib(n, 'style'); + nl.id.value = dom.getAttrib(n, 'id'); + nl.dir.value = dom.getAttrib(n, 'dir'); + nl.lang.value = dom.getAttrib(n, 'lang'); + nl.usemap.value = dom.getAttrib(n, 'usemap'); + nl.longdesc.value = dom.getAttrib(n, 'longdesc'); + nl.insert.value = ed.getLang('update'); + + if (/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/.test(dom.getAttrib(n, 'onmouseover'))) + nl.onmouseoversrc.value = dom.getAttrib(n, 'onmouseover').replace(/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/, '$1'); + + if (/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/.test(dom.getAttrib(n, 'onmouseout'))) + nl.onmouseoutsrc.value = dom.getAttrib(n, 'onmouseout').replace(/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/, '$1'); + + if (ed.settings.inline_styles) { + // Move attribs to styles + if (dom.getAttrib(n, 'align')) + this.updateStyle('align'); + + if (dom.getAttrib(n, 'hspace')) + this.updateStyle('hspace'); + + if (dom.getAttrib(n, 'border')) + this.updateStyle('border'); + + if (dom.getAttrib(n, 'vspace')) + this.updateStyle('vspace'); + } + } + + // Setup browse button + document.getElementById('srcbrowsercontainer').innerHTML = getBrowserHTML('srcbrowser','src','image','theme_advanced_image'); + if (isVisible('srcbrowser')) + document.getElementById('src').style.width = '260px'; + + // Setup browse button + document.getElementById('onmouseoversrccontainer').innerHTML = getBrowserHTML('overbrowser','onmouseoversrc','image','theme_advanced_image'); + if (isVisible('overbrowser')) + document.getElementById('onmouseoversrc').style.width = '260px'; + + // Setup browse button + document.getElementById('onmouseoutsrccontainer').innerHTML = getBrowserHTML('outbrowser','onmouseoutsrc','image','theme_advanced_image'); + if (isVisible('outbrowser')) + document.getElementById('onmouseoutsrc').style.width = '260px'; + + // If option enabled default contrain proportions to checked + if (ed.getParam("advimage_constrain_proportions", true)) + f.constrain.checked = true; + + // Check swap image if valid data + if (nl.onmouseoversrc.value || nl.onmouseoutsrc.value) + this.setSwapImage(true); + else + this.setSwapImage(false); + + this.changeAppearance(); + this.showPreviewImage(nl.src.value, 1); + }, + + insert : function(file, title) { + var ed = tinyMCEPopup.editor, t = this, f = document.forms[0]; + + if (f.src.value === '') { + if (ed.selection.getNode().nodeName == 'IMG') { + ed.dom.remove(ed.selection.getNode()); + ed.execCommand('mceRepaint'); + } + + tinyMCEPopup.close(); + return; + } + + if (tinyMCEPopup.getParam("accessibility_warnings", 1)) { + if (!f.alt.value) { + tinyMCEPopup.confirm(tinyMCEPopup.getLang('advimage_dlg.missing_alt'), function(s) { + if (s) + t.insertAndClose(); + }); + + return; + } + } + + t.insertAndClose(); + }, + + insertAndClose : function() { + var ed = tinyMCEPopup.editor, f = document.forms[0], nl = f.elements, v, args = {}, el; + + tinyMCEPopup.restoreSelection(); + + // Fixes crash in Safari + if (tinymce.isWebKit) + ed.getWin().focus(); + + if (!ed.settings.inline_styles) { + args = { + vspace : nl.vspace.value, + hspace : nl.hspace.value, + border : nl.border.value, + align : getSelectValue(f, 'align') + }; + } else { + // Remove deprecated values + args = { + vspace : '', + hspace : '', + border : '', + align : '' + }; + } + + tinymce.extend(args, { + src : nl.src.value.replace(/ /g, '%20'), + width : nl.width.value, + height : nl.height.value, + alt : nl.alt.value, + title : nl.title.value, + 'class' : getSelectValue(f, 'class_list'), + style : nl.style.value, + id : nl.id.value, + dir : nl.dir.value, + lang : nl.lang.value, + usemap : nl.usemap.value, + longdesc : nl.longdesc.value + }); + + args.onmouseover = args.onmouseout = ''; + + if (f.onmousemovecheck.checked) { + if (nl.onmouseoversrc.value) + args.onmouseover = "this.src='" + nl.onmouseoversrc.value + "';"; + + if (nl.onmouseoutsrc.value) + args.onmouseout = "this.src='" + nl.onmouseoutsrc.value + "';"; + } + + el = ed.selection.getNode(); + + if (el && el.nodeName == 'IMG') { + ed.dom.setAttribs(el, args); + } else { + ed.execCommand('mceInsertContent', false, '', {skip_undo : 1}); + ed.dom.setAttribs('__mce_tmp', args); + ed.dom.setAttrib('__mce_tmp', 'id', ''); + ed.undoManager.add(); + } + + tinyMCEPopup.editor.execCommand('mceRepaint'); + tinyMCEPopup.editor.focus(); + tinyMCEPopup.close(); + }, + + getAttrib : function(e, at) { + var ed = tinyMCEPopup.editor, dom = ed.dom, v, v2; + + if (ed.settings.inline_styles) { + switch (at) { + case 'align': + if (v = dom.getStyle(e, 'float')) + return v; + + if (v = dom.getStyle(e, 'vertical-align')) + return v; + + break; + + case 'hspace': + v = dom.getStyle(e, 'margin-left') + v2 = dom.getStyle(e, 'margin-right'); + + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'vspace': + v = dom.getStyle(e, 'margin-top') + v2 = dom.getStyle(e, 'margin-bottom'); + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'border': + v = 0; + + tinymce.each(['top', 'right', 'bottom', 'left'], function(sv) { + sv = dom.getStyle(e, 'border-' + sv + '-width'); + + // False or not the same as prev + if (!sv || (sv != v && v !== 0)) { + v = 0; + return false; + } + + if (sv) + v = sv; + }); + + if (v) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + } + } + + if (v = dom.getAttrib(e, at)) + return v; + + return ''; + }, + + setSwapImage : function(st) { + var f = document.forms[0]; + + f.onmousemovecheck.checked = st; + setBrowserDisabled('overbrowser', !st); + setBrowserDisabled('outbrowser', !st); + + if (f.over_list) + f.over_list.disabled = !st; + + if (f.out_list) + f.out_list.disabled = !st; + + f.onmouseoversrc.disabled = !st; + f.onmouseoutsrc.disabled = !st; + }, + + fillClassList : function(id) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + if (v = tinyMCEPopup.getParam('theme_advanced_styles')) { + cl = []; + + tinymce.each(v.split(';'), function(v) { + var p = v.split('='); + + cl.push({'title' : p[0], 'class' : p[1]}); + }); + } else + cl = tinyMCEPopup.editor.dom.getClasses(); + + if (cl.length > 0) { + lst.options.length = 0; + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('not_set'), ''); + + tinymce.each(cl, function(o) { + lst.options[lst.options.length] = new Option(o.title || o['class'], o['class']); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + fillFileList : function(id, l) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + l = window[l]; + lst.options.length = 0; + + if (l && l.length > 0) { + lst.options[lst.options.length] = new Option('', ''); + + tinymce.each(l, function(o) { + lst.options[lst.options.length] = new Option(o[0], o[1]); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + resetImageData : function() { + var f = document.forms[0]; + + f.elements.width.value = f.elements.height.value = ''; + }, + + updateImageData : function(img, st) { + var f = document.forms[0]; + + if (!st) { + f.elements.width.value = img.width; + f.elements.height.value = img.height; + } + + this.preloadImg = img; + }, + + changeAppearance : function() { + var ed = tinyMCEPopup.editor, f = document.forms[0], img = document.getElementById('alignSampleImg'); + + if (img) { + if (ed.getParam('inline_styles')) { + ed.dom.setAttrib(img, 'style', f.style.value); + } else { + img.align = f.align.value; + img.border = f.border.value; + img.hspace = f.hspace.value; + img.vspace = f.vspace.value; + } + } + }, + + changeHeight : function() { + var f = document.forms[0], tp, t = this; + + if (!f.constrain.checked || !t.preloadImg) { + return; + } + + if (f.width.value == "" || f.height.value == "") + return; + + tp = (parseInt(f.width.value) / parseInt(t.preloadImg.width)) * t.preloadImg.height; + f.height.value = tp.toFixed(0); + }, + + changeWidth : function() { + var f = document.forms[0], tp, t = this; + + if (!f.constrain.checked || !t.preloadImg) { + return; + } + + if (f.width.value == "" || f.height.value == "") + return; + + tp = (parseInt(f.height.value) / parseInt(t.preloadImg.height)) * t.preloadImg.width; + f.width.value = tp.toFixed(0); + }, + + updateStyle : function(ty) { + var dom = tinyMCEPopup.dom, st, v, f = document.forms[0], img = dom.create('img', {style : dom.get('style').value}); + + if (tinyMCEPopup.editor.settings.inline_styles) { + // Handle align + if (ty == 'align') { + dom.setStyle(img, 'float', ''); + dom.setStyle(img, 'vertical-align', ''); + + v = getSelectValue(f, 'align'); + if (v) { + if (v == 'left' || v == 'right') + dom.setStyle(img, 'float', v); + else + img.style.verticalAlign = v; + } + } + + // Handle border + if (ty == 'border') { + dom.setStyle(img, 'border', ''); + + v = f.border.value; + if (v || v == '0') { + if (v == '0') + img.style.border = '0 none none'; + else + img.style.border = v + 'px solid black'; + } + } + + // Handle hspace + if (ty == 'hspace') { + dom.setStyle(img, 'marginLeft', ''); + dom.setStyle(img, 'marginRight', ''); + + v = f.hspace.value; + if (v) { + img.style.marginLeft = v + 'px'; + img.style.marginRight = v + 'px'; + } + } + + // Handle vspace + if (ty == 'vspace') { + dom.setStyle(img, 'marginTop', ''); + dom.setStyle(img, 'marginBottom', ''); + + v = f.vspace.value; + if (v) { + img.style.marginTop = v + 'px'; + img.style.marginBottom = v + 'px'; + } + } + + // Merge + dom.get('style').value = dom.serializeStyle(dom.parseStyle(img.style.cssText), 'img'); + } + }, + + changeMouseMove : function() { + }, + + showPreviewImage : function(u, st) { + if (!u) { + tinyMCEPopup.dom.setHTML('prev', ''); + return; + } + + if (!st && tinyMCEPopup.getParam("advimage_update_dimensions_onchange", true)) + this.resetImageData(); + + u = tinyMCEPopup.editor.documentBaseURI.toAbsolute(u); + + if (!st) + tinyMCEPopup.dom.setHTML('prev', ''); + else + tinyMCEPopup.dom.setHTML('prev', ''); + } +}; + +ImageDialog.preInit(); +tinyMCEPopup.onInit.add(ImageDialog.init, ImageDialog); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advimage/langs/en_dlg.js b/public/assets/javascripts/core/tiny_mce/plugins/advimage/langs/en_dlg.js new file mode 100644 index 0000000..d8f11e0 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advimage/langs/en_dlg.js @@ -0,0 +1,45 @@ +tinyMCE.addI18n('en.advimage_dlg',{ +tab_general:"General", +tab_appearance:"Appearance", +tab_advanced:"Advanced", +general:"General", +title:"Title", +preview:"Preview", +constrain_proportions:"Constrain proportions", +langdir:"Language direction", +langcode:"Language code", +long_desc:"Long description link", +style:"Style", +classes:"Classes", +ltr:"Left to right", +rtl:"Right to left", +id:"Id", +map:"Image map", +swap_image:"Swap image", +alt_image:"Alternative image", +mouseover:"for mouse over", +mouseout:"for mouse out", +misc:"Miscellaneous", +example_img:"Appearance preview image", +missing_alt:"Are you sure you want to continue without including an Image Description? Without it the image may not be accessible to some users with disabilities, or to those using a text browser, or browsing the Web with images turned off.", +dialog_title:"Insert/edit image", +src:"Image URL", +alt:"Image description", +list:"Image list", +border:"Border", +dimensions:"Dimensions", +width:"Width", +height:"Height", +vspace:"Vertical space", +hspace:"Horizontal space", +align:"Alignment", +align_baseline:"Baseline", +align_top:"Top", +align_middle:"Middle", +align_bottom:"Bottom", +align_texttop:"Text top", +align_textbottom:"Text bottom", +align_left:"Left", +align_right:"Right", +image_list:"Image list" +}); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/css/advlink.css b/public/assets/javascripts/core/tiny_mce/plugins/advlink/css/advlink.css new file mode 100644 index 0000000..1436431 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/css/advlink.css @@ -0,0 +1,8 @@ +.mceLinkList, .mceAnchorList, #targetlist {width:280px;} +.mceActionPanel {margin-top:7px;} +.panel_wrapper div.current {height:320px;} +#classlist, #title, #href {width:280px;} +#popupurl, #popupname {width:200px;} +#popupwidth, #popupheight, #popupleft, #popuptop {width:30px;vertical-align:middle;text-align:center;} +#id, #style, #classes, #target, #dir, #hreflang, #lang, #charset, #type, #rel, #rev, #tabindex, #accesskey {width:200px;} +#events_panel input {width:200px;} diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin.js new file mode 100644 index 0000000..983fe5a --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedLinkPlugin",{init:function(a,b){this.editor=a;a.addCommand("mceAdvLink",function(){var c=a.selection;if(c.isCollapsed()&&!a.dom.getParent(c.getNode(),"A")){return}a.windowManager.open({file:b+"/link.htm",width:480+parseInt(a.getLang("advlink.delta_width",0)),height:400+parseInt(a.getLang("advlink.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("link",{title:"advlink.link_desc",cmd:"mceAdvLink"});a.addShortcut("ctrl+k","advlink.advlink_desc","mceAdvLink");a.onNodeChange.add(function(d,c,f,e){c.setDisabled("link",e&&f.nodeName!="A");c.setActive("link",f.nodeName=="A"&&!f.name)})},getInfo:function(){return{longname:"Advanced link",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlink",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advlink",tinymce.plugins.AdvancedLinkPlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin_src.js new file mode 100644 index 0000000..14e46a7 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/editor_plugin_src.js @@ -0,0 +1,61 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedLinkPlugin', { + init : function(ed, url) { + this.editor = ed; + + // Register commands + ed.addCommand('mceAdvLink', function() { + var se = ed.selection; + + // No selection and not in link + if (se.isCollapsed() && !ed.dom.getParent(se.getNode(), 'A')) + return; + + ed.windowManager.open({ + file : url + '/link.htm', + width : 480 + parseInt(ed.getLang('advlink.delta_width', 0)), + height : 400 + parseInt(ed.getLang('advlink.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('link', { + title : 'advlink.link_desc', + cmd : 'mceAdvLink' + }); + + ed.addShortcut('ctrl+k', 'advlink.advlink_desc', 'mceAdvLink'); + + ed.onNodeChange.add(function(ed, cm, n, co) { + cm.setDisabled('link', co && n.nodeName != 'A'); + cm.setActive('link', n.nodeName == 'A' && !n.name); + }); + }, + + getInfo : function() { + return { + longname : 'Advanced link', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlink', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advlink', tinymce.plugins.AdvancedLinkPlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/js/advlink.js b/public/assets/javascripts/core/tiny_mce/plugins/advlink/js/advlink.js new file mode 100644 index 0000000..5fd6d91 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/js/advlink.js @@ -0,0 +1,523 @@ +/* Functions for the advlink plugin popup */ + +tinyMCEPopup.requireLangPack(); + +var templates = { + "window.open" : "window.open('${url}','${target}','${options}')" +}; + +function preinit() { + var url; + + if (url = tinyMCEPopup.getParam("external_link_list_url")) + document.write(''); +} + +function changeClass() { + var f = document.forms[0]; + + f.classes.value = getSelectValue(f, 'classlist'); +} + +function init() { + tinyMCEPopup.resizeToInnerSize(); + + var formObj = document.forms[0]; + var inst = tinyMCEPopup.editor; + var elm = inst.selection.getNode(); + var action = "insert"; + var html; + + document.getElementById('hrefbrowsercontainer').innerHTML = getBrowserHTML('hrefbrowser','href','file','advlink'); + document.getElementById('popupurlbrowsercontainer').innerHTML = getBrowserHTML('popupurlbrowser','popupurl','file','advlink'); + document.getElementById('linklisthrefcontainer').innerHTML = getLinkListHTML('linklisthref','href'); + document.getElementById('anchorlistcontainer').innerHTML = getAnchorListHTML('anchorlist','href'); + document.getElementById('targetlistcontainer').innerHTML = getTargetListHTML('targetlist','target'); + + // Link list + html = getLinkListHTML('linklisthref','href'); + if (html == "") + document.getElementById("linklisthrefrow").style.display = 'none'; + else + document.getElementById("linklisthrefcontainer").innerHTML = html; + + // Resize some elements + if (isVisible('hrefbrowser')) + document.getElementById('href').style.width = '260px'; + + if (isVisible('popupurlbrowser')) + document.getElementById('popupurl').style.width = '180px'; + + elm = inst.dom.getParent(elm, "A"); + if (elm != null && elm.nodeName == "A") + action = "update"; + + formObj.insert.value = tinyMCEPopup.getLang(action, 'Insert', true); + + setPopupControlsDisabled(true); + + if (action == "update") { + var href = inst.dom.getAttrib(elm, 'href'); + var onclick = inst.dom.getAttrib(elm, 'onclick'); + + // Setup form data + setFormValue('href', href); + setFormValue('title', inst.dom.getAttrib(elm, 'title')); + setFormValue('id', inst.dom.getAttrib(elm, 'id')); + setFormValue('style', inst.dom.getAttrib(elm, "style")); + setFormValue('rel', inst.dom.getAttrib(elm, 'rel')); + setFormValue('rev', inst.dom.getAttrib(elm, 'rev')); + setFormValue('charset', inst.dom.getAttrib(elm, 'charset')); + setFormValue('hreflang', inst.dom.getAttrib(elm, 'hreflang')); + setFormValue('dir', inst.dom.getAttrib(elm, 'dir')); + setFormValue('lang', inst.dom.getAttrib(elm, 'lang')); + setFormValue('tabindex', inst.dom.getAttrib(elm, 'tabindex', typeof(elm.tabindex) != "undefined" ? elm.tabindex : "")); + setFormValue('accesskey', inst.dom.getAttrib(elm, 'accesskey', typeof(elm.accesskey) != "undefined" ? elm.accesskey : "")); + setFormValue('type', inst.dom.getAttrib(elm, 'type')); + setFormValue('onfocus', inst.dom.getAttrib(elm, 'onfocus')); + setFormValue('onblur', inst.dom.getAttrib(elm, 'onblur')); + setFormValue('onclick', onclick); + setFormValue('ondblclick', inst.dom.getAttrib(elm, 'ondblclick')); + setFormValue('onmousedown', inst.dom.getAttrib(elm, 'onmousedown')); + setFormValue('onmouseup', inst.dom.getAttrib(elm, 'onmouseup')); + setFormValue('onmouseover', inst.dom.getAttrib(elm, 'onmouseover')); + setFormValue('onmousemove', inst.dom.getAttrib(elm, 'onmousemove')); + setFormValue('onmouseout', inst.dom.getAttrib(elm, 'onmouseout')); + setFormValue('onkeypress', inst.dom.getAttrib(elm, 'onkeypress')); + setFormValue('onkeydown', inst.dom.getAttrib(elm, 'onkeydown')); + setFormValue('onkeyup', inst.dom.getAttrib(elm, 'onkeyup')); + setFormValue('target', inst.dom.getAttrib(elm, 'target')); + setFormValue('classes', inst.dom.getAttrib(elm, 'class')); + + // Parse onclick data + if (onclick != null && onclick.indexOf('window.open') != -1) + parseWindowOpen(onclick); + else + parseFunction(onclick); + + // Select by the values + selectByValue(formObj, 'dir', inst.dom.getAttrib(elm, 'dir')); + selectByValue(formObj, 'rel', inst.dom.getAttrib(elm, 'rel')); + selectByValue(formObj, 'rev', inst.dom.getAttrib(elm, 'rev')); + selectByValue(formObj, 'linklisthref', href); + + if (href.charAt(0) == '#') + selectByValue(formObj, 'anchorlist', href); + + addClassesToList('classlist', 'advlink_styles'); + + selectByValue(formObj, 'classlist', inst.dom.getAttrib(elm, 'class'), true); + selectByValue(formObj, 'targetlist', inst.dom.getAttrib(elm, 'target'), true); + } else + addClassesToList('classlist', 'advlink_styles'); +} + +function checkPrefix(n) { + if (n.value && Validator.isEmail(n) && !/^\s*mailto:/i.test(n.value) && confirm(tinyMCEPopup.getLang('advlink_dlg.is_email'))) + n.value = 'mailto:' + n.value; + + if (/^\s*www\./i.test(n.value) && confirm(tinyMCEPopup.getLang('advlink_dlg.is_external'))) + n.value = 'http://' + n.value; +} + +function setFormValue(name, value) { + document.forms[0].elements[name].value = value; +} + +function parseWindowOpen(onclick) { + var formObj = document.forms[0]; + + // Preprocess center code + if (onclick.indexOf('return false;') != -1) { + formObj.popupreturn.checked = true; + onclick = onclick.replace('return false;', ''); + } else + formObj.popupreturn.checked = false; + + var onClickData = parseLink(onclick); + + if (onClickData != null) { + formObj.ispopup.checked = true; + setPopupControlsDisabled(false); + + var onClickWindowOptions = parseOptions(onClickData['options']); + var url = onClickData['url']; + + formObj.popupname.value = onClickData['target']; + formObj.popupurl.value = url; + formObj.popupwidth.value = getOption(onClickWindowOptions, 'width'); + formObj.popupheight.value = getOption(onClickWindowOptions, 'height'); + + formObj.popupleft.value = getOption(onClickWindowOptions, 'left'); + formObj.popuptop.value = getOption(onClickWindowOptions, 'top'); + + if (formObj.popupleft.value.indexOf('screen') != -1) + formObj.popupleft.value = "c"; + + if (formObj.popuptop.value.indexOf('screen') != -1) + formObj.popuptop.value = "c"; + + formObj.popuplocation.checked = getOption(onClickWindowOptions, 'location') == "yes"; + formObj.popupscrollbars.checked = getOption(onClickWindowOptions, 'scrollbars') == "yes"; + formObj.popupmenubar.checked = getOption(onClickWindowOptions, 'menubar') == "yes"; + formObj.popupresizable.checked = getOption(onClickWindowOptions, 'resizable') == "yes"; + formObj.popuptoolbar.checked = getOption(onClickWindowOptions, 'toolbar') == "yes"; + formObj.popupstatus.checked = getOption(onClickWindowOptions, 'status') == "yes"; + formObj.popupdependent.checked = getOption(onClickWindowOptions, 'dependent') == "yes"; + + buildOnClick(); + } +} + +function parseFunction(onclick) { + var formObj = document.forms[0]; + var onClickData = parseLink(onclick); + + // TODO: Add stuff here +} + +function getOption(opts, name) { + return typeof(opts[name]) == "undefined" ? "" : opts[name]; +} + +function setPopupControlsDisabled(state) { + var formObj = document.forms[0]; + + formObj.popupname.disabled = state; + formObj.popupurl.disabled = state; + formObj.popupwidth.disabled = state; + formObj.popupheight.disabled = state; + formObj.popupleft.disabled = state; + formObj.popuptop.disabled = state; + formObj.popuplocation.disabled = state; + formObj.popupscrollbars.disabled = state; + formObj.popupmenubar.disabled = state; + formObj.popupresizable.disabled = state; + formObj.popuptoolbar.disabled = state; + formObj.popupstatus.disabled = state; + formObj.popupreturn.disabled = state; + formObj.popupdependent.disabled = state; + + setBrowserDisabled('popupurlbrowser', state); +} + +function parseLink(link) { + link = link.replace(new RegExp(''', 'g'), "'"); + + var fnName = link.replace(new RegExp("\\s*([A-Za-z0-9\.]*)\\s*\\(.*", "gi"), "$1"); + + // Is function name a template function + var template = templates[fnName]; + if (template) { + // Build regexp + var variableNames = template.match(new RegExp("'?\\$\\{[A-Za-z0-9\.]*\\}'?", "gi")); + var regExp = "\\s*[A-Za-z0-9\.]*\\s*\\("; + var replaceStr = ""; + for (var i=0; i'); + for (var i=0; i'; + html += ''; + + for (i=0, len=nodes.length; i' + name + ''; + } + + html += ''; + + return html; +} + +function insertAction() { + var inst = tinyMCEPopup.editor; + var elm, elementArray, i; + + elm = inst.selection.getNode(); + checkPrefix(document.forms[0].href); + + elm = inst.dom.getParent(elm, "A"); + + // Remove element if there is no href + if (!document.forms[0].href.value) { + i = inst.selection.getBookmark(); + inst.dom.remove(elm, 1); + inst.selection.moveToBookmark(i); + tinyMCEPopup.execCommand("mceEndUndoLevel"); + tinyMCEPopup.close(); + return; + } + + // Create new anchor elements + if (elm == null) { + inst.getDoc().execCommand("unlink", false, null); + tinyMCEPopup.execCommand("mceInsertLink", false, "#mce_temp_url#", {skip_undo : 1}); + + elementArray = tinymce.grep(inst.dom.select("a"), function(n) {return inst.dom.getAttrib(n, 'href') == '#mce_temp_url#';}); + for (i=0; i' + tinyMCELinkList[i][0] + ''; + + html += ''; + + return html; + + // tinyMCE.debug('-- image list start --', html, '-- image list end --'); +} + +function getTargetListHTML(elm_id, target_form_element) { + var targets = tinyMCEPopup.getParam('theme_advanced_link_targets', '').split(';'); + var html = ''; + + html += ''; + + return html; +} + +// While loading +preinit(); +tinyMCEPopup.onInit.add(init); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/langs/en_dlg.js b/public/assets/javascripts/core/tiny_mce/plugins/advlink/langs/en_dlg.js new file mode 100644 index 0000000..19dff29 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/langs/en_dlg.js @@ -0,0 +1,54 @@ +tinyMCE.addI18n('en.advlink_dlg',{ +title:"Insert/edit link", +url:"Link URL", +target:"Target", +titlefield:"Title", +is_email:"The URL you entered seems to be an email address. Do you want to add the required mailto: prefix?", +is_external:"The URL you entered seems to be an external link. Do you want to add the required http:// prefix?", +list:"Link list", +general_tab:"General", +popup_tab:"Popup", +events_tab:"Events", +advanced_tab:"Advanced", +general_props:"General properties", +popup_props:"Popup properties", +event_props:"Events", +advanced_props:"Advanced properties", +popup_opts:"Options", +anchor_names:"Anchors", +target_same:"Open in this window / frame", +target_parent:"Open in parent window / frame", +target_top:"Open in top frame (replaces all frames)", +target_blank:"Open in new window", +popup:"Javascript popup", +popup_url:"Popup URL", +popup_name:"Window name", +popup_return:"Insert 'return false'", +popup_scrollbars:"Show scrollbars", +popup_statusbar:"Show status bar", +popup_toolbar:"Show toolbars", +popup_menubar:"Show menu bar", +popup_location:"Show location bar", +popup_resizable:"Make window resizable", +popup_dependent:"Dependent (Mozilla/Firefox only)", +popup_size:"Size", +width:"Width", +height:"Height", +popup_position:"Position (X/Y)", +id:"Id", +style:"Style", +classes:"Classes", +target_name:"Target name", +langdir:"Language direction", +target_langcode:"Target language", +langcode:"Language code", +encoding:"Target character encoding", +mime:"Target MIME type", +rel:"Relationship page to target", +rev:"Relationship target to page", +tabindex:"Tabindex", +accesskey:"Accesskey", +ltr:"Left to right", +rtl:"Right to left", +link_list:"Link list" +}); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlink/link.htm b/public/assets/javascripts/core/tiny_mce/plugins/advlink/link.htm new file mode 100644 index 0000000..6c2d9a5 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlink/link.htm @@ -0,0 +1,338 @@ + + + + {#advlink_dlg.title} + + + + + + + + + +
    + + + + +
    + + +
    +
    + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin.js new file mode 100644 index 0000000..e884b76 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.each;tinymce.create("tinymce.plugins.AdvListPlugin",{init:function(b,c){var d=this;d.editor=b;function e(g){var f=[];a(g.split(/,/),function(h){f.push({title:"advlist."+(h=="default"?"def":h.replace(/-/g,"_")),styles:{listStyleType:h=="default"?"":h}})});return f}d.numlist=b.getParam("advlist_number_styles")||e("default,lower-alpha,lower-greek,lower-roman,upper-alpha,upper-roman");d.bullist=b.getParam("advlist_bullet_styles")||e("default,circle,disc,square")},createControl:function(d,b){var f=this,e,h;if(d=="numlist"||d=="bullist"){if(f[d][0].title=="advlist.def"){h=f[d][0]}function c(i,k){var j=true;a(k.styles,function(m,l){if(f.editor.dom.getStyle(i,l)!=m){j=false;return false}});return j}function g(){var k,i=f.editor,l=i.dom,j=i.selection;k=l.getParent(j.getNode(),"ol,ul");if(!k||k.nodeName==(d=="bullist"?"OL":"UL")||c(k,h)){i.execCommand(d=="bullist"?"InsertUnorderedList":"InsertOrderedList")}if(h){k=l.getParent(j.getNode(),"ol,ul");if(k){l.setStyles(k,h.styles);k.removeAttribute("data-mce-style")}}i.focus()}e=b.createSplitButton(d,{title:"advanced."+d+"_desc","class":"mce_"+d,onclick:function(){g()}});e.onRenderMenu.add(function(i,j){j.onShowMenu.add(function(){var m=f.editor.dom,l=m.getParent(f.editor.selection.getNode(),"ol,ul"),k;if(l||h){k=f[d];a(j.items,function(n){var o=true;n.setSelected(0);if(l&&!n.isDisabled()){a(k,function(p){if(p.id==n.id){if(!c(l,p)){o=false;return false}}});if(o){n.setSelected(1)}}});if(!l){j.items[h.id].setSelected(1)}}});j.add({id:f.editor.dom.uniqueId(),title:"advlist.types","class":"mceMenuItemTitle",titleItem:true}).setDisabled(1);a(f[d],function(k){k.id=f.editor.dom.uniqueId();j.add({id:k.id,title:k.title,onclick:function(){h=k;g()}})})});return e}},getInfo:function(){return{longname:"Advanced lists",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlist",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advlist",tinymce.plugins.AdvListPlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin_src.js new file mode 100644 index 0000000..e8ff208 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/advlist/editor_plugin_src.js @@ -0,0 +1,154 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var each = tinymce.each; + + tinymce.create('tinymce.plugins.AdvListPlugin', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + function buildFormats(str) { + var formats = []; + + each(str.split(/,/), function(type) { + formats.push({ + title : 'advlist.' + (type == 'default' ? 'def' : type.replace(/-/g, '_')), + styles : { + listStyleType : type == 'default' ? '' : type + } + }); + }); + + return formats; + }; + + // Setup number formats from config or default + t.numlist = ed.getParam("advlist_number_styles") || buildFormats("default,lower-alpha,lower-greek,lower-roman,upper-alpha,upper-roman"); + t.bullist = ed.getParam("advlist_bullet_styles") || buildFormats("default,circle,disc,square"); + }, + + createControl: function(name, cm) { + var t = this, btn, format; + + if (name == 'numlist' || name == 'bullist') { + // Default to first item if it's a default item + if (t[name][0].title == 'advlist.def') + format = t[name][0]; + + function hasFormat(node, format) { + var state = true; + + each(format.styles, function(value, name) { + // Format doesn't match + if (t.editor.dom.getStyle(node, name) != value) { + state = false; + return false; + } + }); + + return state; + }; + + function applyListFormat() { + var list, ed = t.editor, dom = ed.dom, sel = ed.selection; + + // Check for existing list element + list = dom.getParent(sel.getNode(), 'ol,ul'); + + // Switch/add list type if needed + if (!list || list.nodeName == (name == 'bullist' ? 'OL' : 'UL') || hasFormat(list, format)) + ed.execCommand(name == 'bullist' ? 'InsertUnorderedList' : 'InsertOrderedList'); + + // Append styles to new list element + if (format) { + list = dom.getParent(sel.getNode(), 'ol,ul'); + if (list) { + dom.setStyles(list, format.styles); + list.removeAttribute('data-mce-style'); + } + } + ed.focus(); + }; + + btn = cm.createSplitButton(name, { + title : 'advanced.' + name + '_desc', + 'class' : 'mce_' + name, + onclick : function() { + applyListFormat(); + } + }); + + btn.onRenderMenu.add(function(btn, menu) { + menu.onShowMenu.add(function() { + var dom = t.editor.dom, list = dom.getParent(t.editor.selection.getNode(), 'ol,ul'), fmtList; + + if (list || format) { + fmtList = t[name]; + + // Unselect existing items + each(menu.items, function(item) { + var state = true; + + item.setSelected(0); + + if (list && !item.isDisabled()) { + each(fmtList, function(fmt) { + if (fmt.id == item.id) { + if (!hasFormat(list, fmt)) { + state = false; + return false; + } + } + }); + + if (state) + item.setSelected(1); + } + }); + + // Select the current format + if (!list) + menu.items[format.id].setSelected(1); + } + }); + + menu.add({id : t.editor.dom.uniqueId(), title : 'advlist.types', 'class' : 'mceMenuItemTitle', titleItem: true}).setDisabled(1); + + each(t[name], function(item) { + item.id = t.editor.dom.uniqueId(); + + menu.add({id : item.id, title : item.title, onclick : function() { + format = item; + applyListFormat(); + }}); + }); + }); + + return btn; + } + }, + + getInfo : function() { + return { + longname : 'Advanced lists', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlist', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advlist', tinymce.plugins.AdvListPlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin.js new file mode 100644 index 0000000..de56d96 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AutolinkPlugin",{init:function(a,b){var c=this;if(tinyMCE.isIE){return}a.onKeyDown.add(function(d,f){if(f.keyCode==13){return c.handleEnter(d)}if(f.shiftKey&&f.keyCode==48){return c.handleEclipse(d)}});a.onKeyUp.add(function(d,f){if(f.keyCode==32){return c.handleSpacebar(d)}})},handleEclipse:function(a){this.parseCurrentLine(a,-1,"(",true)},handleSpacebar:function(a){this.parseCurrentLine(a,0,"",true)},handleEnter:function(a){this.parseCurrentLine(a,-1,"",false)},parseCurrentLine:function(i,d,b,g){var a,f,c,n,k,m,h,e,j;a=i.selection.getRng().cloneRange();if(a.startOffset<5){e=a.endContainer.previousSibling;if(e==null){if(a.endContainer.firstChild==null||a.endContainer.firstChild.nextSibling==null){return}e=a.endContainer.firstChild.nextSibling}j=e.length;a.setStart(e,j);a.setEnd(e,j);if(a.endOffset<5){return}f=a.endOffset;n=e}else{n=a.endContainer;if(n.nodeType!=3&&n.firstChild){while(n.nodeType!=3&&n.firstChild){n=n.firstChild}a.setStart(n,0);a.setEnd(n,n.nodeValue.length)}if(a.endOffset==1){f=2}else{f=a.endOffset-1-d}}c=f;do{a.setStart(n,f-2);a.setEnd(n,f-1);f-=1}while(a.toString()!=" "&&a.toString()!=""&&a.toString().charCodeAt(0)!=160&&(f-2)>=0&&a.toString()!=b);if(a.toString()==b||a.toString().charCodeAt(0)==160){a.setStart(n,f);a.setEnd(n,c);f+=1}else{if(a.startOffset==0){a.setStart(n,0);a.setEnd(n,c)}else{a.setStart(n,f);a.setEnd(n,c)}}m=a.toString();h=m.match(/^(https?:\/\/|ssh:\/\/|ftp:\/\/|file:\/|www\.)(.+)$/i);if(h){if(h[1]=="www."){h[1]="http://www."}k=i.selection.getBookmark();i.selection.setRng(a);tinyMCE.execCommand("mceInsertLink",false,h[1]+h[2]);i.selection.moveToBookmark(k);if(tinyMCE.isWebKit){i.selection.collapse(false);var l=Math.min(n.length,c+1);a.setStart(n,l);a.setEnd(n,l);i.selection.setRng(a)}}},getInfo:function(){return{longname:"Autolink",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autolink",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("autolink",tinymce.plugins.AutolinkPlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin_src.js new file mode 100644 index 0000000..4917edc --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autolink/editor_plugin_src.js @@ -0,0 +1,169 @@ +/** + * editor_plugin_src.js + * + * Copyright 2011, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AutolinkPlugin', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + + init : function(ed, url) { + var t = this; + + // Internet Explorer has built-in automatic linking + if (tinyMCE.isIE) + return; + + // Add a key down handler + ed.onKeyDown.add(function(ed, e) { + if (e.keyCode == 13) + return t.handleEnter(ed); + if (e.shiftKey && e.keyCode == 48) + return t.handleEclipse(ed); + }); + + // Add a key up handler + ed.onKeyUp.add(function(ed, e) { + if (e.keyCode == 32) + return t.handleSpacebar(ed); + }); + }, + + handleEclipse : function(ed) { + this.parseCurrentLine(ed, -1, '(', true); + }, + + handleSpacebar : function(ed) { + this.parseCurrentLine(ed, 0, '', true); + }, + + handleEnter : function(ed) { + this.parseCurrentLine(ed, -1, '', false); + }, + + parseCurrentLine : function(ed, end_offset, delimiter, goback) { + var r, end, start, endContainer, bookmark, text, matches, prev, len; + + // We need at least five characters to form a URL, + // hence, at minimum, five characters from the beginning of the line. + r = ed.selection.getRng().cloneRange(); + if (r.startOffset < 5) { + // During testing, the caret is placed inbetween two text nodes. + // The previous text node contains the URL. + prev = r.endContainer.previousSibling; + if (prev == null) { + if (r.endContainer.firstChild == null || r.endContainer.firstChild.nextSibling == null) + return; + + prev = r.endContainer.firstChild.nextSibling; + } + len = prev.length; + r.setStart(prev, len); + r.setEnd(prev, len); + + if (r.endOffset < 5) + return; + + end = r.endOffset; + endContainer = prev; + } else { + endContainer = r.endContainer; + + // Get a text node + if (endContainer.nodeType != 3 && endContainer.firstChild) { + while (endContainer.nodeType != 3 && endContainer.firstChild) + endContainer = endContainer.firstChild; + + r.setStart(endContainer, 0); + r.setEnd(endContainer, endContainer.nodeValue.length); + } + + if (r.endOffset == 1) + end = 2; + else + end = r.endOffset - 1 - end_offset; + } + + start = end; + + do + { + // Move the selection one character backwards. + r.setStart(endContainer, end - 2); + r.setEnd(endContainer, end - 1); + end -= 1; + + // Loop until one of the following is found: a blank space,  , delimeter, (end-2) >= 0 + } while (r.toString() != ' ' && r.toString() != '' && r.toString().charCodeAt(0) != 160 && (end -2) >= 0 && r.toString() != delimiter); + + if (r.toString() == delimiter || r.toString().charCodeAt(0) == 160) { + r.setStart(endContainer, end); + r.setEnd(endContainer, start); + end += 1; + } else if (r.startOffset == 0) { + r.setStart(endContainer, 0); + r.setEnd(endContainer, start); + } + else { + r.setStart(endContainer, end); + r.setEnd(endContainer, start); + } + + text = r.toString(); + matches = text.match(/^(https?:\/\/|ssh:\/\/|ftp:\/\/|file:\/|www\.)(.+)$/i); + + if (matches) { + if (matches[1] == 'www.') { + matches[1] = 'http://www.'; + } + + bookmark = ed.selection.getBookmark(); + + ed.selection.setRng(r); + tinyMCE.execCommand('mceInsertLink',false, matches[1] + matches[2]); + ed.selection.moveToBookmark(bookmark); + + // TODO: Determine if this is still needed. + if (tinyMCE.isWebKit) { + // move the caret to its original position + ed.selection.collapse(false); + var max = Math.min(endContainer.length, start + 1); + r.setStart(endContainer, max); + r.setEnd(endContainer, max); + ed.selection.setRng(r); + } + } + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Autolink', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autolink', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('autolink', tinymce.plugins.AutolinkPlugin); +})(); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin.js new file mode 100644 index 0000000..1676b15 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AutoResizePlugin",{init:function(a,c){var d=this;if(a.getParam("fullscreen_is_enabled")){return}function b(){var h=a.getDoc(),e=h.body,j=h.documentElement,g=tinymce.DOM,i=d.autoresize_min_height,f;f=tinymce.isIE?e.scrollHeight:j.offsetHeight;if(f>d.autoresize_min_height){i=f}g.setStyle(g.get(a.id+"_ifr"),"height",i+"px");if(d.throbbing){a.setProgressState(false);a.setProgressState(true)}}d.editor=a;d.autoresize_min_height=a.getElement().offsetHeight;a.onChange.add(b);a.onSetContent.add(b);a.onPaste.add(b);a.onKeyUp.add(b);a.onPostRender.add(b);if(a.getParam("autoresize_on_init",true)){a.onInit.add(function(f,e){f.setProgressState(true);d.throbbing=true;f.getBody().style.overflowY="hidden"});a.onLoadContent.add(function(f,e){b();setTimeout(function(){b();f.setProgressState(false);d.throbbing=false},1250)})}a.addCommand("mceAutoResize",b)},getInfo:function(){return{longname:"Auto Resize",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autoresize",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("autoresize",tinymce.plugins.AutoResizePlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin_src.js new file mode 100644 index 0000000..c260b7a --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autoresize/editor_plugin_src.js @@ -0,0 +1,119 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + /** + * Auto Resize + * + * This plugin automatically resizes the content area to fit its content height. + * It will retain a minimum height, which is the height of the content area when + * it's initialized. + */ + tinymce.create('tinymce.plugins.AutoResizePlugin', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed, url) { + var t = this; + + if (ed.getParam('fullscreen_is_enabled')) + return; + + /** + * This method gets executed each time the editor needs to resize. + */ + function resize() { + var d = ed.getDoc(), b = d.body, de = d.documentElement, DOM = tinymce.DOM, resizeHeight = t.autoresize_min_height, myHeight; + + // Get height differently depending on the browser used + myHeight = tinymce.isIE ? b.scrollHeight : de.offsetHeight; + + // Don't make it smaller than the minimum height + if (myHeight > t.autoresize_min_height) + resizeHeight = myHeight; + + // Resize content element + DOM.setStyle(DOM.get(ed.id + '_ifr'), 'height', resizeHeight + 'px'); + + // if we're throbbing, we'll re-throb to match the new size + if (t.throbbing) { + ed.setProgressState(false); + ed.setProgressState(true); + } + }; + + t.editor = ed; + + // Define minimum height + t.autoresize_min_height = ed.getElement().offsetHeight; + + // Add appropriate listeners for resizing content area + ed.onChange.add(resize); + ed.onSetContent.add(resize); + ed.onPaste.add(resize); + ed.onKeyUp.add(resize); + ed.onPostRender.add(resize); + + if (ed.getParam('autoresize_on_init', true)) { + // Things to do when the editor is ready + ed.onInit.add(function(ed, l) { + // Show throbber until content area is resized properly + ed.setProgressState(true); + t.throbbing = true; + + // Hide scrollbars + ed.getBody().style.overflowY = "hidden"; + }); + + ed.onLoadContent.add(function(ed, l) { + resize(); + + // Because the content area resizes when its content CSS loads, + // and we can't easily add a listener to its onload event, + // we'll just trigger a resize after a short loading period + setTimeout(function() { + resize(); + + // Disable throbber + ed.setProgressState(false); + t.throbbing = false; + }, 1250); + }); + } + + // Register the command so that it can be invoked by using tinyMCE.activeEditor.execCommand('mceExample'); + ed.addCommand('mceAutoResize', resize); + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Auto Resize', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autoresize', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('autoresize', tinymce.plugins.AutoResizePlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autosave/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/autosave/editor_plugin.js new file mode 100644 index 0000000..7f49107 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autosave/editor_plugin.js @@ -0,0 +1 @@ +(function(e){var c="autosave",g="restoredraft",b=true,f,d,a=e.util.Dispatcher;e.create("tinymce.plugins.AutoSave",{init:function(i,j){var h=this,l=i.settings;h.editor=i;function k(n){var m={s:1000,m:60000};n=/^(\d+)([ms]?)$/.exec(""+n);return(n[2]?m[n[2]]:1)*parseInt(n)}e.each({ask_before_unload:b,interval:"30s",retention:"20m",minlength:50},function(n,m){m=c+"_"+m;if(l[m]===f){l[m]=n}});l.autosave_interval=k(l.autosave_interval);l.autosave_retention=k(l.autosave_retention);i.addButton(g,{title:c+".restore_content",onclick:function(){if(i.getContent({draft:true}).replace(/\s| |<\/?p[^>]*>|]*>/gi,"").length>0){i.windowManager.confirm(c+".warning_message",function(m){if(m){h.restoreDraft()}})}else{h.restoreDraft()}}});i.onNodeChange.add(function(){var m=i.controlManager;if(m.get(g)){m.setDisabled(g,!h.hasDraft())}});i.onInit.add(function(){if(i.controlManager.get(g)){h.setupStorage(i);setInterval(function(){h.storeDraft();i.nodeChanged()},l.autosave_interval)}});h.onStoreDraft=new a(h);h.onRestoreDraft=new a(h);h.onRemoveDraft=new a(h);if(!d){window.onbeforeunload=e.plugins.AutoSave._beforeUnloadHandler;d=b}},getInfo:function(){return{longname:"Auto save",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autosave",version:e.majorVersion+"."+e.minorVersion}},getExpDate:function(){return new Date(new Date().getTime()+this.editor.settings.autosave_retention).toUTCString()},setupStorage:function(i){var h=this,k=c+"_test",j="OK";h.key=c+i.id;e.each([function(){if(localStorage){localStorage.setItem(k,j);if(localStorage.getItem(k)===j){localStorage.removeItem(k);return localStorage}}},function(){if(sessionStorage){sessionStorage.setItem(k,j);if(sessionStorage.getItem(k)===j){sessionStorage.removeItem(k);return sessionStorage}}},function(){if(e.isIE){i.getElement().style.behavior="url('#default#userData')";return{autoExpires:b,setItem:function(l,n){var m=i.getElement();m.setAttribute(l,n);m.expires=h.getExpDate();try{m.save("TinyMCE")}catch(o){}},getItem:function(l){var m=i.getElement();try{m.load("TinyMCE");return m.getAttribute(l)}catch(n){return null}},removeItem:function(l){i.getElement().removeAttribute(l)}}}},],function(l){try{h.storage=l();if(h.storage){return false}}catch(m){}})},storeDraft:function(){var i=this,l=i.storage,j=i.editor,h,k;if(l){if(!l.getItem(i.key)&&!j.isDirty()){return}k=j.getContent({draft:true});if(k.length>j.settings.autosave_minlength){h=i.getExpDate();if(!i.storage.autoExpires){i.storage.setItem(i.key+"_expires",h)}i.storage.setItem(i.key,k);i.onStoreDraft.dispatch(i,{expires:h,content:k})}}},restoreDraft:function(){var h=this,i=h.storage;if(i){content=i.getItem(h.key);if(content){h.editor.setContent(content);h.onRestoreDraft.dispatch(h,{content:content})}}},hasDraft:function(){var h=this,k=h.storage,i,j;if(k){j=!!k.getItem(h.key);if(j){if(!h.storage.autoExpires){i=new Date(k.getItem(h.key+"_expires"));if(new Date().getTime()]*>|]*>/gi, "").length > 0) { + // Show confirm dialog if the editor isn't empty + ed.windowManager.confirm( + PLUGIN_NAME + ".warning_message", + function(ok) { + if (ok) + self.restoreDraft(); + } + ); + } else + self.restoreDraft(); + } + }); + + // Enable/disable restoredraft button depending on if there is a draft stored or not + ed.onNodeChange.add(function() { + var controlManager = ed.controlManager; + + if (controlManager.get(RESTORE_DRAFT)) + controlManager.setDisabled(RESTORE_DRAFT, !self.hasDraft()); + }); + + ed.onInit.add(function() { + // Check if the user added the restore button, then setup auto storage logic + if (ed.controlManager.get(RESTORE_DRAFT)) { + // Setup storage engine + self.setupStorage(ed); + + // Auto save contents each interval time + setInterval(function() { + self.storeDraft(); + ed.nodeChanged(); + }, settings.autosave_interval); + } + }); + + /** + * This event gets fired when a draft is stored to local storage. + * + * @event onStoreDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onStoreDraft = new Dispatcher(self); + + /** + * This event gets fired when a draft is restored from local storage. + * + * @event onStoreDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onRestoreDraft = new Dispatcher(self); + + /** + * This event gets fired when a draft removed/expired. + * + * @event onRemoveDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onRemoveDraft = new Dispatcher(self); + + // Add ask before unload dialog only add one unload handler + if (!unloadHandlerAdded) { + window.onbeforeunload = tinymce.plugins.AutoSave._beforeUnloadHandler; + unloadHandlerAdded = TRUE; + } + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @method getInfo + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Auto save', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autosave', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + /** + * Returns an expiration date UTC string. + * + * @method getExpDate + * @return {String} Expiration date UTC string. + */ + getExpDate : function() { + return new Date( + new Date().getTime() + this.editor.settings.autosave_retention + ).toUTCString(); + }, + + /** + * This method will setup the storage engine. If the browser has support for it. + * + * @method setupStorage + */ + setupStorage : function(ed) { + var self = this, testKey = PLUGIN_NAME + '_test', testVal = "OK"; + + self.key = PLUGIN_NAME + ed.id; + + // Loop though each storage engine type until we find one that works + tinymce.each([ + function() { + // Try HTML5 Local Storage + if (localStorage) { + localStorage.setItem(testKey, testVal); + + if (localStorage.getItem(testKey) === testVal) { + localStorage.removeItem(testKey); + + return localStorage; + } + } + }, + + function() { + // Try HTML5 Session Storage + if (sessionStorage) { + sessionStorage.setItem(testKey, testVal); + + if (sessionStorage.getItem(testKey) === testVal) { + sessionStorage.removeItem(testKey); + + return sessionStorage; + } + } + }, + + function() { + // Try IE userData + if (tinymce.isIE) { + ed.getElement().style.behavior = "url('#default#userData')"; + + // Fake localStorage on old IE + return { + autoExpires : TRUE, + + setItem : function(key, value) { + var userDataElement = ed.getElement(); + + userDataElement.setAttribute(key, value); + userDataElement.expires = self.getExpDate(); + + try { + userDataElement.save("TinyMCE"); + } catch (e) { + // Ignore, saving might fail if "Userdata Persistence" is disabled in IE + } + }, + + getItem : function(key) { + var userDataElement = ed.getElement(); + + try { + userDataElement.load("TinyMCE"); + return userDataElement.getAttribute(key); + } catch (e) { + // Ignore, loading might fail if "Userdata Persistence" is disabled in IE + return null; + } + }, + + removeItem : function(key) { + ed.getElement().removeAttribute(key); + } + }; + } + }, + ], function(setup) { + // Try executing each function to find a suitable storage engine + try { + self.storage = setup(); + + if (self.storage) + return false; + } catch (e) { + // Ignore + } + }); + }, + + /** + * This method will store the current contents in the the storage engine. + * + * @method storeDraft + */ + storeDraft : function() { + var self = this, storage = self.storage, editor = self.editor, expires, content; + + // Is the contents dirty + if (storage) { + // If there is no existing key and the contents hasn't been changed since + // it's original value then there is no point in saving a draft + if (!storage.getItem(self.key) && !editor.isDirty()) + return; + + // Store contents if the contents if longer than the minlength of characters + content = editor.getContent({draft: true}); + if (content.length > editor.settings.autosave_minlength) { + expires = self.getExpDate(); + + // Store expiration date if needed IE userData has auto expire built in + if (!self.storage.autoExpires) + self.storage.setItem(self.key + "_expires", expires); + + self.storage.setItem(self.key, content); + self.onStoreDraft.dispatch(self, { + expires : expires, + content : content + }); + } + } + }, + + /** + * This method will restore the contents from the storage engine back to the editor. + * + * @method restoreDraft + */ + restoreDraft : function() { + var self = this, storage = self.storage; + + if (storage) { + content = storage.getItem(self.key); + + if (content) { + self.editor.setContent(content); + self.onRestoreDraft.dispatch(self, { + content : content + }); + } + } + }, + + /** + * This method will return true/false if there is a local storage draft available. + * + * @method hasDraft + * @return {boolean} true/false state if there is a local draft. + */ + hasDraft : function() { + var self = this, storage = self.storage, expDate, exists; + + if (storage) { + // Does the item exist at all + exists = !!storage.getItem(self.key); + if (exists) { + // Storage needs autoexpire + if (!self.storage.autoExpires) { + expDate = new Date(storage.getItem(self.key + "_expires")); + + // Contents hasn't expired + if (new Date().getTime() < expDate.getTime()) + return TRUE; + + // Remove it if it has + self.removeDraft(); + } else + return TRUE; + } + } + + return false; + }, + + /** + * Removes the currently stored draft. + * + * @method removeDraft + */ + removeDraft : function() { + var self = this, storage = self.storage, key = self.key, content; + + if (storage) { + // Get current contents and remove the existing draft + content = storage.getItem(key); + storage.removeItem(key); + storage.removeItem(key + "_expires"); + + // Dispatch remove event if we had any contents + if (content) { + self.onRemoveDraft.dispatch(self, { + content : content + }); + } + } + }, + + "static" : { + // Internal unload handler will be called before the page is unloaded + _beforeUnloadHandler : function(e) { + var msg; + + tinymce.each(tinyMCE.editors, function(ed) { + // Store a draft for each editor instance + if (ed.plugins.autosave) + ed.plugins.autosave.storeDraft(); + + // Never ask in fullscreen mode + if (ed.getParam("fullscreen_is_enabled")) + return; + + // Setup a return message if the editor is dirty + if (!msg && ed.isDirty() && ed.getParam("autosave_ask_before_unload")) + msg = ed.getLang("autosave.unload_msg"); + }); + + return msg; + } + } + }); + + tinymce.PluginManager.add('autosave', tinymce.plugins.AutoSave); +})(tinymce); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/autosave/langs/en.js b/public/assets/javascripts/core/tiny_mce/plugins/autosave/langs/en.js new file mode 100644 index 0000000..fce6bd3 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/autosave/langs/en.js @@ -0,0 +1,4 @@ +tinyMCE.addI18n('en.autosave',{ +restore_content: "Restore auto-saved content", +warning_message: "If you restore the saved content, you will lose all the content that is currently in the editor.\n\nAre you sure you want to restore the saved content?" +}); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin.js new file mode 100644 index 0000000..8f8821f --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.BBCodePlugin",{init:function(a,b){var d=this,c=a.getParam("bbcode_dialect","punbb").toLowerCase();a.onBeforeSetContent.add(function(e,f){f.content=d["_"+c+"_bbcode2html"](f.content)});a.onPostProcess.add(function(e,f){if(f.set){f.content=d["_"+c+"_bbcode2html"](f.content)}if(f.get){f.content=d["_"+c+"_html2bbcode"](f.content)}})},getInfo:function(){return{longname:"BBCode Plugin",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/bbcode",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_punbb_html2bbcode:function(a){a=tinymce.trim(a);function b(c,d){a=a.replace(c,d)}b(/(.*?)<\/a>/gi,"[url=$1]$2[/url]");b(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]");b(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]");b(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]");b(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]");b(/(.*?)<\/span>/gi,"[color=$1]$2[/color]");b(/(.*?)<\/font>/gi,"[color=$1]$2[/color]");b(/(.*?)<\/span>/gi,"[size=$1]$2[/size]");b(/(.*?)<\/font>/gi,"$1");b(//gi,"[img]$1[/img]");b(/(.*?)<\/span>/gi,"[code]$1[/code]");b(/(.*?)<\/span>/gi,"[quote]$1[/quote]");b(/(.*?)<\/strong>/gi,"[code][b]$1[/b][/code]");b(/(.*?)<\/strong>/gi,"[quote][b]$1[/b][/quote]");b(/(.*?)<\/em>/gi,"[code][i]$1[/i][/code]");b(/(.*?)<\/em>/gi,"[quote][i]$1[/i][/quote]");b(/(.*?)<\/u>/gi,"[code][u]$1[/u][/code]");b(/(.*?)<\/u>/gi,"[quote][u]$1[/u][/quote]");b(/<\/(strong|b)>/gi,"[/b]");b(/<(strong|b)>/gi,"[b]");b(/<\/(em|i)>/gi,"[/i]");b(/<(em|i)>/gi,"[i]");b(/<\/u>/gi,"[/u]");b(/(.*?)<\/span>/gi,"[u]$1[/u]");b(//gi,"[u]");b(/]*>/gi,"[quote]");b(/<\/blockquote>/gi,"[/quote]");b(/
    /gi,"\n");b(//gi,"\n");b(/
    /gi,"\n");b(/

    /gi,"");b(/<\/p>/gi,"\n");b(/ |\u00a0/gi," ");b(/"/gi,'"');b(/</gi,"<");b(/>/gi,">");b(/&/gi,"&");return a},_punbb_bbcode2html:function(a){a=tinymce.trim(a);function b(c,d){a=a.replace(c,d)}b(/\n/gi,"
    ");b(/\[b\]/gi,"");b(/\[\/b\]/gi,"");b(/\[i\]/gi,"");b(/\[\/i\]/gi,"");b(/\[u\]/gi,"");b(/\[\/u\]/gi,"");b(/\[url=([^\]]+)\](.*?)\[\/url\]/gi,'$2');b(/\[url\](.*?)\[\/url\]/gi,'$1');b(/\[img\](.*?)\[\/img\]/gi,'');b(/\[color=(.*?)\](.*?)\[\/color\]/gi,'$2');b(/\[code\](.*?)\[\/code\]/gi,'$1 ');b(/\[quote.*?\](.*?)\[\/quote\]/gi,'$1 ');return a}});tinymce.PluginManager.add("bbcode",tinymce.plugins.BBCodePlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin_src.js new file mode 100644 index 0000000..4e7eb33 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/bbcode/editor_plugin_src.js @@ -0,0 +1,120 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.BBCodePlugin', { + init : function(ed, url) { + var t = this, dialect = ed.getParam('bbcode_dialect', 'punbb').toLowerCase(); + + ed.onBeforeSetContent.add(function(ed, o) { + o.content = t['_' + dialect + '_bbcode2html'](o.content); + }); + + ed.onPostProcess.add(function(ed, o) { + if (o.set) + o.content = t['_' + dialect + '_bbcode2html'](o.content); + + if (o.get) + o.content = t['_' + dialect + '_html2bbcode'](o.content); + }); + }, + + getInfo : function() { + return { + longname : 'BBCode Plugin', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/bbcode', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + // HTML -> BBCode in PunBB dialect + _punbb_html2bbcode : function(s) { + s = tinymce.trim(s); + + function rep(re, str) { + s = s.replace(re, str); + }; + + // example: to [b] + rep(/(.*?)<\/a>/gi,"[url=$1]$2[/url]"); + rep(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"); + rep(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"); + rep(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"); + rep(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"); + rep(/(.*?)<\/span>/gi,"[color=$1]$2[/color]"); + rep(/(.*?)<\/font>/gi,"[color=$1]$2[/color]"); + rep(/(.*?)<\/span>/gi,"[size=$1]$2[/size]"); + rep(/(.*?)<\/font>/gi,"$1"); + rep(//gi,"[img]$1[/img]"); + rep(/(.*?)<\/span>/gi,"[code]$1[/code]"); + rep(/(.*?)<\/span>/gi,"[quote]$1[/quote]"); + rep(/(.*?)<\/strong>/gi,"[code][b]$1[/b][/code]"); + rep(/(.*?)<\/strong>/gi,"[quote][b]$1[/b][/quote]"); + rep(/(.*?)<\/em>/gi,"[code][i]$1[/i][/code]"); + rep(/(.*?)<\/em>/gi,"[quote][i]$1[/i][/quote]"); + rep(/(.*?)<\/u>/gi,"[code][u]$1[/u][/code]"); + rep(/(.*?)<\/u>/gi,"[quote][u]$1[/u][/quote]"); + rep(/<\/(strong|b)>/gi,"[/b]"); + rep(/<(strong|b)>/gi,"[b]"); + rep(/<\/(em|i)>/gi,"[/i]"); + rep(/<(em|i)>/gi,"[i]"); + rep(/<\/u>/gi,"[/u]"); + rep(/(.*?)<\/span>/gi,"[u]$1[/u]"); + rep(//gi,"[u]"); + rep(/]*>/gi,"[quote]"); + rep(/<\/blockquote>/gi,"[/quote]"); + rep(/
    /gi,"\n"); + rep(//gi,"\n"); + rep(/
    /gi,"\n"); + rep(/

    /gi,""); + rep(/<\/p>/gi,"\n"); + rep(/ |\u00a0/gi," "); + rep(/"/gi,"\""); + rep(/</gi,"<"); + rep(/>/gi,">"); + rep(/&/gi,"&"); + + return s; + }, + + // BBCode -> HTML from PunBB dialect + _punbb_bbcode2html : function(s) { + s = tinymce.trim(s); + + function rep(re, str) { + s = s.replace(re, str); + }; + + // example: [b] to + rep(/\n/gi,"
    "); + rep(/\[b\]/gi,""); + rep(/\[\/b\]/gi,""); + rep(/\[i\]/gi,""); + rep(/\[\/i\]/gi,""); + rep(/\[u\]/gi,""); + rep(/\[\/u\]/gi,""); + rep(/\[url=([^\]]+)\](.*?)\[\/url\]/gi,"$2"); + rep(/\[url\](.*?)\[\/url\]/gi,"$1"); + rep(/\[img\](.*?)\[\/img\]/gi,""); + rep(/\[color=(.*?)\](.*?)\[\/color\]/gi,"$2"); + rep(/\[code\](.*?)\[\/code\]/gi,"$1 "); + rep(/\[quote.*?\](.*?)\[\/quote\]/gi,"$1 "); + + return s; + } + }); + + // Register plugin + tinymce.PluginManager.add('bbcode', tinymce.plugins.BBCodePlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin.js new file mode 100644 index 0000000..ca7468a --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.dom.Event,c=tinymce.each,b=tinymce.DOM;tinymce.create("tinymce.plugins.ContextMenu",{init:function(e){var h=this,i,f,d;h.editor=e;d=e.settings.contextmenu_never_use_native;h.onContextMenu=new tinymce.util.Dispatcher(this);f=e.onContextMenu.add(function(j,k){if(k.ctrlKey&&!d){return}if(i){j.selection.setRng(i)}h._getMenu(j).showMenu(k.clientX||k.pageX,k.clientY||k.pageX);a.add(j.getDoc(),"click",function(l){g(j,l)});a.cancel(k)});e.onRemove.add(function(){if(h._menu){h._menu.removeAll()}});function g(j,k){i=null;if(k&&k.button==2){i=j.selection.getRng();return}if(h._menu){h._menu.removeAll();h._menu.destroy();a.remove(j.getDoc(),"click",g)}}e.onMouseDown.add(g);e.onKeyDown.add(g);e.onKeyDown.add(function(j,k){if(k.shiftKey&&!k.ctrlKey&&!k.altKey&&k.keyCode===121){a.cancel(k);f(j,k)}})},getInfo:function(){return{longname:"Contextmenu",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/contextmenu",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_getMenu:function(h){var l=this,f=l._menu,i=h.selection,e=i.isCollapsed(),d=i.getNode()||h.getBody(),g,k,j;if(f){f.removeAll();f.destroy()}k=b.getPos(h.getContentAreaContainer());j=b.getPos(h.getContainer());f=h.controlManager.createDropMenu("contextmenu",{offset_x:k.x+h.getParam("contextmenu_offset_x",0),offset_y:k.y+h.getParam("contextmenu_offset_y",0),constrain:1,keyboard_focus:true});l._menu=f;f.add({title:"advanced.cut_desc",icon:"cut",cmd:"Cut"}).setDisabled(e);f.add({title:"advanced.copy_desc",icon:"copy",cmd:"Copy"}).setDisabled(e);f.add({title:"advanced.paste_desc",icon:"paste",cmd:"Paste"});if((d.nodeName=="A"&&!h.dom.getAttrib(d,"name"))||!e){f.addSeparator();f.add({title:"advanced.link_desc",icon:"link",cmd:h.plugins.advlink?"mceAdvLink":"mceLink",ui:true});f.add({title:"advanced.unlink_desc",icon:"unlink",cmd:"UnLink"})}f.addSeparator();f.add({title:"advanced.image_desc",icon:"image",cmd:h.plugins.advimage?"mceAdvImage":"mceImage",ui:true});f.addSeparator();g=f.addMenu({title:"contextmenu.align"});g.add({title:"contextmenu.left",icon:"justifyleft",cmd:"JustifyLeft"});g.add({title:"contextmenu.center",icon:"justifycenter",cmd:"JustifyCenter"});g.add({title:"contextmenu.right",icon:"justifyright",cmd:"JustifyRight"});g.add({title:"contextmenu.full",icon:"justifyfull",cmd:"JustifyFull"});l.onContextMenu.dispatch(l,f,d,e);return f}});tinymce.PluginManager.add("contextmenu",tinymce.plugins.ContextMenu)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin_src.js new file mode 100644 index 0000000..56c93ab --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/contextmenu/editor_plugin_src.js @@ -0,0 +1,156 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var Event = tinymce.dom.Event, each = tinymce.each, DOM = tinymce.DOM; + + /** + * This plugin a context menu to TinyMCE editor instances. + * + * @class tinymce.plugins.ContextMenu + */ + tinymce.create('tinymce.plugins.ContextMenu', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @method init + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed) { + var t = this, lastRng, showMenu, contextmenuNeverUseNative; + + t.editor = ed; + + contextmenuNeverUseNative = ed.settings.contextmenu_never_use_native; + + /** + * This event gets fired when the context menu is shown. + * + * @event onContextMenu + * @param {tinymce.plugins.ContextMenu} sender Plugin instance sending the event. + * @param {tinymce.ui.DropMenu} menu Drop down menu to fill with more items if needed. + */ + t.onContextMenu = new tinymce.util.Dispatcher(this); + + showMenu = ed.onContextMenu.add(function(ed, e) { + if (e.ctrlKey && !contextmenuNeverUseNative) return; + + // Restore the last selection since it was removed + if (lastRng) + ed.selection.setRng(lastRng); + + t._getMenu(ed).showMenu(e.clientX || e.pageX, e.clientY || e.pageX); + Event.add(ed.getDoc(), 'click', function(e) { + hide(ed, e); + }); + Event.cancel(e); + }); + + ed.onRemove.add(function() { + if (t._menu) + t._menu.removeAll(); + }); + + function hide(ed, e) { + lastRng = null; + + // Since the contextmenu event moves + // the selection we need to store it away + if (e && e.button == 2) { + lastRng = ed.selection.getRng(); + return; + } + + if (t._menu) { + t._menu.removeAll(); + t._menu.destroy(); + Event.remove(ed.getDoc(), 'click', hide); + } + }; + + ed.onMouseDown.add(hide); + ed.onKeyDown.add(hide); + ed.onKeyDown.add(function(ed, e) { + if (e.shiftKey && !e.ctrlKey && !e.altKey && e.keyCode === 121) { + Event.cancel(e); + showMenu(ed, e); + } + }); + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @method getInfo + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Contextmenu', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/contextmenu', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + _getMenu : function(ed) { + var t = this, m = t._menu, se = ed.selection, col = se.isCollapsed(), el = se.getNode() || ed.getBody(), am, p1, p2; + + if (m) { + m.removeAll(); + m.destroy(); + } + + p1 = DOM.getPos(ed.getContentAreaContainer()); + p2 = DOM.getPos(ed.getContainer()); + + m = ed.controlManager.createDropMenu('contextmenu', { + offset_x : p1.x + ed.getParam('contextmenu_offset_x', 0), + offset_y : p1.y + ed.getParam('contextmenu_offset_y', 0), + constrain : 1, + keyboard_focus: true + }); + + t._menu = m; + + m.add({title : 'advanced.cut_desc', icon : 'cut', cmd : 'Cut'}).setDisabled(col); + m.add({title : 'advanced.copy_desc', icon : 'copy', cmd : 'Copy'}).setDisabled(col); + m.add({title : 'advanced.paste_desc', icon : 'paste', cmd : 'Paste'}); + + if ((el.nodeName == 'A' && !ed.dom.getAttrib(el, 'name')) || !col) { + m.addSeparator(); + m.add({title : 'advanced.link_desc', icon : 'link', cmd : ed.plugins.advlink ? 'mceAdvLink' : 'mceLink', ui : true}); + m.add({title : 'advanced.unlink_desc', icon : 'unlink', cmd : 'UnLink'}); + } + + m.addSeparator(); + m.add({title : 'advanced.image_desc', icon : 'image', cmd : ed.plugins.advimage ? 'mceAdvImage' : 'mceImage', ui : true}); + + m.addSeparator(); + am = m.addMenu({title : 'contextmenu.align'}); + am.add({title : 'contextmenu.left', icon : 'justifyleft', cmd : 'JustifyLeft'}); + am.add({title : 'contextmenu.center', icon : 'justifycenter', cmd : 'JustifyCenter'}); + am.add({title : 'contextmenu.right', icon : 'justifyright', cmd : 'JustifyRight'}); + am.add({title : 'contextmenu.full', icon : 'justifyfull', cmd : 'JustifyFull'}); + + t.onContextMenu.dispatch(t, m, el, col); + + return m; + } + }); + + // Register plugin + tinymce.PluginManager.add('contextmenu', tinymce.plugins.ContextMenu); +})(); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin.js new file mode 100644 index 0000000..bce8e73 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Directionality",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceDirectionLTR",function(){var d=a.dom.getParent(a.selection.getNode(),a.dom.isBlock);if(d){if(a.dom.getAttrib(d,"dir")!="ltr"){a.dom.setAttrib(d,"dir","ltr")}else{a.dom.setAttrib(d,"dir","")}}a.nodeChanged()});a.addCommand("mceDirectionRTL",function(){var d=a.dom.getParent(a.selection.getNode(),a.dom.isBlock);if(d){if(a.dom.getAttrib(d,"dir")!="rtl"){a.dom.setAttrib(d,"dir","rtl")}else{a.dom.setAttrib(d,"dir","")}}a.nodeChanged()});a.addButton("ltr",{title:"directionality.ltr_desc",cmd:"mceDirectionLTR"});a.addButton("rtl",{title:"directionality.rtl_desc",cmd:"mceDirectionRTL"});a.onNodeChange.add(c._nodeChange,c)},getInfo:function(){return{longname:"Directionality",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/directionality",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_nodeChange:function(b,a,e){var d=b.dom,c;e=d.getParent(e,d.isBlock);if(!e){a.setDisabled("ltr",1);a.setDisabled("rtl",1);return}c=d.getAttrib(e,"dir");a.setActive("ltr",c=="ltr");a.setDisabled("ltr",0);a.setActive("rtl",c=="rtl");a.setDisabled("rtl",0)}});tinymce.PluginManager.add("directionality",tinymce.plugins.Directionality)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin_src.js new file mode 100644 index 0000000..4444959 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/directionality/editor_plugin_src.js @@ -0,0 +1,82 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Directionality', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + ed.addCommand('mceDirectionLTR', function() { + var e = ed.dom.getParent(ed.selection.getNode(), ed.dom.isBlock); + + if (e) { + if (ed.dom.getAttrib(e, "dir") != "ltr") + ed.dom.setAttrib(e, "dir", "ltr"); + else + ed.dom.setAttrib(e, "dir", ""); + } + + ed.nodeChanged(); + }); + + ed.addCommand('mceDirectionRTL', function() { + var e = ed.dom.getParent(ed.selection.getNode(), ed.dom.isBlock); + + if (e) { + if (ed.dom.getAttrib(e, "dir") != "rtl") + ed.dom.setAttrib(e, "dir", "rtl"); + else + ed.dom.setAttrib(e, "dir", ""); + } + + ed.nodeChanged(); + }); + + ed.addButton('ltr', {title : 'directionality.ltr_desc', cmd : 'mceDirectionLTR'}); + ed.addButton('rtl', {title : 'directionality.rtl_desc', cmd : 'mceDirectionRTL'}); + + ed.onNodeChange.add(t._nodeChange, t); + }, + + getInfo : function() { + return { + longname : 'Directionality', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/directionality', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + _nodeChange : function(ed, cm, n) { + var dom = ed.dom, dir; + + n = dom.getParent(n, dom.isBlock); + if (!n) { + cm.setDisabled('ltr', 1); + cm.setDisabled('rtl', 1); + return; + } + + dir = dom.getAttrib(n, 'dir'); + cm.setActive('ltr', dir == "ltr"); + cm.setDisabled('ltr', 0); + cm.setActive('rtl', dir == "rtl"); + cm.setDisabled('rtl', 0); + } + }); + + // Register plugin + tinymce.PluginManager.add('directionality', tinymce.plugins.Directionality); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin.js new file mode 100644 index 0000000..dbdd8ff --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin.js @@ -0,0 +1 @@ +(function(a){a.create("tinymce.plugins.EmotionsPlugin",{init:function(b,c){b.addCommand("mceEmotion",function(){b.windowManager.open({file:c+"/emotions.htm",width:250+parseInt(b.getLang("emotions.delta_width",0)),height:160+parseInt(b.getLang("emotions.delta_height",0)),inline:1},{plugin_url:c})});b.addButton("emotions",{title:"emotions.emotions_desc",cmd:"mceEmotion"})},getInfo:function(){return{longname:"Emotions",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/emotions",version:a.majorVersion+"."+a.minorVersion}}});a.PluginManager.add("emotions",a.plugins.EmotionsPlugin)})(tinymce); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin_src.js new file mode 100644 index 0000000..71d5416 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/emotions/editor_plugin_src.js @@ -0,0 +1,43 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function(tinymce) { + tinymce.create('tinymce.plugins.EmotionsPlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceEmotion', function() { + ed.windowManager.open({ + file : url + '/emotions.htm', + width : 250 + parseInt(ed.getLang('emotions.delta_width', 0)), + height : 160 + parseInt(ed.getLang('emotions.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('emotions', {title : 'emotions.emotions_desc', cmd : 'mceEmotion'}); + }, + + getInfo : function() { + return { + longname : 'Emotions', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/emotions', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('emotions', tinymce.plugins.EmotionsPlugin); +})(tinymce); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/emotions.htm b/public/assets/javascripts/core/tiny_mce/plugins/emotions/emotions.htm new file mode 100644 index 0000000..2c91002 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/emotions/emotions.htm @@ -0,0 +1,41 @@ + + + + {#emotions_dlg.title} + + + + + +

    +
    {#emotions_dlg.title}:

    + + + + + + + + + + + + + + + + + + + + + + + + + + +
    {#emotions_dlg.cool}{#emotions_dlg.cry}{#emotions_dlg.embarassed}{#emotions_dlg.foot_in_mouth}
    {#emotions_dlg.frown}{#emotions_dlg.innocent}{#emotions_dlg.kiss}{#emotions_dlg.laughing}
    {#emotions_dlg.money_mouth}{#emotions_dlg.sealed}{#emotions_dlg.smile}{#emotions_dlg.surprised}
    {#emotions_dlg.tongue-out}{#emotions_dlg.undecided}{#emotions_dlg.wink}{#emotions_dlg.yell}
    +
    + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cool.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cool.gif new file mode 100644 index 0000000..ba90cc3 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cool.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cry.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cry.gif new file mode 100644 index 0000000..74d897a Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-cry.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-embarassed.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-embarassed.gif new file mode 100644 index 0000000..963a96b Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-embarassed.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif new file mode 100644 index 0000000..16f68cc Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-frown.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-frown.gif new file mode 100644 index 0000000..716f55e Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-frown.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-innocent.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-innocent.gif new file mode 100644 index 0000000..334d49e Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-innocent.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-kiss.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-kiss.gif new file mode 100644 index 0000000..4efd549 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-kiss.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-laughing.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-laughing.gif new file mode 100644 index 0000000..1606c11 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-laughing.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif new file mode 100644 index 0000000..ca2451e Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-sealed.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-sealed.gif new file mode 100644 index 0000000..b33d3cc Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-sealed.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-smile.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-smile.gif new file mode 100644 index 0000000..e6a9e60 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-smile.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-surprised.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-surprised.gif new file mode 100644 index 0000000..cb99cdd Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-surprised.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif new file mode 100644 index 0000000..2075dc1 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-undecided.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-undecided.gif new file mode 100644 index 0000000..bef7e25 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-undecided.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-wink.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-wink.gif new file mode 100644 index 0000000..9faf1af Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-wink.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-yell.gif b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-yell.gif new file mode 100644 index 0000000..648e6e8 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/emotions/img/smiley-yell.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/js/emotions.js b/public/assets/javascripts/core/tiny_mce/plugins/emotions/js/emotions.js new file mode 100644 index 0000000..c549367 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/emotions/js/emotions.js @@ -0,0 +1,22 @@ +tinyMCEPopup.requireLangPack(); + +var EmotionsDialog = { + init : function(ed) { + tinyMCEPopup.resizeToInnerSize(); + }, + + insert : function(file, title) { + var ed = tinyMCEPopup.editor, dom = ed.dom; + + tinyMCEPopup.execCommand('mceInsertContent', false, dom.createHTML('img', { + src : tinyMCEPopup.getWindowArg('plugin_url') + '/img/' + file, + alt : ed.getLang(title), + title : ed.getLang(title), + border : 0 + })); + + tinyMCEPopup.close(); + } +}; + +tinyMCEPopup.onInit.add(EmotionsDialog.init, EmotionsDialog); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/emotions/langs/en_dlg.js b/public/assets/javascripts/core/tiny_mce/plugins/emotions/langs/en_dlg.js new file mode 100644 index 0000000..3b57ad9 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/emotions/langs/en_dlg.js @@ -0,0 +1,20 @@ +tinyMCE.addI18n('en.emotions_dlg',{ +title:"Insert emotion", +desc:"Emotions", +cool:"Cool", +cry:"Cry", +embarassed:"Embarassed", +foot_in_mouth:"Foot in mouth", +frown:"Frown", +innocent:"Innocent", +kiss:"Kiss", +laughing:"Laughing", +money_mouth:"Money mouth", +sealed:"Sealed", +smile:"Smile", +surprised:"Surprised", +tongue_out:"Tongue out", +undecided:"Undecided", +wink:"Wink", +yell:"Yell" +}); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/dialog.htm b/public/assets/javascripts/core/tiny_mce/plugins/example/dialog.htm new file mode 100644 index 0000000..50b2b34 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/dialog.htm @@ -0,0 +1,22 @@ + + + + {#example_dlg.title} + + + + + +
    +

    Here is a example dialog.

    +

    Selected text:

    +

    Custom arg:

    + +
    + + +
    +
    + + + diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin.js new file mode 100644 index 0000000..ec1f81e --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.PluginManager.requireLangPack("example");tinymce.create("tinymce.plugins.ExamplePlugin",{init:function(a,b){a.addCommand("mceExample",function(){a.windowManager.open({file:b+"/dialog.htm",width:320+parseInt(a.getLang("example.delta_width",0)),height:120+parseInt(a.getLang("example.delta_height",0)),inline:1},{plugin_url:b,some_custom_arg:"custom arg"})});a.addButton("example",{title:"example.desc",cmd:"mceExample",image:b+"/img/example.gif"});a.onNodeChange.add(function(d,c,e){c.setActive("example",e.nodeName=="IMG")})},createControl:function(b,a){return null},getInfo:function(){return{longname:"Example plugin",author:"Some author",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/example",version:"1.0"}}});tinymce.PluginManager.add("example",tinymce.plugins.ExamplePlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin_src.js new file mode 100644 index 0000000..9a0e7da --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/editor_plugin_src.js @@ -0,0 +1,84 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + // Load plugin specific language pack + tinymce.PluginManager.requireLangPack('example'); + + tinymce.create('tinymce.plugins.ExamplePlugin', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed, url) { + // Register the command so that it can be invoked by using tinyMCE.activeEditor.execCommand('mceExample'); + ed.addCommand('mceExample', function() { + ed.windowManager.open({ + file : url + '/dialog.htm', + width : 320 + parseInt(ed.getLang('example.delta_width', 0)), + height : 120 + parseInt(ed.getLang('example.delta_height', 0)), + inline : 1 + }, { + plugin_url : url, // Plugin absolute URL + some_custom_arg : 'custom arg' // Custom argument + }); + }); + + // Register example button + ed.addButton('example', { + title : 'example.desc', + cmd : 'mceExample', + image : url + '/img/example.gif' + }); + + // Add a node change handler, selects the button in the UI when a image is selected + ed.onNodeChange.add(function(ed, cm, n) { + cm.setActive('example', n.nodeName == 'IMG'); + }); + }, + + /** + * Creates control instances based in the incomming name. This method is normally not + * needed since the addButton method of the tinymce.Editor class is a more easy way of adding buttons + * but you sometimes need to create more complex controls like listboxes, split buttons etc then this + * method can be used to create those. + * + * @param {String} n Name of the control to create. + * @param {tinymce.ControlManager} cm Control manager to use inorder to create new control. + * @return {tinymce.ui.Control} New control instance or null if no control was created. + */ + createControl : function(n, cm) { + return null; + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Example plugin', + author : 'Some author', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/example', + version : "1.0" + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('example', tinymce.plugins.ExamplePlugin); +})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/img/example.gif b/public/assets/javascripts/core/tiny_mce/plugins/example/img/example.gif new file mode 100644 index 0000000..1ab5da4 Binary files /dev/null and b/public/assets/javascripts/core/tiny_mce/plugins/example/img/example.gif differ diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/js/dialog.js b/public/assets/javascripts/core/tiny_mce/plugins/example/js/dialog.js new file mode 100644 index 0000000..fa83411 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/js/dialog.js @@ -0,0 +1,19 @@ +tinyMCEPopup.requireLangPack(); + +var ExampleDialog = { + init : function() { + var f = document.forms[0]; + + // Get the selected contents as text and place it in the input + f.someval.value = tinyMCEPopup.editor.selection.getContent({format : 'text'}); + f.somearg.value = tinyMCEPopup.getWindowArg('some_custom_arg'); + }, + + insert : function() { + // Insert the contents from the input into the document + tinyMCEPopup.editor.execCommand('mceInsertContent', false, document.forms[0].someval.value); + tinyMCEPopup.close(); + } +}; + +tinyMCEPopup.onInit.add(ExampleDialog.init, ExampleDialog); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en.js b/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en.js new file mode 100644 index 0000000..e0784f8 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en.js @@ -0,0 +1,3 @@ +tinyMCE.addI18n('en.example',{ + desc : 'This is just a template button' +}); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en_dlg.js b/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en_dlg.js new file mode 100644 index 0000000..ebcf948 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/example/langs/en_dlg.js @@ -0,0 +1,3 @@ +tinyMCE.addI18n('en.example_dlg',{ + title : 'This is just a example title' +}); diff --git a/public/assets/javascripts/core/tiny_mce/plugins/fullpage/css/fullpage.css b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/css/fullpage.css new file mode 100644 index 0000000..cd56968 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/css/fullpage.css @@ -0,0 +1,184 @@ +/* Hide the advanced tab */ +#advanced_tab { + display: none; +} + +#metatitle, #metakeywords, #metadescription, #metaauthor, #metacopyright { + width: 280px; +} + +#doctype, #docencoding { + width: 200px; +} + +#langcode { + width: 30px; +} + +#bgimage { + width: 220px; +} + +#fontface { + width: 240px; +} + +#leftmargin, #rightmargin, #topmargin, #bottommargin { + width: 50px; +} + +.panel_wrapper div.current { + height: 400px; +} + +#stylesheet, #style { + width: 240px; +} + +#doctypes { + width: 200px; +} + +/* Head list classes */ + +.headlistwrapper { + width: 100%; +} + +/* not implemented advanced tab buttons +.addbutton, .removebutton, .moveupbutton, .movedownbutton { + border-top: 1px solid; + border-left: 1px solid; + border-bottom: 1px solid; + border-right: 1px solid; + border-color: #F0F0EE; + cursor: default; + display: block; + width: 20px; + height: 20px; +} + +.addbutton:hover, .removebutton:hover, .moveupbutton:hover, .movedownbutton:hover { + border: 1px solid #0A246A; + background-color: #B6BDD2; +} + +.addbutton { + background-image: url('../images/add.gif'); + float: left; + margin-right: 3px; +} + +.removebutton { + background-image: url('../images/remove.gif'); + float: left; +} + +.moveupbutton { + background-image: url('../images/move_up.gif'); + float: left; + margin-right: 3px; +} + +.movedownbutton { + background-image: url('../images/move_down.gif'); + float: left; +} +*/ + +.selected { + border: 1px solid #0A246A; + background-color: #B6BDD2; +} + +.toolbar { + width: 100%; +} + +#headlist { + width: 100%; + margin-top: 3px; + font-size: 11px; +} + +#info, #title_element, #meta_element, #script_element, #style_element, #base_element, #link_element, #comment_element, #unknown_element { + display: none; +} + +#addmenu { + position: absolute; + border: 1px solid gray; + display: none; + z-index: 100; + background-color: white; +} + +#addmenu a { + display: block; + width: 100%; + line-height: 20px; + text-decoration: none; + background-color: white; +} + +#addmenu a:hover { + background-color: #B6BDD2; + color: black; +} + +#addmenu span { + padding-left: 10px; + padding-right: 10px; +} + +#updateElementPanel { + display: none; +} + +#script_element .panel_wrapper div.current { + height: 108px; +} + +#style_element .panel_wrapper div.current { + height: 108px; +} + +#link_element .panel_wrapper div.current { + height: 140px; +} + +#element_script_value { + width: 100%; + height: 100px; +} + +#element_comment_value { + width: 100%; + height: 120px; +} + +#element_style_value { + width: 100%; + height: 100px; +} + +#element_title, #element_script_src, #element_meta_name, #element_meta_content, #element_base_href, #element_link_href, #element_link_title { + width: 250px; +} + +.updateElementButton { + margin-top: 3px; +} + +/* MSIE specific styles */ + +* html .addbutton, * html .removebutton, * html .moveupbutton, * html .movedownbutton { + width: 22px; + height: 22px; +} + +textarea { + height: 55px; +} + +.panel_wrapper div.current {height:420px;} \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin.js b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin.js new file mode 100644 index 0000000..1fc22a4 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.FullPagePlugin",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceFullPageProperties",function(){a.windowManager.open({file:b+"/fullpage.htm",width:430+parseInt(a.getLang("fullpage.delta_width",0)),height:495+parseInt(a.getLang("fullpage.delta_height",0)),inline:1},{plugin_url:b,head_html:c.head})});a.addButton("fullpage",{title:"fullpage.desc",cmd:"mceFullPageProperties"});a.onBeforeSetContent.add(c._setContent,c);a.onSetContent.add(c._setBodyAttribs,c);a.onGetContent.add(c._getContent,c)},getInfo:function(){return{longname:"Fullpage",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/fullpage",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_setBodyAttribs:function(e,a){var p,d,g,l,b,m,n,h=this.head.match(/body(.*?)>/i),j="",c,f=this.head.match(/]*?)>/i);if(h&&h[1]){p=h[1].match(/\s*(\w+\s*=\s*".*?"|\w+\s*=\s*'.*?'|\w+\s*=\s*\w+|\w+)\s*/g);if(p){for(d=0,g=p.length;d",a);i.head=f.substring(0,a+1);var k=0,g;i.css="";while((k=i.head.indexOf("",k)+1;if((g=i.head.indexOf("\n'}i.head+=d.getParam("fullpage_default_doctype",'');i.head+="\n\n\n";if(h=d.getParam("fullpage_default_title")){i.head+=""+h+"\n"}if(h=d.getParam("fullpage_default_encoding")){i.head+='\n'}if(h=d.getParam("fullpage_default_font_family")){j+="font-family: "+h+";"}if(h=d.getParam("fullpage_default_font_size")){j+="font-size: "+h+";"}if(h=d.getParam("fullpage_default_text_color")){j+="color: "+h+";"}i.head+="\n\n";i.foot="\n\n"}},_getContent:function(a,c){var b=this;if(!c.source_view||!a.getParam("fullpage_hide_in_source_view")){c.content=tinymce.trim(b.head)+"\n"+tinymce.trim(c.content)+"\n"+tinymce.trim(b.foot);if(b.css){b._setStyle(a,b.css)}}},_setStyle:function(a,b){a.dom.remove("injectedCSS");var d=a.dom.doc,c=d.createElement("style");c.type="text/css";c.id="injectedCSS";if(c.styleSheet){c.styleSheet.cssText=b}else{c.appendChild(d.createTextNode(b))}d.getElementsByTagName("head")[0].appendChild(c)}});tinymce.PluginManager.add("fullpage",tinymce.plugins.FullPagePlugin)})(); \ No newline at end of file diff --git a/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin_src.js b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin_src.js new file mode 100644 index 0000000..09ee085 --- /dev/null +++ b/public/assets/javascripts/core/tiny_mce/plugins/fullpage/editor_plugin_src.js @@ -0,0 +1,198 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.FullPagePlugin', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceFullPageProperties', function() { + ed.windowManager.open({ + file : url + '/fullpage.htm', + width : 430 + parseInt(ed.getLang('fullpage.delta_width', 0)), + height : 495 + parseInt(ed.getLang('fullpage.delta_height', 0)), + inline : 1 + }, { + plugin_url : url, + head_html : t.head + }); + }); + + // Register buttons + ed.addButton('fullpage', {title : 'fullpage.desc', cmd : 'mceFullPageProperties'}); + + ed.onBeforeSetContent.add(t._setContent, t); + ed.onSetContent.add(t._setBodyAttribs, t); + ed.onGetContent.add(t._getContent, t); + }, + + getInfo : function() { + return { + longname : 'Fullpage', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/fullpage', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private plugin internal methods + + _setBodyAttribs : function(ed, o) { + var bdattr, i, len, kv, k, v, t, attr = this.head.match(/body(.*?)>/i), bddir = '',htattr, hattr = this.head.match(/]*?)>/i); + + if (attr && attr[1]) { + bdattr = attr[1].match(/\s*(\w+\s*=\s*".*?"|\w+\s*=\s*'.*?'|\w+\s*=\s*\w+|\w+)\s*/g); + + if (bdattr) { + for(i = 0, len = bdattr.length; i < len; i++) { + kv = bdattr[i].split('='); + k = kv[0].replace(/\s/,''); + v = kv[1]; + + if (v) { + v = v.replace(/^\s+/,'').replace(/\s+$/,''); + t = v.match(/^["'](.*)["']$/); + + if (t) + v = t[1]; + if(k == 'dir') + bddir = v; + } else + v = k; + + ed.dom.setAttrib(ed.getBody(), 'style', v); + } + } + } + //if found fetch the dir-attribute from the html-tag and apply it to the editor-body + if(bddir == '' && hattr && hattr[1]){ + htattr = hattr[1].match(/dir\s*=\s*["']([^"']*)["']/i); + if (htattr && htattr[1]) + bddir = htattr[1]; + } + bd = ed.getBody(); + bd.setAttribute('dir', bddir); + }, + + _createSerializer : function() { + return new tinymce.dom.Serializer({ + dom : this.editor.dom, + indent : true, + apply_source_formatting : true, + indent_before : 'p,h1,h2,h3,h4,h5,h6,blockquote,div,title,style,pre,script,td,ul,li,area,title,meta,head', + indent_after : 'p,h1,h2,h3,h4,h5,h6,blockquote,div,title,style,pre,script,td,ul,li,area,title,meta,head' + }); + }, + + _setContent : function(ed, o) { + var t = this, sp, ep, c = o.content, v, st = ''; + + // Ignore raw updated if we already have a head, this will fix issues with undo/redo keeping the head/foot separate + if (o.format == 'raw' && t.head) + return; + + if (o.source_view && ed.getParam('fullpage_hide_in_source_view')) + return; + + // Parse out head, body and footer + c = c.replace(/<(\/?)BODY/gi, '<$1body'); + sp = c.indexOf('', sp); + t.head = c.substring(0, sp + 1); + + // Concatenate all